{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "aa9fde46-1242-4945-b68f-aef214a8b7a0",
          "code": "50-89-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=50-89-5",
          "code_system": "CAS",
          "references": [
            "e84e1ab5-e2e0-448c-a4d0-5221d6b88173",
            "670d3064-920b-4b3d-abea-287c017578a9"
          ]
        },
        {
          "uuid": "bd46fdd6-ab89-4587-8e36-893bc7dbadf9",
          "code": "C880",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C880",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e84e1ab5-e2e0-448c-a4d0-5221d6b88173"
          ]
        },
        {
          "uuid": "1de9efd1-935f-47fd-a5a8-29f7455acfa8",
          "code": "D013936",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68013936",
          "code_system": "MESH",
          "references": [
            "e84e1ab5-e2e0-448c-a4d0-5221d6b88173"
          ]
        },
        {
          "uuid": "7bda8b5f-b740-45b1-8f14-b0726e4b7f5b",
          "code": "THYMIDINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Thymidine",
          "code_system": "WIKIPEDIA",
          "references": [
            "e84e1ab5-e2e0-448c-a4d0-5221d6b88173"
          ]
        },
        {
          "uuid": "fe538854-6795-459b-82ab-52b26db42c5c",
          "code": "1372538",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1372538/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "e84e1ab5-e2e0-448c-a4d0-5221d6b88173"
          ]
        },
        {
          "uuid": "f4ecc6e9-9e3b-4e40-bbab-b148ef6f00b1",
          "code": "m10822",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10822?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "e84e1ab5-e2e0-448c-a4d0-5221d6b88173"
          ]
        },
        {
          "uuid": "c4b31d0e-b2de-4d46-8440-e8bbadffc3cf",
          "code": "SUB15554MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "e84e1ab5-e2e0-448c-a4d0-5221d6b88173"
          ]
        },
        {
          "uuid": "558805b6-0c2a-47fd-b020-ee3e603cdecd",
          "code": "5789",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5789",
          "code_system": "PUBCHEM",
          "references": [
            "e84e1ab5-e2e0-448c-a4d0-5221d6b88173"
          ]
        },
        {
          "uuid": "3e49343e-6d75-4a5a-8e3d-4d63796392c5",
          "code": "200-070-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.065",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e84e1ab5-e2e0-448c-a4d0-5221d6b88173"
          ]
        },
        {
          "uuid": "ffba0727-1967-ef36-858d-615ca5a51af7",
          "code": "DTXSID5023661",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5023661",
          "code_system": "EPA CompTox",
          "references": [
            "8a53eef0-9e96-26ac-9dd8-f0e055e2f8aa"
          ]
        },
        {
          "uuid": "b13155e7-8496-470e-11ff-1009c37a21f3",
          "code": "C707",
          "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Nucleic Acids, Nucleosides, and Nucleotides[C708]|Nucleoside",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C707",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f5e32649-0fad-b1ed-024e-4da47fc6b0c7"
          ]
        },
        {
          "uuid": "10d93f0d-6ec0-a74d-f5cc-2c0ab32381ed",
          "code": "59215-4",
          "comments": "LOINC|ACTIVE|CHEM|Urine|Thymidine/Creatinine [Molar ratio] in Urine",
          "type": "PRIMARY",
          "url": "https://loinc.org/59215-4/",
          "code_system": "LOINC",
          "references": [
            "f5e32649-0fad-b1ed-024e-4da47fc6b0c7"
          ]
        },
        {
          "uuid": "b3f7c002-55bd-319c-994c-a6284a932710",
          "code": "75156-0",
          "comments": "LOINC|ACTIVE|CHEM|CSF|Thymidine [Moles/volume] in Cerebral spinal fluid",
          "type": "PRIMARY",
          "url": "https://loinc.org/75156-0/",
          "code_system": "LOINC",
          "references": [
            "f5e32649-0fad-b1ed-024e-4da47fc6b0c7"
          ]
        },
        {
          "uuid": "1b1de33e-5ba4-ac3b-694b-47022d5c2b3b",
          "code": "EU/3/17/1870",
          "comments": "EU ORPHAN DRUG|Positive|\"Treatment of mitochondrial DNA depletion syndrome, myopathic form\"",
          "type": "PRIMARY",
          "url": "https://www.ema.europa.eu/en/medicines/human/orphan-designations/eu3171870",
          "code_system": "EU-Orphan Drug",
          "references": [
            "f5e32649-0fad-b1ed-024e-4da47fc6b0c7"
          ]
        },
        {
          "uuid": "7cc3c957-c951-52f5-78f8-1b2a0dce259a",
          "code": "48162-2",
