{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9cd34696-555c-442e-9186-c1a99043e7ce",
          "code": "123-47-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=123-47-7",
          "code_system": "CAS",
          "references": [
            "76ee337f-4388-49b9-af7d-c6ff5506a317",
            "ebb22099-6584-414c-92e6-040f1b35e15d"
          ]
        },
        {
          "uuid": "9c7eaa45-bbe0-4fda-83e4-7fb600bfefd7",
          "code": "C74336",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C74336",
          "code_system": "NCI_THESAURUS",
          "references": [
            "76ee337f-4388-49b9-af7d-c6ff5506a317"
          ]
        },
        {
          "uuid": "443ea9c9-6d1d-4c33-8e68-615f2fa7c2cc",
          "code": "C036108",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67036108",
          "code_system": "MESH",
          "references": [
            "76ee337f-4388-49b9-af7d-c6ff5506a317"
          ]
        },
        {
          "uuid": "158975f9-de19-4abb-be6d-8b07c41ba12f",
          "code": "1550",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1550",
          "code_system": "INN",
          "references": [
            "76ee337f-4388-49b9-af7d-c6ff5506a317"
          ]
        },
        {
          "uuid": "6d794ebd-b2f3-4f75-81be-48d4a0c19314",
          "code": "204-630-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.211",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "76ee337f-4388-49b9-af7d-c6ff5506a317"
          ]
        },
        {
          "uuid": "2f64edc1-be01-47c9-b02d-6f6c214b5dc9",
          "code": "m9167",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9167?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "76ee337f-4388-49b9-af7d-c6ff5506a317"
          ]
        },
        {
          "uuid": "30f9f40b-2b0c-482c-91d8-ebc045b3efa1",
          "code": "SUB10084MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "76ee337f-4388-49b9-af7d-c6ff5506a317"
          ]
        },
        {
          "uuid": "ca5a3f2d-f60c-4070-bb4f-2e58da62bd66",
          "code": "CHEMBL1180550",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1180550",
          "code_system": "ChEMBL",
          "references": [
            "76ee337f-4388-49b9-af7d-c6ff5506a317"
          ]
        },
        {
          "uuid": "b9dce078-42e6-4aaf-a445-cc5655370b32",
          "code": "67158",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/67158",
          "code_system": "PUBCHEM",
          "references": [
            "76ee337f-4388-49b9-af7d-c6ff5506a317"
          ]
        },
        {
          "uuid": "817f67b0-7965-e039-bc4a-d2d2703746fa",
          "code": "C1505",
          "comments": "Dietary Supplement",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1505",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5f6d4509-de91-81f2-f102-bfd3ab071d6c"
          ]
        },
        {
          "uuid": "24b58a6f-ba80-4e0a-bf07-8b57393f39f2",
          "code": "VKH95UNQ6N",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8f0f4509-d9c0-e6b3-b112-762ff62a961a",
          "code": "100000081125",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "48618608-b686-230c-1a5d-66b39fe63dd7"
          ]
        },
        {
          "uuid": "58113775-2b45-f462-0679-6eb7de47c7e3",
          "code": "DTXSID201021784",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID201021784",
          "code_system": "EPA CompTox",
          "references": [
            "5f6d4509-de91-81f2-f102-bfd3ab071d6c"
          ]
        },
        {
          "uuid": "9d1c964b-f353-4212-bd7a-7b9f6ec9a1b1",
          "code": "4149",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=4149",
          "code_system": "NSC",
          "references": [
            "86dedb5c-ba16-e462-7560-1e43e1b9c750"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "1afa14fe-0d0c-46a3-8f7e-c8cf764a2fcf",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "6d6be567-add9-494a-80f3-d06cca015b79",
            "refuuid": "8367b86b-812f-4977-9684-6a62bbe3d883",
            "name": "PROLONIUM",
            "unii": "B7I54M7Z12",
            "linking_id": "B7I54M7Z12",
