{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9336534d-f4bd-4483-bc62-3311227d75f3",
          "code": "16079-88-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=16079-88-2",
          "code_system": "CAS",
          "references": [
            "e804f5a9-6c80-4f9e-8678-0735a94c60e2",
            "f4a24701-feef-4d25-8b33-c1122218e3b7"
          ]
        },
        {
          "uuid": "caa39550-c88a-4d4a-b472-4ca13949e417",
          "code": "32718-18-6",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=32718-18-6",
          "code_system": "CAS",
          "references": [
            "e804f5a9-6c80-4f9e-8678-0735a94c60e2",
            "0b265952-0591-45db-aa48-3408f86e27ed"
          ]
        },
        {
          "uuid": "3a9a0381-d68a-46b2-8a9d-f9948b55bea5",
          "code": "6315",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:432",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "e804f5a9-6c80-4f9e-8678-0735a94c60e2"
          ]
        },
        {
          "uuid": "67f81041-8844-49a1-9384-4ac37ece81c8",
          "code": "240-230-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.036.557",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e804f5a9-6c80-4f9e-8678-0735a94c60e2"
          ]
        },
        {
          "uuid": "61c6ef1c-92b2-4ceb-9712-77af09895351",
          "code": "251-171-5",
          "type": "ALTERNATIVE",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.046.504",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e804f5a9-6c80-4f9e-8678-0735a94c60e2"
          ]
        },
        {
          "uuid": "66c9a512-883e-4022-9ee1-b7e65ffab99f",
          "code": "61828",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/61828",
          "code_system": "PUBCHEM",
          "references": [
            "e804f5a9-6c80-4f9e-8678-0735a94c60e2"
          ]
        },
        {
          "uuid": "00d32e1f-6485-4137-b900-ed786379884a",
          "code": "7489",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7489",
          "code_system": "HSDB",
          "references": [
            "77ef7977-f8f1-6776-b120-5eecdcd56335"
          ]
        },
        {
          "uuid": "8bf8a2b0-aca0-50cb-53c8-8dd7b6da87da",
          "code": "DTXSID3032591",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3032591",
          "code_system": "EPA CompTox",
          "references": [
            "208515c7-e9cc-1243-0f76-9af8522e507d"
          ]
        },
        {
          "uuid": "5681c41c-7b13-d0e3-cbd3-de7f12f3cebf",
          "code": "21 CFR 176.300",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=176.300",
          "code_system": "CFR",
          "references": [
            "3d0c37b9-a88f-bf82-2d07-67d022eff4d1"
          ]
        },
        {
          "uuid": "c15e66e8-ccf6-b5ac-0167-e53a30917c4e",
          "code": "2374349",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2374349/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "7415a809-9eff-8ed8-6001-898ddcf2f8a8"
          ]
        },
        {
          "uuid": "33c1b122-0ca1-419a-a31e-5a00fc1707ba",
          "code": "W18O2G87ND",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c062e00c-d118-3a20-a40b-3a841b72afd8",
          "code": "BCDMH",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/BCDMH",
          "code_system": "WIKIPEDIA",
          "references": [
            "26dd868f-4e2a-6be0-3c7f-ac6aa34201d1"
          ]
        },
        {
          "uuid": "d1361a99-c557-93e7-4e81-11b0add22d48",
          "code": "W18O2G87ND",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=W18O2G87ND",
          "code_system": "DAILYMED",
          "references": [
            "af195e5a-b4ac-d774-8876-d01453f134e3"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "662e24a7-6091-44d8-bbf2-8962c2805e60",
          "name": "1-BROMO-3-CHLORO-5,5-DIMETHYL-2,4-IMIDAZOLIDINEDIONE",
          "stdName": "1-BROMO-3-CHLORO-5,5-DIMETHYL-2,4-IMIDAZOLIDINEDIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5e1a66d-0141-4150-a0fb-f73daf05deb6",
            "433af4ec-7b33-45a6-8f51-e3ab79ae1a48"
          ],