          "comments": "LOINC|ACTIVE|CHEM|Ser/Plas|Thymidine [Moles/volume] in Serum or Plasma",
          "type": "PRIMARY",
          "url": "https://loinc.org/48162-2/",
          "code_system": "LOINC",
          "references": [
            "f5e32649-0fad-b1ed-024e-4da47fc6b0c7"
          ]
        },
        {
          "uuid": "f6d4e77e-c3df-58c1-43ab-58c662d6b6bc",
          "code": "DB04485",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB04485",
          "code_system": "DRUG BANK",
          "references": [
            "f5e32649-0fad-b1ed-024e-4da47fc6b0c7"
          ]
        },
        {
          "uuid": "fb26bae5-00be-4b98-a56b-c0075a0fc658",
          "code": "VC2W18DGKR",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "bb1c73b2-0812-2451-4af6-f5cc15f8e6f0",
          "code": "1724543",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1724543",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "f5e32649-0fad-b1ed-024e-4da47fc6b0c7"
          ]
        },
        {
          "uuid": "68e68efb-79ef-08e5-7235-379779332141",
          "code": "17748",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:17748",
          "code_system": "CHEBI",
          "references": [
            "f5e32649-0fad-b1ed-024e-4da47fc6b0c7"
          ]
        },
        {
          "uuid": "1a9eea8a-ed84-5ec2-d5c3-42fdaed25a5e",
          "code": "11756",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=11756",
          "code_system": "INN",
          "references": [
            "cbd334b4-96c7-03c7-35a4-0a3628c9669a"
          ]
        },
        {
          "uuid": "1887431d-91f7-3974-9e8e-7a685da8a5c4",
          "code": "KL-167",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/KL-167/relevant/1/",
          "code_system": "USAN",
          "references": [
            "1511791f-9dcd-5518-2c57-4cfe2a70567e"
          ]
        },
        {
          "uuid": "dc5dc1fb-a6d1-fa94-865b-0560c16af12f",
          "code": "21548",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=21548",
          "code_system": "NSC",
          "references": [
            "9c080f0e-64fa-df6e-30ba-2e2756ec8605"
          ]
        },
        {
          "uuid": "f7f48e28-0fe8-060a-7afc-72e815179bed",
          "code": "VC2W18DGKR",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=VC2W18DGKR",
          "code_system": "DAILYMED",
          "references": [
            "23330554-8072-9a31-f521-29d20921abbf"
          ]
        },
        {
          "uuid": "93de6e88-15e5-b2ac-ba81-6b9ab0ed9a1e",
          "code": "100000077023",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "0c0a3289-eb61-1eaa-42d0-f47e8b06fc12"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "fc1bf3d5-4067-4933-9652-c627e12c918d",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7e8d8505-105d-4af9-bb3a-fcabd008f63c",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae6417dd-a874-47ac-9209-40693fc07924",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "85539d6f-24c8-4608-a986-b5681b66ee65",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "77dcac65-05cb-4c82-b4cc-cb65d75de459",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c86da814-4fdb-44af-863b-3ef778d6de33",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8660b613-a462-4eeb-b9f0-a4c7796c7ef3",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "915ccbe9-934e-4a54-af20-ebbfedfbd63c",
          "citation": "http://www.usp.org/pdf/EN/referenceStandards/certificates/1724543-F0J367.pdf",
          "url": "http://www.usp.org/pdf/EN/referenceStandards/certificates/1724543-F0J367.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad2688e3-1019-47d1-9431-46156c63219b",
          "citation": "WHO-IP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8a8bdd89-0b98-4aaa-961f-159ee6131910",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e84e1ab5-e2e0-448c-a4d0-5221d6b88173",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389714000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2e4010e6-437d-4917-8185-e431de5b3b10",
          "citation": "USP-MC",
          "url": "https://mc.usp.org/monographs/zidovudine-0-1",
          "doc_type": "USP-MC",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b3ed587-d979-4925-8cde-640692033733",
          "citation": "THE INTERNATIONAL PHARMACOPOEIA FIFTH EDITION",
          "url": "http://apps.who.int/phint/en/p/docf/",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "94071fbe-da55-4801-8e70-f7b80c6ad0dc",
