{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e2152ab2-d7e2-f891-ac83-b5d331b1dc58",
          "code": "2239273-34-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2239273-34-6",
          "code_system": "CAS",
          "references": [
            "0e14c76b-5d69-3233-745f-ca8bc7291489"
          ]
        },
        {
          "uuid": "96b5eb0a-6fc0-2287-cd41-595630597a34",
          "code": "135242184",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135242184",
          "code_system": "PUBCHEM",
          "references": [
            "1c6899f6-a64c-9abc-ddaa-1578e549b618"
          ]
        },
        {
          "uuid": "b0ef5084-49cc-7605-5281-fb3b32988f3a",
          "code": "11620",
          "comments": "INN",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=11620",
          "code_system": "INN",
          "references": [
            "ce3c7c47-6099-b5a8-47d9-e1a233a8e75c"
          ]
        },
        {
          "uuid": "ec4e1075-89e8-262c-1194-da1d219c7032",
          "code": "C159564",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C159564",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3705e9a8-edc7-8bd1-b9f8-34b5888dc242"
          ]
        },
        {
          "uuid": "d5f345ee-cf96-47cb-a24e-bbebcb7dcba8",
          "code": "W0ZE0NT8IF",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1845884a-8a90-758f-c9b8-760e0de951b0",
          "code": "KL-41",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/KL-41/relevant/1/",
          "code_system": "USAN",
          "references": [
            "7a8ae7cb-3f90-393d-934b-40ce7ab2f9a8"
          ]
        },
        {
          "uuid": "bf3d6f21-34ce-9797-6850-2841dd591238",
          "code": "300000015762",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "08e65ecc-6a83-1e50-eeb0-37198e790e5c"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "0e14c76b-5d69-3233-745f-ca8bc7291489",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f0f2845-8a9d-c693-1a52-69efa0053f5a",
          "citation": "https://adisinsight.springer.com/drugs/800049311",
          "url": "https://adisinsight.springer.com/drugs/800049311",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "501322d2-3443-524f-5d75-b00c2e445a08",
          "citation": "Seitz, Lisa, et al. \"Safety, tolerability, and pharmacology of AB928, a novel dual adenosine receptor antagonist, in a randomized, phase 1 study in healthy volunteers.\" Investigational new drugs (2018): 1-11. doi: 10.1007/s10637-018-0706-6",
          "url": "https://link.springer.com/article/10.1007%2Fs10637-018-0706-6",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "CLIN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1c6899f6-a64c-9abc-ddaa-1578e549b618",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "7a8ae7cb-3f90-393d-934b-40ce7ab2f9a8",
          "citation": "USAN COUN 2022",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "4f4774b0-3bd1-ec15-b934-b75228257dfc",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "3705e9a8-edc7-8bd1-b9f8-34b5888dc242",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "ce3c7c47-6099-b5a8-47d9-e1a233a8e75c",
          "citation": "INN",
          "doc_type": "INN_LIST",
          "public_domain": true
        },
        {
          "uuid": "ba2bba21-0ffe-4d35-9df6-781014f0d4c6",
          "citation": "INN P124",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9079dbc9-6759-4b43-8b17-879c7c0c40c2",
          "citation": "Seitz, Lisa, et al. \"Safety, tolerability, and pharmacology of AB928, a novel dual adenosine receptor antagonist, in a randomized, phase 1 study in healthy volunteers.\" Investigational new drugs (2018): 1-11. doi: 10.1007/s10637-018-0706-6",
          "url": "https://link.springer.com/article/10.1007%2Fs10637-018-0706-6",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "CLIN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1c616703-b32f-4678-95ce-957cb6f27d08",
          "citation": "Seitz, Lisa, et al. \"Safety, tolerability, and pharmacology of AB928, a novel dual adenosine receptor antagonist, in a randomized, phase 1 study in healthy volunteers.\" Investigational new drugs (2018): 1-11. doi: 10.1007/s10637-018-0706-6",
          "url": "https://link.springer.com/article/10.1007%2Fs10637-018-0706-6",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "CLIN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "092c0a8b-9a4e-f162-0cdc-07fe0b0413f0",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "08e65ecc-6a83-1e50-eeb0-37198e790e5c",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "c4ceb2e8-24f8-401f-8646-f50cdce2b814",
          "citation": "Zhang, Jinfeng, et al. \"Tumor immunotherapy using A2A adenosine receptor antagonists.\" Pharmaceuticals 13.9 (2020): 237.",
