{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "b2815e00-0e27-48f6-9fc1-3b34d2a0991e", "code": "489-32-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=489-32-7", "code_system": "CAS", "references": [ "001fdbfb-8bea-47d9-8650-8dd5bf046e67", "feb46c8b-f8e6-45e9-b10b-66c8bcc80f7b" ] }, { "uuid": "1b31ac1d-8255-422a-bb11-7b86e03b534b", "code": "ICARIIN", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Icariin", "code_system": "WIKIPEDIA", "references": [ "001fdbfb-8bea-47d9-8650-8dd5bf046e67" ] }, { "uuid": "4f3cefce-5b63-4faf-aa41-1a1f927e4197", "code": "m4942", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m4942?q=authorize", "code_system": "MERCK INDEX", "references": [ "001fdbfb-8bea-47d9-8650-8dd5bf046e67" ] }, { "uuid": "e6f2a8f2-78c9-4389-9d23-1643967bf90d", "code": "SUB182587", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "001fdbfb-8bea-47d9-8650-8dd5bf046e67" ] }, { "uuid": "12173522-ede8-47d5-9bf8-3a3e8b47a5c3", "code": "1788871", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1788871/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "001fdbfb-8bea-47d9-8650-8dd5bf046e67" ] }, { "uuid": "2a109f3a-61de-4a7f-9d70-b70148509c52", "code": "5318997", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5318997", "code_system": "PUBCHEM", "references": [ "001fdbfb-8bea-47d9-8650-8dd5bf046e67" ] }, { "uuid": "f11a0f26-1d24-390a-15f0-c39442f7b424", "code": "1125 (Number of products:24)", "comments": "Dietary Supplement Label Database|chemical|icariin", "type": "PRIMARY", "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=1125&item=icariin", "code_system": "DSLD", "references": [ "1b035622-f19c-6713-87db-83ac85afd4bd" ] }, { "uuid": "8a9ca7fa-90f9-2c3b-5eef-0af48bbae970", "code": "DB12052", "type": "PRIMARY", "url": "https://go.drugbank.com/drugs/DB12052", "code_system": "DRUG BANK", "references": [ "1b035622-f19c-6713-87db-83ac85afd4bd" ] }, { "uuid": "6458071e-afc5-4191-b047-a3ffd3afe58d", "code": "VNM47R2QSQ", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "06643bb5-d128-2078-45f8-a85684b5086b", "code": "100000168995", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "c703fc88-363f-87c3-7745-c80d0b7570c2" ] }, { "uuid": "7a5c31b7-8891-1652-4be7-8816032b4b90", "code": "VNM47R2QSQ", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=VNM47R2QSQ", "code_system": "DAILYMED", "references": [ "871797a8-d028-be81-cbc3-109420562516" ] }, { "uuid": "a83eddec-5709-f178-a2f9-e58b2664cfa4", "code": "DTXSID00964133", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00964133", "code_system": "EPA CompTox", "references": [ "1b035622-f19c-6713-87db-83ac85afd4bd" ] } ], "relationships": [ { "uuid": "b0958041-de74-4f9c-80aa-013f43bac8ae", "amount": { "uuid": "acd220ad-592c-4bbc-a329-60c88865cf97" }, "type": "TRANSPORTER->INHIBITOR", "references": [ "07464e38-d27e-432b-9b49-9d39b1a93654" ], "related_substance": { "uuid": "337d150d-4427-4f62-9576-8e427f50f4ed", "refuuid": "3921aa0b-fd6d-40ec-9c07-d83e5c6f124a", "name": "MULTIDRUG RESISTANCE PROTEIN 1", "unii": "22ES734693", "linking_id": "22ES734693", "ref_pname": "MULTIDRUG RESISTANCE PROTEIN 1", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "64174807-314c-47d7-a785-ffbd537f61a0", "name": "4H-1-BENZOPYRAN-4-ONE, 3-((6-DEOXY-.ALPHA.-L-MANNOPYRANOSYL)OXY)-7-(.BETA.-D-GLUCOPYRANOSYLOXY)-5-HYDROXY-2-(4-METHOXYPHENYL)-8-(3-METHYL-2-BUTEN-1-YL)-", "stdName": "4H-1-BENZOPYRAN-4-ONE, 3-((6-DEOXY-.ALPHA.-L-MANNOPYRANOSYL)OXY)-7-(.BETA.-D-GLUCOPYRANOSYLOXY)-5-HYDROXY-2-(4-METHOXYPHENYL)-8-(3-METHYL-2-BUTEN-1-YL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "83b8d6da-a1c3-4a59-a853-94639ee14cfe", "ebf2cba1-47e4-4c66-941f-d7c5d6179c9f" ], "display_name": false }, { "uuid": "b9ba3d8e-c461-4c3b-ba79-dc12dbaddd57", "name": "EPIMEDII HERBA ICARIIN [MI]", "stdName": "EPIMEDII HERBA ICARIIN [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "83b8d6da-a1c3-4a59-a853-94639ee14cfe", "ed700ebf-2eb6-4efd-bd8b-a49a71020564" ], "display_name": false }, { "uuid": "a1308df3-43bf-4afb-b115-8881df345204", "name": "ICARIIN", "stdName": "ICARIIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "621d0315-cdf8-41bc-8954-77214a550ad5", "549dd664-461b-466b-99c5-882b23f9f4dc" ], "display_name": true } ], "references": [ { "uuid": "549dd664-461b-466b-99c5-882b23f9f4dc", "citation": "CHEMID 2011 Drugportal", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "621d0315-cdf8-41bc-8954-77214a550ad5", "citation": "DRUGPORTAL 2011", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ebf2cba1-47e4-4c66-941f-d7c5d6179c9f", "citation": "stn", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "83b8d6da-a1c3-4a59-a853-94639ee14cfe", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ed700ebf-2eb6-4efd-bd8b-a49a71020564", "citation": "MERCK", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "001fdbfb-8bea-47d9-8650-8dd5bf046e67", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391213000, "tags": [ "NOMEN" ] }, { "uuid": "f82b3376-f19f-4d6e-b270-c013dd69dfe3", "citation": "SRS import [VNM47R2QSQ]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=VNM47R2QSQ", "doc_type": "SRS", "public_domain": true, "document_date": 1493391213000, "tags": [ "NOMEN" ] }, { "uuid": "c6a5a982-564a-457b-b4a9-af66377419fc", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1b035622-f19c-6713-87db-83ac85afd4bd", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "feb46c8b-f8e6-45e9-b10b-66c8bcc80f7b", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "07464e38-d27e-432b-9b49-9d39b1a93654", "citation": "Engle, Kritika, and Gautam Kumar. \"Cancer multidrug-resistance reversal by ABCB1 inhibition: A recent update.