          "citation": "SRS import [VC2W18DGKR]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=VC2W18DGKR",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389714000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8b64f011-1fcf-432e-8c81-acd941fbae00",
          "citation": "THYMIDINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e65f5c34-45c8-45df-a3e4-3ee084abe0b0",
          "citation": "THYMIDINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7fd89924-336f-4a46-9c02-3aa716caced4",
          "citation": "THYMIDINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "64a52688-119b-4692-af97-aab9dca7b12a",
          "citation": "ZIDOVUDINE RELATED COMPOUND D [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dc875bbf-46aa-49af-8a8b-fcba937849ee",
          "citation": "THYMIDINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "062cc6d4-1e98-4868-b6ad-9ebb649f300e",
          "citation": "THYMIDINE [WHO-IP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8a53eef0-9e96-26ac-9dd8-f0e055e2f8aa",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=50-89-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "96c9c988-2423-4194-a329-ca55c8ff349d",
          "citation": "11.1",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "569796cf-984e-16d7-6d8b-f9161e6eb21a",
          "citation": "EP",
          "url": "http://online6.edqm.eu/ep907/",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f5e32649-0fad-b1ed-024e-4da47fc6b0c7",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "670d3064-920b-4b3d-abea-287c017578a9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4c325cf4-7560-c9ad-74be-fd4d60affebf",
          "citation": "European Pharmacopoeia Online 9.8, Stavudine Monograph",
          "url": "http://online6.edqm.eu/ep908/",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cbd334b4-96c7-03c7-35a4-0a3628c9669a",
          "citation": "P125",
          "doc_type": "INN_LIST",
          "public_domain": true
        },
        {
          "uuid": "7be16e39-24c7-67a4-e9eb-f499638fa5a0",
          "citation": "USP/NF",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "1511791f-9dcd-5518-2c57-4cfe2a70567e",
          "citation": "USAN COUN 2022",
          "doc_type": "USANCOUN",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "736ffe04-3615-4674-0532-d7220a8b0cf4",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "9c080f0e-64fa-df6e-30ba-2e2756ec8605",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "23330554-8072-9a31-f521-29d20921abbf",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "0c0a3289-eb61-1eaa-42d0-f47e8b06fc12",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2eb3f653-c436-4ef7-a6ce-10245c0f56ca",
          "id": "2eb3f653-c436-4ef7-a6ce-10245c0f56ca",
          "molfile": "\n  Marvin  01132102312D          \n\n 17 18  0  0  1  0            999 V2000\n    3.3156   -5.7932    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    2.7595   -6.3414    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3781   -5.7932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7410   -5.1405    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.8404   -4.6654    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0023   -5.1405    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    2.3888   -4.7593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6865   -5.1118    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1927   -4.1954    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9211   -3.7803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9211   -2.9553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6364   -2.5402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2110   -2.5350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2110   -1.7127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4904   -2.9553    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4904   -3.7803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7777   -4.1954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  6  1  0  0  0  0\n  4  3  1  1  0  0  0\n  5  4  1  0  0  0  0\n  4  9  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  1  0  0  0\n  8  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 16  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 11  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 13  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  2  0  0  0  0\nM  END",
          "smiles": "Cc1cn([C@H]2C[C@@H]([C@@H](CO)O2)O)c(=O)[nH]c1=O",
          "formula": "C10H14N2O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "96da474f-e733-4904-b70b-2b4caabea090"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "242.229",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "fd60a501-f26c-4478-8501-c01e62ce43ce",
