{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bfdfed74-6b4d-4267-a2ad-74b8d38ad98e",
          "code": "11006-34-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=11006-34-1",
          "code_system": "CAS",
          "references": [
            "011bd004-6733-4c59-bd5c-b2eeca12a7c0",
            "cfb1355a-d809-49f4-ac96-8011ee914bdd"
          ]
        },
        {
          "uuid": "5ffe0ade-0ad0-4b91-84ff-41e08f805d75",
          "code": "234-242-5",
          "type": "PRIMARY",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "011bd004-6733-4c59-bd5c-b2eeca12a7c0"
          ]
        },
        {
          "uuid": "76c582f6-84d5-26c8-1d13-49c9cb576f42",
          "code": "9875143",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9875143",
          "code_system": "PUBCHEM",
          "references": [
            "03dad489-c41b-cc38-0f6a-515cf0b20209"
          ]
        },
        {
          "uuid": "dbbe651c-cca4-489b-9009-f33f5f0c4b8d",
          "code": "VAC44EX123",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6c38b9f0-3c19-9383-b5b4-fdce7ec0cd98",
          "code": "VAC44EX123",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=VAC44EX123",
          "code_system": "DAILYMED",
          "references": [
            "cfef2bb1-bba5-995b-69ec-bf67e4542725"
          ]
        },
        {
          "uuid": "06ec4a4e-1056-c086-6a23-789e721e4f87",
          "code": "2583872",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2583872/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "34323bf5-dfc0-0c61-9718-08ee2912a712"
          ]
        },
        {
          "uuid": "c90ee18b-38ee-15ee-7d77-e5b7d68cb58c",
          "code": "DTXSID1045956",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1045956",
          "code_system": "EPA CompTox",
          "references": [
            "9f1f7dec-8a88-9018-2581-66fa7cbdfd6e"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "da941029-54ba-4b86-94af-bc110f89686e",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "42064e2d-74e5-49d5-979a-2f6864e5d0f9",
            "refuuid": "fb2b9b51-d768-4c6f-99e7-99071d83a4fb",
            "name": "CUPRIC CATION",
            "unii": "8CBV67279L",
            "linking_id": "8CBV67279L",
            "ref_pname": "CUPRIC CATION",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9a20bf22-cf1d-4758-8346-027d1b7bba58",
          "name": "CUPRATE(3-), ((7S,8S)-3-CARBOXY-5-(CARBOXYMETHYL)-13-ETHENYL-18-ETHYL-7,8-DIHYDRO-2,8,12,17-TETRAMETHYL-21H,23H-PORPHINE-7-PROPANOATO(5-)-.KAPPA.N21,.KAPPA.N22,.KAPPA.N23,.KAPPA.N24)-, SODIUM (1:3), (SP-4-2)-",
          "stdName": "CUPRATE(3-), ((7S,8S)-3-CARBOXY-5-(CARBOXYMETHYL)-13-ETHENYL-18-ETHYL-7,8-DIHYDRO-2,8,12,17-TETRAMETHYL-21H,23H-PORPHINE-7-PROPANOATO(5-)-.KAPPA.N21,.KAPPA.N22,.KAPPA.N23,.KAPPA.N24)-, SODIUM (1:3), (SP-4-2)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "327c097f-408a-4cde-8832-d21b47e2ce75"
          ],
          "display_name": false
        },
        {
          "uuid": "9e24cf03-618a-478d-af0f-4fb862d88641",
          "name": "SODIUM COPPER CHLOROPHYLLIN A",
          "stdName": "SODIUM COPPER CHLOROPHYLLIN A",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c6325bd2-46da-469f-b06c-cc75030dde01"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "c6325bd2-46da-469f-b06c-cc75030dde01",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "327c097f-408a-4cde-8832-d21b47e2ce75",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "011bd004-6733-4c59-bd5c-b2eeca12a7c0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390907000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f1c43095-b6cb-4fff-a66f-6d234e05198d",
          "citation": "SRS import [VAC44EX123]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=VAC44EX123",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390907000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "42e5c790-8732-411e-b858-5990e079ecb4",
          "citation": "fda_srs",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa7bf820-ce60-b486-97b4-468e78af89e0",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=11006-34-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "34323bf5-dfc0-0c61-9718-08ee2912a712",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "03dad489-c41b-cc38-0f6a-515cf0b20209",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "cfb1355a-d809-49f4-ac96-8011ee914bdd",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "cfef2bb1-bba5-995b-69ec-bf67e4542725",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "9f1f7dec-8a88-9018-2581-66fa7cbdfd6e",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "33905a45-adc2-4dec-b0cb-2b14eeeae439",
          "id": "33905a45-adc2-4dec-b0cb-2b14eeeae439",
          "molfile": "\n  Marvin  01132102452D          \n\n  1  0  0  0  1  0            999 V2000\n    3.4266  -17.5177    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 3,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 3,
            "units": "MOL RATIO",
            "uuid": "8fce598d-f532-416d-9ee4-dcc7992b000b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "de857556-3252-4b02-8f1b-01711323a884",
          "id": "de857556-3252-4b02-8f1b-01711323a884",
