{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0a7b5b62-f39f-4332-80be-e0b5871750f2",
          "code": "156595-85-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=156595-85-6",
          "code_system": "CAS",
          "references": [
            "c74a4cf9-3cda-42d7-9691-b01cf80ec862",
            "fe56d4d4-53ea-40e8-92e2-1f3ab3f7b742"
          ]
        },
        {
          "uuid": "cd9bc214-6ef0-4383-9918-71856983c30b",
          "code": "158376",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/158376",
          "code_system": "PUBCHEM",
          "references": [
            "c74a4cf9-3cda-42d7-9691-b01cf80ec862"
          ]
        },
        {
          "uuid": "4ea81edb-0625-74a1-664e-4677df33afed",
          "code": "DB02026",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB02026",
          "code_system": "DRUG BANK",
          "references": [
            "e95e90bb-f559-bf4f-2e5e-7f1c3a8ff094"
          ]
        },
        {
          "uuid": "f34a7217-b211-b0d4-f819-2fef397a9137",
          "code": "DTXSID50166105",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50166105",
          "code_system": "EPA CompTox",
          "references": [
            "fef1c0d5-1b1a-6757-7370-fa0b49ae7013"
          ]
        },
        {
          "uuid": "9f1a83f5-e34b-4069-8682-10487dfba363",
          "code": "VBP3BN3U2V",
          "type": "PRIMARY",
          "code_system": "FDA UNII",
          "references": [
            "fe56d4d4-53ea-40e8-92e2-1f3ab3f7b742"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f9571cc2-7f78-445a-a86c-6d974742d2b9",
          "name": "(2S)-2-({4-[({2,4-diaminofuro[2,3-d]pyrimidin-5-yl}methyl)(methyl)amino]phenyl}formamido)pentanedioic acid",
          "stdName": "(2S)-2-((4-(((2,4-DIAMINOFURO(2,3-D)PYRIMIDIN-5-YL)METHYL)(METHYL)AMINO)PHENYL)FORMAMIDO)PENTANEDIOIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe56d4d4-53ea-40e8-92e2-1f3ab3f7b742"
          ],
          "display_name": false
        },
        {
          "uuid": "b0b6e687-27d7-4455-9b84-45d719a852c2",
          "name": "Furo(2,3d)pyrimidine antifolate",
          "stdName": "FURO(2,3D)PYRIMIDINE ANTIFOLATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "028d78f7-0005-4733-9662-7b6b9f474e13",
            "5aba6bb1-4b7c-4bf3-a38b-79ce14e13675"
          ],
          "display_name": true
        },
        {
          "uuid": "9a9e345b-9c7c-4d8f-8cb2-18f8055fad81",
          "name": "L-Glutamic acid, N-[4-[[(2,4-diaminofuro[2,3-d]pyrimidin-5-yl)methyl]methylamino]benzoyl]-",
          "stdName": "L-GLUTAMIC ACID, N-(4-(((2,4-DIAMINOFURO(2,3-D)PYRIMIDIN-5-YL)METHYL)METHYLAMINO)BENZOYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe56d4d4-53ea-40e8-92e2-1f3ab3f7b742"
          ],
          "display_name": false
        },
        {
          "uuid": "4ff62599-81fb-4047-b00c-893f68b7418f",
          "name": "MTXO",
          "stdName": "MTXO",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe56d4d4-53ea-40e8-92e2-1f3ab3f7b742"
          ],
          "display_name": false
        },
        {
          "uuid": "eb47d70d-7a4f-45e4-bafa-b93b2b27f2f3",
          "name": "N-(4-(N-((2,4-diamino-furo(2,3-d)pyrimidin-5-yl)methyl)methylamino)benzoyl)glutamic acid",
          "stdName": "N-(4-(N-((2,4-DIAMINO-FURO(2,3-D)PYRIMIDIN-5-YL)METHYL)METHYLAMINO)BENZOYL)GLUTAMIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe56d4d4-53ea-40e8-92e2-1f3ab3f7b742"
          ],
          "display_name": false
        },
        {
          "uuid": "b66eb595-0601-4322-9bd7-ab237143a944",
          "name": "N-[4-[[(2,4-Diaminofuro[2,3-d]pyrimidin-5-yl)methyl]methylamino]benzoyl]-L-glutamic acid (ACI)",
          "stdName": "N-(4-(((2,4-DIAMINOFURO(2,3-D)PYRIMIDIN-5-YL)METHYL)METHYLAMINO)BENZOYL)-L-GLUTAMIC ACID (ACI)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe56d4d4-53ea-40e8-92e2-1f3ab3f7b742"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "028d78f7-0005-4733-9662-7b6b9f474e13",
          "citation": "Drug Bank",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c74a4cf9-3cda-42d7-9691-b01cf80ec862",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393565000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba8a6164-d7da-4a38-8ad8-5daeb3e281b2",
          "citation": "Drug Bank DB02026",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7cb16849-e258-d34a-a090-29453e6696e3",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=156595-85-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e95e90bb-f559-bf4f-2e5e-7f1c3a8ff094",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "fe56d4d4-53ea-40e8-92e2-1f3ab3f7b742",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fef1c0d5-1b1a-6757-7370-fa0b49ae7013",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "5aba6bb1-4b7c-4bf3-a38b-79ce14e13675",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3f8cc5c8-0e72-4c8a-80ef-a23c9559dfc3",
          "id": "3f8cc5c8-0e72-4c8a-80ef-a23c9559dfc3",
          "molfile": "\n  Marvin  06262315362D          \n\n 32 34  0  0  1  0            999 V2000\n    3.1492    2.8579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5617    2.1434    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1492    1.4290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7954    4.5873    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    5.1815    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8617    2.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2742    1.4290    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2742    2.8579    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0992    1.4290    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.5117    2.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5117    0.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3367    2.