{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b5a274f9-6365-4621-a38d-528cb0339dfe",
          "code": "QP53AF06",
          "comments": "VATC|ECTOPARACITICIDES,  INSECTICIDES AND REPELLENTS|ECTOPARASITICIDES FOR TOPICAL USE, INCL. INSECTICIDES|Organophosphorous compounds|phosmet",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QP53AF06&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "1b4cb256-8420-48a3-86a4-4f99e98cc0e6"
          ]
        },
        {
          "uuid": "97ce021c-d65d-4831-82c9-2cab99811689",
          "code": "QP53BB03",
          "comments": "VATC|ECTOPARACITICIDES,  INSECTICIDES AND REPELLENTS|ECTOPARASITICIDES FOR SYSTEMIC USE|Organophosphorous compounds|phosmet",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QP53BB03&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "1b4cb256-8420-48a3-86a4-4f99e98cc0e6"
          ]
        },
        {
          "uuid": "643e60f3-1068-4261-858b-7d1a77144ab3",
          "code": "732-11-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=732-11-6",
          "code_system": "CAS",
          "references": [
            "1b4cb256-8420-48a3-86a4-4f99e98cc0e6",
            "d2927034-5028-46fb-a5e3-40c8a4c1b0e2"
          ]
        },
        {
          "uuid": "12df335e-760d-4cb7-9f8f-f9f5fd9db35c",
          "code": "C76877",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76877",
          "code_system": "NCI_THESAURUS",
          "references": [
            "1b4cb256-8420-48a3-86a4-4f99e98cc0e6"
          ]
        },
        {
          "uuid": "d11c3d61-fc7a-4135-bdf9-652e9a9f5006",
          "code": "D010706",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68010706",
          "code_system": "MESH",
          "references": [
            "1b4cb256-8420-48a3-86a4-4f99e98cc0e6"
          ]
        },
        {
          "uuid": "5d995bc7-bdc5-4eb0-9768-5399a5170a01",
          "code": "PHOSMET",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Phosmet",
          "code_system": "WIKIPEDIA",
          "references": [
            "1b4cb256-8420-48a3-86a4-4f99e98cc0e6"
          ]
        },
        {
          "uuid": "cf45cd44-552c-489b-b7eb-1a3170a7d1de",
          "code": "59201",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3329",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "1b4cb256-8420-48a3-86a4-4f99e98cc0e6"
          ]
        },
        {
          "uuid": "e63f3dd9-eec5-40f1-b6d6-36ff82a78556",
          "code": "m8718",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8718?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "1b4cb256-8420-48a3-86a4-4f99e98cc0e6"
          ]
        },
        {
          "uuid": "9901addd-25d9-4bae-8ea7-fab6a47b1bef",
          "code": "21 CFR 524.1742",
          "comments": "SUBCHAPTER E--ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 524 OPHTHALMIC AND TOPICAL DOSAGE FORM NEW ANIMAL DRUGS|SEC. 524.1742 N-(Mercaptomethyl) phthalimide S-(O,O-dimethyl phosphorodithioate) emulsifiable liquid.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=524.1742",
          "code_system": "CFR",
          "references": [
            "1b4cb256-8420-48a3-86a4-4f99e98cc0e6"
          ]
        },
        {
          "uuid": "f2859251-620b-4851-a504-4c1d5d98c855",
          "code": "CHEMBL1481873",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1481873",
          "code_system": "ChEMBL",
          "references": [
            "1b4cb256-8420-48a3-86a4-4f99e98cc0e6"
          ]
        },
        {
          "uuid": "6e180765-b465-461b-825b-73d5b0a2cefc",
          "code": "211-987-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.010.899",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "1b4cb256-8420-48a3-86a4-4f99e98cc0e6"
          ]
        },
        {
          "uuid": "0c221383-2df5-41a9-a541-c222a2594e52",
          "code": "12901",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/12901",
          "code_system": "PUBCHEM",
          "references": [
            "1b4cb256-8420-48a3-86a4-4f99e98cc0e6"
          ]
        },
        {
          "uuid": "9f48d237-519c-4f7c-cb55-ff97fe141ef3",
          "code": "1734",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1734",
          "code_system": "HSDB",
          "references": [
            "f945cbae-64de-b260-2208-666bc1da7e16"
          ]
        },
        {
          "uuid": "0da7a44e-3280-5948-b7a9-9d8c223d75c4",
          "code": "DTXSID5024261",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5024261",
          "code_system": "EPA CompTox",
          "references": [
            "d06bc9c0-5219-7d2f-2c05-bd5e5a73d6b6"
          ]
        },
        {
          "uuid": "cb8cb83a-157e-fef3-eb21-3bb87eb26b4e",