            "ref_pname": "PROLONIUM",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1b70d549-620b-4393-bbba-4d7cff9a0f9c",
          "name": "(2-HYDROXYTRIMETHYLENE)BIS(TRIMETHYLAMMONIUM IODIDE)",
          "stdName": "(2-HYDROXYTRIMETHYLENE)BIS(TRIMETHYLAMMONIUM IODIDE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c3eaf38c-4a11-4b14-b12a-0dc53e0de779",
            "0732d5c9-7778-48e1-8ee3-4053ee0f8e5e"
          ],
          "display_name": false
        },
        {
          "uuid": "3d8bee45-e0eb-4f4d-9fc1-7c9b32086033",
          "name": "1,3-PROPANEDIAMINIUM, 2-HYDROXY-N1,N1,N1,N3,N3,N3-HEXAMETHYL-, IODIDE (1:2)",
          "stdName": "1,3-PROPANEDIAMINIUM, 2-HYDROXY-N1,N1,N1,N3,N3,N3-HEXAMETHYL-, IODIDE (1:2)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c3eaf38c-4a11-4b14-b12a-0dc53e0de779",
            "0732d5c9-7778-48e1-8ee3-4053ee0f8e5e"
          ],
          "display_name": false
        },
        {
          "uuid": "70b047af-0a46-4c4b-83d3-489afbac112f",
          "name": "2-HYDROXYTRIMETHYLENE)BIS(TRIMETHYLAMMONIUM",
          "stdName": "2-HYDROXYTRIMETHYLENE)BIS(TRIMETHYLAMMONIUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b0cab61-350c-41ce-94d0-8b36fb856b5c"
          ],
          "display_name": false
        },
        {
          "uuid": "b06adfd4-c85e-4b44-a7b1-0897c510f897",
          "name": "ENDOJODIN",
          "stdName": "ENDOJODIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0732d5c9-7778-48e1-8ee3-4053ee0f8e5e",
            "810c43d2-638e-48a2-8747-8daaceca7684"
          ],
          "display_name": false
        },
        {
          "uuid": "99cf14b8-c8c1-4bfe-8b8d-b135f5c72690",
          "name": "HYDROXYPROPYL BISTRIMONIUM DIIODIDE",
          "stdName": "HYDROXYPROPYL BISTRIMONIUM DIIODIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "d7a8c234-0bcf-4412-bc71-548a9b244a6f",
            "0732d5c9-7778-48e1-8ee3-4053ee0f8e5e",
            "c28a610e-eb24-4d78-bd5f-1792531b0af4",
            "c768e681-9026-4baa-9782-36b9da8c73f1"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "2227c1ce-c704-4314-be9e-42b313de400b",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "aba41aa6-b63d-4bae-8156-7252bac7981e",
          "name": "IODISAN",
          "stdName": "IODISAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b0cab61-350c-41ce-94d0-8b36fb856b5c"
          ],
          "display_name": false
        },
        {
          "uuid": "ce18431c-a3ed-4a7b-bf68-f7ff80935f82",
          "name": "IODO-FLUOTHYMINA",
          "stdName": "IODO-FLUOTHYMINA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c3eaf38c-4a11-4b14-b12a-0dc53e0de779",
            "0732d5c9-7778-48e1-8ee3-4053ee0f8e5e"
          ],
          "display_name": false
        },
        {
          "uuid": "f247faf1-66ad-48f0-9b33-e4bcca02ab7c",
          "name": "IODOGENE",
          "stdName": "IODOGENE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0732d5c9-7778-48e1-8ee3-4053ee0f8e5e",
            "c28a610e-eb24-4d78-bd5f-1792531b0af4"
          ],
          "display_name": false
        },
        {
          "uuid": "f1fc1038-b602-4cdb-a8bf-8425f089d332",
          "name": "NSC-4149",
          "stdName": "NSC-4149",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0732d5c9-7778-48e1-8ee3-4053ee0f8e5e",
            "bee84703-d107-45ec-a881-5286cf531594"
          ],
          "display_name": false
        },
        {
          "uuid": "b0546406-5e07-416b-98f4-d169a216f2ad",
          "name": "PROLONIUM IODIDE",
          "stdName": "PROLONIUM IODIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e21c4922-61f4-41a3-9f60-aae8ab21bf65",
            "f6cf2b5c-6acb-4554-8551-98c71c4c01c7",
            "632a015e-f647-4ceb-9072-0eef1506c3c7",
            "caccfc18-fa07-4dd5-aae3-cc839800c840",
            "22e17de5-9284-469f-b675-82278d3e32dd",
            "0732d5c9-7778-48e1-8ee3-4053ee0f8e5e",
            "60838e68-0d55-4ac7-905d-0b1e3e1083ec",
            "9c2e9399-0f47-4fe2-9327-9dfc7296c74a",
            "76cf412e-a0bd-4894-9628-7378d6bd217e",
            "b0f65408-59b9-4bd7-8f2f-1fbf5203b399"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "a70ffe98-b2a6-42f5-a135-2db88b71c5aa",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "76a44bea-adf8-44dd-add8-06c0f157b2e8",
