{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "72202620-f594-49ad-83db-fabc9b30531a", "code": "V9D92S9YE5", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "bcc65eb9-96d7-465a-b941-bd65e1401bda", "code": "820-605-0", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.255.107", "code_system": "ECHA (EC/EINECS)", "references": [ "1b2e9caf-56ee-4e15-a2d4-351ad5782357" ] }, { "uuid": "137c5bde-d5f8-4731-88cd-25ce50e0c792", "code": "30881-23-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=30881-23-3", "code_system": "CAS", "references": [ "0afe7ec4-ca4c-4940-84d9-2531dfd98a69" ] }, { "uuid": "30d7f930-7626-f5d1-1c46-b1e0413a1035", "code": "DTXSID80184892", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80184892", "code_system": "EPA CompTox", "references": [ "ae1eb5d1-30ce-b165-2bb5-8b562d9314e9" ] }, { "uuid": "944a816b-31fb-f6c7-5beb-0f1ccb3860e9", "code": "V9D92S9YE5", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=(V9D92S9YE5)", "code_system": "DAILYMED", "references": [ "2d9f58ef-eb96-bd47-1e0a-f014495bec73" ] }, { "uuid": "1e5deef8-a9fe-bb57-b88c-5e19cc577260", "code": "207830", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/207830", "code_system": "PUBCHEM", "references": [ "5d49d7d8-019a-2590-893a-4af1797e7f83" ] } ], "substance_class": "chemical", "names": [ { "uuid": "df903c95-3e2c-4e4f-b9e6-af9bfb579343", "name": "2,4-Pentanedione, 3-[(4-hydroxy-3-methoxyphenyl)methyl]-", "stdName": "2,4-PENTANEDIONE, 3-((4-HYDROXY-3-METHOXYPHENYL)METHYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "0afe7ec4-ca4c-4940-84d9-2531dfd98a69" ], "display_name": false }, { "uuid": "312bac58-6073-4601-818e-26e9a8e1d648", "name": "3-[(4-Hydroxy-3-methoxyphenyl)methyl]-2,4-pentanedione", "stdName": "3-((4-HYDROXY-3-METHOXYPHENYL)METHYL)-2,4-PENTANEDIONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "0afe7ec4-ca4c-4940-84d9-2531dfd98a69" ], "display_name": false }, { "uuid": "e735ce2c-f185-47a2-b44d-c533b8d52123", "name": "Acetyl Zingerone", "stdName": "ACETYL ZINGERONE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "1b2e9caf-56ee-4e15-a2d4-351ad5782357" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "bbb3f75f-3146-4900-8438-50be06655dc8", "name_org": "INCI" } ] }, { "uuid": "da77f4c8-9315-43d6-9e59-f40d4d2e4c6d", "name": "Synoxyl AZ", "stdName": "SYNOXYL AZ", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "1b2e9caf-56ee-4e15-a2d4-351ad5782357" ], "display_name": false } ], "references": [ { "uuid": "1b2e9caf-56ee-4e15-a2d4-351ad5782357", "citation": "PCPC", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "0afe7ec4-ca4c-4940-84d9-2531dfd98a69", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "2d9f58ef-eb96-bd47-1e0a-f014495bec73", "citation": "DAILYMED", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "ae1eb5d1-30ce-b165-2bb5-8b562d9314e9", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true }, { "uuid": "5d49d7d8-019a-2590-893a-4af1797e7f83", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "edb048e4-5b19-4b4a-b180-d643ac24a748", "id": "edb048e4-5b19-4b4a-b180-d643ac24a748", "molfile": "3-[(4-Hydroxy-3-methoxyphenyl)methyl]-2,4-pentanedione\n CDK 12202305212D\n30881-23-3 Copyright (C) 2023 ACS\n 17 17 0 0 0 0 0 0 0 0999 V2000\n 5.3347 1.5400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6684 2.3100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0021 1.5400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6684 3.8500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0021 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3358 2.3100 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3347 4.6200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0021 4.6200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 1.5400 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 4.6200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0011 2.3100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6674 1.5400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0011 3.8500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3336 2.3100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6674 4.6200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3336 3.8500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 12 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 3 5 1 0 0 0 0\n 3 6 2 0 0 0 0\n 4 7 1 0 0 0 0\n 4 8 2 0 0 0 0\n 9 10 1 0 0 0 0\n 9 15 1 0 0 0 0\n 11 17 1 0 0 0 0\n 12 13 2 0 0 0 0\n 12 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 14 16 2 0 0 0 0\n 15 17 2 0 0 0 0\n 16 17 1 0 0 0 0\nM END", "smiles": "CC(=O)C(Cc1ccc(c(c1)OC)O)C(=O)C", "formula": "C13H16O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "3c9e6a38-3ed8-4983-84a7-db85352cd404" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "236.2642", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "1b312eb9-7eb2-4294-8166-b30053c2eb1e", "version": "7", "structure": { "id": "c113bf2c-958f-4585-afb5-35ed006cc768", "molfile": "3-[(4-Hydroxy-3-methoxyphenyl)methyl]-2,4-pentanedione\n JSDraw212202305212D\n\n 17 17 0 0 0 0 0 V2000\n 25.8435 -8.4760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1945 -7.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5455 -8.4760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1945 -6.1360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5455 -10.0360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8965 -7.6960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.8435 -5.3560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5455 -5.3560 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.4395 -8.4760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.4395 -10.0360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.4395 -5.3560 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 24.4925 -7.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.1415 -8.4760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.4925 -6.1360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.7904 -7.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.1415 -5.3560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.7904 -6.1360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 12 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 3 5 1 0 0 0 0\n 3 6 2 0 0 0 0\n 4 7 1 0 0 0 0\n 4 8 2 0 0 0 0\n 9 10 1 0 0 0 0\n 9 15 1 0 0 0 0\n 11 17 1 0 0 0 0\n 12 13 2 0 0 0 0\n 12 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 14 16 2 0 0 0 0\n 15 17 2 0 0 0 0\n 16 17 1 0 0 0 0\nM END", "smiles": "CC(=O)C(Cc1ccc(c(c1)OC)O)C(=O)C", "formula": "C13H16O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "236.2642", "optical_activity": "NONE", "references": [ "0afe7ec4-ca4c-4940-84d9-2531dfd98a69", "1b2e9caf-56ee-4e15-a2d4-351ad5782357" ], "stereo_centers": 0 }, "unii": "V9D92S9YE5" } ] }