{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c6208cc6-b34a-421e-a7ed-a34ec8ba11c2",
          "code": "4378-61-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4378-61-4",
          "code_system": "CAS",
          "references": [
            "a59b9f18-99af-4b7d-8f70-6dc3d832e178",
            "53b76a98-d5a7-4bb9-a5fc-71358668bf1c"
          ]
        },
        {
          "uuid": "078026e9-b8bb-4acf-b72d-8ef32e701726",
          "code": "224-481-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.022.257",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a59b9f18-99af-4b7d-8f70-6dc3d832e178"
          ]
        },
        {
          "uuid": "3376d6e4-d679-4782-ab2e-daac47777956",
          "code": "78084",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/78084",
          "code_system": "PUBCHEM",
          "references": [
            "a59b9f18-99af-4b7d-8f70-6dc3d832e178"
          ]
        },
        {
          "uuid": "15359f17-86db-8b57-2984-4d49d01a4aff",
          "code": "DTXSID8044674",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8044674",
          "code_system": "EPA CompTox",
          "references": [
            "b78225ec-d028-1269-d73e-8681a2ca4f59"
          ]
        },
        {
          "uuid": "43a7eead-148d-4802-8a0b-6fed88f1a2db",
          "code": "VAG817W276",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0c035893-1fe3-ed2a-a0fc-c989b46208f6",
          "code": "Dibromoanthanthrone",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Dibromoanthanthrone",
          "code_system": "WIKIPEDIA",
          "references": [
            "419bdb49-f690-1701-8876-ebc0cb17108e"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c7aef8c3-97c3-4836-aed5-2bad2d885411",
          "name": "4,10-DIBROMOANTHANTHRONE",
          "stdName": "4,10-DIBROMOANTHANTHRONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "467527d1-bd5b-42a7-b0d3-3dcc57c30ec1"
          ],
          "display_name": true
        },
        {
          "uuid": "94b5664d-6507-4f2f-8a7a-cad962b1efd1",
          "name": "4,10-DIBROMODIBENZO(DEF,MNO)CHRYSENE-6,12-DIONE",
          "stdName": "4,10-DIBROMODIBENZO(DEF,MNO)CHRYSENE-6,12-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "467527d1-bd5b-42a7-b0d3-3dcc57c30ec1"
          ],
          "display_name": false
        },
        {
          "uuid": "9552fb27-6f61-4a5f-8fe2-709f4ffbd581",
          "name": "BRILLIANT ORANGE RK",
          "stdName": "BRILLIANT ORANGE RK",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "467527d1-bd5b-42a7-b0d3-3dcc57c30ec1"
          ],
          "display_name": false
        },
        {
          "uuid": "4fa95732-2c2d-42c9-9230-9fb313798144",
          "name": "C.I. 59300",
          "stdName": "C.I. 59300",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "467527d1-bd5b-42a7-b0d3-3dcc57c30ec1"
          ],
          "display_name": false
        },
        {
          "uuid": "4567424a-3001-4a34-a053-72b3fe3fb40f",
          "name": "C.I. PIGMENT RED 168",
          "stdName": "C.I. PIGMENT RED 168",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "467527d1-bd5b-42a7-b0d3-3dcc57c30ec1"
          ],
          "display_name": false
        },
        {
          "uuid": "49989b09-85f0-48c7-a51b-438149ab847e",
          "name": "C.I. VAT ORANGE 3",
          "stdName": "C.I. VAT ORANGE 3",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8c6de3ff-22c1-497b-8ff1-ff0a8030d333"
          ],
          "display_name": false
        },
        {
          "uuid": "71115960-2a54-4ce7-8bc9-e863d89230e7",
          "name": "CI 59300",
          "stdName": "CI 59300",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ea01ed5e-707d-41e9-a90b-b7ede1c23454"
          ],
          "display_name": false
        },
        {
          "uuid": "6e12af63-b861-4107-9716-11bc6b222391",
          "name": "CI VAT ORANGE 3",
          "stdName": "CI VAT ORANGE 3",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ea01ed5e-707d-41e9-a90b-b7ede1c23454"
          ],
          "display_name": false
        },
        {
          "uuid": "c295bc72-f8a4-4731-8435-ca4ae6ddc37c",
          "name": "DIBENZO(DEF,MNO)CHRYSENE-6,12-DIONE, 4,10-DIBROMO-",
          "stdName": "DIBENZO(DEF,MNO)CHRYSENE-6,12-DIONE, 4,10-DIBROMO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "467527d1-bd5b-42a7-b0d3-3dcc57c30ec1"
          ],
          "display_name": false
        },
        {
          "uuid": "e488440d-b5a6-4cc3-a9a9-670dc5f87e4d",
          "name": "PIGMENT RED 168",
          "stdName": "PIGMENT RED 168",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ea01ed5e-707d-41e9-a90b-b7ede1c23454"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ea01ed5e-707d-41e9-a90b-b7ede1c23454",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "467527d1-bd5b-42a7-b0d3-3dcc57c30ec1",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a59b9f18-99af-4b7d-8f70-6dc3d832e178",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392084000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "128f660a-7a5b-46d1-a8f9-6238771bd791",
          "citation": "SRS import [VAG817W276]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=VAG817W276",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392084000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8c6de3ff-22c1-497b-8ff1-ff0a8030d333",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b78225ec-d028-1269-d73e-8681a2ca4f59",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4378-61-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "419bdb49-f690-1701-8876-ebc0cb17108e",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "53b76a98-d5a7-4bb9-a5fc-71358668bf1c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "cb73a6fb-4f78-4b49-bafe-d7bb3eae2a0b",
