{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a16af263-5748-4c02-bb10-60179627d6d1",
          "code": "H02AB05",
          "comments": "ATC|SYSTEMIC HORMONAL PREPARATIONS, EXCL. SEX HORMONES AND INSULINS|CORTICOSTEROIDS FOR SYSTEMIC USE|CORTICOSTEROIDS FOR SYSTEMIC USE, PLAIN|Glucocorticoids|paramethasone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=H02AB05&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "713dd9f6-6beb-4e21-87ab-b3926cdedae7"
          ]
        },
        {
          "uuid": "4dd4b9be-3d1c-451c-b02e-ed91110b04e3",
          "code": "QH02AB05",
          "comments": "VATC|CORTICOSTEROIDS FOR SYSTEMIC USE|CORTICOSTEROIDS FOR SYSTEMIC USE, PLAIN|Glucocorticoids|paramethasone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QH02AB05&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "713dd9f6-6beb-4e21-87ab-b3926cdedae7"
          ]
        },
        {
          "uuid": "f2ac9a19-dbaf-4e10-a7f3-85ea8ad15080",
          "code": "53-33-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=53-33-8",
          "code_system": "CAS",
          "references": [
            "713dd9f6-6beb-4e21-87ab-b3926cdedae7",
            "629480fa-719e-4dc7-aefd-bf1b7dc4eb05"
          ]
        },
        {
          "uuid": "6e30c837-631d-4db2-9227-c4e15169bcb1",
          "code": "D010248",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68010248",
          "code_system": "MESH",
          "references": [
            "713dd9f6-6beb-4e21-87ab-b3926cdedae7"
          ]
        },
        {
          "uuid": "82bafffd-b233-40bd-b6e0-c01aed309c2f",
          "code": "PARAMETHASONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Paramethasone",
          "code_system": "WIKIPEDIA",
          "references": [
            "713dd9f6-6beb-4e21-87ab-b3926cdedae7"
          ]
        },
        {
          "uuid": "e07e85b7-2094-4a5a-95b6-d1c4572688e3",
          "code": "1096",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1096",
          "code_system": "INN",
          "references": [
            "713dd9f6-6beb-4e21-87ab-b3926cdedae7"
          ]
        },
        {
          "uuid": "b7a5f745-42f8-4b05-9b1a-dd758105e19e",
          "code": "200-169-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.155",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "713dd9f6-6beb-4e21-87ab-b3926cdedae7"
          ]
        },
        {
          "uuid": "0a08aa72-eaca-4051-acef-5b6bda062ade",
          "code": "C66309",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C66309",
          "code_system": "NCI_THESAURUS",
          "references": [
            "713dd9f6-6beb-4e21-87ab-b3926cdedae7"
          ]
        },
        {
          "uuid": "a5b0874c-85cb-4aeb-973b-8498d439270f",
          "code": "7910",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/7910/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "713dd9f6-6beb-4e21-87ab-b3926cdedae7"
          ]
        },
        {
          "uuid": "23f8ce63-d990-45ff-8877-31e52d44161b",
          "code": "m8403",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8403?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "713dd9f6-6beb-4e21-87ab-b3926cdedae7"
          ]
        },
        {
          "uuid": "50a19ced-0957-4fe7-aca5-18268afb751f",
          "code": "DB01384",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01384",
          "code_system": "DRUG BANK",
          "references": [
            "713dd9f6-6beb-4e21-87ab-b3926cdedae7"
          ]
        },
        {
          "uuid": "68f0d35b-0953-436a-b468-81e570b87564",
          "code": "SUB09614MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "713dd9f6-6beb-4e21-87ab-b3926cdedae7"
          ]
        },
        {
          "uuid": "9847f0a8-2992-400e-93f4-d65e62c1103d",
          "code": "CHEMBL1200342",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1200342",
          "code_system": "ChEMBL",
          "references": [
            "713dd9f6-6beb-4e21-87ab-b3926cdedae7"
          ]
        },
        {
          "uuid": "856ccad2-afbb-4c30-873f-d58aa5135f27",
          "code": "5875",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5875",
          "code_system": "PUBCHEM",
          "references": [
            "713dd9f6-6beb-4e21-87ab-b3926cdedae7"
          ]
        },
        {
          "uuid": "bdb6ed5a-3885-7617-279e-7c1911803ae6",
          "code": "3376",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3376",
          "code_system": "HSDB",
          "references": [
            "77fcee5f-c506-d451-fff1-c1e46ed72f35"
          ]
        },
        {
          "uuid": "9abde6d7-8849-4265-3947-fbd7cb1759ae",
          "code": "DTXSID3023421",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3023421",
          "code_system": "EPA CompTox",
          "references": [
            "1e4bfba5-95eb-5116-65d6-5e1390387067"
          ]
        },
        {
          "uuid": "8f4cae6b-1a80-70d2-48c2-bf04d8d2a7a6",
          "code": "C521",
