{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "98c85dee-c919-4418-97e3-4d86a1883bde",
          "code": "19010-66-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=19010-66-3",
          "code_system": "CAS",
          "references": [
            "63c060a2-84ec-4b53-a0d9-4389e17fcb31",
            "424b2bde-1d98-4a5d-9a6b-b6712fa9cb4a"
          ]
        },
        {
          "uuid": "3b0278b1-bcfc-4fcf-97a6-a00ff3723657",
          "code": "242-748-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.038.847",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "63c060a2-84ec-4b53-a0d9-4389e17fcb31"
          ]
        },
        {
          "uuid": "5f63d8a4-115f-2cc9-12f3-139949fff150",
          "code": "2886",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/2886",
          "code_system": "HSDB",
          "references": [
            "096e0839-30d8-de48-1f40-2fcaa4c321c3"
          ]
        },
        {
          "uuid": "700043f9-c1ad-0090-af81-377cc0f70a23",
          "code": "DTXSID6020775",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6020775",
          "code_system": "EPA CompTox",
          "references": [
            "691faeec-b4b2-dfd8-f523-ad81d8e7511c"
          ]
        },
        {
          "uuid": "8be45f41-bda9-45d9-b4a0-571360f15473",
          "code": "W04XWW8W1U",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "868f66fc-6d35-7745-06f7-6466f6009741",
          "code": "29383",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/29383",
          "code_system": "PUBCHEM",
          "references": [
            "ae3aa21e-aa72-d48a-0718-f74e772a400f"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "571d5ef6-ad0d-4b95-9c6a-8143003d7cfa",
          "name": "BIS(DIMETHYLDITHIOCARBAMATO)LEAD",
          "stdName": "BIS(DIMETHYLDITHIOCARBAMATO)LEAD",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e9a878b4-a27e-4d1d-90f2-65a972651624",
            "b861d85e-b2ea-4564-9487-4aeb262a661e"
          ],
          "display_name": false
        },
        {
          "uuid": "96b73947-2e39-4e58-b693-bb08ec35811e",
          "name": "CARBAMIC ACID, DIMETHYLDITHIO-, LEAD SALT",
          "stdName": "CARBAMIC ACID, DIMETHYLDITHIO-, LEAD SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e9a878b4-a27e-4d1d-90f2-65a972651624",
            "b861d85e-b2ea-4564-9487-4aeb262a661e"
          ],
          "display_name": false
        },
        {
          "uuid": "ed3e2c10-fc22-4b67-bec2-bc75b93d44d8",
          "name": "CARBAMODITHIOIC ACID, DIMETHYL-, LEAD COMPLEX",
          "stdName": "CARBAMODITHIOIC ACID, DIMETHYL-, LEAD COMPLEX",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b861d85e-b2ea-4564-9487-4aeb262a661e",
            "ba6de5c9-30d7-457c-9017-c0da58f006f3"
          ],
          "display_name": false
        },
        {
          "uuid": "2a0f831b-cc90-4c7e-a313-634ed1f79d05",
          "name": "LEAD BIS(DIMETHYLDITHIOCARBAMATE)",
          "stdName": "LEAD BIS(DIMETHYLDITHIOCARBAMATE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e9a878b4-a27e-4d1d-90f2-65a972651624",
            "b861d85e-b2ea-4564-9487-4aeb262a661e"
          ],
          "display_name": false
        },
        {
          "uuid": "1b73defb-f5ea-4f62-ac1b-4742ce86b9d4",
          "name": "LEAD DIMETHYLDITHIOCARBAMATE",
          "stdName": "LEAD DIMETHYLDITHIOCARBAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "857c49b6-7994-4466-b05b-6d05a962f14f"
          ],
          "display_name": true
        },
        {
          "uuid": "ecaf3c53-e7ed-4b6d-bb7d-a1f24774f018",
          "name": "LEAD, BIS(DIMETHYLCARBAMODITHIOATO-.KAPPA.S,.KAPPA.S')-, (T-4)-",
          "stdName": "LEAD, BIS(DIMETHYLCARBAMODITHIOATO-.KAPPA.S,.KAPPA.S')-, (T-4)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e9a878b4-a27e-4d1d-90f2-65a972651624",
            "b861d85e-b2ea-4564-9487-4aeb262a661e"
          ],
          "display_name": false
        },
        {
          "uuid": "22e30e6b-ca97-4d6c-b6dd-d9b6b62ff9f7",
          "name": "LEAD, BIS(DIMETHYLCARBAMODITHIOATO-S,S')-, (.BETA.-4)-",
          "stdName": "LEAD, BIS(DIMETHYLCARBAMODITHIOATO-S,S')-, (.BETA.-4)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e9a878b4-a27e-4d1d-90f2-65a972651624",
            "b861d85e-b2ea-4564-9487-4aeb262a661e"
          ],
          "display_name": false
        },
        {
          "uuid": "d72c4628-af67-4a25-a70f-7a3c903c7488",
          "name": "LEAD, BIS(DIMETHYLDITHIOCARBAMATO)- [HSDB]",
          "stdName": "LEAD, BIS(DIMETHYLDITHIOCARBAMATO)- [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b861d85e-b2ea-4564-9487-4aeb262a661e",
            "fcd99955-b02d-45ee-ae11-32f0e3ce2d7a"
          ],
          "display_name": false
        },
        {
          "uuid": "0076fa93-e509-47b8-88be-e94a06fcc32c",
          "name": "LEDATE",
          "stdName": "LEDATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e9a878b4-a27e-4d1d-90f2-65a972651624",
            "b861d85e-b2ea-4564-9487-4aeb262a661e"
          ],
          "display_name": false
        },
        {
          "uuid": "41db13ec-43d3-4092-8253-cd0d00c88118",