\" European Journal of Medicinal Chemistry (2022): 114542.", "url": "https://reader.elsevier.com/reader/sd/pii/S0223523422004445?token=B3EF98BA0FAAF433D381FC1940C0A0821598B2CD02A38085CDCBCDC6820386D96F5F5C32DDBD9012577502F3F6A9B6C9&originRegion=us-east-1&originCreation=20220716171256", "doc_type": "JA", "public_domain": true }, { "uuid": "871797a8-d028-be81-cbc3-109420562516", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "c703fc88-363f-87c3-7745-c80d0b7570c2", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "dc665982-fcf6-4efb-88f8-16ebab2484d6", "id": "dc665982-fcf6-4efb-88f8-16ebab2484d6", "molfile": "\n Marvin 01132111262D \n\n 48 52 0 0 1 0 999 V2000\n 13.5719 -10.2561 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 12.8532 -10.6612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5803 -9.4311 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2990 -9.0260 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 14.3075 -8.2010 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5973 -7.7812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6058 -6.9563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8956 -6.5364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1769 -6.9416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4667 -6.5217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4752 -5.6968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7650 -5.2770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7735 -4.4520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0633 -4.0322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4922 -4.0469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7481 -6.9268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0379 -6.5070 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3192 -6.9122 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 9.3107 -7.7371 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5920 -8.1423 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 8.5835 -8.9673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8649 -9.3724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8819 -7.7224 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 7.1632 -8.1276 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8903 -6.8975 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 7.1801 -6.4777 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6090 -6.4924 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 8.6175 -5.6674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7396 -7.7518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4498 -8.1717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4413 -8.9966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1685 -7.7665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8786 -8.1863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8701 -9.0113 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3245 -6.5511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0347 -6.9709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7533 -6.5658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7618 -5.7408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4805 -5.3357 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4890 -4.5107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0516 -5.3210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3329 -5.7261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0092 -9.4458 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 15.7279 -9.0407 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0007 -10.2708 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 15.7109 -10.6906 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2821 -10.6759 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 14.2736 -11.5008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 47 1 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 1 0 0 0\n 43 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 2 0 0 0 0\n 6 33 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 35 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 32 9 2 0 0 0 0\n 10 11 1 0 0 0 0\n 10 16 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 29 1 0 0 0 0\n 18 17 1 6 0 0 0\n 18 19 1 0 0 0 0\n 27 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 20 21 1 6 0 0 0\n 23 20 1 0 0 0 0\n 21 22 1 0 0 0 0\n 23 24 1 1 0 0 0\n 25 23 1 0 0 0 0\n 25 26 1 6 0 0 0\n 25 27 1 0 0 0 0\n 27 28 1 1 0 0 0\n 29 30 2 0 0 0 0\n 30 31 1 0 0 0 0\n 32 30 1 0 0 0 0\n 33 32 1 0 0 0 0\n 33 34 2 0 0 0 0\n 35 36 1 0 0 0 0\n 35 42 2 0 0 0 0\n 36 37 2 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 1 0 0 0 0\n 38 41 2 0 0 0 0\n 39 40 1 0 0 0 0\n 41 42 1 0 0 0 0\n 43 44 1 6 0 0 0\n 45 43 1 0 0 0 0\n 45 46 1 6 0 0 0\n 