{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "cfd56350-9761-4e92-ad0d-99f0740d32f3", "code": "133825-80-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=133825-80-6", "code_system": "CAS", "references": [ "4543b894-b521-1a3a-7219-3652f313e686", "c4fac8e4-3b54-4a7f-8756-11e53dc52b26" ] }, { "uuid": "2ae33d91-eaec-41f6-94c3-7d0a1973780a", "code": "131679", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/131679", "code_system": "PUBCHEM", "references": [ "c29fa91f-f108-4e21-bbee-265d6a0f10dc" ] }, { "uuid": "c262e0fc-c0a3-4e9f-9dc0-78312627a1b1", "code": "10892", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=10892", "code_system": "INN", "references": [ "4543b894-b521-1a3a-7219-3652f313e686" ] }, { "uuid": "c8e9f8b3-bb08-48fe-b59e-ef7eaf0b3b69", "code": "VK9OS8R205", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "939b61fa-07d1-048e-e8d5-79e1eaa0ad13", "code": "C170216", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C170216", "code_system": "NCI_THESAURUS", "references": [ "c69f00e7-71a0-eff0-afb5-922edd83cc20" ] }, { "uuid": "0e638f3f-3e9e-c7fb-87dd-8c6b01ba6b8f", "code": "EF-118", "type": "PRIMARY", "url": "https://searchusan.ama-assn.org/finder/usan/search/EF-118/relevant/1/", "code_system": "USAN", "references": [ "71ecdb49-aeb1-e143-96d2-0e477159fa3b" ] }, { "uuid": "b7403438-1511-6d8e-7cd1-78fe61ec8cd4", "code": "100000177353", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "6365b6b6-4f9f-0e4d-6d4d-dcc61474e567" ] }, { "uuid": "3e5ee88f-01e7-8f81-f126-3b9b9fb34229", "code": "DTXSID10928286", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10928286", "code_system": "EPA CompTox", "references": [ "c69f00e7-71a0-eff0-afb5-922edd83cc20" ] }, { "uuid": "aa33e292-c103-dfde-2c25-c4f254a96c11", "code": "497315", "comments": "ORPHAN DRUG|Designated/Withdrawn|Treatment of congenital adrenal hyperplasia", "codeText": "ORPHAN DRUG|Designated/Withdrawn|Treatment of congenital adrenal hyperplasia", "type": "PRIMARY", "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=497315", "code_system": "FDA ORPHAN DRUG" } ], "relationships": [ { "uuid": "f4fa638e-3e3e-46a2-8221-738421420127", "amount": { "uuid": "8fa17c13-019f-43c5-9f43-78ad50405f91" }, "type": "ACTIVE MOIETY", "references": [ "4543b894-b521-1a3a-7219-3652f313e686" ], "related_substance": { "uuid": "34fe7693-a4e8-4b09-b184-46d74af1bcd9", "refuuid": "8062cccb-4192-4367-9724-ae38df934cfa", "name": "NEVANIMIBE", "unii": "VK9OS8R205", "linking_id": "VK9OS8R205", "ref_pname": "NEVANIMIBE", "substance_class": "reference" } }, { "uuid": "a0ea8afa-c7b4-4607-a5ea-61992d6efe53", "amount": { "uuid": "841a8a24-4f1e-4623-985c-65cb8deeeb22" }, "type": "SALT/SOLVATE->PARENT", "references": [ "4543b894-b521-1a3a-7219-3652f313e686" ], "related_substance": { "uuid": "fdd0567d-34aa-4467-ab92-cb0d243982d7", "refuuid": "9d443083-1f68-4654-b928-211ddb96c9b8", "name": "NEVANIMIBE HYDROCHLORIDE", "unii": "TK694ZFS57", "linking_id": "TK694ZFS57", "ref_pname": "NEVANIMIBE HYDROCHLORIDE", "substance_class": "reference" } }, { "uuid": "0847c0db-3b13-4630-86a8-b67858a60438", "amount": { "uuid": "0b37e742-3617-4db4-91d3-e57442123d46" }, "type": "INHIBITOR->TARGET", "references": [ "c4fac8e4-3b54-4a7f-8756-11e53dc52b26" ], "related_substance": { "uuid": "0cd82998-ad64-473a-8c54-0a9e2442a63e", "refuuid": "6997cea9-8a28-4a33-abd5-8983c29d78dd", "name": "Sterol O-acyltransferase 1", "unii": "ZX7XK4NS7A", "linking_id": "ZX7XK4NS7A", "ref_pname": "Sterol O-acyltransferase 1", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "346e6721-9862-4187-9465-aa5f71648c32", "name": "ATR-101 FREE BASE", "stdName": "ATR-101 FREE BASE", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "86a9c5bc-3d43-4a86-bdf7-f14eb9ad128a" ], "display_name": false }, { "uuid": "b4c6ef83-8852-201e-0d49-259592a9fe06", "name": "N-(2,6-BIS(PROPAN-2-YL)PHENYL)-N'-((1-(4-(DIMETHYLAMINO)PHENYL) CYCLOPENTYL)METHYL)UREA", "stdName": "N-(2,6-BIS(PROPAN-2-YL)PHENYL)-N'-((1-(4-(DIMETHYLAMINO)PHENYL) CYCLOPENTYL)METHYL)UREA", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4543b894-b521-1a3a-7219-3652f313e686" ], "display_name": false }, { "uuid": "37e7cc5b-1df9-5e51-0ab6-f875ed13cdbe", "name": "NEVANIMIBE", "stdName": "NEVANIMIBE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "4543b894-b521-1a3a-7219-3652f313e686" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "2c0b5adf-d8db-435e-9e31-fbc802d63d3f", "name_org": "USAN" }, { "uuid": "aedba8f8-b251-4128-93e7-fdb0d24fb858", "name_org": "INN" } ] }, { "uuid": "aa35696c-a4a9-eeba-1bfa-8bb89a77fb55", "name": "NEVANIMIBE [USAN]", "stdName": "NEVANIMIBE [USAN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4543b894-b521-1a3a-7219-3652f313e686" ], "display_name": false }, { "uuid": "13602065-c1d1-4a5f-ab30-8568e2ae7718", "name": "PD 132301", "stdName": "PD 132301", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "4543b894-b521-1a3a-7219-3652f313e686" ], "display_name": false }, { "uuid": "389f1027-98ba-40b1-8ed5-20a01a9e2ef2", "name": "PD-132301", "stdName": "PD-132301", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "4543b894-b521-1a3a-7219-3652f313e686" ], "display_name": false }, { "uuid": "7e8eedb2-d34e-46f9-b775-e586717c572b", "name": "UREA, N-(2,6-BIS(1-METHYLETHYL)PHENYL)-N'-((1-(4-(DIMETHYLAMINO)PHENYL)CYCLOPENTYL)METHYL)-", "stdName": "UREA, N-(2,6-BIS(1-METHYLETHYL)PHENYL)-N'-((1-(4-(DIMETHYLAMINO)PHENYL)CYCLOPENTYL)METHYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4543b894-b521-1a3a-7219-3652f313e686" ], "display_name": false }, { "uuid": "e6cc6acc-8c04-d15f-3c1e-a19132ad81db", "name": "nevanimibe [INN]", "stdName": "NEVANIMIBE [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "92c7188c-3010-c1de-5340-d9d659c2e3ff" ], "display_name": false } ], "references": [ { "uuid": "94c8d3fb-eb98-49da-a293-d5519cd01a26", "citation": "ORPHAN DRUG", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "e7d6afc4-baba-44ca-9123-c59464993f09", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "86a9c5bc-3d43-4a86-bdf7-f14eb9ad128a", "citation": "http://www.medkoo.com/products/5263", "url": "http://www.medkoo.com/products/5263", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c29fa91f-f108-4e21-bbee-265d6a0f10dc", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391659000, "tags": [ "NOMEN" ] }, { "uuid": "32825d2c-be9b-4223-ae17-7aa0a5eccf78", "citation": "SRS import [VK9OS8R205]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=VK9OS8R205", "doc_type": "SRS", "public_domain": true, "document_date": 1493391659000, "tags": [ "NOMEN" ] }, { "uuid": "4543b894-b521-1a3a-7219-3652f313e686", "citation": "USAN COUN NOV 2017", "doc_type": "USANCOUN", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] }, { "uuid": "92c7188c-3010-c1de-5340-d9d659c2e3ff", "citation": "INN Proposed List 119", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL119.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "71ecdb49-aeb1-e143-96d2-0e477159fa3b", "citation": "USAD COUN", "doc_type": "USANCOUN", "public_domain": true }, { "uuid": "c69f00e7-71a0-eff0-afb5-922edd83cc20", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "c4fac8e4-3b54-4a7f-8756-11e53dc52b26", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "008f49d3-d9cb-e2b6-0201-1bc7b1f68531", "citation": "USAN", "doc_type": "USANCOUN", "public_domain": true }, { "uuid": "6365b6b6-4f9f-0e4d-6d4d-dcc61474e567", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "33d9cd93-5096-4474-9c3a-5ca6ead8b23d", "id": "33d9cd93-5096-4474-9c3a-5ca6ead8b23d", "molfile": "\n Marvin 01132102462D \n\n 31 33 0 0 0 0 999 V2000\n 4.6740 -3.0687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3885 -2.6563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1030 -3.0687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3885 -1.8312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1030 -1.4187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1030 -0.5937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3885 -0.1812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6740 -0.5937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2113 -0.0553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2953 0.7697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4549 0.0359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6740 -1.4187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9595 -1.8312 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2450 -1.4187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2450 -0.6357 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5306 -1.8312 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5306 -2.6563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8161 -3.0687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2030 -3.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4885 -3.