{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "0dd4174b-a8b1-402a-975e-a4bed8ed3ffe", "code": "VF8L36HTE0", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "7c911a6f-b2f8-fa51-8785-aab50263be77", "code": "9865501", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9865501", "code_system": "PUBCHEM", "references": [ "0e6b6f8b-0cbd-c8b6-d9b8-28d32ba8608d" ] }, { "uuid": "e4a35943-ed57-48b8-95d8-4e2662d6c0d5", "code": "686351-75-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=686351-75-7", "code_system": "CAS", "references": [ "91a3edb2-40e8-489c-bdbb-8d62294c50d2" ] }, { "uuid": "7f631cbf-fd78-9040-e34f-833e9b44f1ba", "code": "3074 (Number of products:57)", "comments": "Dietary Supplement Label Database|chemical|Creatine Malate", "type": "PRIMARY", "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=3074&item=Creatine Malate", "code_system": "DSLD", "references": [ "3eaa9dd7-b6a9-2674-45c4-b6df167fc87f" ] } ], "substance_class": "chemical", "names": [ { "uuid": "d24c7ffb-6e4e-4261-94a2-e85872baed0f", "name": "DICREATINE MALATE", "stdName": "DICREATINE MALATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2679fe11-67ef-4dd2-968e-d1a266ee34b2" ], "display_name": true }, { "uuid": "3ea278f6-33a8-49dd-91b0-984b92266cb4", "name": "GLYCINE, N-(AMINOIMINOMETHYL)-N-METHYL-, 2-HYDROXYBUTANEDIOATE (2:1)", "stdName": "GLYCINE, N-(AMINOIMINOMETHYL)-N-METHYL-, 2-HYDROXYBUTANEDIOATE (2:1)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "91a3edb2-40e8-489c-bdbb-8d62294c50d2" ], "display_name": false } ], "references": [ { "uuid": "0e6b6f8b-0cbd-c8b6-d9b8-28d32ba8608d", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "91a3edb2-40e8-489c-bdbb-8d62294c50d2", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "2679fe11-67ef-4dd2-968e-d1a266ee34b2", "citation": "https://ods.od.nih.gov/Research/Dietary_Supplement_Label_Database.aspx", "url": "https://ods.od.nih.gov/Research/Dietary_Supplement_Label_Database.aspx", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "3eaa9dd7-b6a9-2674-45c4-b6df167fc87f", "doc_type": "SYSTEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "b4fefa02-a960-462f-92c2-48b8192ac8d5", "id": "b4fefa02-a960-462f-92c2-48b8192ac8d5", "molfile": "\n Marvin 01132109222D \n\n 9 8 0 0 0 0 999 V2000\n 11.5239 -3.3555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1114 -2.6411 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3489 -3.3555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1114 -4.0701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2864 -4.0701 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8739 -4.7845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2864 -5.4989 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0489 -4.7845 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8739 -3.3555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 2 0 0 0 0\n 1 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 9 1 0 0 0 0\n 6 7 2 0 0 0 0\n 6 8 1 0 0 0 0\nM END", "smiles": "CN(CC(=O)O)C(=N)N", "formula": "C4H9N3O2", "atropisomerism": "No", "charge": 0, "count": 2, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "8628b864-a010-41e1-999c-6c84daf2b786" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "131.1333", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "7822db57-53bd-4da9-834c-e14309247d3b", "id": "7822db57-53bd-4da9-834c-e14309247d3b", "molfile": "\n Marvin 01132106142D \n\n 9 8 0 0 0 0 999 V2000\n 14.7132 -4.3115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7132 -5.1365 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4278 -3.8990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1422 -4.3115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8568 -3.8990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8568 -3.0740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.5711 -4.3115 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4278 -3.0740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9989 -3.8990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 0 0 0 0\n 1 9 2 0 0 0 0\n 3 4 1 0 0 0 0\n 3 8 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 5 7 1 0 0 0 0\nM END", "smiles": "C(C(C(=O)O)O)C(=O)O", "formula": "C4H6O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "6fd209cb-5a7a-4a6d-98f6-161878fbd0fb" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "134.0876", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "fca52f01-78ca-4476-b4fc-f4a6253a4fbc", "version": "6", "structure": { "id": "4e8de6ce-3cc5-4617-8490-5472f95eada6", "molfile": "\n Marvin 01132104062D \n\n 27 24 0 0 0 0 999 V2000\n 11.5239 -3.3555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1114 -2.6411 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3489 -3.3555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1114 -4.0701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2864 -4.0701 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8739 -4.7845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2864 -5.4989 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0489 -4.7845 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8739 -3.3555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7132 -4.3115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7132 -5.1365 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4278 -3.8990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1422 -4.3115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8568 -3.8990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8568 -3.0740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.5711 -4.3115 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4278 -3.0740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9989 -3.8990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5239 -3.3555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1114 -2.6411 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3489 -3.3555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1114 -4.0701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2864 -4.0701 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8739 -4.7845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2864 -5.4989 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0489 -4.7845 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8739 -3.3555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 2 0 0 0 0\n 1 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 6 8 1 0 0 0 0\n 5 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 14 16 1 0 0 0 0\n 12 17 1 0 0 0 0\n 10 18 2 0 0 0 0\n 19 20 1 0 0 0 0\n 19 21 2 0 0 0 0\n 19 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 27 1 0 0 0 0\n 24 25 2 0 0 0 0\n 24 26 1 0 0 0 0\nM STY 1 1 MUL\nM SAL 1 15 1 2 3 4 5 6 7 8 9 19 20 21 22 23 24\nM SAL 1 3 25 26 27\nM SPA 1 9 1 2 3 4 5 6 7 8 9\nM SDI 1 4 8.6289 -5.9189 8.6289 -2.2211\nM SDI 1 4 12.7689 -2.2211 12.7689 -5.9189\nM SMT 1 2\nM END", "smiles": "CN(CC(=O)O)C(=N)N.CN(CC(=O)O)C(=N)N.C(C(C(=O)O)O)C(=O)O", "formula": "2C4H9N3O2.C4H6O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "396.3543", "optical_activity": "( + / - )", "references": [ "2679fe11-67ef-4dd2-968e-d1a266ee34b2" ], "stereo_centers": 1 }, "unii": "VF8L36HTE0" } ] }