{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "58876cb5-10d3-4128-b939-d5527750d8a1",
          "code": "562-10-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=562-10-7",
          "code_system": "CAS",
          "references": [
            "33ab3079-8195-4131-8fe2-496329133589",
            "ad9b90e0-03ad-4e52-9dee-361370e565e6"
          ]
        },
        {
          "uuid": "d901d0a7-5f07-4dc4-82e6-d73b92b7e991",
          "code": "C035385",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67035385",
          "code_system": "MESH",
          "references": [
            "33ab3079-8195-4131-8fe2-496329133589"
          ]
        },
        {
          "uuid": "ab269fed-92af-426d-aa8b-563af7747687",
          "code": "21 CFR 341.12",
          "comments": "PART 341 -- COLD, COUGH, ALLERGY, BRONCHODILATOR, AND ANTIASTHMATIC DRUG PRODUCTS FOR OVER-THE-COUNTER HUMAN USE|Subpart B--Active Ingredients|Sec. 341.12 Antihistamine active ingredients.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=341.12",
          "code_system": "CFR",
          "references": [
            "33ab3079-8195-4131-8fe2-496329133589"
          ]
        },
        {
          "uuid": "bd8351e5-5743-429d-83a1-5216b3446dd5",
          "code": "21 CFR 522.784",
          "comments": "PART 522 IMPLANTATION OR INJECTABLE DOSAGE FORM NEW ANIMAL DRUGS|Sec. 522.784 Doxylamine succinate injection.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=522.784",
          "code_system": "CFR",
          "references": [
            "33ab3079-8195-4131-8fe2-496329133589"
          ]
        },
        {
          "uuid": "593a639e-fc77-4dca-9f72-9801d1a41826",
          "code": "C47501",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47501",
          "code_system": "NCI_THESAURUS",
          "references": [
            "33ab3079-8195-4131-8fe2-496329133589"
          ]
        },
        {
          "uuid": "3311d635-c1fc-416a-ac1c-f1143bb52a3b",
          "code": "23665",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/23665/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "33ab3079-8195-4131-8fe2-496329133589"
          ]
        },
        {
          "uuid": "7d2da4f8-c46c-4716-9bd3-2a2155fde185",
          "code": "m4759",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4759?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "33ab3079-8195-4131-8fe2-496329133589"
          ]
        },
        {
          "uuid": "9aab512a-32c1-4160-8a21-b446a2f3f6b7",
          "code": "SUB01834MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "33ab3079-8195-4131-8fe2-496329133589"
          ]
        },
        {
          "uuid": "ff0b0178-d3ff-45b9-947e-a03da1abddfc",
          "code": "CHEMBL1004",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1004",
          "code_system": "ChEMBL",
          "references": [
            "33ab3079-8195-4131-8fe2-496329133589"
          ]
        },
        {
          "uuid": "7c74169a-456e-4007-972b-b4882bc6e8c0",
          "code": "209-228-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.390",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "33ab3079-8195-4131-8fe2-496329133589"
          ]
        },
        {
          "uuid": "51fe80d2-678a-44b7-9f37-7d07d058bc80",
          "code": "11224",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11224",
          "code_system": "PUBCHEM",
          "references": [
            "33ab3079-8195-4131-8fe2-496329133589"
          ]
        },
        {
          "uuid": "ff679944-89da-bfe6-dedf-94a6c70f51cf",
