{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b5cfa8f6-99ae-4a39-92fd-f491180f0978",
          "code": "40860-79-5",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=40860-79-5",
          "code_system": "CAS",
          "references": [
            "fc71161b-3b29-4156-b7a2-b6febea6f411",
            "39adabb7-bb4d-4902-a9a0-1aaa768e6512"
          ]
        },
        {
          "uuid": "b00c0c7f-c7e1-464d-850e-2d80dfc4b151",
          "code": "N0000185508",
          "comments": "Established Pharmacologic Class [EPC]|Standardized Chemical Allergen [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000185508",
          "code_system": "NDF-RT",
          "references": [
            "fc71161b-3b29-4156-b7a2-b6febea6f411"
          ]
        },
        {
          "uuid": "74cd2645-e2ec-4b9e-b930-cd4a781bd668",
          "code": "102-77-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=102-77-2",
          "code_system": "CAS",
          "references": [
            "fc71161b-3b29-4156-b7a2-b6febea6f411",
            "0e02124e-5250-400c-a4fa-bb52323ceaa1"
          ]
        },
        {
          "uuid": "c4446fc4-c1b3-40cd-bfc2-a070eaa64d5e",
          "code": "SUB61032",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "fc71161b-3b29-4156-b7a2-b6febea6f411"
          ]
        },
        {
          "uuid": "746ef75d-b51e-4542-ab71-317a427d5fbc",
          "code": "N0000184306",
          "comments": "Cell-mediated Immunity [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000184306",
          "code_system": "NDF-RT",
          "references": [
            "fc71161b-3b29-4156-b7a2-b6febea6f411"
          ]
        },
        {
          "uuid": "2e442ce3-5e48-4ce1-872f-cfd2b5ad4497",
          "code": "N0000171131",
          "comments": "Allergens [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000171131",
          "code_system": "NDF-RT",
          "references": [
            "fc71161b-3b29-4156-b7a2-b6febea6f411"
          ]
        },
        {
          "uuid": "fe350587-8b5a-4906-9745-a9675c6a2cbb",
          "code": "N0000175629",
          "comments": "Increased Histamine Release [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175629",
          "code_system": "NDF-RT",
          "references": [
            "fc71161b-3b29-4156-b7a2-b6febea6f411"
          ]
        },
        {
          "uuid": "7655221b-bda3-4180-b192-fb3a3c000ded",
          "code": "203-052-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.002.776",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "fc71161b-3b29-4156-b7a2-b6febea6f411"
          ]
        },
        {
          "uuid": "9727f430-59d2-4f5e-9cbe-8ddd65724203",
          "code": "7619",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7619",
          "code_system": "PUBCHEM",
          "references": [
            "fc71161b-3b29-4156-b7a2-b6febea6f411"
          ]
        },
        {
          "uuid": "85f0b8b7-92ec-a571-4f9c-1e805d7fdb8e",
          "code": "2867",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/2867",
          "code_system": "HSDB",
          "references": [
            "c579094b-e090-6eee-2efa-b834fcc42330"
          ]
        },
        {
          "uuid": "75f5d7a1-8bff-a380-e0ae-cef40358d575",
          "code": "DTXSID0021096",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0021096",
          "code_system": "EPA CompTox",
          "references": [
            "69444eac-87c9-dcd3-8110-d45fc8c688e5"
          ]
        },
        {
          "uuid": "f7a3e0db-0748-3078-ce27-cd9a01dc0981",
          "code": "DB14202",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB14202",
          "code_system": "DRUG BANK",
          "references": [
            "a497926b-e2d7-ae5d-34cf-064f8aa2d1e7"
          ]
        },
        {
          "uuid": "935cc2cb-e819-4f60-9bd6-5f94a3df846b",
          "code": "VCD7623F3K",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "15de013f-6f00-7f40-d359-25ff8f9d7fdd",
          "code": "70078",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=70078",
          "code_system": "NSC",
          "references": [
            "aeaf2161-39aa-f59c-6f8d-7ff78b9d2cc3"
          ]
        },
        {
          "uuid": "dbc93a25-27ca-4238-d087-179cd74ee5f1",
          "code": "VCD7623F3K",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=VCD7623F3K",
          "code_system": "DAILYMED",
          "references": [
            "2c56a29d-4724-4928-13f7-68361d86053a"
          ]
        },
        {
          "uuid": "278bb052-8742-c70d-39c0-570a631fb52a",
          "code": "100000134273",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "9447565c-8fdd-b65c-db99-da4d2495c104"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "dc005a5f-d8e9-4c01-8a4a-9b4904d0c5b9",
          "name": "2-(4-MORPHOLINO)THIOBENZOTHIAZOLE",
          "stdName": "2-(4-MORPHOLINO)THIOBENZOTHIAZOLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c75fc62-03ad-40bf-92a9-f8ca8f9387ac",