          "code": "C737",
          "comments": "Industrial Aid[C45678]|Pesticide",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C737",
          "code_system": "NCI_THESAURUS",
          "references": [
            "07f829d2-7ef0-6ef4-5c5e-ac45c25e8cfe"
          ]
        },
        {
          "uuid": "c14ad074-75b8-d850-e83a-a442f5ce1b10",
          "code": "DB11448",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11448",
          "code_system": "DRUG BANK",
          "references": [
            "07f829d2-7ef0-6ef4-5c5e-ac45c25e8cfe"
          ]
        },
        {
          "uuid": "353a8d14-0cdf-4660-acae-f09b7443efab",
          "code": "VN04LI540Y",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8b701f37-a0c9-bee9-d64c-cc55e38ac05f",
          "code": "38786",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:38786",
          "code_system": "CHEBI",
          "references": [
            "07f829d2-7ef0-6ef4-5c5e-ac45c25e8cfe"
          ]
        },
        {
          "uuid": "d22c7c17-4b60-b364-6648-dd33bb598678",
          "code": "300000029414",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "59ef84db-6a59-ebb3-dd0a-d1d8e4082c4b"
          ]
        },
        {
          "uuid": "23e7a911-e3af-a243-2e73-551ee6184657",
          "code": "phosmet",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/phosmet.html",
          "code_system": "ALANWOOD",
          "references": [
            "61bc1f97-d002-461c-c131-79b4fc483f92"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "4ec956c4-582a-413a-b1b3-77938c5185ad",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "f6075d3c-8099-4160-8886-f574ac8e3290",
            "refuuid": "33647f5b-dda9-4c7d-a0ff-fe47c119ec11",
            "name": "PHOSMET",
            "unii": "VN04LI540Y",
            "linking_id": "VN04LI540Y",
            "ref_pname": "PHOSMET",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8f879e6b-4c28-4bb7-89e4-823716247a4b",
          "amount": {
            "uuid": "5e5593e6-4c24-4138-91e8-ea7681664c16"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "2536bc84-1bbc-4463-9c02-c8b17ae379b5"
          ],
          "related_substance": {
            "uuid": "45e6c766-e6fe-4429-b1b1-ce9cb3829641",
            "refuuid": "048368a1-8eb0-458e-bdff-0059bef49e76",
            "name": "O,O-DIMETHYL DITHIOPHOSPHATE",
            "unii": "4K09JRW4Z6",
            "linking_id": "4K09JRW4Z6",
            "ref_pname": "O,O-DIMETHYL DITHIOPHOSPHATE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7a820317-f3d9-45c8-92bb-9870cf1fe263",
          "name": "N-(MERCAPTOMETHYL) PHTHALIMIDE S-(O,O-DIMETHYL PHOSPHORODITHIOATE)",
          "stdName": "N-(MERCAPTOMETHYL) PHTHALIMIDE S-(O,O-DIMETHYL PHOSPHORODITHIOATE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "904ff128-2b78-485b-9e3f-4aa862b21ace",
            "ded9bfc4-3fc3-4de1-a49f-a4c5fc192211"
          ],
          "display_name": false
        },
        {
          "uuid": "6992ba8e-c0fb-4279-9848-c27f8e83b579",
          "name": "O,O-DIMETHYL PHTHALIMIDOMETHYL PHOSPHORODITHIOATE",
          "stdName": "O,O-DIMETHYL PHTHALIMIDOMETHYL PHOSPHORODITHIOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0b07ed07-5a26-4b3b-bcff-3e709d794a9f"
          ],
          "display_name": false
        },
        {
          "uuid": "875cab55-5ad0-4a56-92f9-b488d37d480f",
          "name": "O,O-DIMETHYL S-PHTHALIMIDOMETHYL PHOSPHORODITHIOATE",
          "stdName": "O,O-DIMETHYL S-PHTHALIMIDOMETHYL PHOSPHORODITHIOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "448d771b-a92e-4546-bb29-b33765a62529",
            "14514d4f-0097-4a67-b74e-6bbd585c74d9"
          ],
          "display_name": false
        },
        {
          "uuid": "f1909b78-9e68-4a06-b836-e880d9309523",
          "name": "PHOSMET",
          "stdName": "PHOSMET",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "904ff128-2b78-485b-9e3f-4aa862b21ace",
            "58d3a267-197a-4861-9829-8a60cbd5eb11",
            "a1694d73-8b1c-4ad2-9107-6ef502654284",
            "90e88d10-9360-4aa1-819e-c0f5df90fd2a",
            "4544ab8a-593a-4558-88ef-57797320e37b",
            "ee52d544-1925-4694-8dcb-5c19032e2d70",
            "9eb5a76f-e659-4c65-8ebb-3ba2f2fb9d10",
            "3cd37536-fe10-4f20-9bfe-9d397d4c29a3",
            "f9003a04-fb18-41ed-aa1c-b2213107412b",
            "576dc8aa-eb27-431f-993c-2759d2257a06",
            "ad8c05bd-ebbf-4c5c-82ac-4173e3118cc8",
            "65923bc6-b412-4d34-b1ab-35e2784cceaf"
          ],
          "display_name": true
        },
        {
          "uuid": "6fa2c038-b4ed-47f1-b170-e6b1e3381ee6",
          "name": "PHOSMET [GREEN BOOK]",