          "code": "DTXSID7020552",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7020552",
          "code_system": "EPA CompTox",
          "references": [
            "aa217304-d9b9-b439-1219-9a35ac88924e"
          ]
        },
        {
          "uuid": "74f681d4-0882-cb0c-2871-d1864a4f776d",
          "code": "C29578",
          "comments": "Pharmacologic Substance[C1909]|Immunotherapeutic Agent[C308]|Histamine-1 Receptor Antagonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29578",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e96a85ed-9e07-fcee-ab53-07b6720bf5ae"
          ]
        },
        {
          "uuid": "f96008f0-e6b1-4173-84f1-d138b342edcf",
          "code": "V9BI9B5YI2",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d0367783-0a95-0377-f04f-f695c0e7b911",
          "code": "DBSALT001402",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DBSALT001402",
          "code_system": "DRUG BANK",
          "references": [
            "e96a85ed-9e07-fcee-ab53-07b6720bf5ae"
          ]
        },
        {
          "uuid": "8f797337-e6a4-f9a9-f5fb-304bf1446873",
          "code": "1227006",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1227006",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "e96a85ed-9e07-fcee-ab53-07b6720bf5ae"
          ]
        },
        {
          "uuid": "10f03083-1eaa-9cbf-b201-aac3cdb3eb62",
          "code": "74772",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=74772",
          "code_system": "NSC",
          "references": [
            "4698a13a-183d-abf2-68b8-48acd0705ff5"
          ]
        },
        {
          "uuid": "4c4854aa-9966-3733-e33f-6c57d5fabac3",
          "code": "100000087529",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "631e961c-bdaa-b3b7-88d9-0ae976f689b8"
          ]
        },
        {
          "uuid": "90f4cb1f-ca8b-070b-1d5f-6edf8b1dbbe0",
          "code": "V9BI9B5YI2",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=V9BI9B5YI2",
          "code_system": "DAILYMED",
          "references": [
            "69503222-c826-334f-0c0a-98e0e3438cf5"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "cb686427-ce16-4f55-9b2c-b50f3f783024",
          "amount": {
            "uuid": "be9bb706-66b8-4bf9-8975-4004cdfb15df"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "73291090-d226-4cae-b2f3-05616045d3ed",
            "refuuid": "c6f7bdba-48ef-4f81-9413-e7788b667639",
            "name": "DOXYLAMINE",
            "unii": "95QB77JKPL",
            "linking_id": "95QB77JKPL",
            "ref_pname": "DOXYLAMINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "aba98091-cdc2-4c3e-b85f-aea95fd1f989",
          "amount": {
            "uuid": "11c20fbe-c47d-4492-b539-d5cdf64a6ba0"
          },
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "f4a665cb-6ee7-4eda-8e00-e8aeec9e42f3",
            "refuuid": "c6f7bdba-48ef-4f81-9413-e7788b667639",
            "name": "DOXYLAMINE",
            "unii": "95QB77JKPL",
            "linking_id": "95QB77JKPL",
            "ref_pname": "DOXYLAMINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a492132a-e8c7-4bc5-949f-bdcf065f7d7e",
          "amount": {
            "uuid": "a88e2dcf-0a44-4ce9-a5d4-518b0c177f86",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "31458be3-2727-4740-87fb-9d2b49a94d06"
          ],
          "related_substance": {
            "uuid": "952f6cea-3820-485b-b8ae-a80b26d299e1",
            "refuuid": "8307bd25-2703-42f1-b88f-e77d86ac06d8",
            "name": "2-(1-(2-(DIMETHYLAMINO)ETHOXY)-1-PHENYLETHYL)PYRIDINE 1-OXIDE",
