{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "2f478a1c-1e48-495a-a631-72c0040cc329", "code": "487-41-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=487-41-2", "code_system": "CAS", "references": [ "0175f28e-01be-450e-99dc-061d422a6065", "e3e7ba8a-fb2d-47f1-8b3f-da68cbe1efc5" ] }, { "uuid": "24491274-21a9-45d6-ab46-7021febe3464", "code": "m8704", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m8704?q=authorize", "code_system": "MERCK INDEX", "references": [ "0175f28e-01be-450e-99dc-061d422a6065" ] }, { "uuid": "ad3028e4-f64b-4769-8b0a-b3cee5705e77", "code": "101712", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/101712", "code_system": "PUBCHEM", "references": [ "0175f28e-01be-450e-99dc-061d422a6065" ] }, { "uuid": "54d60718-44dd-418c-97c2-f3f3b143ec38", "code": "VE9P4964MG", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "2cce52d7-e2a1-7fe2-1e62-b84b929a6214", "code": "Phillyrin", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Phillyrin", "code_system": "WIKIPEDIA", "references": [ "bdcd3aa1-47ba-db84-9438-48596565485e" ] }, { "uuid": "aa55dcd0-ce7b-aa28-9a32-6826a09db550", "code": "300000044122", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "bffe19e1-f194-1b0a-540e-593af4d5cde7" ] }, { "uuid": "391158db-a259-9f79-e2fa-d532fd55f0c5", "code": "DTXSID40197589", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40197589", "code_system": "EPA CompTox", "references": [ "660adc62-a5a4-98aa-605a-36b61656b00b" ] } ], "substance_class": "chemical", "names": [ { "uuid": "88128497-c44f-486d-b902-22edbc13f031", "name": ".BETA.-D-GLUCOPYRANOSIDE, 4-((1S,3AR,4R,6AR)-4-(3,4-DIMETHOXYPHENYL)TETRAHYDRO-1H,3H-FURO(3,4-C)FURAN-1-YL)-2-METHOXYPHENYL", "stdName": ".BETA.-D-GLUCOPYRANOSIDE, 4-((1S,3AR,4R,6AR)-4-(3,4-DIMETHOXYPHENYL)TETRAHYDRO-1H,3H-FURO(3,4-C)FURAN-1-YL)-2-METHOXYPHENYL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "89bff357-74c6-416c-8c6b-9ddc4d894b11", "ae0c0211-f9ba-423c-9cb7-117a72dd3e3f" ], "display_name": false }, { "uuid": "70ae7aae-f065-42d8-9d46-945035b38024", "name": "4-((1S,3AR,4R,6AR))-4-(4-(3,4-DIMETHOXYPHENYL)TETRAHYDRO-1H,3H-FURO(3,4-C)FURAN-1-YL)-2-METHOXYPHENYL-.BETA.-D-GLUCOPYRANOSIDE", "stdName": "4-((1S,3AR,4R,6AR))-4-(4-(3,4-DIMETHOXYPHENYL)TETRAHYDRO-1H,3H-FURO(3,4-C)FURAN-1-YL)-2-METHOXYPHENYL-.BETA.-D-GLUCOPYRANOSIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "1f53688c-b109-40b2-80ee-81f9b7da54a3", "89bff357-74c6-416c-8c6b-9ddc4d894b11" ], "display_name": false }, { "uuid": "05d43d0a-6c9d-432b-94b7-4872bfe993c9", "name": "FORSYTHIN", "stdName": "FORSYTHIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1f53688c-b109-40b2-80ee-81f9b7da54a3", "89bff357-74c6-416c-8c6b-9ddc4d894b11" ], "display_name": false }, { "uuid": "8a12e609-c633-424a-99ea-242c9e269d08", "name": "PHILLYRIN", "stdName": "PHILLYRIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1f53688c-b109-40b2-80ee-81f9b7da54a3", "1ac6118b-51da-4bd8-8236-16add7602ea8", "e5dc2a83-9179-4a97-bb9f-71a2361a04a0", "89bff357-74c6-416c-8c6b-9ddc4d894b11" ], "display_name": true }, { "uuid": "d5198dcb-ccc7-43f0-b271-24f12a39fe42", "name": "PHILLYRIN [MI]", "stdName": "PHILLYRIN [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1f53688c-b109-40b2-80ee-81f9b7da54a3", "89bff357-74c6-416c-8c6b-9ddc4d894b11" ], "display_name": false }, { "uuid": "9d6d870f-d96c-48de-b77a-a292a3a6dbfd", "name": "PHILLYROSIDE, (+)-", "stdName": "PHILLYROSIDE, (+)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "89bff357-74c6-416c-8c6b-9ddc4d894b11", "9f21546c-1491-4149-91e2-83ffb30f8a81" ], "display_name": false }, { "uuid": "583c1921-2f40-4e51-bdfa-c5e1cf030797", "name": "PHYLLYRIN", "stdName": "PHYLLYRIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "89bff357-74c6-416c-8c6b-9ddc4d894b11", "ae0c0211-f9ba-423c-9cb7-117a72dd3e3f" ], "display_name": false } ], "references": [ { "uuid": "e5dc2a83-9179-4a97-bb9f-71a2361a04a0", "citation": "Merk Index", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "89bff357-74c6-416c-8c6b-9ddc4d894b11", "citation": "MERCK INDEX", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1f53688c-b109-40b2-80ee-81f9b7da54a3", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ae0c0211-f9ba-423c-9cb7-117a72dd3e3f", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9f21546c-1491-4149-91e2-83ffb30f8a81", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0175f28e-01be-450e-99dc-061d422a6065", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392279000, "tags": [ "NOMEN" ] }, { "uuid": "7c8fe0a3-a661-4968-99aa-e7a67068ae73", "citation": "SRS import [VE9P4964MG]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=VE9P4964MG", "doc_type": "SRS", "public_domain": true, "document_date": 1493392279000, "tags": [ "NOMEN" ] }, { "uuid": "5f3cfb9e-4fff-4386-b62a-1ac7ffe9d06c", "citation": "MERK INDEX MONORAPH: MONO1500007434", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1ac6118b-51da-4bd8-8236-16add7602ea8", "citation": "PHILLYRIN [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "a4053241-29ca-1dfa-5520-fca033c849c1", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=487-41-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "bdcd3aa1-47ba-db84-9438-48596565485e", "citation": "WIKI", "doc_type": "WIKI", "public_domain": true }, { "uuid": "660adc62-a5a4-98aa-605a-36b61656b00b", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true }, { "uuid": "e3e7ba8a-fb2d-47f1-8b3f-da68cbe1efc5", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "bffe19e1-f194-1b0a-540e-593af4d5cde7", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "623604fc-2d6a-4246-b654-6598d4fa3f70", "id": "623604fc-2d6a-4246-b654-6598d4fa3f70", "molfile": "\n Marvin 01132105052D \n\n 38 42 0 0 1 0 999 V2000\n 5.7214 -6.9518 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 6.5060 -7.2067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9910 -6.5393 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5060 -5.8719 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 6.7610 -5.0873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5680 -4.9157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8229 -4.1311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2709 -3.5180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5259 -2.7334 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3328 -2.5619 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 8.8848 -3.1750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6918 -3.0035 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 10.2438 -3.6165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9889 -4.4011 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9467 -2.2188 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 10.7537 -2.0473 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3947 -1.6058 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 9.6496 -0.8211 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5877 -1.7772 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 8.0357 -1.1642 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4639 -3.6896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9119 -3.0764 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1669 -2.2918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2090 -4.4741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7214 -6.1268 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 4.9368 -5.8719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4519 -6.5393 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9368 -7.2067 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 4.6819 -7.9913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2340 -8.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9790 -9.3891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1720 -9.5606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9171 -10.3452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4691 -10.9583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6200 -8.9475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8130 -9.1190 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2610 -8.5059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8750 -8.1629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 25 1 1 0 0 0 0\n 1 28 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 3 1 1 0 0 0\n 4 5 1 0 0 0 0\n 25 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 24 2 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 21 2 0 0 0 0\n 10 9 1 1 0 0 0\n 10 11 1 0 0 0 0\n 19 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 1 0 0 0\n 15 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 16 1 6 0 0 0\n 15 17 1 0 0 0 0\n 17 18 1 1 0 0 0\n 17 19 1 0 0 0 0\n 19 20 1 6 0 0 0\n 21 22 1 0 0 0 0\n 21 24 1 0 0 0 0\n 22 23 1 0 0 0 0\n 25 26 1 6 0 0 0\n 27 26 1 0 0 0 0\n 28 27 1 6 0 0 0\n 28 29 1 0 0 0 0\n 30 29 1 0 0 0 0\n 29 38 2 0 0 0 0\n 31 30 2 0 0 0 0\n 32 31 1 0 0 0 0\n 33 32 1 0 0 0 0\n 32 35 2 0 0 0 0\n 34 33 1 0 0 