          "stdName": "PHOSMET [GREEN BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9003a04-fb18-41ed-aa1c-b2213107412b"
          ],
          "display_name": false
        },
        {
          "uuid": "b6abaf4a-2e8b-4ddf-a722-efef6d8251e0",
          "name": "PHOSMET [HSDB]",
          "stdName": "PHOSMET [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "904ff128-2b78-485b-9e3f-4aa862b21ace",
            "58d3a267-197a-4861-9829-8a60cbd5eb11"
          ],
          "display_name": false
        },
        {
          "uuid": "1ba11867-f9ba-44b0-ba04-0f38ea2e9ad8",
          "name": "PHOSMET [ISO]",
          "stdName": "PHOSMET [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "904ff128-2b78-485b-9e3f-4aa862b21ace",
            "9eb5a76f-e659-4c65-8ebb-3ba2f2fb9d10"
          ],
          "display_name": false
        },
        {
          "uuid": "0d6944c8-c7dd-42a6-bd35-24df9b7fda9e",
          "name": "PHOSMET [MART.]",
          "stdName": "PHOSMET [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "65923bc6-b412-4d34-b1ab-35e2784cceaf"
          ],
          "display_name": false
        },
        {
          "uuid": "f1016b2f-c626-4ee2-a33c-51dabc05935d",
          "name": "PHOSMET [MI]",
          "stdName": "PHOSMET [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "904ff128-2b78-485b-9e3f-4aa862b21ace",
            "90e88d10-9360-4aa1-819e-c0f5df90fd2a"
          ],
          "display_name": false
        },
        {
          "uuid": "fe3f5c83-e117-45b9-88d3-35067002b662",
          "name": "S-((1,3-DIHYDRO-1,3-DIOXO-2H-ISOINDOL-2-YL)METHYL) O,O-DIMETHYL PHOSPHORODITHIOATE",
          "stdName": "S-((1,3-DIHYDRO-1,3-DIOXO-2H-ISOINDOL-2-YL)METHYL) O,O-DIMETHYL PHOSPHORODITHIOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acfbad29-b950-4f61-b4e5-6706f1c6d695",
            "448d771b-a92e-4546-bb29-b33765a62529"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a1694d73-8b1c-4ad2-9107-6ef502654284",
          "citation": "USP Dictionary 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1b654fc8-b38f-4356-8f61-f4c9b88f5f2a",
          "citation": "ACD 8.0",
          "doc_type": "ACD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0b07ed07-5a26-4b3b-bcff-3e709d794a9f",
          "citation": "usp dictionary 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "448d771b-a92e-4546-bb29-b33765a62529",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "acfbad29-b950-4f61-b4e5-6706f1c6d695",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "14514d4f-0097-4a67-b74e-6bbd585c74d9",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "65923bc6-b412-4d34-b1ab-35e2784cceaf",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "90e88d10-9360-4aa1-819e-c0f5df90fd2a",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "904ff128-2b78-485b-9e3f-4aa862b21ace",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f9003a04-fb18-41ed-aa1c-b2213107412b",
          "citation": "FDA SRS 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "58d3a267-197a-4861-9829-8a60cbd5eb11",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9eb5a76f-e659-4c65-8ebb-3ba2f2fb9d10",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ded9bfc4-3fc3-4de1-a49f-a4c5fc192211",
          "citation": "cfr",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1b4cb256-8420-48a3-86a4-4f99e98cc0e6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390166000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a0c1803f-f0a9-45db-a816-d5621cba06a7",
          "citation": "SRS import [VN04LI540Y]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=VN04LI540Y",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390166000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ea91b8a5-ac73-4e11-9eb1-1b3827ba5fd8",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "576dc8aa-eb27-431f-993c-2759d2257a06",
          "citation": "PHOSMET [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ee52d544-1925-4694-8dcb-5c19032e2d70",
          "citation": "PHOSMET [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ad8c05bd-ebbf-4c5c-82ac-4173e3118cc8",
          "citation": "PHOSMET [GREEN BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3cd37536-fe10-4f20-9bfe-9d397d4c29a3",
          "citation": "PHOSMET [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4544ab8a-593a-4558-88ef-57797320e37b",
          "citation": "PHOSMET [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f945cbae-64de-b260-2208-666bc1da7e16",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+732-11-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d06bc9c0-5219-7d2f-2c05-bd5e5a73d6b6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=732-11-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "07f829d2-7ef0-6ef4-5c5e-ac45c25e8cfe",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "61bc1f97-d002-461c-c131-79b4fc483f92",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "2536bc84-1bbc-4463-9c02-c8b17ae379b5",
