{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a9578073-0260-4260-8033-564c0c2b876b",
          "code": "122882-90-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=122882-90-0",
          "code_system": "CAS",
          "references": [
            "e64930e3-9e75-43c4-826b-7626ff3aaac9",
            "d6c98321-f53d-4121-a6cb-1f0ad0c935f5"
          ]
        },
        {
          "uuid": "1dd4453f-f86f-449b-9ec8-1b59473be103",
          "code": "VALERYLFENTANYL",
          "comments": "ChemSpider ID is 10551383, PubChem 21595398, CAS 122882-90-0.",
          "type": "PRIMARY",
          "url": "http://www.bluelight.org/vb/threads/775406-Novel-opioid-Valerylfentanyl-(sold-as-quot-TCE-quot-)",
          "code_system": "WEB RESOURCE",
          "references": [
            "e64930e3-9e75-43c4-826b-7626ff3aaac9"
          ]
        },
        {
          "uuid": "9d1233a5-9529-49ed-a10a-ca1c1f56798a",
          "code": "VALERYLFENTANYL",
          "comments": "Valeryl fentanyl (CRM) (Item No. 19798) is a certified reference material that is structurally categorized as an opioid. The physiological and toxicological properties of this compound are not known.",
          "type": "PRIMARY",
          "url": "https://www.caymanchem.com/product/19798",
          "code_system": "MANUFACTURER PRODUCT INFORMATION",
          "references": [
            "e64930e3-9e75-43c4-826b-7626ff3aaac9"
          ]
        },
        {
          "uuid": "e8e45251-4b45-4a66-b152-85255b988ab1",
          "code": "VALERYLFENTANYL",
          "type": "PRIMARY",
          "url": "https://www.revolvy.com/topic/List%20of%20fentanyl%20analogues&uid=1575",
          "code_system": "WEB RESOURCE",
          "references": [
            "e64930e3-9e75-43c4-826b-7626ff3aaac9"
          ]
        },
        {
          "uuid": "e1e6e732-9ace-431d-9601-e272c9473691",
          "code": "21595398",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/21595398",
          "code_system": "PUBCHEM",
          "references": [
            "e64930e3-9e75-43c4-826b-7626ff3aaac9"
          ]
        },
        {
          "uuid": "6338f860-9689-4ec6-8473-4f4fa284fdef",
          "code": "Valerylfentanyl",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Valerylfentanyl",
          "code_system": "WIKIPEDIA",
          "references": [
            "803ddb4e-b447-94ae-e0ee-c914220bc5a4"
          ]
        },
        {
          "uuid": "7f21202b-bf9a-42b9-80ec-38d7c5de5dec",
          "code": "9840",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule I. |Opiates",
          "type": "PRIMARY",
          "url": "https://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "3f3563c3-60d8-ea67-26e0-1a11959745b0"
          ]
        },
        {
          "uuid": "3f4d64c3-e19f-4583-a019-ece1286c99c5",
          "code": "VUG0EQK700",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3d5edace-d04f-4a8d-8101-a3bfc21da34e",
          "code": "List_of_fentanyl_analogues",
          "comments": "WIKIPEDIA|FENTANYL ANALOGUES",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_fentanyl_analogues",
          "code_system": "WIKIPEDIA"
        },
        {
          "uuid": "b8c5bd7b-64c4-08a6-0bb9-fe210711abda",
          "code": "Designer-drugs-Valerylfentanyl",
          "comments": "Wikipedia|List of designer drugs|Sedatives|Opioids",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "fe5162be-746d-277a-94f3-7348d8f70610"
          ]
        },
        {
          "uuid": "921a378d-f6b2-f9da-be84-93d450b67a1d",
          "code": "DTXSID801014173",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID801014173",
          "code_system": "EPA CompTox",
          "references": [
            "fe5162be-746d-277a-94f3-7348d8f70610"
          ]
        },
        {
          "uuid": "f6fa95ab-c286-df32-281b-6b46150de756",
          "code": "300000055880",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "1aac043c-845d-ce9f-ef0e-7f548cc93cbb"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "62555996-e5e5-419f-a181-38b2813612f5",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "8996120b-84f7-402e-a939-3e2b973cc245",
            "refuuid": "c3044c13-403f-45ab-a858-4c129dcb2644",
            "name": "VALERYLFENTANYL HYDROCHLORIDE",
            "unii": "THC91A283J",
            "linking_id": "THC91A283J",
            "ref_pname": "VALERYLFENTANYL HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "42a17769-5aa2-438c-9d44-ff162bfa1d81",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "803a96aa-4a55-4280-9d17-b64bd0a35eb2",
            "refuuid": "0212e775-b4da-4782-a551-4a4ad026b1a2",
            "name": "VALERYLFENTANYL",
            "unii": "VUG0EQK700",
            "linking_id": "VUG0EQK700",
            "ref_pname": "VALERYLFENTANYL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4217eee7-aa21-4f9e-ba30-28f8ea22167d",
          "type": "TARGET->AGONIST",
          "related_substance": {
            "uuid": "615ca4be-4a95-4701-ad40-47a27c60abb8",
            "refuuid": "39262e4f-d963-4b83-9b34-52fd55036f0e",
            "name": "MU-TYPE OPIOID RECEPTOR",
            "unii": "1PE72K8X46",
            "linking_id": "1PE72K8X46",
            "ref_pname": "MU-TYPE OPIOID RECEPTOR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "089f5ca6-f47b-42e4-b373-351f6ce2040c",