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6600 -2.4013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4805 -2.3151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3010 -3.7362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1215 -3.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6064 -4.3174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2708 -5.0711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4504 -5.1574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9654 -4.4899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7558 -5.7385 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4202 -6.4922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5762 -5.6523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 2 1 0 0 0 0\n 5 4 1 0 0 0 0\n 12 4 2 0 0 0 0\n 6 5 2 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 2 0 0 0 0\n 8 9 1 0 0 0 0\n 12 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 14 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 22 1 0 0 0 0\n 18 23 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 28 2 0 0 0 0\n 24 25 2 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 2 0 0 0 0\n 26 29 1 0 0 0 0\n 27 28 1 0 0 0 0\n 29 30 1 0 0 0 0\n 29 31 1 0 0 0 0\nM END", "smiles": "CC(C)c1cccc(C(C)C)c1NC(=O)NCC2(CCCC2)c3ccc(cc3)N(C)C", "formula": "C27H39N3O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "23273396-fce1-4f67-a957-da575cd30fe1" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "421.6191", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "8062cccb-4192-4367-9724-ae38df934cfa", "version": "19", "structure": { "id": "a78b622a-5e80-43b5-b853-eebaf03566d5", "molfile": "\n Marvin 01132108422D \n\n 31 33 0 0 0 0 999 V2000\n 17.3735 -3.4259 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6591 -3.0134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6591 -2.2304 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9447 -3.4259 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9447 -4.2510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2302 -4.6634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6171 -5.2155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9026 -4.8030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0741 -3.9960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8946 -3.9098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7151 -5.3309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5356 -5.2447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0205 -5.9121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6849 -6.6658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8644 -6.7520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3795 -6.0845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1699 -7.3332 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8343 -8.0869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.9903 -7.2469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0880 -3.0134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0880 -2.1884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8025 -1.7759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5170 -2.1884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5170 -3.0134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8025 -3.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8025 -4.2510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0880 -4.6634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5170 -4.6634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6254 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7094 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8690 -1.5588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 6 10 1 0 0 0 0\n 6 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 11 16 2 0 0 0 0\n 14 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 1 0 0 0 0\n 1 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 2 0 0 0 0\n 24 25 1 0 0 0 0\n 20 25 2 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 26 28 1 0 0 0 0\n 21 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 29 31 1 0 0 0 0\nM END", "smiles": "CC(C)c1cccc(C(C)C)c1NC(=O)NCC2(CCCC2)c3ccc(cc3)N(C)C", "formula": "C27H39N3O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "421.6191", "optical_activity": "NONE", "references": [ "e7d6afc4-baba-44ca-9123-c59464993f09", "4543b894-b521-1a3a-7219-3652f313e686", "92c7188c-3010-c1de-5340-d9d659c2e3ff" ], "stereo_centers": 0 }, "unii": "VK9OS8R205" } ] }