{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e35128e2-9024-4a79-bfb7-c34b0037644b",
          "code": "27425-55-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=27425-55-4",
          "code_system": "CAS",
          "references": [
            "f464b718-6323-4597-b94d-1c6319de54b8",
            "d1f9c22e-9fb8-4c48-9ada-3d14499caa0a"
          ]
        },
        {
          "uuid": "a915e6cd-05e3-4d2e-8c58-168d11c634fc",
          "code": "248-451-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.044.033",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f464b718-6323-4597-b94d-1c6319de54b8"
          ]
        },
        {
          "uuid": "7f6e3c70-ccb0-4fba-ac00-3595ecb325d3",
          "code": "94381",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/94381",
          "code_system": "PUBCHEM",
          "references": [
            "f464b718-6323-4597-b94d-1c6319de54b8"
          ]
        },
        {
          "uuid": "a87c9bbe-4536-4c19-bb92-3d031f215dcc",
          "code": "VX3Q255SG5",
          "type": "PRIMARY",
          "code_system": "FDA UNII",
          "references": [
            "d1f9c22e-9fb8-4c48-9ada-3d14499caa0a"
          ]
        },
        {
          "uuid": "79a88591-c876-f122-1b0d-1df784dc70e7",
          "code": "DTXSID4067309",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4067309",
          "code_system": "EPA CompTox",
          "references": [
            "dc07100d-7866-0082-c2c1-e186c4f4947a"
          ]
        },
        {
          "uuid": "0e617c1c-990d-287e-6002-3631f5459c63",
          "code": "303254",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=303254",
          "code_system": "NSC",
          "references": [
            "48bf4396-1cc6-7ae4-28fe-f9cccb4606d9"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b2fd297c-b5fd-45b0-baf0-7b8697694f54",
          "name": "2H-1-Benzopyran-2-one, 3-(1H-benzimidazol-2-yl)-7-(diethylamino)-",
          "stdName": "2H-1-BENZOPYRAN-2-ONE, 3-(1H-BENZIMIDAZOL-2-YL)-7-(DIETHYLAMINO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1f9c22e-9fb8-4c48-9ada-3d14499caa0a"
          ],
          "display_name": false
        },
        {
          "uuid": "c5ddd85c-92f3-455c-a2d5-a562d7a41a4a",
          "name": "3-(1H-Benzimidazol-2-yl)-7-(diethylamino)-2H-1-benzopyran-2-one",
          "stdName": "3-(1H-BENZIMIDAZOL-2-YL)-7-(DIETHYLAMINO)-2H-1-BENZOPYRAN-2-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1f9c22e-9fb8-4c48-9ada-3d14499caa0a"
          ],
          "display_name": false
        },
        {
          "uuid": "1d61575f-2ed2-4c3a-b8e7-bb42979a8912",
          "name": "3-(2-Benzimidazolyl)-7-(diethylamino)coumarin",
          "stdName": "3-(2-BENZIMIDAZOLYL)-7-(DIETHYLAMINO)COUMARIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1f9c22e-9fb8-4c48-9ada-3d14499caa0a"
          ],
          "display_name": false
        },
        {
          "uuid": "853127dd-c34f-4e9e-9bc1-cf10e3efe718",
          "name": "3-(2′-Benzimidazolyl)-7-(diethylamino)coumarin",
          "stdName": "3-(2'-BENZIMIDAZOLYL)-7-(DIETHYLAMINO)COUMARIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1f9c22e-9fb8-4c48-9ada-3d14499caa0a"
          ],
          "display_name": false
        },
        {
          "uuid": "1d4ac3ea-d8cb-4719-ae2f-c96c3a019731",
          "name": "3-(Benzimidazol-2-yl)-7-diethylamino-2H-benzopyran-2-one",
          "stdName": "3-(BENZIMIDAZOL-2-YL)-7-DIETHYLAMINO-2H-BENZOPYRAN-2-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1f9c22e-9fb8-4c48-9ada-3d14499caa0a"
          ],
          "display_name": false
        },
        {
          "uuid": "30977ff0-8fda-40f0-8414-f896abc29ef6",
          "name": "C.I. Disperse Yellow 82",
          "stdName": "C.I. DISPERSE YELLOW 82",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1f9c22e-9fb8-4c48-9ada-3d14499caa0a"
          ],
          "display_name": false
        },
        {
          "uuid": "776b914c-46ea-458f-9f42-e0d2705d49c8",
          "name": "Coumarin 7",
          "stdName": "COUMARIN 7",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1f9c22e-9fb8-4c48-9ada-3d14499caa0a"
          ],
          "display_name": true
        },
        {
          "uuid": "f6b55781-99ec-427b-9ba8-1b84b85191c3",
          "name": "Coumarin, 3-(2-benzimidazolyl)-7-(diethylamino)-",
          "stdName": "COUMARIN, 3-(2-BENZIMIDAZOLYL)-7-(DIETHYLAMINO)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1f9c22e-9fb8-4c48-9ada-3d14499caa0a"
          ],
          "display_name": false
        },
        {
          "uuid": "e379bfa4-cd06-4d35-bf29-987cba3e1b9b",
          "name": "D820 Savannah Yellow",
          "stdName": "D820 SAVANNAH YELLOW",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1f9c22e-9fb8-4c48-9ada-3d14499caa0a"
          ],
          "display_name": false
        },
        {
          "uuid": "4f5557ad-0d92-4f58-8290-449f335c6e67",
          "name": "Disperse Yellow 82",
          "stdName": "DISPERSE YELLOW 82",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1f9c22e-9fb8-4c48-9ada-3d14499caa0a"
          ],
          "display_name": false
        },
        {
          "uuid": "739668c6-7468-4901-b478-6ddba98a0800",
          "name": "Disperse Yellow 8GFF",
          "stdName": "DISPERSE YELLOW 8GFF",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1f9c22e-9fb8-4c48-9ada-3d14499caa0a"
          ],
          "display_name": false
        },
        {
          "uuid": "f7ac6a41-9f97-4f4c-935b-35407d37733d",
          "name": "Fluorescent Yellow 10G",
          "stdName": "FLUORESCENT YELLOW 10G",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1f9c22e-9fb8-4c48-9ada-3d14499caa0a"
          ],
          "display_name": false
        },
        {
          "uuid": "eb415aa7-c0fe-4911-9ae5-63501885e10c",
          "name": "NSC-303254",
          "stdName": "NSC-303254",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8dbed508-1bb7-429b-9f3a-a5737eb3a94f"
          ],
          "display_name": false
        },
        {
          "uuid": "ea6f4130-7bed-4d67-95f0-ed674a17d1f7",
          "name": "Sumikaron Brilliant Flavine S 10G",
          "stdName": "SUMIKARON BRILLIANT FLAVINE S 10G",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1f9c22e-9fb8-4c48-9ada-3d14499caa0a"
          ],
          "display_name": false
        },
        {
          "uuid": "188bf7ca-db60-4154-ad3c-d0818111ca60",
          "name": "Terasil Brilliant Flavine 8GFF",
          "stdName": "TERASIL BRILLIANT FLAVINE 8GFF",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1f9c22e-9fb8-4c48-9ada-3d14499caa0a"
          ],
          "display_name": false