            "unii": "QV5E5H59OS",
            "linking_id": "QV5E5H59OS",
            "ref_pname": "2-(1-(2-(DIMETHYLAMINO)ETHOXY)-1-PHENYLETHYL)PYRIDINE 1-OXIDE"
          }
        },
        {
          "uuid": "16ff7af0-8034-4e76-88b8-a0fdd588b0a7",
          "amount": {
            "uuid": "63aad5b3-84c0-45c5-bc62-48d6471404e8",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.15
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "c633d543-a4a2-4149-85fd-3e98a1b15f80"
          ],
          "related_substance": {
            "uuid": "ae3898a2-90fe-443b-97f7-74291688caf3",
            "refuuid": "8b804796-20f7-4311-bb01-520ed1b8ed4d",
            "name": "DOXYLAMINE ALCOHOL",
            "unii": "CW1R904IXS",
            "linking_id": "CW1R904IXS",
            "ref_pname": "DOXYLAMINE ALCOHOL"
          }
        },
        {
          "uuid": "1018d120-9afb-49fa-ab90-c968edd2f234",
          "amount": {
            "uuid": "a43b22cc-ccd0-46e4-a6b1-5005651fb7ac",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "efb223e5-4056-4feb-8942-4a84f396e741"
          ],
          "related_substance": {
            "uuid": "03464692-fdd3-4480-b4c8-6e6ca787e617",
            "refuuid": "686332fe-ed89-4c3f-ba88-436778590a90",
            "name": "DOXYLAMINE DIOXIDE",
            "unii": "VSB0Z06TOK",
            "linking_id": "VSB0Z06TOK",
            "ref_pname": "DOXYLAMINE DIOXIDE"
          }
        },
        {
          "uuid": "360a4fff-8ae2-4805-be94-12a8ebc612ee",
          "amount": {
            "uuid": "3ba935f4-11a5-4aff-bdac-8372b7f22bcc",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.15
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "7752b016-60e8-4bdc-aa8f-40e55ac1062d"
          ],
          "related_substance": {
            "uuid": "3a65f78b-671a-4bd5-9ee3-ec97d18bad58",
            "refuuid": "f93bd41d-af80-4661-8f5c-5b0c47613123",
            "name": "DOXYLAMINE PYRIDINE-4-YL ISOMER",
            "unii": "8G6OPB2RDO",
            "linking_id": "8G6OPB2RDO",
            "ref_pname": "DOXYLAMINE PYRIDINE-4-YL ISOMER"
          }
        },
        {
          "uuid": "8e94efb2-897e-4d29-9f22-3e6d5a82896b",
          "amount": {
            "uuid": "401b35cf-cb62-4d77-ae87-ba85375e3d21",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.5
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "a4d7e35d-e171-4e03-b797-5fe4acb874c0"
          ],
          "related_substance": {
            "uuid": "61cf45f2-efd2-47b6-b79c-8e4158ad6f2c",
            "refuuid": "a6b03c6b-dd89-4741-bae7-e1d754de9ba2",
            "name": "DESCHLORO CARBINOXAMINE",
            "unii": "O977IVG217",
            "linking_id": "O977IVG217",
            "ref_pname": "DESCHLORO CARBINOXAMINE"
          }
        },
        {
          "uuid": "97a7c309-4d94-467d-82f0-cab7b9c78f77",
          "amount": {
            "uuid": "457c7f8a-9ba5-4a9c-bbf6-d90dab5404f1",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.15
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "b731d77f-67e0-4514-92d7-5ea420466b25"
          ],
          "related_substance": {
            "uuid": "36f589bf-c6f9-4ee2-9d34-35c210e5230d",
            "refuuid": "0668503d-a3ab-4119-b071-ac3e7110577a",
            "name": "2-BENZOYLPYRIDINE",
            "unii": "IZ1TTI0X5O",
            "linking_id": "IZ1TTI0X5O",
            "ref_pname": "2-BENZOYLPYRIDINE"
          }
        },
        {
          "uuid": "f027b3ec-0b1a-4bb6-8df2-d098d7471ebf",
          "amount": {
