{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c4a12330-b990-423e-9753-340b018fb526",
          "code": "115-25-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=115-25-3",
          "code_system": "CAS",
          "references": [
            "d1b82352-6d04-4488-bd63-8784e9e6b5fe",
            "fc2cf607-19ca-4fca-9f4c-93e6dd9c0723"
          ]
        },
        {
          "uuid": "99d79fc7-185e-441c-8cc2-94cc9d68db1b",
          "code": "C007785",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67007785",
          "code_system": "MESH",
          "references": [
            "d1b82352-6d04-4488-bd63-8784e9e6b5fe"
          ]
        },
        {
          "uuid": "a7781099-8a08-4354-963a-eef5d0647a71",
          "code": "OCTAFLUOROCYCLOBUTANE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Octafluorocyclobutane",
          "code_system": "WIKIPEDIA",
          "references": [
            "d1b82352-6d04-4488-bd63-8784e9e6b5fe"
          ]
        },
        {
          "uuid": "e60b5a21-23fd-4848-9307-e63d006f6ad2",
          "code": "21 CFR 173.360",
          "comments": "PART 173 -- SECONDARY DIRECT FOOD ADDITIVES PERMITTED IN FOOD FOR HUMAN CONSUMPTION|Subpart D--Specific Usage Additives|Sec. 173.360 Octafluorocyclobutane.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=173.360",
          "code_system": "CFR",
          "references": [
            "d1b82352-6d04-4488-bd63-8784e9e6b5fe"
          ]
        },
        {
          "uuid": "d757ea8c-786b-4239-8787-6c268fa68355",
          "code": "m8104",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8104?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d1b82352-6d04-4488-bd63-8784e9e6b5fe"
          ]
        },
        {
          "uuid": "37bac64d-5623-4f90-b450-39c040794b6e",
          "code": "204-075-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.003.705",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d1b82352-6d04-4488-bd63-8784e9e6b5fe"
          ]
        },
        {
          "uuid": "4dbe723a-d8c2-48c8-a6ce-b8db1cb2bc8b",
          "code": "8263",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/8263",
          "code_system": "PUBCHEM",
          "references": [
            "d1b82352-6d04-4488-bd63-8784e9e6b5fe"
          ]
        },
        {
          "uuid": "829f03dc-fc11-1231-6bec-cbabfe3019e9",
          "code": "DTXSID9041811",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9041811",
          "code_system": "EPA CompTox",
          "references": [
            "4fb5d1a6-d06c-b9de-f1be-4cd2a1af9491"
          ]
        },
        {
          "uuid": "8d279b84-a486-4fe5-9925-4af1bbb9f5fe",
          "code": "V9P1D0A21K",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0121c213-feee-30c6-0dff-abca00857df5",
          "code": "31007",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:31007",
          "code_system": "CHEBI",
          "references": [
            "a3c0be5c-589a-5538-ae02-2c4d053947c7"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fc195c89-0a3a-40f1-805b-1fc45ac489fe",
          "name": "FREON C318",
          "stdName": "FREON C318",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a5360020-e0d4-45a3-8ef7-bf737c7b75c1",
            "ff203407-6680-4823-a537-a85380373d70"
          ],
          "display_name": false
        },
        {
          "uuid": "c226f819-ab20-40fc-ae98-08a22ff758f9",
          "name": "OCTAFLUOROCYCLOBUTANE",
          "stdName": "OCTAFLUOROCYCLOBUTANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4983390f-15f2-4329-91a5-7c4b2fd972bf",
            "8c669c79-edc9-4a7f-a422-68f3866dc3e9",
            "a5360020-e0d4-45a3-8ef7-bf737c7b75c1",
            "ff203407-6680-4823-a537-a85380373d70"
          ],
          "display_name": true
        },
        {
          "uuid": "0dd138e5-8c16-48e4-b4a6-d83c9470cca0",
          "name": "OCTAFLUOROCYCLOBUTANE [MI]",
          "stdName": "OCTAFLUOROCYCLOBUTANE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4983390f-15f2-4329-91a5-7c4b2fd972bf",
            "ff203407-6680-4823-a537-a85380373d70"
          ],
          "display_name": false
        },
        {
          "uuid": "3e4cc6ab-125d-4a1e-9f08-546b1df97016",
          "name": "PERFLUOROCYCLOBUTANE",
          "stdName": "PERFLUOROCYCLOBUTANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a5360020-e0d4-45a3-8ef7-bf737c7b75c1",
            "ff203407-6680-4823-a537-a85380373d70"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a5360020-e0d4-45a3-8ef7-bf737c7b75c1",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4983390f-15f2-4329-91a5-7c4b2fd972bf",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff203407-6680-4823-a537-a85380373d70",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d1b82352-6d04-4488-bd63-8784e9e6b5fe",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389702000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9b0c9a59-e4c6-4cd2-97f8-f3f1b30f27f3",
          "citation": "SRS import [V9P1D0A21K]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=V9P1D0A21K",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389702000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8c669c79-edc9-4a7f-a422-68f3866dc3e9",
          "citation": "OCTAFLUOROCYCLOBUTANE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4fb5d1a6-d06c-b9de-f1be-4cd2a1af9491",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=115-25-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fc2cf607-19ca-4fca-9f4c-93e6dd9c0723",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a3c0be5c-589a-5538-ae02-2c4d053947c7",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6a6f227a-9aa9-47d2-bb46-8c1c257b3cd0",
          "id": "6a6f227a-9aa9-47d2-bb46-8c1c257b3cd0",
          "molfile": "\n  Marvin  01132105322D          \n\n 12 12  0  0  0  0            999 V2000\n   -0.7083   -5.8667    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7000   -6.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1167   -6.6917    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7000   -7.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1167   -7.5167    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7083   -8.3417    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5250   -7.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3583   -7.5125    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5333   -8.3417    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5250   -6.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5333   -5.8667    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3583   -6.6917    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2 10  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  4  1  0  0  0  0\n  4  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  1  0  0  0  0\n  7 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 10  1  0  0  0  0\nM  END",
          "smiles": "C1(C(C(C1(F)F)(F)F)(F)F)(F)F",
          "formula": "C4F8",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ecc91b6c-9659-40b2-ad30-20d0310ebc97"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "200.0302",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0083f41d-9e81-488d-bf03-3df095a01103",
      "version": "4",
      "structure": {
        "id": "39442ca8-3874-44c2-b0e7-69c7d4db0603",
        "molfile": "\n  Marvin  01132103022D          \n\n 12 12  0  0  0  0            999 V2000\n   -1.5250   -6.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5250   -7.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7000   -7.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7000   -6.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7083   -5.8667    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1167   -6.6917    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1167   -7.5167    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7083   -8.3417    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3583   -7.5125    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5333   -8.3417    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5333   -5.8667    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3583   -6.6917    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  3  1  0  0  0  0\n  8  3  1  0  0  0  0\n  9  2  1  0  0  0  0\n 10  2  1  0  0  0  0\n 11  1  1  0  0  0  0\n 12  1  1  0  0  0  0\n  4  3  1  0  0  0  0\nM  END",
        "smiles": "C1(C(C(C1(F)F)(F)F)(F)F)(F)F",
        "formula": "C4F8",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "200.0302",
        "optical_activity": "NONE",
        "references": [
          "a5360020-e0d4-45a3-8ef7-bf737c7b75c1",
          "9b0c9a59-e4c6-4cd2-97f8-f3f1b30f27f3"
        ],
        "stereo_centers": 0
      },
      "unii": "V9P1D0A21K"
    }
  ]
}