{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0b82de81-4185-4b4b-a185-0d13164b6a18",
          "code": "109023-83-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=109023-83-8",
          "code_system": "CAS",
          "references": [
            "84098966-cc0e-4d46-be3a-d1a550a16a4e",
            "6851e12b-2c00-40af-a945-a8d3abaafd61"
          ]
        },
        {
          "uuid": "6a11b518-5a81-443d-9403-7961d9e17c07",
          "code": "C99815",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C99815",
          "code_system": "NCI_THESAURUS",
          "references": [
            "84098966-cc0e-4d46-be3a-d1a550a16a4e"
          ]
        },
        {
          "uuid": "45b68a13-c26e-4435-bd82-68d2e8828dfc",
          "code": "3621694",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3621694",
          "code_system": "PUBCHEM",
          "references": [
            "84098966-cc0e-4d46-be3a-d1a550a16a4e"
          ]
        },
        {
          "uuid": "c3770d55-eb86-3ff2-1276-a8579a1dd74a",
          "code": "DTXSID40148798",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40148798",
          "code_system": "EPA CompTox",
          "references": [
            "f58f42f2-f545-5a33-3897-43cc9eed52cc"
          ]
        },
        {
          "uuid": "3a3f221d-3706-5c7e-5f23-b8f7a79069ab",
          "code": "C461",
          "comments": "Industrial Aid[C45678]|Dye",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C461",
          "code_system": "NCI_THESAURUS",
          "references": [
            "457c14a7-052e-0b38-01c8-6d46c8ed3095"
          ]
        },
        {
          "uuid": "14eaeca1-28eb-443c-8654-2333d5211bf6",
          "code": "VQY3VF9106",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "574ef51b-77d3-4140-be04-08adca2a2197",
          "name": "1,5-DI(.BETA.-HYDROXYETHYL)AMINO-2-NITRO-4-CHLOROBENZENE",
          "stdName": "1,5-DI(.BETA.-HYDROXYETHYL)AMINO-2-NITRO-4-CHLOROBENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c52292b9-f05a-4f9d-aa6b-b23c4b9c952a",
            "5d792fd8-ec55-499f-995b-c51c1715db9e"
          ],
          "display_name": false
        },
        {
          "uuid": "d51151bc-e4f8-412a-81af-4dde56167849",
          "name": "2,2'-((4-CHLORO-6-NITRO-1,3-PHENYLENE)DIIMINO)BIS(ETHANOL)",
          "stdName": "2,2'-((4-CHLORO-6-NITRO-1,3-PHENYLENE)DIIMINO)BIS(ETHANOL)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ed6e23bf-2f9c-43ed-b475-3266ab4a5634",
            "c52292b9-f05a-4f9d-aa6b-b23c4b9c952a"
          ],
          "display_name": false
        },
        {
          "uuid": "1af4f1ef-0eb9-4e2d-9bd4-fc17aff94703",
          "name": "ETHANOL, 2,2'-((4-CHLORO-6-NITRO-1,3-PHENYLENE)DIIMINO)BIS-",
          "stdName": "ETHANOL, 2,2'-((4-CHLORO-6-NITRO-1,3-PHENYLENE)DIIMINO)BIS-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c52292b9-f05a-4f9d-aa6b-b23c4b9c952a",
            "28fbc7a5-458e-45de-bf9a-9b716373508c"
          ],
          "display_name": false
        },
        {
          "uuid": "7da62cff-a81a-438a-888a-e8fbb6e4af91",
          "name": "HC YELLOW 10",
          "stdName": "HC YELLOW 10",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c52292b9-f05a-4f9d-aa6b-b23c4b9c952a",
            "28fbc7a5-458e-45de-bf9a-9b716373508c"
          ],
          "display_name": false
        },
        {
          "uuid": "17c30592-3de1-43de-918a-f4cac6061011",
          "name": "HC YELLOW NO. 10",
          "stdName": "HC YELLOW NO. 10",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c52292b9-f05a-4f9d-aa6b-b23c4b9c952a",
            "69e5e05e-5db1-40cb-b6a6-aff2a8460228",
            "5d792fd8-ec55-499f-995b-c51c1715db9e"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "0d302875-bc20-41b7-82a2-a7db65dbdfcb",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "b5feaadd-e324-47e5-b937-42d48379bcc2",
          "name": "IMEXINE FAH",
          "stdName": "IMEXINE FAH",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c52292b9-f05a-4f9d-aa6b-b23c4b9c952a",
            "5d792fd8-ec55-499f-995b-c51c1715db9e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5d792fd8-ec55-499f-995b-c51c1715db9e",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c52292b9-f05a-4f9d-aa6b-b23c4b9c952a",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "28fbc7a5-458e-45de-bf9a-9b716373508c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ed6e23bf-2f9c-43ed-b475-3266ab4a5634",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "84098966-cc0e-4d46-be3a-d1a550a16a4e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391503000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f4b0043d-cbf6-49a5-9430-3f07857c4eb9",
          "citation": "SRS import [VQY3VF9106]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=VQY3VF9106",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391503000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "69e5e05e-5db1-40cb-b6a6-aff2a8460228",