      "version": "44",
      "structure": {
        "id": "8458c26e-749f-4cef-a2da-b107bc868941",
        "molfile": "\n  Marvin  01132106522D          \n\n 17 18  0  0  1  0            999 V2000\n   15.8360   -3.9877    0.0000 N   0  0  2  0  0  0  0  0  0  0  0  0\n   16.0599   -3.1937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.8595   -2.9906    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4352   -3.5815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2112   -4.3755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4116   -4.5786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7869   -4.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.2348   -3.3784    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4842   -2.6027    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0364   -4.1907    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.4021   -3.6632    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7044   -4.1035    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.9382   -3.7977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2902   -4.3085    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9074   -4.9031    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.7307   -4.9570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3800   -5.5373    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  1  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  4  2  0  0  0  0\n  9  2  2  0  0  0  0\n 10  1  1  1  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  1  0  0  0\n 14 13  1  0  0  0  0\n 12 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 10  1  0  0  0  0\n 15 17  1  6  0  0  0\nM  END",
        "smiles": "Cc1cn([C@H]2C[C@@H]([C@@H](CO)O2)O)c(=O)[nH]c1=O",
        "formula": "C10H14N2O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "242.229",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "fc1bf3d5-4067-4933-9652-c627e12c918d",
          "94071fbe-da55-4801-8e70-f7b80c6ad0dc"
        ],
        "stereo_centers": 3
      },
      "unii": "VC2W18DGKR",
      "relationships": [
        {
          "uuid": "2ccd658a-a103-4dea-b376-0de48a94512f",
          "amount": {
            "uuid": "cb167618-b5b7-4e31-922b-6532ef0aee24"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "bff572d6-1cce-4bbb-981e-90256294e095",
            "refuuid": "fd60a501-f26c-4478-8501-c01e62ce43ce",
            "name": "Doxribtimine",
            "unii": "VC2W18DGKR",
            "linking_id": "VC2W18DGKR",
            "ref_pname": "Doxribtimine",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "2db885f0-0d4a-4dd1-919d-184c95638b57",
          "amount": {
            "uuid": "4f9d3287-e337-4085-8f99-b7e6e73306a2",
            "type": "WEIGHT PERCENT",
            "units": "%",
            "high_limit": 0.1,
            "non_numeric_value": "PEAK VALUE"
          },
          "qualification": "EP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "569796cf-984e-16d7-6d8b-f9161e6eb21a",
            "2e4010e6-437d-4917-8185-e431de5b3b10"
          ],
          "related_substance": {
            "uuid": "92378465-86ea-42fb-a74b-d628ce8084df",
            "refuuid": "479f1396-4958-4f59-9d41-0bd0468c8da7",
            "name": "ZIDOVUDINE",
            "unii": "4B9XT59T7S",
            "linking_id": "4B9XT59T7S",
            "ref_pname": "ZIDOVUDINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e2df246e-4b56-47af-be34-2a1ea6cae131",
          "amount": {
            "uuid": "42a71b25-85ce-427b-bce3-3f4a7f44dbb8"
          },
          "comments": "Amount Not Specified",
          "qualification": "INTERNATIONAL PHARMACOPEIA",
          "type": "PARENT->IMPURITY",
          "references": [
            "3b3ed587-d979-4925-8cde-640692033733"
          ],
          "related_substance": {
            "uuid": "59291903-39fc-4124-b1c2-4af8408731aa",
            "refuuid": "699aa281-44f5-4974-8a8a-16709eda6e74",
            "name": "STAVUDINE",
            "unii": "BO9LE4QFZF",
            "linking_id": "BO9LE4QFZF",
            "ref_pname": "STAVUDINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "46d9f7e4-6564-41a9-b717-c076dc01a6ec",
          "amount": {
            "uuid": "261b1c4e-d5a3-40b3-ae2d-da19731ec7b0",
            "type": "MOLE PERCENT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "4c325cf4-7560-c9ad-74be-fd4d60affebf"
          ],
          "related_substance": {
            "uuid": "9f64fab5-848b-4a83-b831-25142bc595d2",
            "refuuid": "699aa281-44f5-4974-8a8a-16709eda6e74",
