{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d36d53a4-9c4d-48dd-a9da-284cd7cb4905",
          "code": "165450-17-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=165450-17-9",
          "code_system": "CAS",
          "references": [
            "4db0044c-e0e7-4265-8a7e-065892efef88",
            "f7704d57-3c87-4ed2-b185-1e7ede15ff4c"
          ]
        },
        {
          "uuid": "d7029c2d-abff-40b4-a60b-ac13eebb8a5b",
          "code": "C81625",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C81625",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4db0044c-e0e7-4265-8a7e-065892efef88"
          ]
        },
        {
          "uuid": "6dcf3304-e31c-4236-b1f6-3dba882ef879",
          "code": "21 CFR 172.829",
          "comments": "PART 172 -- FOOD ADDITIVES PERMITTED FOR DIRECT ADDITION TO FOOD FOR HUMAN CONSUMPTION|Subpart I--Multipurpose Additives|Sec. 172.829 Neotame.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=172.829",
          "code_system": "CFR",
          "references": [
            "4db0044c-e0e7-4265-8a7e-065892efef88"
          ]
        },
        {
          "uuid": "2801ce6a-854d-42d5-ab86-51a5b36ac2ab",
          "code": "NEOTAME",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Neotame",
          "code_system": "WIKIPEDIA",
          "references": [
            "4db0044c-e0e7-4265-8a7e-065892efef88"
          ]
        },
        {
          "uuid": "185a1468-8993-489a-9165-5783fe68c01d",
          "code": "INS-961",
          "comments": "Codex Alimentarius|Functional Classification|Flavour enhancer|Sweetener",
          "type": "PRIMARY",
          "url": "http://www.fao.org/gsfaonline/additives/details.html?id=340",
          "code_system": "CODEX ALIMENTARIUS (GSFA)",
          "references": [
            "4db0044c-e0e7-4265-8a7e-065892efef88"
          ]
        },
        {
          "uuid": "3cb96ac7-4741-4a2c-90ba-ef6aa7ebeb38",
          "code": "INS-961",
          "comments": "JECFA|Functional Classification|Flavour enhancer|Sweetener",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemINS=961",
          "code_system": "JECFA EVALUATION",
          "references": [
            "4db0044c-e0e7-4265-8a7e-065892efef88"
          ]
        },
        {
          "uuid": "e0df0c35-1924-43b0-8e84-64bdc3f24f3a",
          "code": "1367111",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1367111/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "4db0044c-e0e7-4265-8a7e-065892efef88"
          ]
        },
        {
          "uuid": "750335c6-d8ca-4211-bdfc-a916cb6016c4",
          "code": "m7820",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7820?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "4db0044c-e0e7-4265-8a7e-065892efef88"
          ]
        },
        {
          "uuid": "1d549e82-f406-43b4-b227-aa9a7ca93ba2",
          "code": "SUB119863",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "4db0044c-e0e7-4265-8a7e-065892efef88"
          ]
        },
        {
          "uuid": "8b3ece34-8f4c-4694-ae8e-0a241c932165",
          "code": "9810996",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9810996",
          "code_system": "PUBCHEM",
          "references": [
            "4db0044c-e0e7-4265-8a7e-065892efef88"
          ]
        },
        {
          "uuid": "aa00e52f-38ea-bed9-df23-c4098a1553da",
          "code": "7965",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7965",
          "code_system": "HSDB",
          "references": [
            "d6d12dc4-fd9d-bcea-e98f-8265817c83ec"
          ]
        },
        {
          "uuid": "46d7bb49-9479-e181-e867-bc5e50003e80",
          "code": "DTXSID50167950",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50167950",
          "code_system": "EPA CompTox",
          "references": [
            "dd68a127-acf9-8d1e-6d16-a89d87adf761"
          ]
        },
        {
          "uuid": "3e1d64fd-9de1-0535-af09-4825460de242",
          "code": "C283",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Artificial Sweetener",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C283",
          "code_system": "NCI_THESAURUS",
          "references": [
            "43a6ebba-d86c-8ce5-1cc3-1df5969ff808"
          ]
        },
        {
          "uuid": "46c37da7-eb83-4c77-b8ff-cd0451475e83",
          "code": "VJ597D52EX",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "297d25bf-6aac-e8e4-5e09-7a497708e8c1",
          "code": "1460204",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1460204",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "43a6ebba-d86c-8ce5-1cc3-1df5969ff808"
          ]
        },
        {
          "uuid": "74c4bd4d-bcf4-2b73-3610-4c5b09d64ad1",
          "code": "VJ597D52EX",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=VJ597D52EX",
          "code_system": "DAILYMED",
          "references": [
            "2f265c44-e4d0-cc5d-c83b-43efad953963"
          ]
        },
        {
          "uuid": "72308336-a892-b793-bc38-bc4930e09bd0",
          "code": "100000143306",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "d7775433-b648-0044-6e85-c76c3fba0bbc"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "b31f88dd-1d93-482b-9acc-781235580b95",