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3367    0.7145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0992    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7492    2.8579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5742    2.8579    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3367    3.5724    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3242    2.8579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8393    3.5254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8393    2.1905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0547    3.2704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0108    4.3323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0547    2.4454    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4415    3.8225    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3977    4.8843    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6131    4.6294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3867    2.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7992    1.4290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7992    2.8579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6242    1.4290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6242    2.8579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0367    2.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 18  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2 27  1  0  0  0  0\n  4 22  1  0  0  0  0\n  5 26  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  2  0  0  0  0\n  6 32  1  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  1  0  0  0\n  9 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 11 14  2  0  0  0  0\n 12 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\n 19 21  1  0  0  0  0\n 19 22  2  0  0  0  0\n 20 23  1  0  0  0  0\n 21 23  1  0  0  0  0\n 21 24  2  0  0  0  0\n 22 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 25 26  2  0  0  0  0\n 27 28  2  0  0  0  0\n 27 29  1  0  0  0  0\n 28 30  1  0  0  0  0\n 29 31  2  0  0  0  0\n 30 32  2  0  0  0  0\n 31 32  1  0  0  0  0\nM  END",
          "smiles": "CN(Cc1coc2c1c(N)nc(N)n2)c3ccc(cc3)C(=O)N[C@@H](CCC(=O)O)C(=O)O",
          "formula": "C20H22N6O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bedfdb74-d91a-4c1c-b998-0ca2de777987"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "442.4261",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ac845f10-c1d2-4666-8212-1bb815f7b56d",
      "version": "9",
      "structure": {
        "id": "22afe821-2b1e-4874-81be-d36b12428420",
        "molfile": "N-[4-[[(2,4-Diaminofuro[2,3-d]pyrimidin-5-yl)methyl]methylamino]benzoyl]-L-gl...\n   JSDraw206262315362D\n\n 32 34  0  0  1  0              0 V2000\n   20.5014   -7.1909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.2814   -8.5418    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   20.5014   -9.8928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.8324   -3.9207    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5466   -2.7971    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   27.5214   -8.5418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.3014   -9.8928    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   28.3014   -7.1909    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   29.8614   -9.8928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.6414   -8.5418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.6414  -11.2437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   32.2014   -8.5418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   32.2014  -11.2437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   29.8614  -12.5949    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   32.9814   -7.1909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   34.5414   -7.1909    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   32.2014   -5.8398    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.9414   -7.1909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.0245   -5.9287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.0245   -8.4529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5408   -6.4109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.3488   -4.4028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5408   -7.9709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3815   -5.3669    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1896   -3.3590    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7058   -3.8410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.8414   -8.5418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.6214   -9.8928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.6214   -7.1909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.1814   -9.8928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.1814   -7.1909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9614   -8.5418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 18  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2 27  1  0  0  0  0\n  4 22  1  0  0  0  0\n  5 26  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  2  0  0  0  0\n  6 32  1  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  1  0  0  0\n  9 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 11 14  2  0  0  0  0\n 12 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\n 19 21  1  0  0  0  0\n 19 22  2  0  0  0  0\n 20 23  1  0  0  0  0\n 21 23  1  0  0  0  0\n 21 24  2  0  0  0  0\n 22 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 25 26  2  0  0  0  0\n 27 28  2  0  0  0  0\n 27 29  1  0  0  0  0\n 28 30  1  0  0  0  0\n 29 31  2  0  0  0  0\n 30 32  2  0  0  0  0\n 31 32  1  0  0  0  0\nM  END",
        "smiles": "CN(Cc1coc2c1c(N)nc(N)n2)c3ccc(cc3)C(=O)N[C@@H](CCC(=O)O)C(=O)O",
        "formula": "C20H22N6O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "442.4261",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "ba8a6164-d7da-4a38-8ad8-5daeb3e281b2",
          "fe56d4d4-53ea-40e8-92e2-1f3ab3f7b742"
        ],
        "stereo_centers": 1
      },
      "unii": "VBP3BN3U2V"
    }
  ]
}