          "amount": {
            "uuid": "98a51c60-0ed8-45bd-b55a-d25dff1f921d"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "4230dfe5-cdc5-4d39-ac90-da4393499fe9",
            "refuuid": "c3044c13-403f-45ab-a858-4c129dcb2644",
            "name": "VALERYLFENTANYL HYDROCHLORIDE",
            "unii": "THC91A283J",
            "linking_id": "THC91A283J",
            "ref_pname": "VALERYLFENTANYL HYDROCHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "72078b47-c67a-66aa-85e4-1b740599e3fb",
          "name": "N-(1-(2-PHENYLETHYL)-4-PIPERIDINYL)-N-PHENYLPENTYLAMIDE",
          "stdName": "N-(1-(2-PHENYLETHYL)-4-PIPERIDINYL)-N-PHENYLPENTYLAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "803ddb4e-b447-94ae-e0ee-c914220bc5a4"
          ],
          "display_name": false
        },
        {
          "uuid": "ab4f938b-ef95-4321-a17d-1d5b8cfd17d6",
          "name": "N-(1-PHENETHYL-4-PIPERIDYL)-N-PHENYL-PENTANAMIDE",
          "stdName": "N-(1-PHENETHYL-4-PIPERIDYL)-N-PHENYL-PENTANAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a924126e-fab1-4b1b-9b4c-120ca4231f4e",
            "7e84aa42-923d-441f-a570-c5edaa75c91f"
          ],
          "display_name": false
        },
        {
          "uuid": "6440d59a-40a9-8f1d-817f-fbf7d119606a",
          "name": "N-(1-PHENETHYLPIPERIDIN-4-YL)-N-PHENYLPENTANAMIDE",
          "stdName": "N-(1-PHENETHYLPIPERIDIN-4-YL)-N-PHENYLPENTANAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f3563c3-60d8-ea67-26e0-1a11959745b0"
          ],
          "display_name": false
        },
        {
          "uuid": "5574d0b4-884c-422f-b2e9-83d895d7507e",
          "name": "PENTANAMIDE, N-PHENYL-N-(1-(2-PHENYLETHYL)-4-PIPERIDINYL)-",
          "stdName": "PENTANAMIDE, N-PHENYL-N-(1-(2-PHENYLETHYL)-4-PIPERIDINYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e84aa42-923d-441f-a570-c5edaa75c91f",
            "7407b1c7-49de-4111-8523-a8b2fe09f75b"
          ],
          "display_name": false
        },
        {
          "uuid": "f4ec1343-517a-4d6b-87fb-a27c9e5444c5",
          "name": "TCE",
          "stdName": "TCE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0d4b371-ca7d-4761-87b9-d4c1ee2eb9d6",
            "7e84aa42-923d-441f-a570-c5edaa75c91f"
          ],
          "display_name": false
        },
        {
          "uuid": "a3a0c266-e81c-9911-a7e0-c46f28ed574b",
          "name": "VALERYL FENTANYL",
          "stdName": "VALERYL FENTANYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f3563c3-60d8-ea67-26e0-1a11959745b0"
          ],
          "display_name": false
        },
        {
          "uuid": "cc045d6f-a8e5-46ff-82ab-a1a5f5d57ecf",
          "name": "VALERYLFENTANYL",
          "stdName": "VALERYLFENTANYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e84aa42-923d-441f-a570-c5edaa75c91f",
            "b57edb4f-24b4-4e63-b4f3-e699cc9c1a8e"
          ],
          "display_name": true
        },
        {
          "uuid": "c5cd2019-03af-4607-9b62-c7ddbf21cb96",
          "name": "VF",
          "stdName": "VF",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0d4b371-ca7d-4761-87b9-d4c1ee2eb9d6",
            "7e84aa42-923d-441f-a570-c5edaa75c91f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7407b1c7-49de-4111-8523-a8b2fe09f75b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7e84aa42-923d-441f-a570-c5edaa75c91f",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d0d4b371-ca7d-4761-87b9-d4c1ee2eb9d6",
          "citation": "WEB PAGE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b57edb4f-24b4-4e63-b4f3-e699cc9c1a8e",
          "citation": "https://commons.wikimedia.org/wiki/File:Valerylfentanyl.png",
          "url": "https://commons.wikimedia.org/wiki/File:Valerylfentanyl.png",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a924126e-fab1-4b1b-9b4c-120ca4231f4e",
          "citation": "CHEMDRAW",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e64930e3-9e75-43c4-826b-7626ff3aaac9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393384000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "32e84684-6017-4464-83f3-6a59d0e3c5aa",
          "citation": "SRS import [VUG0EQK700]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=VUG0EQK700",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393384000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d359074c-c5c3-3261-30bb-a32f12c049a1",
          "citation": "List of fentanyl analogues",
          "url": "https://en.wikipedia.org/wiki/List_of_fentanyl_analogues",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "803ddb4e-b447-94ae-e0ee-c914220bc5a4",
          "citation": "https://en.wikipedia.org/wiki/Valerylfentanyl",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "d6c98321-f53d-4121-a6cb-1f0ad0c935f5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3f3563c3-60d8-ea67-26e0-1a11959745b0",
          "citation": "Electronic Code of Federal Regulations\ne-CFR data is current as of February 7, 2020",
          "doc_type": "CFR",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fe5162be-746d-277a-94f3-7348d8f70610",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "1aac043c-845d-ce9f-ef0e-7f548cc93cbb",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0bfbddf8-114a-4f17-aa81-38dcd1642b7e",