          "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Therapeutic Hormone[C548]|Therapeutic Steroid Hormone[C1636]|Adrenal Agent[C2364]|Therapeutic Corticosteroid[C211]|Therapeutic Glucocorticoid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C521",
          "code_system": "NCI_THESAURUS",
          "references": [
            "97031bad-81b5-dec7-6262-1630d751d414"
          ]
        },
        {
          "uuid": "602089a7-a139-4092-9305-8b32547ed14b",
          "code": "VFC6ZX3584",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5119d9af-8eda-410e-344b-e9424c6c5dde",
          "code": "100000082771",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "1d465c35-5768-7ec1-6979-ba1c3a088ed9"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "8bba2e7d-b706-44ff-93f8-bd7bb1a45318",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "d7062af9-b9f4-47ab-aa66-52784631cdf4",
            "refuuid": "06dae634-2566-4002-9c1d-e7076abc94c8",
            "name": "PARAMETHASONE",
            "unii": "VFC6ZX3584",
            "linking_id": "VFC6ZX3584",
            "ref_pname": "PARAMETHASONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "96125073-7ad0-4ce2-aaf2-f7c1a6e0a1a4",
          "type": "TARGET->AGONIST",
          "references": [
            "985fb5cc-975a-494d-a478-b26bd215fed9"
          ],
          "related_substance": {
            "uuid": "a64a9c24-635d-4856-9e74-ce10f7485f39",
            "refuuid": "78c1008d-c95f-4462-be19-f9612c97b55f",
            "name": "GLUCOCORTICOID RECEPTOR",
            "unii": "FZW85LW99M",
            "linking_id": "FZW85LW99M",
            "ref_pname": "GLUCOCORTICOID RECEPTOR"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "302cdca0-3d4b-4d59-ad6d-0cfebb9f4157",
          "name": "(6.ALPHA.,11.BETA.,16.ALPHA.)-6-FLUORO-11,17,21-TRIHYDROXY-16-METHYLPREGNA-1,4-DIENE-3,20-DIONE",
          "stdName": "(6.ALPHA.,11.BETA.,16.ALPHA.)-6-FLUORO-11,17,21-TRIHYDROXY-16-METHYLPREGNA-1,4-DIENE-3,20-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3881d8bd-6ec7-42dd-a3d0-e4fe6cc71ca9"
          ],
          "display_name": false
        },
        {
          "uuid": "49b37cf9-3113-447a-9da4-03d79746474a",
          "name": "DILLAR",
          "stdName": "DILLAR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35f76d73-5a10-49ec-9d3a-dd362f124c7c",
            "bedc0c82-9ae5-47ad-8c23-a750104d89e0"
          ],
          "display_name": false
        },
        {
          "uuid": "206ebefe-0d20-4111-ad0d-983e5630fe80",
          "name": "PARAMETHASONE",
          "stdName": "PARAMETHASONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2764fc2e-4d29-481c-912f-1d650b6b753d",
            "f81b1b6a-4b82-426a-b30b-c90711aaf031",
            "2d95bbee-e9b5-4dff-a092-82f31032bf64",
            "fe2d20be-3c26-4c54-a5c6-7efb0f70fb69",
            "98cdd7ed-d965-464f-8f60-02ebc3833fd8",
            "8eb765b3-7e19-405b-b2be-168785009a14",
            "af1442ff-328f-4324-9dff-d207f6f41d7a",
            "4e30843b-8479-4c8e-b365-346979bfa64d",
            "3881d8bd-6ec7-42dd-a3d0-e4fe6cc71ca9",
            "3f723998-9d78-46b3-8b0a-f9ea81ba3e40",
            "10e79789-4305-4a57-8451-3c54444044e6",
            "d1cf4e4c-733a-4c57-a5bd-1ee779b03f63"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "4397fd27-b7d3-4f10-9830-81451cc1f722",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "40326df2-fbac-492b-809c-5ddce094ca2d",
          "name": "PARAMETHASONE [HSDB]",
          "stdName": "PARAMETHASONE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8eb765b3-7e19-405b-b2be-168785009a14",
            "3f723998-9d78-46b3-8b0a-f9ea81ba3e40"
          ],
          "display_name": false
        },
        {
          "uuid": "2a2022d5-657c-4c73-9959-1bb36030e3b3",
          "name": "PARAMETHASONE [MI]",
          "stdName": "PARAMETHASONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af1442ff-328f-4324-9dff-d207f6f41d7a",
            "3f723998-9d78-46b3-8b0a-f9ea81ba3e40"
          ],
          "display_name": false
        },
        {
          "uuid": "056c7f96-7632-42fc-baab-717d8296fa7e",
          "name": "PARAMETHASONE [VANDF]",
          "stdName": "PARAMETHASONE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e30843b-8479-4c8e-b365-346979bfa64d",
            "3f723998-9d78-46b3-8b0a-f9ea81ba3e40"
          ],
          "display_name": false
        },
        {
          "uuid": "61ad24a8-5d9b-4a08-873b-1124f0f2c2eb",
          "name": "PREGNA-1,4-DIENE-3,20-DIONE, 6-FLUORO-11,17,21-TRIHYDROXY-16-METHYL-, (6.ALPHA.,11.BETA.,16.ALPHA.)-",
          "stdName": "PREGNA-1,4-DIENE-3,20-DIONE, 6-FLUORO-11,17,21-TRIHYDROXY-16-METHYL-, (6.ALPHA.,11.BETA.,16.ALPHA.)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3881d8bd-6ec7-42dd-a3d0-e4fe6cc71ca9"
          ],
          "display_name": false
        },
        {
          "uuid": "4fab2ab2-2948-95e0-1c47-bdbd2b34ca17",
          "name": "Paramethasone [WHO-DD]",
          "stdName": "PARAMETHASONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c52f23fb-4e78-b311-de61-6cc90293882d"
          ],
          "display_name": false
        },
        {
          "uuid": "e4e73a78-4339-4aa6-bc5e-240b6a4e9f96",