          "citation": "Toxicol Appl Pharmacol 1984;72(2):236",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d2927034-5028-46fb-a5e3-40c8a4c1b0e2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "59ef84db-6a59-ebb3-dd0a-d1d8e4082c4b",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0acf2843-6e9d-4dd8-b4c7-de403831a383",
          "id": "0acf2843-6e9d-4dd8-b4c7-de403831a383",
          "molfile": "\n  Marvin  01132100492D          \n\n 19 20  0  0  0  0            999 V2000\n   -2.7536   -2.7634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6209   -2.3810    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6209   -1.5985    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6209   -0.5894    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.5487   -1.8711    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.2933   -1.4817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7253   -1.7508    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1198   -1.1099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0860   -1.1206    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6079   -0.4620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8629    0.3347    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1709   -0.7170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8967   -0.2921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6119   -0.6921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6119   -1.5171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8967   -1.9313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1780   -1.5171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6045   -1.7755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8559   -2.5616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  7  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 18  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 17  2  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\nM  END",
          "smiles": "COP(=S)(OC)SCN1C(=O)c2ccccc2C1=O",
          "formula": "C11H12NO4PS2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c63e3c38-6133-42c5-9bac-33519286b860"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "317.3236",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "33647f5b-dda9-4c7d-a0ff-fe47c119ec11",
      "version": "10",
      "structure": {
        "id": "c03ccf30-6361-4642-af32-c7370138cd4a",
        "molfile": "\n  Marvin  01132109562D          \n\n 19 20  0  0  0  0            999 V2000\n    0.1709   -0.7170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1780   -1.5171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6079   -0.4620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8967   -0.2921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6045   -1.7755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8967   -1.9313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0860   -1.1206    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8629    0.3347    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6119   -0.6921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8559   -2.5616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6119   -1.5171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1198   -1.1099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7253   -1.7508    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6209   -1.5985    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6209   -2.3810    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.5487   -1.8711    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6209   -0.5894    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7536   -2.7634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.2933   -1.4817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  3  8  2  0  0  0  0\n  4  9  2  0  0  0  0\n  5 10  2  0  0  0  0\n  6 11  2  0  0  0  0\n  7 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 14 17  2  0  0  0  0\n 15 18  1  0  0  0  0\n 16 19  1  0  0  0  0\n  5  7  1  0  0  0  0\n  9 11  1  0  0  0  0\nM  END",
        "smiles": "COP(=S)(OC)SCN1C(=O)c2ccccc2C1=O",
        "formula": "C11H12NO4PS2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "317.3236",
        "optical_activity": "NONE",
        "references": [
          "a0c1803f-f0a9-45db-a816-d5621cba06a7",
          "ea91b8a5-ac73-4e11-9eb1-1b3827ba5fd8"
        ],
        "stereo_centers": 0
      },
      "unii": "VN04LI540Y"
    }
  ]
}