            "name": "STAVUDINE",
            "unii": "BO9LE4QFZF",
            "linking_id": "BO9LE4QFZF",
            "ref_pname": "STAVUDINE",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "9b3737f3-969a-4c45-8f7e-05c80bcf0ace",
          "name": "1-(2-DEOXY-.BETA.-D-ERYTHRO-PENTOFURANOSYL)-5-METHYLPYRIMIDINE-2,4(1H,3H)-DIONE [WHO-IP]",
          "stdName": "1-(2-DEOXY-.BETA.-D-ERYTHRO-PENTOFURANOSYL)-5-METHYLPYRIMIDINE-2,4(1H,3H)-DIONE [WHO-IP]",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e8d8505-105d-4af9-bb3a-fcabd008f63c",
            "ad2688e3-1019-47d1-9431-46156c63219b"
          ],
          "display_name": false
        },
        {
          "uuid": "03fc4a3a-a178-f129-34a1-616b4f1443fe",
          "name": "1-(2-Deoxy-β-D-erythro-pentofuranosyl)-5-methyl-2,4(1H,3H)-pyrimidinedione",
          "stdName": "1-(2-DEOXY-.BETA.-D-ERYTHRO-PENTOFURANOSYL)-5-METHYL-2,4(1H,3H)-PYRIMIDINEDIONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "569796cf-984e-16d7-6d8b-f9161e6eb21a"
          ],
          "display_name": false
        },
        {
          "uuid": "a23a81f4-17b7-4fd5-9ac7-d5c7a5ab8637",
          "name": "2,4(1H,3H)-Pyrimidinedione, 1-(2-deoxy-β-D-erythro-pentofuranosyl)-5-methyl-",
          "stdName": "2,4(1H,3H)-PYRIMIDINEDIONE, 1-(2-DEOXY-.BETA.-D-ERYTHRO-PENTOFURANOSYL)-5-METHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "670d3064-920b-4b3d-abea-287c017578a9"
          ],
          "display_name": false
        },
        {
          "uuid": "e3dc745e-c222-acc2-b9d2-2122fabffac4",
          "name": "2′-Deoxythymidine",
          "stdName": "2'-DEOXYTHYMIDINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "670d3064-920b-4b3d-abea-287c017578a9"
          ],
          "display_name": false
        },
        {
          "uuid": "991f2c66-4e82-47f1-967a-4b4f3be4bef5",
          "name": "5-Methyl-2′-deoxyuridine",
          "stdName": "5-METHYL-2'-DEOXYURIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "670d3064-920b-4b3d-abea-287c017578a9"
          ],
          "display_name": false
        },
        {
          "uuid": "d4a461a9-2bb5-40a4-ad83-9e2aa2261f5e",
          "name": "DEOXYRIBOTHYMIDINE",
          "stdName": "DEOXYRIBOTHYMIDINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a8bdd89-0b98-4aaa-961f-159ee6131910",
            "7e8d8505-105d-4af9-bb3a-fcabd008f63c"
          ],
          "display_name": false
        },
        {
          "uuid": "4e74b91e-0c9a-8af5-ff37-df6cee68740b",
          "name": "DOXRIBTIMINE [USAN]",
          "stdName": "DOXRIBTIMINE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1511791f-9dcd-5518-2c57-4cfe2a70567e"
          ],
          "display_name": false
        },
        {
          "uuid": "d52e330f-b430-9e43-5479-30b0c6157760",
          "name": "Doxribtimine",
          "stdName": "DOXRIBTIMINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cbd334b4-96c7-03c7-35a4-0a3628c9669a",
            "1511791f-9dcd-5518-2c57-4cfe2a70567e"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "026ffa8d-298c-4b62-ab4b-88372a4e2c9e",
              "name_org": "INN"
            },
            {
              "uuid": "f22fcfa5-ec11-4539-b356-f23975ec8d78",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "740a45c2-804a-4225-a731-d3ad777027c1",
          "name": "IMPURITY C [EP IMPURITY]",
          "stdName": "IMPURITY C [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96c9c988-2423-4194-a329-ca55c8ff349d"
          ],
          "display_name": false
        },
        {
          "uuid": "0094f673-3226-cc7d-4e0c-492327f5fd87",
          "name": "MT-1621 COMPONENT 2'-DEOXYTHYMIDINE",
          "stdName": "MT-1621 COMPONENT 2'-DEOXYTHYMIDINE",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1511791f-9dcd-5518-2c57-4cfe2a70567e"
          ],
          "display_name": false
        },
        {
          "uuid": "84c361ce-c76a-4860-a5da-6c56c1c54f03",
          "name": "NSC-21548",
          "stdName": "NSC-21548",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a8bdd89-0b98-4aaa-961f-159ee6131910",
            "7e8d8505-105d-4af9-bb3a-fcabd008f63c"
          ],
          "display_name": false
        },
        {
          "uuid": "2761efcb-e36a-0633-263b-2a746d7264bd",
          "name": "STAVUDINE IMPURITY C [EP IMPURITY]",
          "stdName": "STAVUDINE IMPURITY C [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c325cf4-7560-c9ad-74be-fd4d60affebf"
          ],
          "display_name": false
        },
        {
          "uuid": "e0e3641a-bfa9-47c0-bd20-af32fdae8bbd",
          "name": "STAVUDINE IMPURITY C [WHO-IP]",