          "molfile": "\n  Marvin  01132111322D          \n\n  1  0  0  0  1  0            999 V2000\n    4.3885  -10.9763    0.0000 Cu  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Cu+2]",
          "formula": "Cu",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b54d7c0b-69a9-4dd0-bab8-5cd92240272c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "63.5456",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "bc5a1c52-f7a5-408f-89dd-9f1416e9e193",
          "id": "bc5a1c52-f7a5-408f-89dd-9f1416e9e193",
          "molfile": "\n  Marvin  01132109442D          \n\n 44 48  0  0  1  0            999 V2000\n    2.6908  -12.3637    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    1.8662  -12.3571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0637  -11.5991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6784  -10.8983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0513  -10.1291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8391   -9.9812    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0133   -9.1793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7450   -8.7935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4570   -9.1673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6054   -9.9908    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3754  -10.1035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7921  -10.8348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4183  -11.5373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5953  -11.7261    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4568  -12.5181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2524  -12.8906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5935  -13.7534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5924  -13.5238    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.7133  -14.9302    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8050  -12.3311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6238  -12.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7514  -12.9034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9129  -13.7440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6710  -14.3660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4701  -14.8766    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.9098  -14.8730    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0127  -12.5038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8868  -11.7372    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2598  -12.9208    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.2508  -13.7371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5328  -14.1472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8197  -13.7324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8150  -12.9118    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    1.1017  -14.1427    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7794   -9.3338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5958   -9.3315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0014  -10.0400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2150   -8.7765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2066   -7.9515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2801   -8.8369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2741   -8.0121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5562   -7.6018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6925   -9.4280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8709   -9.4200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 29  1  0  0  0  0\n  3  4  1  0  0  0  0\n 28  3  2  0  0  0  0\n  5  4  2  0  0  0  0\n  5  6  1  0  0  0  0\n 43  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n 40  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n  9 10  1  0  0  0  0\n 38  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 35 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 13 14  1  0  0  0  0\n 20 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 15  1  0  0  0  0\n 15 22  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 20  2  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  2  0  0  0  0\n 20 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 27 22  2  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  2  0  0  0  0\n 27 28  1  0  0  0  0\n 29 27  1  0  0  0  0\n 29 30  1  1  0  0  0\n 30 31  1  0  0  0  0\n 31 32  1  0  0  0  0\n 32 33  1  0  0  0  0\n 32 34  2  0  0  0  0\n 35 36  1  0  0  0  0\n 35 38  2  0  0  0  0\n 36 37  1  0  0  0  0\n 38 39  1  0  0  0  0\n 40 41  1  0  0  0  0\n 40 43  2  0  0  0  0\n 41 42  2  0  0  0  0\n 43 44  1  0  0  0  0\nM  CHG  3  18  -1  25  -1  33  -1\nM  END",
          "smiles": "C=Cc1c(C)c2cc3[C@@H](C)[C@H](CCC(=O)[O-])c(c(CC(=O)[O-])c4c(c(C)c(cc5c(CC)c(C)c(cc1n2)n5)n4)C(=O)[O-])n3",
          "formula": "C34H31N4O6",
          "atropisomerism": "No",
          "charge": -3,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a65e9963-bfb7-4521-8fde-03291a43416f"
          },
          "defined_stereo": 2,
          "ez_centers": 4,
          "molecular_weight": "591.6344",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3f0762e5-f94e-4020-ad98-b037453342a1",
