{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "047c0d60-cabc-4ec7-88be-44a9148e3f49", "code": "57963-77-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=57963-77-6", "code_system": "CAS", "references": [ "e1622680-1ca7-4524-aef6-84bf05a0c422", "d5bb0b09-5933-4fa8-8ec9-80fc96852a7a" ] }, { "uuid": "c7c3f376-4eda-b22f-d7b5-fcb18042c091", "code": "137379059", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/137379059", "code_system": "PUBCHEM", "references": [ "1cf9b7c8-6cdd-1fcc-750a-ff0ec7ccde30" ] }, { "uuid": "dd858d0e-7bc2-2dd8-b0d5-32a9568fb5f0", "code": "DTXSID601021267", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID601021267", "code_system": "EPA CompTox" }, { "uuid": "d6a550d4-4b34-48b6-8911-54358483080f", "code": "VPT58CC7M7", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "41fda8ba-f4bb-419b-b62e-ab120c0dfddb", "name": "(4aS,8aS)-5,5,8a-trimethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-4a-ol", "stdName": "(4AS,8AS)-5,5,8A-TRIMETHYL-2,3,4,6,7,8-HEXAHYDRO-1H-NAPHTHALEN-4A-OL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "1cf9b7c8-6cdd-1fcc-750a-ff0ec7ccde30" ], "display_name": false }, { "uuid": "70d13c40-4729-47d4-94aa-d59a2c7c7b1e", "name": "4a(2H)-Naphthalenol, octahydro-4,4,8a-trimethyl-, cis-", "stdName": "4A(2H)-NAPHTHALENOL, OCTAHYDRO-4,4,8A-TRIMETHYL-, CIS-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c7607cf6-96ee-4826-9949-4660a2e126d7" ], "display_name": true } ], "references": [ { "uuid": "c7607cf6-96ee-4826-9949-4660a2e126d7", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e1622680-1ca7-4524-aef6-84bf05a0c422", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392085000, "tags": [ "NOMEN" ] }, { "uuid": "1cf9b7c8-6cdd-1fcc-750a-ff0ec7ccde30", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "d5bb0b09-5933-4fa8-8ec9-80fc96852a7a", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "7b59517c-5378-4c85-9b81-4c6f419074f3", "id": "7b59517c-5378-4c85-9b81-4c6f419074f3", "molfile": "\n Marvin 10262315052D \n\n 14 15 0 0 1 0 999 V2000\n 12.9759 -5.4954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7321 -4.7072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4883 -5.4954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4466 -4.2947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4466 -3.4697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7321 -3.0573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0177 -3.4697 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 12.0177 -2.6448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3033 -3.0573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5888 -3.4697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5888 -4.2947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3033 -4.7072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0177 -4.2947 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 12.0177 -5.1197 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 2 13 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 6 0 0 0\n 7 9 1 0 0 0 0\n 7 13 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 6 0 0 0\nM END", "smiles": "CC1(C)CCC[C@]2(C)CCCC[C@]12O", "formula": "C13H24O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "0119de44-3dee-47b3-b12f-fd843a839e89" }, "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "196.3295", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "a47441c8-376a-49a0-a60c-eb424b604b71", "version": "7", "structure": { "id": "259ce245-a71f-4b5e-881c-6ea3d5f13cd4", "molfile": "\n JSDraw210262315052D\n\n 14 15 0 0 1 0 0 V2000\n 24.5359 -10.3911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.0749 -8.9008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.6139 -10.3911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.4259 -8.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.4259 -6.5608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.0749 -5.7809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7239 -6.5608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7239 -5.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3731 -5.7809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.0221 -6.5608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.0221 -8.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3731 -8.9008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7239 -8.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7239 -9.6807 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 6 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 2 13 1 0 0 0 0\n 7 13 1 0 0 0 0\n 13 14 1 6 0 0 0\nM END", "smiles": "CC1(C)CCC[C@]2(C)CCCC[C@]12O", "formula": "C13H24O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "196.3295", "optical_activity": "UNSPECIFIED", "references": [ "c7607cf6-96ee-4826-9949-4660a2e126d7" ], "stereo_centers": 2 }, "unii": "VPT58CC7M7" } ] }