          "stdName": "STAVUDINE IMPURITY C [WHO-IP]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e8d8505-105d-4af9-bb3a-fcabd008f63c",
            "ad2688e3-1019-47d1-9431-46156c63219b"
          ],
          "display_name": false
        },
        {
          "uuid": "9b03c0e8-525e-4ff7-a59e-67a217acf8db",
          "name": "THYMIDINE",
          "stdName": "THYMIDINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "7e8d8505-105d-4af9-bb3a-fcabd008f63c",
            "e65f5c34-45c8-45df-a3e4-3ee084abe0b0",
            "ad2688e3-1019-47d1-9431-46156c63219b",
            "062cc6d4-1e98-4868-b6ad-9ebb649f300e",
            "85539d6f-24c8-4608-a986-b5681b66ee65",
            "77dcac65-05cb-4c82-b4cc-cb65d75de459",
            "8b64f011-1fcf-432e-8c81-acd941fbae00",
            "8660b613-a462-4eeb-b9f0-a4c7796c7ef3",
            "fc1bf3d5-4067-4933-9652-c627e12c918d",
            "7fd89924-336f-4a46-9c02-3aa716caced4",
            "ae6417dd-a874-47ac-9209-40693fc07924",
            "dc875bbf-46aa-49af-8a8b-fcba937849ee"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "bc2eb94e-564f-401c-9127-3be6f69a5148",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "401a2b48-d15d-44d7-8d6a-02cb29679965",
          "name": "THYMIDINE [MART.]",
          "stdName": "THYMIDINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae6417dd-a874-47ac-9209-40693fc07924"
          ],
          "display_name": false
        },
        {
          "uuid": "40589231-4841-47a5-8c33-ab0113fa997f",
          "name": "THYMIDINE [MI]",
          "stdName": "THYMIDINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e8d8505-105d-4af9-bb3a-fcabd008f63c",
            "85539d6f-24c8-4608-a986-b5681b66ee65"
          ],
          "display_name": false
        },
        {
          "uuid": "5194aa26-5e5c-4fc9-9b22-0c7f60bb09ef",
          "name": "THYMIDINE [WHO-IP]",
          "stdName": "THYMIDINE [WHO-IP]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e8d8505-105d-4af9-bb3a-fcabd008f63c",
            "ad2688e3-1019-47d1-9431-46156c63219b"
          ],
          "display_name": false
        },
        {
          "uuid": "c72fa28d-47b6-452c-9d4d-1c42d3f7faf1",
          "name": "THYMINE-2-DESOXYRIBOSIDE",
          "stdName": "THYMINE-2-DESOXYRIBOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e8d8505-105d-4af9-bb3a-fcabd008f63c",
            "fc1bf3d5-4067-4933-9652-c627e12c918d"
          ],
          "display_name": false
        },
        {
          "uuid": "54d4606c-76dc-2e28-0a37-f0ea74b22b11",
          "name": "Thymidine [WHO-DD]",
          "stdName": "THYMIDINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "736ffe04-3615-4674-0532-d7220a8b0cf4"
          ],
          "display_name": false
        },
        {
          "uuid": "9b008b46-c1c0-212c-0798-af2079f86215",
          "name": "ZIDOVUDINE IMPURITY E [EP IMPURITY]",
          "stdName": "ZIDOVUDINE IMPURITY E [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "569796cf-984e-16d7-6d8b-f9161e6eb21a"
          ],
          "display_name": false
        },
        {
          "uuid": "1e42ba95-3985-40ec-b348-cb174ab941ea",
          "name": "ZIDOVUDINE RELATED COMPOUND D",
          "stdName": "ZIDOVUDINE RELATED COMPOUND D",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e8d8505-105d-4af9-bb3a-fcabd008f63c",
            "c86da814-4fdb-44af-863b-3ef778d6de33",
            "915ccbe9-934e-4a54-af20-ebbfedfbd63c",
            "64a52688-119b-4692-af97-aab9dca7b12a"
          ],
          "display_name": false
        },
        {
          "uuid": "2d8dece0-8127-8c41-6aed-65915ef3cfd0",
          "name": "ZIDOVUDINE RELATED COMPOUND D [USP IMPURITY]",
          "stdName": "ZIDOVUDINE RELATED COMPOUND D [USP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7be16e39-24c7-67a4-e9eb-f499638fa5a0"
          ],
          "display_name": false
        },
        {
          "uuid": "8072832d-62f3-43f2-b0bf-d942b17269f3",
          "name": "ZIDOVUDINE RELATED COMPOUND D [USP-RS]",
          "stdName": "ZIDOVUDINE RELATED COMPOUND D [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e8d8505-105d-4af9-bb3a-fcabd008f63c",
            "c86da814-4fdb-44af-863b-3ef778d6de33"
          ],
          "display_name": false
        },
        {
          "uuid": "e3655c28-51fb-5c1b-bcb0-a8f0a2959888",
          "name": "doxribtimine [INN]",
          "stdName": "DOXRIBTIMINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cbd334b4-96c7-03c7-35a4-0a3628c9669a"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "fa3bc5d9-d52b-43bb-b5c4-82672dae9daf"
      }
    }
  ]
}