      "version": "9",
      "structure": {
        "id": "9113ed00-ea08-44b7-941b-a697911fa18e",
        "molfile": "\n  Marvin  01132107312D          \n\n 48 48  0  0  1  0            999 V2000\n    4.3885  -10.9763    0.0000 Cu  0  2  0  0  0  0  0  0  0  0  0  0\n    7.5924  -13.5238    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5935  -13.7534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2524  -12.8906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8050  -12.3311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4183  -11.5373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5953  -11.7261    0.0000 N   0  5  0  0  0  0  0  0  0  0  0  0\n    5.4568  -12.5181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7514  -12.9034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9129  -13.7440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6710  -14.3660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4701  -14.8766    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9098  -14.8730    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.0127  -12.5038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2598  -12.9208    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.2508  -13.7371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5328  -14.1472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8197  -13.7324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8150  -12.9118    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1017  -14.1427    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.6908  -12.3637    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    1.8662  -12.3571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0637  -11.5991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6784  -10.8983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0513  -10.1291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6925   -9.4280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2801   -8.8369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0133   -9.1793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8391   -9.9812    0.0000 N   0  5  0  0  0  0  0  0  0  0  0  0\n    4.7450   -8.7935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4570   -9.1673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2150   -8.7765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2066   -7.9515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7794   -9.3338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5958   -9.3315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0014  -10.0400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3754  -10.1035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7921  -10.8348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6054   -9.9908    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2741   -8.0121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5562   -7.6018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8709   -9.4200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8868  -11.7372    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6238  -12.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7133  -14.9302    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.4266  -17.5177    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n    3.4266  -17.5177    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n    3.4266  -17.5177    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  4  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 14  9  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  1  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  1  0  0  0  0\n 21 15  1  0  0  0  0\n 21 22  1  6  0  0  0\n 21 23  1  0  0  0  0\n 23 24  2  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  2  0  0  0  0\n 27 26  1  0  0  0  0\n 27 28  2  0  0  0  0\n 29 28  1  0  0  0  0\n 25 29  1  0  0  0  0\n 28 30  1  0  0  0  0\n 31 30  2  0  0  0  0\n 32 31  1  0  0  0  0\n 32 33  1  0  0  0  0\n 34 32  2  0  0  0  0\n 34 35  1  0  0  0  0\n 35 36  1  0  0  0  0\n 34 37  1  0  0  0  0\n 37 38  1  0  0  0  0\n  6 38  2  0  0  0  0\n 39 37  2  0  0  0  0\n 31 39  1  0  0  0  0\n 27 40  1  0  0  0  0\n 40 41  2  0  0  0  0\n 26 42  1  0  0  0  0\n 43 23  1  0  0  0  0\n 14 43  2  0  0  0  0\n  5 44  1  0  0  0  0\n  3 45  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\nM  CHG  8   1   2   7  -1  13  -1  20  -1  29  -1  45  -1  46   1  47   1\nM  CHG  1  48   1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  3  46  47  48\nM  SPA   1  1  46\nM  SDI   1  4    3.0066  -17.9377    3.0066  -17.0977\nM  SDI   1  4    3.8466  -17.0977    3.8466  -17.9377\nM  SMT   1 3\nM  END",
        "smiles": "C=Cc1c(C)c2cc3[C@@H](C)[C@H](CCC(=O)[O-])c(c(CC(=O)[O-])c4c(c(C)c(cc5C(=C(C)c(cc1[n-]2)n5)CC)[n-]4)C(=O)[O-])n3.[Cu+2].[Na+].[Na+].[Na+]",
        "formula": "C34H31N4O6.Cu.3Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 4,
        "molecular_weight": "724.1494",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "42e5c790-8732-411e-b858-5990e079ecb4",
          "f1c43095-b6cb-4fff-a66f-6d234e05198d"
        ],
        "stereo_centers": 2
      },
      "unii": "VAC44EX123"
    }
  ]
}