          "id": "cb73a6fb-4f78-4b49-bafe-d7bb3eae2a0b",
          "molfile": "\n  Marvin  01132110302D          \n\n 26 31  0  0  0  0            999 V2000\n    5.0046   -0.8257    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    4.2890   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5783   -0.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8627   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8627   -2.0619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5783   -2.4723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2890   -2.0619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0046   -2.4723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0046   -3.2981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2890   -3.7084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5783   -3.2981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8627   -3.7084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8627   -4.5342    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1520   -3.2981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4364   -3.7084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7157   -3.2981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.7084    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    0.7157   -2.4723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.0619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7157   -0.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4364   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4364   -2.0619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1520   -2.4723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1520   -0.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1520    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  7  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  4 25  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 24  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 11  2  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 12  1  0  0  0  0\n 14 15  1  0  0  0  0\n 24 14  2  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 16  1  0  0  0  0\n 18 19  1  0  0  0  0\n 23 18  2  0  0  0  0\n 19 20  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 22 25  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 26  2  0  0  0  0\nM  END",
          "smiles": "c1cc2c(cc3c-4c2c(c1)c(=O)c5cc(c6cccc(c6c54)c3=O)Br)Br",
          "formula": "C22H8Br2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a141f65b-cafb-4391-9fb3-31134c82b741"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "464.1056",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "743bd476-af75-408a-8e9f-231bc0f1459a",
      "version": "5",
      "structure": {
        "id": "8f0c2195-aa2f-4be7-bcda-f01cd71a2a3b",
        "molfile": "\n  Marvin  01132107252D          \n\n 26 31  0  0  0  0            999 V2000\n    2.8627   -2.0619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1520   -2.4723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4364   -2.0619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5783   -2.4723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1520   -3.2981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8627   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5783   -3.2981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4364   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1520   -0.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8627   -3.7084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7157   -2.4723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2890   -2.0619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2890   -3.7084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7157   -0.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.0619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0046   -2.4723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0046   -3.2981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5783   -0.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2890   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4364   -3.7084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7157   -3.2981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1520    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8627   -4.5342    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0046   -0.8257    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.7084    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  4  2  0  0  0  0\n  1  6  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  5  1  0  0  0  0\n  3  8  1  0  0  0  0\n  3 11  1  0  0  0  0\n  4  7  1  0  0  0  0\n  4 12  1  0  0  0  0\n  5 10  1  0  0  0  0\n  5 21  2  0  0  0  0\n  6  9  1  0  0  0  0\n  6 19  2  0  0  0  0\n  7 10  1  0  0  0  0\n  7 13  2  0  0  0  0\n  8  9  1  0  0  0  0\n  8 14  2  0  0  0  0\n  9 23  2  0  0  0  0\n 10 24  2  0  0  0  0\n 11 15  1  0  0  0  0\n 11 22  2  0  0  0  0\n 12 16  1  0  0  0  0\n 12 20  2  0  0  0  0\n 13 18  1  0  0  0  0\n 14 17  1  0  0  0  0\n 15 17  2  0  0  0  0\n 16 18  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 25  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 26  1  0  0  0  0\nM  END",
        "smiles": "c1cc2c(cc3c-4c2c(c1)c(=O)c5cc(c6cccc(c6c54)c3=O)Br)Br",
        "formula": "C22H8Br2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "464.1056",
        "optical_activity": "NONE",
        "references": [
          "128f660a-7a5b-46d1-a8f9-6238771bd791",
          "8c6de3ff-22c1-497b-8ff1-ff0a8030d333"
        ],
        "stereo_centers": 0
      },
      "unii": "VAG817W276"
    }
  ]
}