          "name": "METHYL LEDATE",
          "stdName": "METHYL LEDATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e9a878b4-a27e-4d1d-90f2-65a972651624",
            "b861d85e-b2ea-4564-9487-4aeb262a661e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "857c49b6-7994-4466-b05b-6d05a962f14f",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "fcd99955-b02d-45ee-ae11-32f0e3ce2d7a",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b861d85e-b2ea-4564-9487-4aeb262a661e",
          "citation": "NLM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e9a878b4-a27e-4d1d-90f2-65a972651624",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba6de5c9-30d7-457c-9017-c0da58f006f3",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "63c060a2-84ec-4b53-a0d9-4389e17fcb31",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391039000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7cbd83e0-8625-4cd0-9aa4-76aa4de6e9f0",
          "citation": "SRS import [W04XWW8W1U]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=W04XWW8W1U",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391039000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c4bfc13f-adf2-4e3b-9cd7-9f824ed0ccc5",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "096e0839-30d8-de48-1f40-2fcaa4c321c3",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+19010-66-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "691faeec-b4b2-dfd8-f523-ad81d8e7511c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=19010-66-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "424b2bde-1d98-4a5d-9a6b-b6712fa9cb4a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ae3aa21e-aa72-d48a-0718-f74e772a400f",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a46dfdfa-dbf2-4fbb-8c01-e7e40bc5f248",
          "id": "a46dfdfa-dbf2-4fbb-8c01-e7e40bc5f248",
          "molfile": "\n  Marvin  01132108322D          \n\n  1  0  0  0  0  0            999 V2000\n    1.6834    0.0704    0.0000 Pb  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Pb+2]",
          "formula": "Pb",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "15ede033-e7ce-4ab3-97c6-c43a37f7d60d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "207.2169",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "10e92e7b-6c57-43f0-bcb2-df2b17f350dc",
          "id": "10e92e7b-6c57-43f0-bcb2-df2b17f350dc",
          "molfile": "\n  Marvin  01132101062D          \n\n  6  5  0  0  0  0            999 V2000\n   -1.6783   -0.7153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2723   -0.0102    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6834    0.7154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4473   -0.0102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0348    0.7081    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0547   -0.7154    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  2  0  0  0  0\nM  END",
          "smiles": "CN(C)C(=S)S",
          "formula": "C3H7NS2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "183eddb2-45bb-454e-b83c-b3e2f7434e7d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "121.2267",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d0e5cf6f-da44-4b09-a5bb-4e2dd5c7d72a",
      "version": "5",
      "structure": {
        "id": "d8a487a3-7b8a-47cb-bf82-e09156941d4d",
        "molfile": "\n  Marvin  01132111142D          \n\n 13 10  0  0  0  0            999 V2000\n   -0.4473   -0.0102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0348    0.7081    0.0000 S   0  5  0  0  0  0  0  0  0  0  0  0\n   -0.0547   -0.7154    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2723   -0.0102    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6783   -0.7153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6834    0.7154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6834    0.0704    0.0000 Pb  0  2  0  0  0  0  0  0  0  0  0  0\n   -0.4473   -0.0102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0348    0.7081    0.0000 S   0  5  0  0  0  0  0  0  0  0  0  0\n   -0.0547   -0.7154    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2723   -0.0102    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6783   -0.7153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6834    0.7154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  2  0  0  0  0\n  1  4  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\n  8 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\nM  CHG  3   2  -1   7   2   9  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 12   1   2   3   4   5   6   8   9  10  11  12  13\nM  SPA   1  6   1   2   3   4   5   6\nM  SDI   1  4   -2.1034   -1.1354   -2.1034    1.1354\nM  SDI   1  4    0.3852    1.1354    0.3852   -1.1354\nM  SMT   1 2\nM  END",
        "smiles": "CN(C)C(=S)[S-].CN(C)C(=S)[S-].[Pb+2]",
        "formula": "2C3H6NS2.Pb",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "447.6544",
        "optical_activity": "NONE",
        "references": [
          "7cbd83e0-8625-4cd0-9aa4-76aa4de6e9f0",
          "c4bfc13f-adf2-4e3b-9cd7-9f824ed0ccc5"
        ],
        "stereo_centers": 0
      },
      "unii": "W04XWW8W1U"
    }
  ]
}