            "87599657-e2e5-4e6e-a076-362f36ea45e1",
            "b3420e61-d6b6-47f7-afd4-4a6b6ee1ee87",
            "cb149e83-363d-42c2-ba06-0972df4a0d8e"
          ],
          "display_name": false
        },
        {
          "uuid": "51bccf90-5191-4ecf-9800-716f3ab6fd15",
          "name": "2-(4-MORPHOLINO)THIOBENZOTHIAZOLE [HSDB]",
          "stdName": "2-(4-MORPHOLINO)THIOBENZOTHIAZOLE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87599657-e2e5-4e6e-a076-362f36ea45e1",
            "b3420e61-d6b6-47f7-afd4-4a6b6ee1ee87"
          ],
          "display_name": false
        },
        {
          "uuid": "2c565784-eeda-4451-8551-c8fbcd2827cb",
          "name": "4-(1,3-BENZOTHIAZOL-2-YLSULFANYL)MORPHOLINE",
          "stdName": "4-(1,3-BENZOTHIAZOL-2-YLSULFANYL)MORPHOLINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c75fc62-03ad-40bf-92a9-f8ca8f9387ac",
            "87599657-e2e5-4e6e-a076-362f36ea45e1"
          ],
          "display_name": false
        },
        {
          "uuid": "ac2dab36-e6a3-4230-8213-c85c47c0871b",
          "name": "ACCEL NS",
          "stdName": "ACCEL NS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87599657-e2e5-4e6e-a076-362f36ea45e1",
            "4b3aff6b-8e59-4da9-b781-7ea4fc7cb5f3"
          ],
          "display_name": false
        },
        {
          "uuid": "be998b89-fc04-4c52-b49e-6485fd90368f",
          "name": "MERAMID M",
          "stdName": "MERAMID M",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87599657-e2e5-4e6e-a076-362f36ea45e1",
            "6f2e0f13-2224-43f6-a843-88ea27da17b7"
          ],
          "display_name": false
        },
        {
          "uuid": "2b02391d-33b6-4b1f-812a-0259122e3fdd",
          "name": "MORPHOLINYLMERCAPTO-BENZO-THIAZOLE",
          "stdName": "MORPHOLINYLMERCAPTO-BENZO-THIAZOLE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87599657-e2e5-4e6e-a076-362f36ea45e1",
            "6f2e0f13-2224-43f6-a843-88ea27da17b7"
          ],
          "display_name": false
        },
        {
          "uuid": "569248c3-20ff-4d25-b08e-ce432ffb3ae1",
          "name": "MORPHOLINYLMERCAPTOBENZOTHIAZOLE",
          "stdName": "MORPHOLINYLMERCAPTOBENZOTHIAZOLE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f2e0f13-2224-43f6-a843-88ea27da17b7",
            "81bfadbf-cd5b-4bb9-a0b9-1bc371ff42e9"
          ],
          "display_name": true
        },
        {
          "uuid": "2375f551-b689-4baf-9cd2-eb18261d2e2d",
          "name": "N-(OXYDIETHYLENE)BENZOTHIAZOLE-2-SULFENAMIDE",
          "stdName": "N-(OXYDIETHYLENE)BENZOTHIAZOLE-2-SULFENAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87599657-e2e5-4e6e-a076-362f36ea45e1",
            "85025eb2-6b25-47ee-bbcd-30edb505bce7"
          ],
          "display_name": false
        },
        {
          "uuid": "16a1d7ba-37ec-47a4-bdff-6133296da461",
          "name": "N-OXYDIETHYLENE-2-BENZOTHIAZYLSULFENAMIDE",
          "stdName": "N-OXYDIETHYLENE-2-BENZOTHIAZYLSULFENAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87599657-e2e5-4e6e-a076-362f36ea45e1",
            "b3420e61-d6b6-47f7-afd4-4a6b6ee1ee87"
          ],
          "display_name": false
        },
        {
          "uuid": "2004db8f-5976-4626-aa3e-3c30bf046981",
          "name": "NSC-70078",
          "stdName": "NSC-70078",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87599657-e2e5-4e6e-a076-362f36ea45e1",
            "6f2e0f13-2224-43f6-a843-88ea27da17b7"
          ],
          "display_name": false
        },
        {
          "uuid": "1725ae23-86e9-41e9-b16c-5d69d12c3477",
          "name": "SULFENAMIDE M",
          "stdName": "SULFENAMIDE M",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87599657-e2e5-4e6e-a076-362f36ea45e1",
            "4b3aff6b-8e59-4da9-b781-7ea4fc7cb5f3"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6f2e0f13-2224-43f6-a843-88ea27da17b7",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "81bfadbf-cd5b-4bb9-a0b9-1bc371ff42e9",
          "citation": "DL",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1c75fc62-03ad-40bf-92a9-f8ca8f9387ac",
          "citation": "http://www.chemindustry.com/chemicals/0235358.html",
          "url": "http://www.chemindustry.com/chemicals/0235358.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87599657-e2e5-4e6e-a076-362f36ea45e1",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "85025eb2-6b25-47ee-bbcd-30edb505bce7",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b3420e61-d6b6-47f7-afd4-4a6b6ee1ee87",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b3aff6b-8e59-4da9-b781-7ea4fc7cb5f3",
          "citation": "http://webbook.nist.gov/cgi/cbook.cgi?ID=C102772&Mask=80",
          "url": "http://webbook.nist.gov/cgi/cbook.cgi?ID=C102772&Mask=80",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc71161b-3b29-4156-b7a2-b6febea6f411",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390168000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f542271f-5744-4ddd-b036-c6a297bdffa1",