          "display_name": true
        },
        {
          "uuid": "360a9214-d947-433e-925e-3e68dd65418a",
          "name": "1-BROMO-3-CHLORO-5,5-DIMETHYLHYDANTOIN",
          "stdName": "1-BROMO-3-CHLORO-5,5-DIMETHYLHYDANTOIN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f07c6743-1e4a-45bd-a4b5-c30e347cbc62",
            "433af4ec-7b33-45a6-8f51-e3ab79ae1a48"
          ],
          "display_name": false
        },
        {
          "uuid": "b6000885-3f40-41f8-9fea-d7eb976f97bf",
          "name": "1-BROMO-3-CHLORO-5,5-DIMETHYLIMIDAZOLIDINE-2,4-DIONE",
          "stdName": "1-BROMO-3-CHLORO-5,5-DIMETHYLIMIDAZOLIDINE-2,4-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5e1a66d-0141-4150-a0fb-f73daf05deb6",
            "433af4ec-7b33-45a6-8f51-e3ab79ae1a48"
          ],
          "display_name": false
        },
        {
          "uuid": "14e68075-0ef1-489e-84c3-a4514268a1df",
          "name": "2,4-IMIDAZOLIDINEDIONE, 1-BROMO-3-CHLORO-5,5-DIMETHYL-",
          "stdName": "2,4-IMIDAZOLIDINEDIONE, 1-BROMO-3-CHLORO-5,5-DIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5e1a66d-0141-4150-a0fb-f73daf05deb6",
            "433af4ec-7b33-45a6-8f51-e3ab79ae1a48"
          ],
          "display_name": false
        },
        {
          "uuid": "83bff50e-9513-4e98-8ac7-1d929a8bfdc2",
          "name": "BROMO-3-CHLORO-5,5-DIMETHYL-2,4-IMIDAZOLIDINEDIONE, 1-",
          "stdName": "BROMO-3-CHLORO-5,5-DIMETHYL-2,4-IMIDAZOLIDINEDIONE, 1-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "31733fce-9fe8-44a3-ab90-2f8573da28da"
          ],
          "display_name": false
        },
        {
          "uuid": "fd75ef60-b575-482f-b372-3aac0706a14a",
          "name": "BROMO-3-CHLORO-5,5-DIMETHYLHYDANTOIN",
          "stdName": "BROMO-3-CHLORO-5,5-DIMETHYLHYDANTOIN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2003c1d-3367-4230-9cf7-076b52fb3642",
            "433af4ec-7b33-45a6-8f51-e3ab79ae1a48"
          ],
          "display_name": false
        },
        {
          "uuid": "dd73a431-be39-42e5-a7d1-17fa8730f870",
          "name": "BROMOCHLORO-5,5-DIMETHYLHYDANTOIN",
          "stdName": "BROMOCHLORO-5,5-DIMETHYLHYDANTOIN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f07c6743-1e4a-45bd-a4b5-c30e347cbc62",
            "433af4ec-7b33-45a6-8f51-e3ab79ae1a48"
          ],
          "display_name": false
        },
        {
          "uuid": "8805780d-34cf-42f5-8c56-40893ef3f3b5",
          "name": "HYDANTOIN, 1-BROMO-3-CHLORO-5,5-DIMETHYL-",
          "stdName": "HYDANTOIN, 1-BROMO-3-CHLORO-5,5-DIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5e1a66d-0141-4150-a0fb-f73daf05deb6",
            "e100e518-69c6-4cea-b873-e2b3a702b9ed",
            "433af4ec-7b33-45a6-8f51-e3ab79ae1a48",
            "598f0aeb-5ed7-439a-b6d0-2fd024fc6991"
          ],
          "display_name": false
        },
        {
          "uuid": "5bb17599-212f-4587-a3d5-dc3b4b8de277",
          "name": "HYDANTOIN, 1-BROMO-3-CHLORO-5,5-DIMETHYL- [HSDB]",
          "stdName": "HYDANTOIN, 1-BROMO-3-CHLORO-5,5-DIMETHYL- [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "433af4ec-7b33-45a6-8f51-e3ab79ae1a48",
            "598f0aeb-5ed7-439a-b6d0-2fd024fc6991"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "31733fce-9fe8-44a3-ab90-2f8573da28da",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "598f0aeb-5ed7-439a-b6d0-2fd024fc6991",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "433af4ec-7b33-45a6-8f51-e3ab79ae1a48",
          "citation": "NLM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f07c6743-1e4a-45bd-a4b5-c30e347cbc62",
          "citation": "CEDI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e5e1a66d-0141-4150-a0fb-f73daf05deb6",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b2003c1d-3367-4230-9cf7-076b52fb3642",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e804f5a9-6c80-4f9e-8678-0735a94c60e2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390951000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "df145db3-0464-41d4-9d94-8a3c7280f42f",
