{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "843c974b-b0f3-4ad0-8a5e-cdb7586b694c",
          "code": "27253-29-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=27253-29-8",
          "code_system": "CAS",
          "references": [
            "49915fa2-a864-4045-8177-47cfef765cbe",
            "a83f0cd2-cf6a-487c-814f-0af5c68bc4bc"
          ]
        },
        {
          "uuid": "12228fa6-4fbd-4c71-92b0-63b6f486a90a",
          "code": "248-370-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.043.959",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "49915fa2-a864-4045-8177-47cfef765cbe"
          ]
        },
        {
          "uuid": "e9d09e60-141e-6f7d-88fb-d9b8994747f7",
          "code": "101505005",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/101505005",
          "code_system": "PUBCHEM",
          "references": [
            "14c73d06-38b7-c3f6-4587-4df4b6b0ab77"
          ]
        },
        {
          "uuid": "b32e69cb-7c90-48c3-9453-0451396a2164",
          "code": "VPR8224Z3T",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "61a25a7d-521e-455e-8b3f-210e721a7ba4",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "6551e4cf-5c78-4f2b-8ae2-1cde4f990c45",
            "refuuid": "a0cf59d1-0ce6-46d2-a53c-21c4b202ec9c",
            "name": "ZINC CATION",
            "unii": "13S1S8SF37",
            "linking_id": "13S1S8SF37",
            "ref_pname": "ZINC CATION",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "679169e2-7871-49ec-9277-102732a8526d",
          "name": "BICAT",
          "stdName": "BICAT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "75f2ab35-0edd-45d3-966e-fa99705f3eb9",
            "cfa4d339-9c0e-410c-b1fd-2e0a079f12df"
          ],
          "display_name": false
        },
        {
          "uuid": "19396727-a3ae-4e9d-9423-77d71370c121",
          "name": "NEODECANOIC ACID, ZINC SALT (2:1)",
          "stdName": "NEODECANOIC ACID, ZINC SALT (2:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "75f2ab35-0edd-45d3-966e-fa99705f3eb9",
            "9b5b6981-8480-4058-a6b1-57f6acc449eb"
          ],
          "display_name": false
        },
        {
          "uuid": "0bbbdc52-d0ca-4e62-a4e7-ec6ec98397fe",
          "name": "ZINC NEODECANOATE",
          "stdName": "ZINC NEODECANOATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "75f2ab35-0edd-45d3-966e-fa99705f3eb9",
            "026742ee-44cb-4fd9-9f40-bb6d8fe1297b",
            "a6ac917d-f20c-499b-815d-66b2a02719fc"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "6b7f749b-3c60-4755-a7f5-9fa7672a2446",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "cfa4d339-9c0e-410c-b1fd-2e0a079f12df",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "75f2ab35-0edd-45d3-966e-fa99705f3eb9",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "026742ee-44cb-4fd9-9f40-bb6d8fe1297b",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9b5b6981-8480-4058-a6b1-57f6acc449eb",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "49915fa2-a864-4045-8177-47cfef765cbe",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390919000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "39d91803-0dbf-494c-8f0d-0963113374a6",
          "citation": "SRS import [VPR8224Z3T]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=VPR8224Z3T",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390919000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a6ac917d-f20c-499b-815d-66b2a02719fc",
          "citation": "ZINC NEODECANOATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c5f2d801-af16-5303-df97-e22b015f9b4f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=27253-29-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "14c73d06-38b7-c3f6-4587-4df4b6b0ab77",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "a83f0cd2-cf6a-487c-814f-0af5c68bc4bc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "94194955-36b4-4d31-a5b8-c5966628ffc1",
          "id": "94194955-36b4-4d31-a5b8-c5966628ffc1",
          "molfile": "\n  Marvin  01132107412D          \n\n  1  0  0  0  0  0            999 V2000\n    5.5094   -5.3892    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Zn+2]",
          "formula": "Zn",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3d30cf84-9840-45d1-93d4-3d0ec3f1a16c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "65.3956",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "568a379e-8e21-4a58-954b-04a90d4e63bb",
          "id": "568a379e-8e21-4a58-954b-04a90d4e63bb",
          "molfile": "\n  Marvin  01132104302D          \n\n 12 11  0  0  0  0            999 V2000\n   11.2343   -3.0666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5199   -3.4791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5199   -4.3041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8054   -4.7166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8054   -5.5416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0909   -5.9541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0909   -6.7791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0909   -7.6041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9159   -6.7791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2659   -6.7791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8535   -7.4936    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.8535   -6.0647    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n 10  7  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\nM  CHG  1  11  -1\nM  END",
          "smiles": "CCCCCCC(C)(C)C(=O)[O-]",
          "formula": "C10H19O2",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "8990c10e-ebf1-42a9-a2a0-14c1a334614e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "171.257",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "REPRESENTATIVE",
      "uuid": "f3b1fdf6-1638-4db9-a9dc-bb3f86436cd3",
      "version": "7",
      "structure": {
        "id": "3b2929ba-490e-448a-b564-ae75c7702625",
        "molfile": "\n  Marvin  01132103082D          \n\n 25 22  0  0  0  0            999 V2000\n    5.5094   -5.3892    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\n    8.2659   -6.7791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0909   -6.7791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0909   -5.9541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8054   -5.5416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8054   -4.7166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5199   -4.3041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0909   -7.6041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9159   -6.7791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8535   -7.4936    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.8535   -6.0647    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5199   -3.4791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2343   -3.0666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2659   -6.7791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0909   -6.7791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0909   -5.9541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8054   -5.5416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8054   -4.7166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5199   -4.3041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0909   -7.6041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9159   -6.7791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8535   -7.4936    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.8535   -6.0647    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5199   -3.4791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2343   -3.0666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  3  8  1  0  0  0  0\n  3  9  1  0  0  0  0\n  2 10  1  0  0  0  0\n  2 11  2  0  0  0  0\n  7 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 22  1  0  0  0  0\n 14 23  2  0  0  0  0\n 15 16  1  0  0  0  0\n 15 20  1  0  0  0  0\n 15 21  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 24  1  0  0  0  0\n 24 25  1  0  0  0  0\nM  CHG  3   1   2  10  -1  22  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 15   2   3   4   5   6   7   8   9  10  11  12  13  14  15  16\nM  SAL   1  9  17  18  19  20  21  22  23  24  25\nM  SPA   1 12   2   3   4   5   6   7   8   9  10  11  12  13\nM  SDI   1  4    7.4335   -8.0241    7.4335   -2.6466\nM  SDI   1  4   11.6543   -2.6466   11.6543   -8.0241\nM  SMT   1 2\nM  END",
        "smiles": "CCCCCCC(C)(C)C(=O)[O-].CCCCCCC(C)(C)C(=O)[O-].[Zn+2]",
        "formula": "2C10H19O2.Zn",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "407.9096",
        "optical_activity": "NONE",
        "references": [
          "39d91803-0dbf-494c-8f0d-0963113374a6",
          "cfa4d339-9c0e-410c-b1fd-2e0a079f12df"
        ],
        "stereo_centers": 0
      },
      "unii": "VPR8224Z3T"
    }
  ]
}