        },
        {
          "uuid": "c4599adc-9350-4c0a-ba0e-492d93d969f8",
          "name": "Yellow 8GFF",
          "stdName": "YELLOW 8GFF",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1f9c22e-9fb8-4c48-9ada-3d14499caa0a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9e17be52-e858-4a5c-be6c-f32fb9f272e7",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8dbed508-1bb7-429b-9f3a-a5737eb3a94f",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f464b718-6323-4597-b94d-1c6319de54b8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392364000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dc07100d-7866-0082-c2c1-e186c4f4947a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=27425-55-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1a59d432-968b-46b9-879f-8b670ccf64cb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d1f9c22e-9fb8-4c48-9ada-3d14499caa0a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "48bf4396-1cc6-7ae4-28fe-f9cccb4606d9",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4f390f36-286f-48e2-b4cf-7c8ace065aa2",
          "id": "4f390f36-286f-48e2-b4cf-7c8ace065aa2",
          "molfile": "\n  Marvin  01132104082D          \n\n 25 28  0  0  0  0            999 V2000\n    0.0257   -1.3114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8657   -1.3285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2685   -2.0485    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8314   -2.7427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.7256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0999   -2.0656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5027   -2.7770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3341   -2.7941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7712   -2.0999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6026   -2.1171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0312   -1.4142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8711   -1.4313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3339   -2.1085    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1310   -1.8770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8339   -2.3056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5538   -1.9113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5710   -1.0713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8682   -0.6428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1482   -1.0456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3682   -0.7714    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6283   -0.6943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0654    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7969   -0.6771    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3684   -1.3799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5284   -1.3628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  6  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n 25  6  2  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 24  9  2  0  0  0  0\n 11 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 11 21  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 20  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 19 14  2  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 22  2  0  0  0  0\n 21 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\nM  END",
          "smiles": "CCN(CC)c1ccc2cc(-c3[nH]c4ccccc4n3)c(=O)oc2c1",
          "formula": "C20H19N3O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2146a4d9-e465-401a-86e0-8555bc5822ab"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "333.3845",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ce117193-cbd3-484a-805c-f272b50978f6",
      "version": "10",
      "structure": {
        "id": "414d701c-f8a4-4a86-a2ee-bf7238b3fa49",
        "molfile": "\n  Marvin  01132103272D          \n\n 25 28  0  0  0  0            999 V2000\n    5.0312   -1.4142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8711   -1.4313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3682   -0.7714    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6283   -0.6943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3339   -2.1085    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6026   -2.1171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7969   -0.6771    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3684   -1.3799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7712   -2.0999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5284   -1.3628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1482   -1.0456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1310   -1.8770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0999   -2.0656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0654    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2685   -2.0485    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3341   -2.7941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5027   -2.7770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8682   -0.6428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8339   -2.3056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8657   -1.3285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8314   -2.7427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0257   -1.3114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.7256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5538   -1.9113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5710   -1.0713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  4  1  0  0  0  0\n  1  6  2  0  0  0  0\n  2  3  2  0  0  0  0\n  2  5  1  0  0  0  0\n  3 11  1  0  0  0  0\n  4  7  1  0  0  0  0\n  4 14  2  0  0  0  0\n  5 12  1  0  0  0  0\n  6  9  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\n  9 16  2  0  0  0  0\n 10 13  1  0  0  0  0\n 11 18  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 19  2  0  0  0  0\n 13 17  2  0  0  0  0\n 13 15  1  0  0  0  0\n 15 20  1  0  0  0  0\n 15 21  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 25  1  0  0  0  0\n 19 24  1  0  0  0  0\n 20 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 24 25  2  0  0  0  0\nM  END",
        "smiles": "CCN(CC)c1ccc2cc(-c3[nH]c4ccccc4n3)c(=O)oc2c1",
        "formula": "C20H19N3O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "333.3845",
        "optical_activity": "NONE",
        "references": [
          "9e17be52-e858-4a5c-be6c-f32fb9f272e7",
          "d1f9c22e-9fb8-4c48-9ada-3d14499caa0a"
        ],
        "stereo_centers": 0
      },
      "unii": "VX3Q255SG5"
    }
  ]
}