          "amount": {
            "uuid": "1e793899-0d16-4040-a4df-a18511dcfa6b"
          },
          "type": "TARGET->AGONIST",
          "references": [
            "41ce0823-6a5b-4977-800e-31756c72ac06"
          ],
          "related_substance": {
            "uuid": "dbe48419-7f9f-4196-91cf-51c0fc298175",
            "refuuid": "a5011326-e476-413d-a2bb-ba7e00e5e863",
            "name": "TASTE RECEPTOR TYPE 1 MEMBER 2",
            "unii": "5MI7P9AI4A",
            "linking_id": "5MI7P9AI4A",
            "ref_pname": "TASTE RECEPTOR TYPE 1 MEMBER 2",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "48145dca-eeae-4004-b5ec-76581a9cfda2",
          "name": "E 961",
          "stdName": "E 961",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "efc7b6fe-366e-470b-9dc8-caf7022b8540",
            "12554ebf-88de-411f-9823-66106927af1b"
          ],
          "display_name": false
        },
        {
          "uuid": "f6400732-4b41-4994-bf8d-d6c28504f725",
          "name": "E-961",
          "stdName": "E-961",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa32dacf-fd21-4af6-96e1-17f01dfe59d7",
            "12554ebf-88de-411f-9823-66106927af1b"
          ],
          "display_name": false
        },
        {
          "uuid": "a205a845-3be6-408c-873f-4cca8cca137a",
          "name": "INS NO.961",
          "stdName": "INS NO.961",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa32dacf-fd21-4af6-96e1-17f01dfe59d7",
            "12554ebf-88de-411f-9823-66106927af1b"
          ],
          "display_name": false
        },
        {
          "uuid": "73901b0e-2f04-443f-8789-5b8201827bf0",
          "name": "INS-961",
          "stdName": "INS-961",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa32dacf-fd21-4af6-96e1-17f01dfe59d7",
            "12554ebf-88de-411f-9823-66106927af1b"
          ],
          "display_name": false
        },
        {
          "uuid": "b883a954-6458-43a8-967d-4aa4aa3dd239",
          "name": "L-PHENYLALANINE, N-(N-(3,3-DIMETHYLBUTYL)-L-.ALPHA.-ASPARTYL)-1-METHYL ESTER",
          "stdName": "L-PHENYLALANINE, N-(N-(3,3-DIMETHYLBUTYL)-L-.ALPHA.-ASPARTYL)-1-METHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cf396674-6cb2-41de-923f-c2a50700d914"
          ],
          "display_name": false
        },
        {
          "uuid": "d7445a9b-b52c-4b89-b1d8-393d6bf77ff0",
          "name": "MIRASEE 200",
          "stdName": "MIRASEE 200",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "efc7b6fe-366e-470b-9dc8-caf7022b8540",
            "12554ebf-88de-411f-9823-66106927af1b"
          ],
          "display_name": false
        },
        {
          "uuid": "3762b02b-e99a-4ae8-9515-2f1371e46212",
          "name": "N-(N-(3,3-DIMETHYLBUTYL)-L-.ALPHA.-ASPARTYL)-L-PHENYLALANINE 1-METHYL ESTER",
          "stdName": "N-(N-(3,3-DIMETHYLBUTYL)-L-.ALPHA.-ASPARTYL)-L-PHENYLALANINE 1-METHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cf396674-6cb2-41de-923f-c2a50700d914"
          ],
          "display_name": false
        },
        {
          "uuid": "4b7dc6de-9027-4e45-90f4-fd584d91c351",
          "name": "NC-00723",
          "stdName": "NC-00723",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa64dea0-0de3-4540-a50e-c2c7862083df",
            "12554ebf-88de-411f-9823-66106927af1b"
          ],
          "display_name": false
        },
        {
          "uuid": "8f5a1bb8-91ed-4b79-93e3-f40a98f0b1df",
          "name": "NEOTAME",
          "stdName": "NEOTAME",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08e1853a-0b4a-4795-8e7a-c943734b5986",
            "d2039960-6a92-4edc-a51d-60965b6b2457",
            "b5880ca2-973b-4161-a14e-9e3191d84510",
            "f084c4d6-e2ae-4ffa-972b-a24d692fbc87",
            "177a5cf8-e062-476a-b635-7100822f32b3",
            "d7c9f413-1326-4e99-ae37-e817c91697b7",
            "4edb68cd-cdfa-43dc-bb32-8cc841bb073e",
            "85a75c2f-bfc5-477a-836e-8f76ddf3f8c0",
            "8b6db6cd-316e-435e-ac88-03770d1447be",
            "405dd585-30d8-4cd1-bbec-97e23ae87909",
            "9ced74bf-21be-4513-b362-69d239236ebf",
            "cf396674-6cb2-41de-923f-c2a50700d914",
            "12554ebf-88de-411f-9823-66106927af1b"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b05409b4-fef5-44db-8c04-127afe12b39b",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "e5834a02-ed67-4dcb-9adb-2efecaf2b32d",
          "name": "NEOTAME [FCC]",
          "stdName": "NEOTAME [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2039960-6a92-4edc-a51d-60965b6b2457",
            "12554ebf-88de-411f-9823-66106927af1b"
          ],
          "display_name": false
        },
        {
          "uuid": "30e47236-375b-4ab0-9ea0-b01693b42650",
          "name": "NEOTAME [FHFI]",
          "stdName": "NEOTAME [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "177a5cf8-e062-476a-b635-7100822f32b3",
            "12554ebf-88de-411f-9823-66106927af1b"
          ],
          "display_name": false
        },
        {
          "uuid": "ccae0297-9e8e-4f85-8690-443bce809f75",
          "name": "NEOTAME [II]",