          "url": "https://www.mdpi.com/1424-8247/13/9/237",
          "doc_type": "JA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "883758a3-3a34-1d79-7d78-0217fa442edc",
          "id": "883758a3-3a34-1d79-7d78-0217fa442edc",
          "molfile": "\n  Marvin  01132107042D          \n\n 32 35  0  0  0  0            999 V2000\n   18.4701   -3.4516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4701   -4.2767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1820   -4.6886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1820   -5.5139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4719   -5.9258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7554   -5.5177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7554   -4.6890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0409   -4.2765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3307   -4.6883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6141   -4.2802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6141   -3.4516    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3288   -3.0392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3288   -2.2142    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0409   -3.4512    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8997   -4.6927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1168   -4.4468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6248   -5.1144    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7999   -5.1144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3873   -4.3999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8016   -3.6822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3852   -2.9705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5642   -2.9721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1515   -3.6867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5622   -4.3995    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3265   -3.6867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9139   -4.4014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9139   -2.9723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7390   -2.9723    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0956   -5.7679    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8997   -5.5178    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   19.8966   -4.2761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.6111   -3.8636    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  7  2  0  0  0  0\n  4  3  2  0  0  0  0\n  3 31  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 14  2  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 10 15  1  0  0  0  0\n 12 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 14 12  1  0  0  0  0\n 15 16  2  0  0  0  0\n 30 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 29 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 24 19  2  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 23 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 27  1  0  0  0  0\n 25 28  1  0  0  0  0\n 30 29  2  0  0  0  0\n 31 32  3  0  0  0  0\nM  END",
          "smiles": "Cc1c(cccc1-c2cc(-c3cn(Cc4cccc(C(C)(C)O)n4)nn3)nc(N)n2)C#N",
          "formula": "C23H22N8O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "675829b1-bff6-4b5e-9520-b22a8e825222"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "426.4747",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "93c7b804-cc48-4b8b-8655-55078040c7da",
      "version": "28",
      "structure": {
        "id": "e6424c72-864a-dca8-9059-47b25ac4ff66",
        "molfile": "\n  Marvin  01132111552D          \n\n 32 35  0  0  0  0            999 V2000\n   15.6141   -3.4516    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0409   -3.4512    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3288   -3.0392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0409   -4.2765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6141   -4.2802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3307   -4.6883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7554   -4.6890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1820   -4.6886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4701   -4.2767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1820   -5.5139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7554   -5.5177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4719   -5.9258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8997   -4.6927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8997   -5.5178    