            "uuid": "272bb7ab-040e-44d9-8099-a7877212be5b"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "8046178e-8603-4259-90ad-d8a763a322fc"
          ],
          "related_substance": {
            "uuid": "6f8cf2e4-cfda-4dce-940c-1a27ca79c666",
            "refuuid": "c6e11a32-66a1-477e-bac9-04036090949c",
            "name": "N-nitroso-desmethyl-doxylamine",
            "unii": "5FPJ7WVT8R",
            "linking_id": "5FPJ7WVT8R",
            "ref_pname": "N-nitroso-desmethyl-doxylamine",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "efa1d17c-bac7-4543-8bdc-7a9eca72c564",
          "name": "2-[α[2-(Dimethylamino)ethoxy]-α-methylbenzyl]pyridine succinate (1:1)",
          "stdName": "2-(.ALPHA.(2-(DIMETHYLAMINO)ETHOXY)-.ALPHA.-METHYLBENZYL)PYRIDINE SUCCINATE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a18d313-92cd-4e08-8cd4-0855aab77981"
          ],
          "display_name": false
        },
        {
          "uuid": "42858534-ea0d-47eb-9322-faaacc0126e9",
          "name": "ALSODORM",
          "stdName": "ALSODORM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "feb5ce02-6b0b-41ac-a5f5-3dd89529b74e"
          ],
          "display_name": false
        },
        {
          "uuid": "f4dd3a4f-e4d6-4f53-970a-c4bc7ba57e8e",
          "name": "BENDECTIN COMPONENT DOXYLAMINE SUCCINATE",
          "stdName": "BENDECTIN COMPONENT DOXYLAMINE SUCCINATE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "568f87fb-1584-4c5a-aa6d-f8070798fb87",
            "d5ac65b9-b354-4f52-be4d-18d9a42a0117"
          ],
          "display_name": false
        },
        {
          "uuid": "c8b6f801-b36b-4c3c-9d7f-3537a62a75df",
          "name": "BONJESTA COMPONENT DOXYLAMINE SUCCINATE",
          "stdName": "BONJESTA COMPONENT DOXYLAMINE SUCCINATE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c6c4cfb9-fa84-4e72-bcfd-9d4bf9f0bf48"
          ],
          "display_name": false
        },
        {
          "uuid": "cd7c0a6f-d2b7-406b-9666-065dd45a4fce",
          "name": "DECAMIUM",
          "stdName": "DECAMIUM",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "feb5ce02-6b0b-41ac-a5f5-3dd89529b74e"
          ],
          "display_name": false
        },
        {
          "uuid": "731e617d-57d6-4b38-ba77-e6df5bbb856b",
          "name": "DECAPRYN",
          "stdName": "DECAPRYN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca2b835f-cb39-4962-9e80-06ad36e6d165"
          ],
          "display_name": false
        },
        {
          "uuid": "192aed76-51a6-4b1e-861e-e181eb56c07a",
          "name": "DICLECTIN COMPONENT DOXYLAMINE SUCCINATE",
          "stdName": "DICLECTIN COMPONENT DOXYLAMINE SUCCINATE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cea637d0-4bf0-4755-a704-c98391094d1b"
          ],
          "display_name": false
        },
        {
          "uuid": "53b4e220-d0e0-4717-84e1-a68df2a3240c",
          "name": "DICLEGIS COMPONENT DOXYLAMINE SUCCINATE",
          "stdName": "DICLEGIS COMPONENT DOXYLAMINE SUCCINATE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7daaade9-9229-4fbb-95d6-29116d649959"
          ],
          "display_name": false
        },
        {
          "uuid": "e5fb7e86-57a3-4f04-9ce1-6e2c4b4de098",
          "name": "DONORMIL",
          "stdName": "DONORMIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "feb5ce02-6b0b-41ac-a5f5-3dd89529b74e"
          ],
          "display_name": false
        },
        {
          "uuid": "1b56eabc-9354-44b0-9c0d-46a7c8087df4",
          "name": "DONORMYL",
          "stdName": "DONORMYL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "feb5ce02-6b0b-41ac-a5f5-3dd89529b74e"