          "stdName": "NEOTAME [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cf396674-6cb2-41de-923f-c2a50700d914"
          ],
          "display_name": false
        },
        {
          "uuid": "b4afcf41-b267-45e3-a396-d6027a73a719",
          "name": "NEOTAME [MART.]",
          "stdName": "NEOTAME [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b5880ca2-973b-4161-a14e-9e3191d84510"
          ],
          "display_name": false
        },
        {
          "uuid": "b1f74668-0f38-4c38-a9a0-074323da44e3",
          "name": "NEOTAME [MI]",
          "stdName": "NEOTAME [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "85a75c2f-bfc5-477a-836e-8f76ddf3f8c0",
            "12554ebf-88de-411f-9823-66106927af1b"
          ],
          "display_name": false
        },
        {
          "uuid": "74cca98f-2a49-2b92-5d7b-6deb4362c560",
          "name": "NEOTAME [USP-RS]",
          "stdName": "NEOTAME [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa7fcffd-e901-05f1-d961-24f51f81b18f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "cf396674-6cb2-41de-923f-c2a50700d914",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b5880ca2-973b-4161-a14e-9e3191d84510",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "85a75c2f-bfc5-477a-836e-8f76ddf3f8c0",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "12554ebf-88de-411f-9823-66106927af1b",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "177a5cf8-e062-476a-b635-7100822f32b3",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d2039960-6a92-4edc-a51d-60965b6b2457",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "08e1853a-0b4a-4795-8e7a-c943734b5986",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa64dea0-0de3-4540-a50e-c2c7862083df",
          "citation": "http://www.fda.gov/ohrms/dockets/dailys/01/jan01/011101/c000005.pdf",
          "url": "http://www.fda.gov/ohrms/dockets/dailys/01/jan01/011101/c000005.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fa32dacf-fd21-4af6-96e1-17f01dfe59d7",
          "citation": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=340",
          "url": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=340",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "efc7b6fe-366e-470b-9dc8-caf7022b8540",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4db0044c-e0e7-4265-8a7e-065892efef88",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390761000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dcc2d947-9be5-47dc-9dd5-07e1af5265b8",
          "citation": "SRS import [VJ597D52EX]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=VJ597D52EX",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390761000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8b6db6cd-316e-435e-ac88-03770d1447be",
          "citation": "NEOTAME [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f084c4d6-e2ae-4ffa-972b-a24d692fbc87",
          "citation": "NEOTAME [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "405dd585-30d8-4cd1-bbec-97e23ae87909",
          "citation": "NEOTAME [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d7c9f413-1326-4e99-ae37-e817c91697b7",
          "citation": "NEOTAME [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4edb68cd-cdfa-43dc-bb32-8cc841bb073e",
          "citation": "NEOTAME [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9ced74bf-21be-4513-b362-69d239236ebf",
          "citation": "NEOTAME [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d6d12dc4-fd9d-bcea-e98f-8265817c83ec",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+165450-17-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dd68a127-acf9-8d1e-6d16-a89d87adf761",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=165450-17-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "43a6ebba-d86c-8ce5-1cc3-1df5969ff808",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "aa7fcffd-e901-05f1-d961-24f51f81b18f",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "f7704d57-3c87-4ed2-b185-1e7ede15ff4c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2f265c44-e4d0-cc5d-c83b-43efad953963",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "d7775433-b648-0044-6e85-c76c3fba0bbc",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "41ce0823-6a5b-4977-800e-31756c72ac06",
          "citation": "Olfaction & Taste M. Max, W. Meyerhof, in The Senses: A Comprehensive Reference, 2008",
          "url": "https://www.sciencedirect.com/topics/neuroscience/neotame",
          "doc_type": "BOOK",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1e5ef411-eb4b-4118-8f18-4fc9f01d9466",
          "id": "1e5ef411-eb4b-4118-8f18-4fc9f01d9466",