          "citation": "SRS import [W18O2G87ND]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=W18O2G87ND",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390951000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d528ba2b-43ce-4579-90ce-7ecb737521e3",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e100e518-69c6-4cea-b873-e2b3a702b9ed",
          "citation": "HYDANTOIN, 1-BROMO-3-CHLORO-5,5-DIMETHYL- [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "77ef7977-f8f1-6776-b120-5eecdcd56335",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+16079-88-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "208515c7-e9cc-1243-0f76-9af8522e507d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=16079-88-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3d0c37b9-a88f-bf82-2d07-67d022eff4d1",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "f4a24701-feef-4d25-8b33-c1122218e3b7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "0b265952-0591-45db-aa48-3408f86e27ed",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "26dd868f-4e2a-6be0-3c7f-ac6aa34201d1",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "7415a809-9eff-8ed8-6001-898ddcf2f8a8",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "af195e5a-b4ac-d774-8876-d01453f134e3",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5fa09500-c63a-441d-9605-e72c30af8b17",
          "id": "5fa09500-c63a-441d-9605-e72c30af8b17",
          "molfile": "\n  Marvin  01132104572D          \n\n 11 11  0  0  0  0            999 V2000\n    7.7339   -3.9137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3288   -4.6330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0369   -5.0419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0729   -5.4182    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6541   -5.9985    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    6.2479   -5.4182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9707   -6.0754    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9957   -4.6330    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2003   -4.4143    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.6567   -4.1510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6567   -3.4242    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2 10  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  8  1  0  0  0  0\n 10 11  2  0  0  0  0\nM  END",
          "smiles": "CC1(C)C(=O)N(C(=O)N1Br)Cl",
          "formula": "C5H6BrClN2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5441d4c8-83c6-47f0-9d90-f3a673d3cc1f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "241.47",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2db67f53-4e2a-4edd-958d-3dc45dce60ed",
      "version": "8",
      "structure": {
        "id": "ebb52516-646c-4ffe-8f38-a37a1162787f",
        "molfile": "\n  Marvin  01132112122D          \n\n 11 11  0  0  0  0            999 V2000\n    7.3288   -4.6330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6567   -4.1510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9957   -4.6330    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2003   -4.4143    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.2479   -5.4182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0729   -5.4182    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6541   -5.9985    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    5.9707   -6.0754    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6567   -3.4242    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7339   -3.9137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0369   -5.0419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  5  8  2  0  0  0  0\n  2  9  2  0  0  0  0\n  1 10  1  0  0  0  0\n  1 11  1  0  0  0  0\nM  END",
        "smiles": "CC1(C)C(=O)N(C(=O)N1Br)Cl",
        "formula": "C5H6BrClN2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "241.47",
        "optical_activity": "NONE",
        "references": [
          "df145db3-0464-41d4-9d94-8a3c7280f42f",
          "d528ba2b-43ce-4579-90ce-7ecb737521e3"
        ],
        "stereo_centers": 0
      },
      "unii": "W18O2G87ND"
    }
  ]
}