0 0\n 35 36 1 0 0 0 0\n 38 35 1 0 0 0 0\n 36 37 1 0 0 0 0\nM END", "smiles": "COc1ccc(cc1OC)[C@H]2[C@H]3CO[C@H](c4ccc(c(c4)OC)O[C@H]5[C@@H]([C@H]([C@@H]([C@@H](CO)O5)O)O)O)[C@H]3CO2", "formula": "C27H34O11", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "c2c090ac-f963-4481-af56-ccaec661692f" }, "defined_stereo": 9, "ez_centers": 0, "molecular_weight": "534.5533", "optical_activity": "UNSPECIFIED", "stereo_centers": 9 } ], "definition_level": "COMPLETE", "uuid": "5743c5b6-e230-43e6-be2b-8a5a4f53125c", "version": "7", "structure": { "id": "bbf47549-0b4c-45c7-9203-ffcb60418b86", "molfile": "\n Marvin 01132109432D \n\n 40 44 0 0 1 0 999 V2000\n 4.4691 -10.9583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9171 -10.3452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1720 -9.5606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6200 -8.9475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8130 -9.1190 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2610 -8.5059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8750 -8.1629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6819 -7.9913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9368 -7.2067 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.7214 -6.9518 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.7215 -7.7768 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5060 -7.2067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9910 -6.5393 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5060 -5.8719 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.7610 -5.0873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2090 -4.4741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4639 -3.6896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9119 -3.0764 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1669 -2.2918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2709 -3.5180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5259 -2.7334 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3328 -2.5619 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.5877 -1.7772 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.0357 -1.1642 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3947 -1.6058 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.6496 -0.8211 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9467 -2.2188 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 10.7537 -2.0473 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6918 -3.0035 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 10.2438 -3.6165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9889 -4.4011 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8848 -3.1750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8229 -4.1311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5680 -4.9157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7214 -6.1268 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.7214 -5.3018 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9368 -5.8719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4519 -6.5393 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2340 -8.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9790 -9.3891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 7 4 2 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 6 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 1 0 0 0\n 10 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 1 1 0 0 0\n 15 16 1 0 0 0 0\n 17 16 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 20 17 1 0 0 0 0\n 20 21 1 0 0 0 0\n 22 21 1 1 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 6 0 0 0\n 25 23 1 0 0 0 0\n 25 26 1 1 0 0 0\n 27 25 1 0 0 0 0\n 27 28 1 6 0 0 0\n 29 27 1 0 0 0 0\n 29 30 1 1 0 0 0\n 30 31 1 0 0 0 0\n 32 29 1 0 0 0 0\n 22 32 1 0 0 0 0\n 33 20 2 0 0 0 0\n 34 33 1 0 0 0 0\n 15 34 2 0 0 0 0\n 35 14 1 0 0 0 0\n 35 10 1 0 0 0 0\n 35 36 1 1 0 0 0\n 35 37 1 0 0 0 0\n 38 37 1 0 0 0 0\n 9 38 1 0 0 0 0\n 39 8 2 0 0 0 0\n 40 39 1 0 0 0 0\n 3 40 2 0 0 0 0\nM END", "smiles": "COc1ccc(cc1OC)[C@H]2[C@@]3([H])CO[C@H](c4ccc(c(c4)OC)O[C@H]5[C@@H]([C@H]([C@@H]([C@@H](CO)O5)O)O)O)[C@@]3([H])CO2", "formula": "C27H34O11", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 9, "ez_centers": 0, "molecular_weight": "534.5533", "optical_activity": "UNSPECIFIED", "references": [ "7c8fe0a3-a661-4968-99aa-e7a67068ae73", "5f3cfb9e-4fff-4386-b62a-1ac7ffe9d06c" ], "stereo_centers": 9 }, "unii": "VE9P4964MG" } ] }