          "molfile": "\n  Marvin  01132101442D          \n\n 27 27  0  0  1  0            999 V2000\n    3.5480   -1.2421    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    3.5479   -2.0663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2640   -2.4783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2640   -3.3025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9770   -2.0633    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8319   -0.8329    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1189   -1.2479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4028   -0.8387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6898   -1.2538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0263   -0.8446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2747   -1.9669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1047   -1.9669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2610   -0.8271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2552    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9771   -1.2362    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6902   -0.8212    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.6843    0.0088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3974    0.4237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1129    0.0107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8255    0.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8231    1.2510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1022    1.6609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3925    1.2442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4062   -1.2304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4033   -2.0575    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1193   -0.8154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8353   -1.2245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  6  1  6  0  0  0\n  1 13  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n 16 15  1  1  0  0  0\n 16 17  1  0  0  0  0\n 16 24  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 23 18  2  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 24 25  2  0  0  0  0\n 24 26  1  0  0  0  0\n 26 27  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)CCN[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1ccccc1)C(=O)OC",
          "formula": "C20H30N2O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c3f7b5ed-44b9-4c54-b30b-8b4205389aaa"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "378.4634",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ac9c4051-b142-4464-89ed-337d019de7cc",
      "version": "17",
      "structure": {
        "id": "0facb952-4898-4b56-abc3-f91feb25f320",
        "molfile": "\n  Marvin  01132101032D          \n\n 27 27  0  0  1  0            999 V2000\n   -0.0263   -0.8446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6898   -1.2538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4028   -0.8387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1189   -1.2479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8319   -0.8329    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5480   -1.2421    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.2610   -0.8271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9771   -1.2362    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6902   -0.8212    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.4062   -1.2304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1193   -0.8154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8353   -1.2245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2747   -1.9669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1047   -1.9669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5479   -2.0663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2640   -2.4783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2640   -3.3025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9770   -2.0633    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4033   -2.0575    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2552    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6843    0.0088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3974    0.4237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1129    0.0107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8255    0.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8231    1.2510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1022    1.6609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3925    1.2442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2 14  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 15  1  6  0  0  0\n  3  4  1  0  0  0  0\n 15 16  1  0  0  0  0\n  7  8  1  0  0  0  0\n 16 17  2  0  0  0  0\n  8  9  1  0  0  0  0\n 16 18  1  0  0  0  0\n  4  5  1  0  0  0  0\n 10 19  2  0  0  0  0\n  9 10  1  0  0  0  0\n  7 20  2  0  0  0  0\n  2  3  1  0  0  0  0\n  9 21  1  1  0  0  0\n 10 11  1  0  0  0  0\n 21 22  1  0  0  0  0\n  5  6  1  0  0  0  0\n 22 23  2  0  0  0  0\n 11 12  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  2  0  0  0  0\n  2 13  1  0  0  0  0\n 25 26  1  0  0  0  0\n  1  2  1  0  0  0  0\n 26 27  2  0  0  0  0\n 27 22  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)CCN[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1ccccc1)C(=O)OC",
        "formula": "C20H30N2O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "378.4634",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "dcc2d947-9be5-47dc-9dd5-07e1af5265b8",
          "cf396674-6cb2-41de-923f-c2a50700d914"
        ],
        "stereo_centers": 2
      },
      "unii": "VJ597D52EX"
    }
  ]
}