          "citation": "SRS import [VCD7623F3K]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=VCD7623F3K",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390168000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8877b497-0cd2-408c-b5ea-9b864ccc5d83",
          "citation": "WEB PAGE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb149e83-363d-42c2-ba06-0972df4a0d8e",
          "citation": "2-(4-MORPHOLINO)THIOBENZOTHIAZOLE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c579094b-e090-6eee-2efa-b834fcc42330",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+102-77-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "69444eac-87c9-dcd3-8110-d45fc8c688e5",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=102-77-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a497926b-e2d7-ae5d-34cf-064f8aa2d1e7",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "0e02124e-5250-400c-a4fa-bb52323ceaa1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "39adabb7-bb4d-4902-a9a0-1aaa768e6512",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "aeaf2161-39aa-f59c-6f8d-7ff78b9d2cc3",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "2c56a29d-4724-4928-13f7-68361d86053a",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "9447565c-8fdd-b65c-db99-da4d2495c104",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a405fe80-cd84-448b-b8a2-5d97e3e383d0",
          "id": "a405fe80-cd84-448b-b8a2-5d97e3e383d0",
          "molfile": "\n  Marvin  01132108312D          \n\n 16 18  0  0  0  0            999 V2000\n    3.9359   -2.9661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5247   -2.2524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9359   -1.5387    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7582   -1.5387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1772   -2.2524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7582   -2.9661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5247   -0.8249    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7024   -0.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2136   -0.1552    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4301   -0.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7137    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7137   -1.6473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4301   -1.2335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2136   -1.4921    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  6  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3  7  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n 16  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 15 10  2  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)nc(s2)SN3CCOCC3",
          "formula": "C11H12N2OS2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b468e48e-ac98-429f-befc-460a49f418da"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "252.3584",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1bd6355e-1c60-4c29-ac92-18ea0363bc3d",
      "version": "9",
      "structure": {
        "id": "5e78bea1-21f5-4715-8742-ea604da2505b",
        "molfile": "\n  Marvin  01132104532D          \n\n 16 18  0  0  0  0            999 V2000\n    2.7024   -0.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2136   -0.1552    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2136   -1.4921    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5247   -0.8249    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4301   -0.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9359   -1.5387    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4301   -1.2335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7582   -2.9661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5247   -2.2524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7582   -1.5387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9359   -2.9661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1772   -2.2524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7137    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7137   -1.6473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  3  1  0  0  0  0\n  8 12  1  0  0  0  0\n  9  6  1  0  0  0  0\n 10  6  1  0  0  0  0\n 11  9  1  0  0  0  0\n 12 10  1  0  0  0  0\n 13  5  1  0  0  0  0\n 14  7  1  0  0  0  0\n 15 13  2  0  0  0  0\n 16 14  2  0  0  0  0\n  7  5  2  0  0  0  0\n  8 11  1  0  0  0  0\n 16 15  1  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)nc(s2)SN3CCOCC3",
        "formula": "C11H12N2OS2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "252.3584",
        "optical_activity": "NONE",
        "references": [
          "f542271f-5744-4ddd-b036-c6a297bdffa1",
          "8877b497-0cd2-408c-b5ea-9b864ccc5d83"
        ],
        "stereo_centers": 0
      },
      "unii": "VCD7623F3K"
    }
  ]
}