45 47 1 0 0 0 0\n 47 48 1 1 0 0 0\nM END", "smiles": "CC(=CCc1c(cc(c2c(=O)c(c(-c3ccc(cc3)OC)oc12)O[C@H]4[C@@H]([C@@H]([C@H]([C@H](C)O4)O)O)O)O)O[C@H]5[C@@H]([C@H]([C@@H]([C@@H](CO)O5)O)O)O)C", "formula": "C33H40O15", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "a6b4d3c4-97df-4efc-9e9a-94854a2da663" }, "defined_stereo": 10, "ez_centers": 0, "molecular_weight": "676.663", "optical_activity": "UNSPECIFIED", "stereo_centers": 10 } ], "definition_level": "COMPLETE", "uuid": "13c0f672-7947-405e-82e0-4296bf239ff6", "version": "9", "structure": { "id": "a6ab0661-e6bb-4606-961b-7b0ee226b606", "molfile": "\n Marvin 01132108392D \n\n 48 52 0 0 1 0 999 V2000\n 13.6058 -6.9563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5973 -7.7812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8786 -8.1863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1685 -7.7665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1769 -6.9416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8956 -6.5364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4667 -6.5217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7481 -6.9268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7396 -7.7518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4498 -8.1717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4413 -8.9966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0379 -6.5070 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3192 -6.9122 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.6090 -6.4924 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.6175 -5.6674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8903 -6.8975 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.1801 -6.4777 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8819 -7.7224 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.1632 -8.1276 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5920 -8.1423 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.3107 -7.7371 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5835 -8.9673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8649 -9.3724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4752 -5.6968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7650 -5.2770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7735 -4.4520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0633 -4.0322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4922 -4.0469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8701 -9.0113 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3075 -8.2010 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2990 -9.0260 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 15.0092 -9.4458 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 15.7279 -9.0407 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0007 -10.2708 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 15.7109 -10.6906 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2821 -10.6759 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 14.2736 -11.5008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5719 -10.2561 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 13.5803 -9.4311 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8532 -10.6612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3245 -6.5511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0347 -6.9709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7533 -6.5658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7618 -5.7408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0516 -5.3210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3329 -5.7261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4805 -5.3357 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4890 -4.5107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 1 6 1 0 0 0 0\n 5 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 4 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 8 12 1 0 0 0 0\n 13 12 1 6 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 1 0 0 0\n 14 16 1 0 0 0 0\n 16 17 1 6 0 0 0\n 16 18 1 0 0 0 0\n 18 19 1 1 0 0 0\n 18 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 13 21 1 0 0 0 0\n 20 22 1 6 0 0 0\n 22 23 1 0 0 0 0\n 7 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 26 28 1 0 0 0 0\n 3 29 2 0 0 0 0\n 2 30 1 0 0 0 0\n 31 30 1 1 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 6 0 0 0\n 32 34 1 0 0 0 0\n 34 35 1 6 0 0 0\n 34 36 1 0 0 0 0\n 36 37 1 1 0 0 0\n 36 38 1 0 0 0 0\n 38 39 1 0 0 0 0\n 31 39 1 0 0 0 0\n 38 40 1 6 0 0 0\n 1 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 42 43 2 0 0 0 0\n 43 44 1 0 0 0 0\n 44 45 2 0 0 0 0\n 45 46 1 0 0 0 0\n 41 46 2 0 0 0 0\n 44 47 1 0 0 0 0\n 47 48 1 0 0 0 0\nM END", "smiles": "CC(=CCc1c(cc(c2c(=O)c(c(-c3ccc(cc3)OC)oc12)O[C@H]4[C@@H]([C@@H]([C@H]([C@H](C)O4)O)O)O)O)O[C@H]5[C@@H]([C@H]([C@@H]([C@@H](CO)O5)O)O)O)C", "formula": "C33H40O15", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 10, "ez_centers": 0, "molecular_weight": "676.663", "optical_activity": "UNSPECIFIED", "references": [ "f82b3376-f19f-4d6e-b270-c013dd69dfe3", "c6a5a982-564a-457b-b4a9-af66377419fc" ], "stereo_centers": 10 }, "unii": "VNM47R2QSQ" } ] }