{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "6aa9cdbf-5f86-4fdd-b3d6-43931b7b269d", "code": "VVS69S6623", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "c63c633a-1360-a852-fb7e-8530f1226600", "code": "58471-52-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=58471-52-6", "code_system": "CAS", "references": [ "9a14e5ff-7096-4b7c-9927-c76641347fa1" ] }, { "uuid": "e5450061-9cfc-3243-f9d7-9ea9cc19246b", "code": "16122514", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16122514", "code_system": "PUBCHEM", "references": [ "7aae08b1-c254-f283-edef-6a7879309f82" ] }, { "uuid": "1bf16f94-025f-3798-b31e-03ae95468446", "code": "DTXSID70583092", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70583092", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "52f17ff5-9056-4384-a30a-2e21149a5e52", "name": "L-Asparagine, L-asparaginyl-", "stdName": "L-ASPARAGINE, L-ASPARAGINYL-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9a14e5ff-7096-4b7c-9927-c76641347fa1" ], "display_name": false }, { "uuid": "eeb8a853-63e7-4ad2-8847-4da7405f908d", "name": "L-Asparaginyl-L-asparagine", "stdName": "L-ASPARAGINYL-L-ASPARAGINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9a14e5ff-7096-4b7c-9927-c76641347fa1" ], "display_name": true } ], "references": [ { "uuid": "264f668e-0916-e7e0-08c6-9506bbd3b7f5", "citation": "ZINC", "url": "http://zinc.docking.org/substances/subsets/in-vivo/", "doc_type": "WEBSITE", "public_domain": true }, { "uuid": "9a14e5ff-7096-4b7c-9927-c76641347fa1", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "7aae08b1-c254-f283-edef-6a7879309f82", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "e3ecb35b-ca96-46cf-a6bb-304d0ba81ad3", "id": "e3ecb35b-ca96-46cf-a6bb-304d0ba81ad3", "molfile": "\n Marvin 01132111482D \n\n 17 16 0 0 0 0 999 V2000\n -1.4290 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 0.4125 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 0.7145 1.2375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4290 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4290 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1435 0.4125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8580 0.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 3.5724 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2869 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0014 0.4125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2869 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8580 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1435 -1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 -1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 6 0 0 0\n 5 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 1 0 0 0\n 10 15 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 2 0 0 0 0\n 15 16 2 0 0 0 0\n 15 17 1 0 0 0 0\nM END", "smiles": "C([C@@H](C(=O)N[C@@H](CC(=O)N)C(=O)O)N)C(=O)N", "formula": "C8H14N4O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "49154e16-105a-4038-9c0a-f7fcd2e7e61a" }, "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "246.2209", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "ff792911-c680-4b97-a83d-43a01c87c392", "version": "7", "structure": { "id": "a3afffeb-71a0-4acf-b33c-c122abb60abf", "molfile": "ZINC000035307739\n Marvin 01132108302D \n\n 17 16 0 0 1 0 999 V2000\n -1.4290 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 0.4125 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 0.7145 1.2375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4290 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4290 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1435 0.4125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8580 0.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 3.5724 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2869 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0014 0.4125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2869 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8580 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1435 -1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 -1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 6 0 0 0\n 5 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 1 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 2 0 0 0 0\n 10 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 15 17 1 0 0 0 0\nM END", "smiles": "C([C@@H](C(=O)N[C@@H](CC(=O)N)C(=O)O)N)C(=O)N", "formula": "C8H14N4O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "246.2209", "optical_activity": "UNSPECIFIED", "references": [ "264f668e-0916-e7e0-08c6-9506bbd3b7f5", "9a14e5ff-7096-4b7c-9927-c76641347fa1" ], "stereo_centers": 2 }, "unii": "VVS69S6623" } ] }