          "name": "PROLONIUM IODIDE [MART.]",
          "stdName": "PROLONIUM IODIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "76cf412e-a0bd-4894-9628-7378d6bd217e"
          ],
          "display_name": false
        },
        {
          "uuid": "aa0cc381-3e22-4f78-b5c1-efe6671c7c26",
          "name": "PROLONIUM IODIDE [MI]",
          "stdName": "PROLONIUM IODIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0732d5c9-7778-48e1-8ee3-4053ee0f8e5e",
            "caccfc18-fa07-4dd5-aae3-cc839800c840"
          ],
          "display_name": false
        },
        {
          "uuid": "03b8a94c-1277-4ab1-90ad-38a0059ecdff",
          "name": "PROPIODAL",
          "stdName": "PROPIODAL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b0cab61-350c-41ce-94d0-8b36fb856b5c"
          ],
          "display_name": false
        },
        {
          "uuid": "7d897dfb-78c3-2071-290c-787250cd6c62",
          "name": "Prolonium iodide [WHO-DD]",
          "stdName": "PROLONIUM IODIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6bf0690-5ad2-8288-8322-ba2905efe1db"
          ],
          "display_name": false
        },
        {
          "uuid": "89137a54-bc82-4f7f-9ebb-62236d773563",
          "name": "prolonium iodide [INN]",
          "stdName": "PROLONIUM IODIDE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "632a015e-f647-4ceb-9072-0eef1506c3c7"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4b0cab61-350c-41ce-94d0-8b36fb856b5c",
          "citation": "USP DICTIONARY 2012",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b0f65408-59b9-4bd7-8f2f-1fbf5203b399",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "632a015e-f647-4ceb-9072-0eef1506c3c7",
          "citation": "INN Proposed List 14",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL14.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "76cf412e-a0bd-4894-9628-7378d6bd217e",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "caccfc18-fa07-4dd5-aae3-cc839800c840",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0732d5c9-7778-48e1-8ee3-4053ee0f8e5e",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c28a610e-eb24-4d78-bd5f-1792531b0af4",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c3eaf38c-4a11-4b14-b12a-0dc53e0de779",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9c2e9399-0f47-4fe2-9327-9dfc7296c74a",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d7a8c234-0bcf-4412-bc71-548a9b244a6f",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "810c43d2-638e-48a2-8747-8daaceca7684",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bee84703-d107-45ec-a881-5286cf531594",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "76ee337f-4388-49b9-af7d-c6ff5506a317",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390728000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2fe00f07-a795-4978-bb79-a731b9943297",
          "citation": "SRS import [VKH95UNQ6N]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=VKH95UNQ6N",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390728000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d176b55f-6487-4c1a-b2e1-6d900390592e",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e21c4922-61f4-41a3-9f60-aae8ab21bf65",
          "citation": "PROLONIUM IODIDE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f6cf2b5c-6acb-4554-8551-98c71c4c01c7",
          "citation": "PROLONIUM IODIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "60838e68-0d55-4ac7-905d-0b1e3e1083ec",
          "citation": "PROLONIUM IODIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c768e681-9026-4baa-9782-36b9da8c73f1",
          "citation": "HYDROXYPROPYL BISTRIMONIUM DIIODIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "22e17de5-9284-469f-b675-82278d3e32dd",
          "citation": "PROLONIUM IODIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5f6d4509-de91-81f2-f102-bfd3ab071d6c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ebb22099-6584-414c-92e6-040f1b35e15d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "86dedb5c-ba16-e462-7560-1e43e1b9c750",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b6bf0690-5ad2-8288-8322-ba2905efe1db",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "48618608-b686-230c-1a5d-66b39fe63dd7",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "353af304-f61f-4e17-a046-700b142997dd",
