{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f2699ab0-c889-48fe-9f37-5202cf2c065f",
          "code": "1069-29-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1069-29-0",
          "code_system": "CAS",
          "references": [
            "ed2f3789-c7cf-4ac4-b8e3-d24e29be5762",
            "d62ad13c-89f1-4b2e-af1d-35d91d15a953"
          ]
        },
        {
          "uuid": "84b43817-f503-4b27-8e14-454ddb9f64ea",
          "code": "C034582",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67034582",
          "code_system": "MESH",
          "references": [
            "ed2f3789-c7cf-4ac4-b8e3-d24e29be5762"
          ]
        },
        {
          "uuid": "25b98e8c-36a1-44b2-9fa4-983d3cb1e060",
          "code": "2724377",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2724377",
          "code_system": "PUBCHEM",
          "references": [
            "ed2f3789-c7cf-4ac4-b8e3-d24e29be5762"
          ]
        },
        {
          "uuid": "4e24b9a9-c651-4126-baef-aaacd2bba60a",
          "code": "VEO23D129R",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "57e13863-c92f-32da-e582-c60a3252574e",
          "code": "DTXSID80910173",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80910173",
          "code_system": "EPA CompTox",
          "references": [
            "6f4d679a-1316-0210-de99-41ac4ddaf922"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "c0d4b89e-158a-4838-b81b-7746bd3cd8ec",
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "394526ae-1a7b-41e3-b044-7ae9bb6d14c2"
          ],
          "related_substance": {
            "uuid": "5b4b9e69-1107-46bc-80a5-6d84cafb5996",
            "refuuid": "36fa9a2a-9b30-4b48-b713-10df5d512718",
            "name": "CYSTINE DIMETHYL ESTER DIHYDROCHLORIDE",
            "unii": "9E45OJ92M0",
            "linking_id": "9E45OJ92M0",
            "ref_pname": "CYSTINE DIMETHYL ESTER DIHYDROCHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3093a122-1542-4553-847a-9de7077322b7",
          "name": "CDME",
          "stdName": "CDME",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ea6409a5-e076-4638-b60e-2a525524a4ae",
            "67f2ba7f-a417-4266-87e5-d47dec9e037f"
          ],
          "display_name": false
        },
        {
          "uuid": "103e0c8e-3e46-4ede-82be-d55a06e63877",
          "name": "CYSTINE DIMETHYL ESTER",
          "stdName": "CYSTINE DIMETHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46f1fecf-29ec-4da4-9607-e558ed08145d",
            "b17c9955-c83e-4bdd-9f5c-d102c57aace3"
          ],
          "display_name": true
        },
        {
          "uuid": "8ac73243-1f08-48b5-b423-2033e924c33f",
          "name": "DIMETHYL CYSTINATE",
          "stdName": "DIMETHYL CYSTINATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "8861ebdf-0ce7-4c1b-973d-e8e990fa7905",
            "b3230f51-13b2-4518-b90b-2606c5a9084b",
            "ea6409a5-e076-4638-b60e-2a525524a4ae",
            "67f2ba7f-a417-4266-87e5-d47dec9e037f"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "3a5ebf04-cd1b-4247-9caa-09e40d3d3abb",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "7c2e31f9-55b8-4a8e-bb0b-cfe64059157d",
          "name": "DIMETHYL-L-CYSTINE",
          "stdName": "DIMETHYL-L-CYSTINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ea6409a5-e076-4638-b60e-2a525524a4ae",
            "67f2ba7f-a417-4266-87e5-d47dec9e037f"
          ],
          "display_name": false
        },
        {
          "uuid": "ab5e9bf7-d71a-4da7-adb4-056e3de48d54",
          "name": "L-CYSTINE, 1,1'-DIMETHYL ESTER",
          "stdName": "L-CYSTINE, 1,1'-DIMETHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67f2ba7f-a417-4266-87e5-d47dec9e037f",
            "394526ae-1a7b-41e3-b044-7ae9bb6d14c2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b17c9955-c83e-4bdd-9f5c-d102c57aace3",
          "citation": "CHEMID 2011 Drugportal",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "46f1fecf-29ec-4da4-9607-e558ed08145d",
          "citation": "DRUGPORTAL 2011",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8861ebdf-0ce7-4c1b-973d-e8e990fa7905",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "67f2ba7f-a417-4266-87e5-d47dec9e037f",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "394526ae-1a7b-41e3-b044-7ae9bb6d14c2",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ea6409a5-e076-4638-b60e-2a525524a4ae",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ed2f3789-c7cf-4ac4-b8e3-d24e29be5762",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391215000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c2baa724-061d-4d42-83f7-c6a8c3cad902",
          "citation": "SRS import [VEO23D129R]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=VEO23D129R",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391215000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6a52a353-fff0-405b-acf7-63a8527b5142",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b3230f51-13b2-4518-b90b-2606c5a9084b",
          "citation": "DIMETHYL CYSTINATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d62ad13c-89f1-4b2e-af1d-35d91d15a953",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6f4d679a-1316-0210-de99-41ac4ddaf922",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0363b4a7-9666-4a97-b984-6290ded9e8ea",
          "id": "0363b4a7-9666-4a97-b984-6290ded9e8ea",
          "molfile": "\n  Marvin  01132100292D          \n\n 16 15  0  0  1  0            999 V2000\n   11.8928   -9.1387    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   11.8928   -8.3065    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6135   -9.5368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3325   -9.1230    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0360   -9.5368    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7425   -9.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4883   -9.5181    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   15.4883  -10.3457    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1840   -9.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1840   -8.3583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9125   -9.5181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6192   -9.0924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1468   -9.5669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4717   -9.1387    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1468  -10.3457    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4296  -10.7628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  1 13  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  1  0  0  0\n  7  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\nM  END",
          "smiles": "COC(=O)[C@H](CSSC[C@@H](C(=O)OC)N)N",
          "formula": "C8H16N2O4S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "382c995a-e914-4090-a59f-e8bc57522580"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "268.3561",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3fcd012b-4878-4fa9-8073-ef971155e761",
      "version": "7",
      "structure": {
        "id": "205a64ea-19be-46e5-905e-3d9d5e3da793",
        "molfile": "\n  Marvin  01132101502D          \n\n 16 15  0  0  1  0            999 V2000\n   11.8928   -9.1387    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.6135   -9.5368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1468   -9.5669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8928   -8.3065    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3325   -9.1230    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1468  -10.3457    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4717   -9.1387    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0360   -9.5368    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7425   -9.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4883   -9.5181    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   16.1840   -9.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4883  -10.3457    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9125   -9.5181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1840   -8.3583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4296  -10.7628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6192   -9.0924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  1  0  0  0\n  2  5  1  0  0  0  0\n  3  6  1  0  0  0  0\n  3  7  2  0  0  0  0\n  5  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  1  0  0  0\n 11 13  1  0  0  0  0\n 11 14  2  0  0  0  0\n  6 15  1  0  0  0  0\n 13 16  1  0  0  0  0\nM  END",
        "smiles": "COC(=O)[C@H](CSSC[C@@H](C(=O)OC)N)N",
        "formula": "C8H16N2O4S2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "268.3561",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "6a52a353-fff0-405b-acf7-63a8527b5142",
          "c2baa724-061d-4d42-83f7-c6a8c3cad902"
        ],
        "stereo_centers": 2
      },
      "unii": "VEO23D129R"
    }
  ]
}