          "citation": "HC YELLOW NO. 10 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f58f42f2-f545-5a33-3897-43cc9eed52cc",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=109023-83-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "457c14a7-052e-0b38-01c8-6d46c8ed3095",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "6851e12b-2c00-40af-a945-a8d3abaafd61",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "edd8b71a-b77a-572c-4c30-99624f6e3663",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c8ef7d37-6e6d-4177-ad45-75b807550522",
          "id": "c8ef7d37-6e6d-4177-ad45-75b807550522",
          "molfile": "\n  Marvin  01132110232D          \n\n 18 18  0  0  0  0            999 V2000\n    6.1224   -5.2114    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5098   -4.4614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3349   -4.4614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7273   -3.7114    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5523   -3.7114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9823   -4.3863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8073   -4.3863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2423   -5.0864    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8498   -5.8113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2848   -6.5139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8948   -7.2439    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1973   -3.6614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7648   -2.9838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9349   -2.9838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5073   -2.2814    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   11.0223   -3.6614    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   11.4148   -2.9089    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   11.4573   -4.3364    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 14  2  0  0  0  0\n  7  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n  7 12  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 16  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  2  0  0  0  0\nM  CHG  2  16   1  17  -1\nM  END",
          "smiles": "C(CO)Nc1cc(c(cc1Cl)[N+](=O)[O-])NCCO",
          "formula": "C10H14ClN3O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "13e07031-0297-4e87-83f9-d329e7bc779b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "275.6892",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "85636c39-5eca-4f83-9feb-cbee393269c2",
      "version": "7",
      "structure": {
        "id": "c4a4e40c-326d-4a22-93cd-2dae17ca7713",
        "molfile": "\n  Marvin  01132110102D          \n\n 18 18  0  0  0  0            999 V2000\n    6.1224   -5.2114    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5098   -4.4614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8948   -7.2439    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3349   -4.4614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5073   -2.2814    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   10.2848   -6.5139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7273   -3.7114    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4148   -2.9089    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   11.4573   -4.3364    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9349   -2.9838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8498   -5.8113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5523   -3.7114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0223   -3.6614    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    9.7648   -2.9838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2423   -5.0864    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9823   -4.3863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1973   -3.6614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8073   -4.3863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n 12 10  1  0  0  0  0\n  2  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  6  3  1  0  0  0  0\n  7  4  1  0  0  0  0\n 10  5  1  0  0  0  0\n 11  6  1  0  0  0  0\n 12  7  1  0  0  0  0\n 13  8  1  0  0  0  0\n 13  9  2  0  0  0  0\n 14 10  2  0  0  0  0\n 15 11  1  0  0  0  0\n 16 12  2  0  0  0  0\n 17 13  1  0  0  0  0\n 17 14  1  0  0  0  0\n 18 15  1  0  0  0  0\n 18 16  1  0  0  0  0\n 18 17  2  0  0  0  0\nM  CHG  2   8  -1  13   1\nM  END",
        "smiles": "C(CO)Nc1cc(c(cc1Cl)[N+](=O)[O-])NCCO",
        "formula": "C10H14ClN3O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "275.6892",
        "optical_activity": "NONE",
        "references": [
          "28fbc7a5-458e-45de-bf9a-9b716373508c",
          "f4b0043d-cbf6-49a5-9430-3f07857c4eb9"
        ],
        "stereo_centers": 0
      },
      "unii": "VQY3VF9106"
    }
  ]
}