          "name": "paramethasone [INN]",
          "stdName": "PARAMETHASONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe2d20be-3c26-4c54-a5c6-7efb0f70fb69"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3881d8bd-6ec7-42dd-a3d0-e4fe6cc71ca9",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "fe2d20be-3c26-4c54-a5c6-7efb0f70fb69",
          "citation": "INN Proposed List 13",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL13.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "af1442ff-328f-4324-9dff-d207f6f41d7a",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3f723998-9d78-46b3-8b0a-f9ea81ba3e40",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35f76d73-5a10-49ec-9d3a-dd362f124c7c",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bedc0c82-9ae5-47ad-8c23-a750104d89e0",
          "citation": "D07464",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8eb765b3-7e19-405b-b2be-168785009a14",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10e79789-4305-4a57-8451-3c54444044e6",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4e30843b-8479-4c8e-b365-346979bfa64d",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "713dd9f6-6beb-4e21-87ab-b3926cdedae7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390561000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f3e2796-15a9-4f42-b4db-ddf7964ec6af",
          "citation": "SRS import [VFC6ZX3584]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=VFC6ZX3584",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390561000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2d95bbee-e9b5-4dff-a092-82f31032bf64",
          "citation": "PARAMETHASONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f81b1b6a-4b82-426a-b30b-c90711aaf031",
          "citation": "PARAMETHASONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d1cf4e4c-733a-4c57-a5bd-1ee779b03f63",
          "citation": "PARAMETHASONE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "98cdd7ed-d965-464f-8f60-02ebc3833fd8",
          "citation": "PARAMETHASONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2764fc2e-4d29-481c-912f-1d650b6b753d",
          "citation": "PARAMETHASONE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "77fcee5f-c506-d451-fff1-c1e46ed72f35",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+53-33-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1e4bfba5-95eb-5116-65d6-5e1390387067",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=53-33-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "97031bad-81b5-dec7-6262-1630d751d414",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "985fb5cc-975a-494d-a478-b26bd215fed9",
          "citation": "https://www.drugbank.ca/drugs/DB01410",
          "doc_type": "WEBSITE",
          "public_domain": true
        },
        {
          "uuid": "629480fa-719e-4dc7-aefd-bf1b7dc4eb05",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "35b4155e-8d50-b90e-6a17-54c84da1f30d",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "c52f23fb-4e78-b311-de61-6cc90293882d",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "1d465c35-5768-7ec1-6979-ba1c3a088ed9",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4185c212-df2c-4053-95d2-1aec25a2d86d",
          "id": "4185c212-df2c-4053-95d2-1aec25a2d86d",
          "molfile": "\n  Marvin  01132103272D          \n\n 28 31  0  0  1  0            999 V2000\n    6.2569   -1.8624    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.9186   -1.5384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2569   -2.6547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7866   -2.6547    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.0569   -3.0577    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.0569   -3.8827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3653   -4.3047    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    3.3980   -5.0889    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6302   -3.8827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8869   -4.3047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1517   -3.8827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5228   -4.2258    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1517   -3.0577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8869   -2.6547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6302   -3.0577    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    2.6139   -2.3062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3653   -2.6547    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.3653   -1.8624    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    2.5975   -1.3097    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0569   -1.4267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7866   -1.8624    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.7866   -1.1545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5300   -1.4267    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.1426   -1.0074    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5300   -0.6045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7757   -0.1334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2460   -0.1089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0493   -0.6371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n 23  1  1  0  0  0  0\n  4  3  1  1  0  0  0\n  5  4  1  0  0  0  0\n  4 21  1  0  0  0  0\n  5  6  1  6  0  0  0\n 17  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  6  0  0  0\n  7  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n 15  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 15  1  1  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  1  0  0  0\n 18 20  1  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  1  0  0  0\n 21 23  1  0  0  0  0\n 23 24  1  6  0  0  0\n 23 25  1  0  0  0  0\n 26 25  2  0  0  0  0\n 27 25  1  0  0  0  0\n 28 27  1  0  0  0  0\nM  END",
          "smiles": "C[C@@H]1C[C@H]2[C@@H]3C[C@@H](C4=CC(=O)C=CC4(C)[C@H]3[C@H](C[C@]2(C)[C@]1(C(=O)CO)O)O)F",
          "formula": "C22H29FO5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "342706c1-ca86-439c-84b1-9acd073ce2b8"
          },
          "defined_stereo": 8,
          "ez_centers": 0,
          "molecular_weight": "392.4619",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 9
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "06dae634-2566-4002-9c1d-e7076abc94c8",
      "version": "14",
      "structure": {
        "id": "9d1613f0-004f-49c5-9e29-930f760b0ec6",
        "molfile": "\n  Marvin  01132108102D          \n\n 31 34  0  0  1  0            999 V2000\n    2.6302   -3.0577    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.7866   -1.8624    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.6302   -3.8827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7866   -2.6547    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.5300   -1.4267    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.0569   -3.0577    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.3653   -2.6547    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    1.8869   -2.6547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0569   -1.4267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3653   -1.8624    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.2569   -1.8624    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.2569   -2.6547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0569   -3.8827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3653   -4.3047    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    1.8869   -4.3047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5300   -0.6045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1517   -3.0577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1517   -3.8827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7757   -0.1334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5228   -4.2258    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1426   -1.0074    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6139   -2.3062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7866   -1.1545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3980   -5.0889    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5975   -1.3097    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2460   -0.1089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9186   -1.5384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0493   -0.6371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7757   -3.5396    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3708   -3.3763    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0515   -2.2245    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  9  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  6  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  1  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10  7  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12  4  1  0  0  0  0\n 13  6  1  0  0  0  0\n 14  3  1  0  0  0  0\n 15  3  2  0  0  0  0\n  5 16  1  1  0  0  0\n 17  8  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 16  2  0  0  0  0\n 20 18  2  0  0  0  0\n  5 21  1  6  0  0  0\n  1 22  1  1  0  0  0\n  2 23  1  1  0  0  0\n 14 24  1  6  0  0  0\n 10 25  1  1  0  0  0\n 26 16  1  0  0  0  0\n 11 27  1  6  0  0  0\n 28 26  1  0  0  0  0\n  4 29  1  6  0  0  0\n  7 30  1  6  0  0  0\n  6 31  1  1  0  0  0\n 13 14  1  0  0  0  0\n 15 18  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5 11  1  0  0  0  0\nM  END",
        "smiles": "C[C@@H]1C[C@@]2([H])[C@]3([H])C[C@@H](C4=CC(=O)C=C[C@]4(C)[C@@]3([H])[C@H](C[C@]2(C)[C@]1(C(=O)CO)O)O)F",
        "formula": "C22H29FO5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 9,
        "ez_centers": 0,
        "molecular_weight": "392.4619",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "3881d8bd-6ec7-42dd-a3d0-e4fe6cc71ca9",
          "1f3e2796-15a9-4f42-b4db-ddf7964ec6af",
          "fe2d20be-3c26-4c54-a5c6-7efb0f70fb69"
        ],
        "stereo_centers": 9
      },
      "unii": "VFC6ZX3584"
    }
  ]
}