{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b3517f76-111a-426f-8602-85f621206f5d",
          "code": "562-90-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=562-90-3",
          "code_system": "CAS",
          "references": [
            "b8e8c7cc-f027-4a52-b3aa-87fc1f0990fb",
            "1003b0b5-9c55-4b09-bdd8-8bcc41dd98cc"
          ]
        },
        {
          "uuid": "c7309242-e405-435d-b14a-2b360a29a175",
          "code": "m9907",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9907?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "b8e8c7cc-f027-4a52-b3aa-87fc1f0990fb"
          ]
        },
        {
          "uuid": "7fcc6850-1a9c-4e34-b2d8-71ea3f0d8b02",
          "code": "68419",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/68419",
          "code_system": "PUBCHEM",
          "references": [
            "b8e8c7cc-f027-4a52-b3aa-87fc1f0990fb"
          ]
        },
        {
          "uuid": "83d29949-ec9d-4650-871e-421506ecd94c",
          "code": "209-239-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.400",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b8e8c7cc-f027-4a52-b3aa-87fc1f0990fb"
          ]
        },
        {
          "uuid": "7e628cf2-9d92-4f3f-b569-842619ff8288",
          "code": "VZ7LP47EPP",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "cac3e19d-633e-ac2e-44c6-ebc1d3059ee0",
          "code": "DTXSID60889353",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60889353",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5d4731f5-db18-409e-9214-68dfbfb8c03e",
          "name": "ACETIC ACID TETRAANHYDRIDE WITH SILICIC ACID (H4SIO4)",
          "stdName": "ACETIC ACID TETRAANHYDRIDE WITH SILICIC ACID (H4SIO4)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1e793f0-019f-44bf-8715-09035f0599ce",
            "ce613aa4-1842-416e-9053-918962a7f3d9"
          ],
          "display_name": false
        },
        {
          "uuid": "cd644433-8359-49bd-81c0-c89c9ee90a3d",
          "name": "SILANE, TETRAKIS(ACETYLOXY)-",
          "stdName": "SILANE, TETRAKIS(ACETYLOXY)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8297424e-d031-4684-8b0a-637c57296cdf",
            "ce613aa4-1842-416e-9053-918962a7f3d9"
          ],
          "display_name": false
        },
        {
          "uuid": "5b8d1ef9-a7d2-42a3-aa97-89f79df8b2e5",
          "name": "SILICON TETRAACETATE",
          "stdName": "SILICON TETRAACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1e793f0-019f-44bf-8715-09035f0599ce",
            "3859a04a-de27-49aa-a5d5-e0c3a230b293",
            "ce613aa4-1842-416e-9053-918962a7f3d9"
          ],
          "display_name": true
        },
        {
          "uuid": "12c5e3d5-4a70-4ab8-98d6-497017c8509a",
          "name": "SILICON TETRAACETATE [MI]",
          "stdName": "SILICON TETRAACETATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1e793f0-019f-44bf-8715-09035f0599ce",
            "ce613aa4-1842-416e-9053-918962a7f3d9"
          ],
          "display_name": false
        },
        {
          "uuid": "8444ee88-7b8c-4566-917b-aea56811c395",
          "name": "TETRAACETOXYSILANE",
          "stdName": "TETRAACETOXYSILANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1e793f0-019f-44bf-8715-09035f0599ce",
            "ce613aa4-1842-416e-9053-918962a7f3d9"
          ],
          "display_name": false
        },
        {
          "uuid": "f95674da-4c1c-485a-af87-d9111e310559",
          "name": "TETRAKIS(ACETYLOXY)SILANE",
          "stdName": "TETRAKIS(ACETYLOXY)SILANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1e793f0-019f-44bf-8715-09035f0599ce",
            "ce613aa4-1842-416e-9053-918962a7f3d9"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a1e793f0-019f-44bf-8715-09035f0599ce",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ce613aa4-1842-416e-9053-918962a7f3d9",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8297424e-d031-4684-8b0a-637c57296cdf",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b8e8c7cc-f027-4a52-b3aa-87fc1f0990fb",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391669000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "44a4df2f-a9e6-4a3b-95d7-7f11d28ff33a",
          "citation": "SRS import [VZ7LP47EPP]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=VZ7LP47EPP",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391669000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "615cbac0-5c9b-48d4-b99d-59e986bdbeff",
          "citation": "CHEMID RECORD 562-90-3",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3859a04a-de27-49aa-a5d5-e0c3a230b293",
          "citation": "SILICON TETRAACETATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1003b0b5-9c55-4b09-bdd8-8bcc41dd98cc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "675ab66d-72be-40c9-8b8a-9d5f9ec6c826",
          "id": "675ab66d-72be-40c9-8b8a-9d5f9ec6c826",
          "molfile": "\n  Marvin  01132105232D          \n\n 17 16  0  0  0  0            999 V2000\n    5.8881   -6.3813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1185   -6.0840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4776   -6.5966    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9944   -5.2642    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6395   -4.7475    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    6.1558   -5.3939    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9759   -5.2689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2760   -4.5021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4877   -5.9107    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2886   -4.2330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1634   -3.4135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3956   -3.1157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8015   -2.9037    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1276   -4.1089    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3126   -4.2318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0096   -4.9999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7965   -3.5883    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 10  1  0  0  0  0\n  5 14  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\nM  END",
          "smiles": "CC(=O)O[Si](OC(=O)C)(OC(=O)C)OC(=O)C",
          "formula": "C8H12O8Si",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e445236f-d94a-4f7e-8ab4-aa25abae6230"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "264.2618",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "08688dcb-6f28-40a3-a538-96a7960dcfa9",
      "version": "3",
      "structure": {
        "id": "ce674bac-3aa4-44ac-ab3b-7cff8eac1673",
        "molfile": "\n  Marvin  01132110392D          \n\n 17 16  0  0  0  0            999 V2000\n    5.6395   -4.7475    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    4.9944   -5.2642    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1185   -6.0840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4776   -6.5966    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8881   -6.3813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1558   -5.3939    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9759   -5.2689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4877   -5.9107    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2760   -4.5021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2886   -4.2330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1634   -3.4135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8015   -2.9037    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3956   -3.1157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1276   -4.1089    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3126   -4.2318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7965   -3.5883    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0096   -4.9999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  1 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n  1 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\nM  END",
        "smiles": "CC(=O)O[Si](OC(=O)C)(OC(=O)C)OC(=O)C",
        "formula": "C8H12O8Si",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "264.2618",
        "optical_activity": "NONE",
        "references": [
          "44a4df2f-a9e6-4a3b-95d7-7f11d28ff33a",
          "615cbac0-5c9b-48d4-b99d-59e986bdbeff"
        ],
        "stereo_centers": 0
      },
      "unii": "VZ7LP47EPP"
    }
  ]
}