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1168   -4.4468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0956   -5.7679    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6248   -5.1144    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7999   -5.1144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3873   -4.3999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1515   -3.6867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5622   -4.3995    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5642   -2.9721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8016   -3.6822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3852   -2.9705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3265   -3.6867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9139   -4.4014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9139   -2.9723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7390   -2.9723    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3288   -2.2142    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   19.8966   -4.2761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.6111   -3.8636    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4701   -3.4516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  6  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  2  3  1  0  0  0  0\n  1  5  1  0  0  0  0\n  4  2  2  0  0  0  0\n  3  1  2  0  0  0  0\n  4  7  1  0  0  0  0\n 12 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  8  2  0  0  0  0\n  9  7  2  0  0  0  0\n  7 11  1  0  0  0  0\n  5 13  1  0  0  0  0\n 16 17  1  0  0  0  0\n 15 17  1  0  0  0  0\n 14 16  2  0  0  0  0\n 14 13  1  0  0  0  0\n 13 15  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 24 22  1  0  0  0  0\n 23 24  2  0  0  0  0\n 20 21  1  0  0  0  0\n 22 20  2  0  0  0  0\n 21 19  2  0  0  0  0\n 19 23  1  0  0  0  0\n 20 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 27  1  0  0  0  0\n 25 28  1  0  0  0  0\n  3 29  1  0  0  0  0\n  8 30  1  0  0  0  0\n 30 31  3  0  0  0  0\n  9 32  1  0  0  0  0\nM  END",
        "smiles": "Cc1c(cccc1-c2cc(-c3cn(Cc4cccc(C(C)(C)O)n4)nn3)nc(N)n2)C#N",
        "formula": "C23H22N8O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "426.4747",
        "optical_activity": "NONE",
        "references": [
          "501322d2-3443-524f-5d75-b00c2e445a08"
        ],
        "stereo_centers": 0
      },
      "unii": "W0ZE0NT8IF",
      "relationships": [
        {
          "uuid": "26e768b9-be95-47fa-af5a-b942a24f4e85",
          "amount": {
            "uuid": "5bf113da-48f6-45f8-9971-2da80573b970"
          },
          "type": "ACTIVE MOIETY",
          "references": [
            "501322d2-3443-524f-5d75-b00c2e445a08"
          ],
          "related_substance": {
            "uuid": "c328fb42-d651-48b9-aaff-b5d14bd28837",
            "refuuid": "93c7b804-cc48-4b8b-8655-55078040c7da",
            "name": "ETRUMADENANT",
            "unii": "W0ZE0NT8IF",
            "linking_id": "W0ZE0NT8IF",
            "ref_pname": "ETRUMADENANT",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ccdee538-3d61-4b7a-9235-68e86e8176fe",
          "amount": {
            "uuid": "5dc16b9f-96cb-4887-ae71-b4609121219a",
            "average": 1.5,
            "units": "NANOMOLAR"
          },
          "comments": "Kb actually",
          "qualification": "Ki",
          "type": "TARGET->INHIBITOR",
          "references": [
            "501322d2-3443-524f-5d75-b00c2e445a08",
            "9f0f2845-8a9d-c693-1a52-69efa0053f5a",
            "9079dbc9-6759-4b43-8b17-879c7c0c40c2"
          ],
          "related_substance": {
            "uuid": "d6087274-c1f0-4d25-bb13-2f66859bd5ce",
            "refuuid": "83ef8407-ced8-4588-bbb0-5a500bce6d4e",
            "name": "ADENOSINE RECEPTOR A2A",
            "unii": "Y154T023U0",
            "linking_id": "Y154T023U0",
            "ref_pname": "ADENOSINE RECEPTOR A2A",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "edf3174c-7317-49e9-a4f2-c056452ec94a",
          "amount": {
            "uuid": "969d4f3e-d0bb-43ad-a3ad-f29d7e77b277",
            "average": 2,
            "units": "NANOMOLAR"
          },
          "comments": "Kb actually.",
          "qualification": "Ki",
          "type": "TARGET->INHIBITOR",
          "references": [
            "501322d2-3443-524f-5d75-b00c2e445a08",
            "9f0f2845-8a9d-c693-1a52-69efa0053f5a",
            "1c616703-b32f-4678-95ce-957cb6f27d08"
          ],
          "related_substance": {
            "uuid": "9f8e0abf-1012-4919-8b56-a6fa2507fdd1",
            "refuuid": "fa16d8ec-894f-462d-9781-5d2f93560a44",
            "name": "ADENOSINE RECEPTOR A2B",
            "unii": "EX4X9IXA0A",