          "id": "353af304-f61f-4e17-a046-700b142997dd",
          "molfile": "\n  Marvin  01132102502D          \n\n  1  0  0  0  0  0            999 V2000\n    7.2172   -4.0514    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "I",
          "formula": "HI",
          "atropisomerism": "No",
          "charge": 0,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "9952bf96-5461-4146-b76b-8a0eb9b271a3"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "127.9124",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "f5d79c54-d99d-4e15-a979-aa9b5079081a",
          "id": "f5d79c54-d99d-4e15-a979-aa9b5079081a",
          "molfile": "\n  Marvin  01132112452D          \n\n 12 11  0  0  0  0            999 V2000\n    1.4771   -4.2651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3384   -4.4499    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n    2.4128   -3.5248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9759   -5.2672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0457   -4.8817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7712   -4.4889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7927   -3.6668    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.4727   -4.9211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2015   -4.5287    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n    5.1307   -3.6784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0228   -4.3301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5919   -5.2513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  9  1  0  0  0  0\n 12  9  1  0  0  0  0\nM  CHG  3   2   1   7  -1   9   1\nM  END",
          "smiles": "C[N+](C)(C)CC(C[N+](C)(C)C)[O-]",
          "formula": "C9H23N2O",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c9962e4b-15a7-4650-ab43-38da49a9e4a4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "175.2921",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "39011e5a-b904-4e5b-b4e2-ede1aa616c41",
      "version": "10",
      "structure": {
        "id": "61f762da-e68e-4728-8017-833c4f5b6698",
        "molfile": "\n  Marvin  01132105052D          \n\n 14 11  0  0  0  0            999 V2000\n    2.3384   -4.4499    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    5.2015   -4.5287    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    4.4727   -4.9211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0457   -4.8817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7712   -4.4889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7927   -3.6668    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4771   -4.2651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1307   -3.6784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0228   -4.3301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5919   -5.2513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4128   -3.5248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9759   -5.2672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2172   -4.0514    0.0000 I   0  5  0  0  0  0  0  0  0  0  0  0\n    7.2172   -4.0514    0.0000 I   0  5  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  5  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  2  1  0  0  0  0\n  9  2  1  0  0  0  0\n 10  2  1  0  0  0  0\n 11  1  1  0  0  0  0\n 12  1  1  0  0  0  0\nM  CHG  4   1   1   2   1  13  -1  14  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  2  13  14\nM  SPA   1  1  13\nM  SDI   1  4    6.7972   -4.4714    6.7972   -3.6314\nM  SDI   1  4    7.6372   -3.6314    7.6372   -4.4714\nM  SMT   1 2\nM  END",
        "smiles": "C[N+](C)(C)CC(C[N+](C)(C)C)O.[I-].[I-]",
        "formula": "C9H24N2O.2I",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "430.109",
        "optical_activity": "NONE",
        "references": [
          "2fe00f07-a795-4978-bb79-a731b9943297",
          "d176b55f-6487-4c1a-b2e1-6d900390592e",
          "632a015e-f647-4ceb-9072-0eef1506c3c7"
        ],
        "stereo_centers": 0
      },
      "unii": "VKH95UNQ6N"
    }
  ]
}