          "id": "0bfbddf8-114a-4f17-aa81-38dcd1642b7e",
          "molfile": "\n  Marvin  01132100522D          \n\n 27 29  0  0  0  0            999 V2000\n    4.7786   -6.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4931   -7.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2075   -6.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9220   -7.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6365   -6.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3510   -7.3044    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6365   -6.0669    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3510   -5.6544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0654   -6.0669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7799   -5.6544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7799   -4.8294    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4944   -4.4169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2089   -4.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9233   -4.4169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6378   -4.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3523   -4.4169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3523   -3.5919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6378   -3.1794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9233   -3.5919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0654   -4.4169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3510   -4.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9220   -5.6544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2075   -6.0669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4931   -5.6544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4931   -4.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2075   -4.4169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9220   -4.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 22  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 21  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 20 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 19  2  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 27  2  0  0  0  0\n 23 24  2  0  0  0  0\n 24 25  1  0  0  0  0\n 26 25  2  0  0  0  0\n 27 26  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(=O)N(c1ccccc1)C2CCN(CCc3ccccc3)CC2",
          "formula": "C24H32N2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "46b471d3-5f98-445d-8da7-0d9a39283861"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "364.5246",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0212e775-b4da-4782-a551-4a4ad026b1a2",
      "version": "14",
      "structure": {
        "id": "8a82e94a-0621-4870-bc3c-4a66fe271412",
        "molfile": "\n  Marvin  01132107122D          \n\n 27 29  0  0  0  0            999 V2000\n    7.6365   -6.0669    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9220   -5.6544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2075   -6.0669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4931   -5.6544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4931   -4.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2075   -4.4169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9220   -4.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3510   -5.6544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0654   -6.0669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7799   -5.6544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7799   -4.8294    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4944   -4.4169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2089   -4.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9233   -4.4169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6378   -4.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3523   -4.4169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3523   -3.5919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6378   -3.1794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9233   -3.5919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0654   -4.4169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3510   -4.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6365   -6.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3510   -7.3044    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9220   -7.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2075   -6.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4931   -7.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7786   -6.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  2  7  2  0  0  0  0\n  1  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 14 19  2  0  0  0  0\n 20 11  1  0  0  0  0\n 21 20  1  0  0  0  0\n  8 21  1  0  0  0  0\n  1 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 22 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\nM  END",
        "smiles": "CCCCC(=O)N(c1ccccc1)C2CCN(CCc3ccccc3)CC2",
        "formula": "C24H32N2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "364.5246",
        "optical_activity": "NONE",
        "references": [
          "32e84684-6017-4464-83f3-6a59d0e3c5aa",
          "7407b1c7-49de-4111-8523-a8b2fe09f75b"
        ],
        "stereo_centers": 0
      },
      "unii": "VUG0EQK700"
    }
  ]
}