            "linking_id": "EX4X9IXA0A",
            "ref_pname": "ADENOSINE RECEPTOR A2B",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "07f58bb2-7d7d-4f77-863c-f5ad1cfc0dba",
          "amount": {
            "uuid": "ce320d4c-8d3e-46f1-bda6-602c91e9cdba",
            "average": 0.489,
            "units": "MICROMOLAR"
          },
          "qualification": "Ki",
          "type": "OFF TARGET->WEAK INHIBITOR",
          "references": [
            "c4ceb2e8-24f8-401f-8646-f50cdce2b814"
          ],
          "related_substance": {
            "uuid": "cd0518f8-235f-456b-8f27-3c3c9f71ba0c",
            "refuuid": "c28af090-c320-4c17-acf9-c2d053dffd58",
            "name": "ADENOSINE RECEPTOR A3",
            "unii": "ZUL9E7IDX0",
            "linking_id": "ZUL9E7IDX0",
            "ref_pname": "ADENOSINE RECEPTOR A3",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "cbb5d4cb-cd8b-4230-8793-fbcba603c1c5",
          "amount": {
            "uuid": "284b4f95-0e46-4dd6-a244-1f674c38a4fe",
            "average": 64,
            "units": "NANOMOLAR"
          },
          "qualification": "Ki",
          "type": "TARGET->INHIBITOR",
          "references": [
            "c4ceb2e8-24f8-401f-8646-f50cdce2b814"
          ],
          "related_substance": {
            "uuid": "0befe86f-3a6a-4c94-8484-b0637420f78e",
            "refuuid": "ee9c39bd-5774-43c4-8eaa-23b333741b5e",
            "name": "ADENOSINE RECEPTOR A1",
            "unii": "9J6QGP7WEA",
            "linking_id": "9J6QGP7WEA",
            "ref_pname": "ADENOSINE RECEPTOR A1",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "2ede7a5a-dbe2-a3dd-6d82-bf58d681e8eb",
          "name": "3-(2-amino-6-(1-((6-(2-hydroxypropan-2-yl)pyridin-2-yl)methyl)-1H-1,2,3-triazol-4-yl)pyrimidin-4-yl)-2-methylbenzonitrile",
          "stdName": "3-(2-AMINO-6-(1-((6-(2-HYDROXYPROPAN-2-YL)PYRIDIN-2-YL)METHYL)-1H-1,2,3-TRIAZOL-4-YL)PYRIMIDIN-4-YL)-2-METHYLBENZONITRILE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ba2bba21-0ffe-4d35-9df6-781014f0d4c6",
            "7a8ae7cb-3f90-393d-934b-40ce7ab2f9a8"
          ],
          "display_name": false
        },
        {
          "uuid": "22b9b3a7-58cf-e9e1-9771-37ece1f9e53b",
          "name": "AB-928",
          "stdName": "AB-928",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9f0f2845-8a9d-c693-1a52-69efa0053f5a"
          ],
          "display_name": false
        },
        {
          "uuid": "9a751550-91e2-ede3-1662-ec4d1500799b",
          "name": "AB928",
          "stdName": "AB928",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "501322d2-3443-524f-5d75-b00c2e445a08"
          ],
          "display_name": false
        },
        {
          "uuid": "7c97ac76-0d5b-579e-692d-89cf82257e2d",
          "name": "Benzonitrile, 3-[2-amino-6-[1-[[6-(1-hydroxy-1-methylethyl)-2-pyridinyl]methyl]-1H-1,2,3-triazol-4-yl]-4-pyrimidinyl]-2-methyl-",
          "stdName": "BENZONITRILE, 3-(2-AMINO-6-(1-((6-(1-HYDROXY-1-METHYLETHYL)-2-PYRIDINYL)METHYL)-1H-1,2,3-TRIAZOL-4-YL)-4-PYRIMIDINYL)-2-METHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0e14c76b-5d69-3233-745f-ca8bc7291489",
            "7a8ae7cb-3f90-393d-934b-40ce7ab2f9a8"
          ],
          "display_name": false
        },
        {
          "uuid": "4cd61b0f-970e-4a5a-aebf-76caec72239f",
          "name": "ETRUMADENANT",
          "stdName": "ETRUMADENANT",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ba2bba21-0ffe-4d35-9df6-781014f0d4c6",
            "7a8ae7cb-3f90-393d-934b-40ce7ab2f9a8"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "8ac380bd-9648-4738-af89-af78115b7f8e",
              "name_org": "USAN"
            },
            {
              "uuid": "f3185e3d-3f82-4bac-b7bf-909613238dfe",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "e2eaeb4f-43ee-8176-ad56-6fb662509fcc",
          "name": "ETRUMADENANT [USAN]",
          "stdName": "ETRUMADENANT [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a8ae7cb-3f90-393d-934b-40ce7ab2f9a8"
          ],
          "display_name": false
        },
        {
          "uuid": "7e82dd78-5413-440c-79ea-4f55205552b4",
          "name": "Etrumadenant [WHO-DD]",
          "stdName": "ETRUMADENANT [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f4774b0-3bd1-ec15-b934-b75228257dfc"
          ],
          "display_name": false
        },
        {
          "uuid": "66e7cfc7-4173-428c-8aef-7dee77e81dd8",
          "name": "etrumadenant [INN]",
          "stdName": "ETRUMADENANT [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ba2bba21-0ffe-4d35-9df6-781014f0d4c6"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "0b08b08b-b566-4dd9-9e23-31a08e5ca23f"
      }
    }
  ]
}