          ],
          "display_name": false
        },
        {
          "uuid": "01db7b3f-a724-49c6-bb65-f679107ddfb9",
          "name": "DORMIDINA",
          "stdName": "DORMIDINA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "feb5ce02-6b0b-41ac-a5f5-3dd89529b74e"
          ],
          "display_name": false
        },
        {
          "uuid": "7f35f928-225d-4b70-bdaa-16af4c021a43",
          "name": "DOXY-SLEEP-AID",
          "stdName": "DOXY-SLEEP-AID",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "daa9e9a1-5b57-4b5c-8bae-21404a4f7c2d"
          ],
          "display_name": false
        },
        {
          "uuid": "a1167aaa-8760-42bf-83fc-e89446c5328a",
          "name": "DOXYLAMINE HYDROGEN SUCCINATE",
          "stdName": "DOXYLAMINE HYDROGEN SUCCINATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "feb5ce02-6b0b-41ac-a5f5-3dd89529b74e",
            "1b0a39ac-dffd-408b-9df9-e80e2dce5d8f",
            "d8c5ad20-9ea1-4c97-aa70-e57bb0f6f1bd"
          ],
          "display_name": false
        },
        {
          "uuid": "dbf417d0-7f40-040b-f39f-e7b65757d929",
          "name": "DOXYLAMINE HYDROGEN SUCCINATE [EP IMPURITY]",
          "stdName": "DOXYLAMINE HYDROGEN SUCCINATE [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "feb5ce02-6b0b-41ac-a5f5-3dd89529b74e"
          ],
          "display_name": false
        },
        {
          "uuid": "76ca5417-5cb3-fb4f-9a0c-e49bcdb38dcb",
          "name": "DOXYLAMINE HYDROGEN SUCCINATE [EP MONOGRAPH]",
          "stdName": "DOXYLAMINE HYDROGEN SUCCINATE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bde6c74a-f669-0742-c377-6ad687431a23"
          ],
          "display_name": false
        },
        {
          "uuid": "4e9fe3e3-fb8f-4b3f-9b04-2fb11ece1e20",
          "name": "DOXYLAMINE SUCCINATE",
          "stdName": "DOXYLAMINE SUCCINATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe237a3a-6948-480a-8f25-484b5924116e",
            "da7fb40a-80bb-4f7a-8807-d4150a4120cf",
            "c77fd10d-b87e-44b9-8451-588735833c8a",
            "4ae7defe-01f6-4ec1-a18b-53aa9df4ba91",
            "ec194174-dcce-40e6-a3c2-95624c198e7e",
            "a0e3ebba-52d5-4197-8c56-c09dc06bc2d4",
            "ae30495f-1bc0-47e3-98fe-c772509e4f68",
            "09844a5b-acb0-482c-937d-827d1f080449",
            "3a53c922-6266-4a9c-bab2-d4587a437b84",
            "fd2c51c6-9af7-4734-acae-187c1edbfee0",
            "8daf5481-6071-449a-95c5-7af3dad7cb70",
            "9afe69bf-4c96-4dbe-8193-285f611e0985",
            "71a66e7e-9b53-4a8d-bece-2929b82da757",
            "4fa16a67-bc49-47ab-a2fe-344db4c67f12",
            "a8f2de1e-8888-490f-98df-bdd524842ee0",
            "1d4ee4d8-82e0-4329-a88d-91a2a1b2c2b5",
            "e8f36102-4df1-4125-8ffa-2e091ce06387"
          ],
          "display_name": true
        },
        {
          "uuid": "729fc0ed-e737-4ee2-9ab8-f8bbb425beac",
          "name": "DOXYLAMINE SUCCINATE [GREEN BOOK]",
          "stdName": "DOXYLAMINE SUCCINATE [GREEN BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fd2c51c6-9af7-4734-acae-187c1edbfee0"
          ],
          "display_name": false
        },
        {
          "uuid": "aae4f473-a087-654d-f019-030176282c27",
          "name": "DOXYLAMINE SUCCINATE [IARC]",
          "stdName": "DOXYLAMINE SUCCINATE [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93e5e730-8051-9189-9b10-2aa797634b29"
          ],
          "display_name": false
        },
        {
          "uuid": "94dfb60e-b25d-464e-bfd6-093dca0c9f4e",
          "name": "DOXYLAMINE SUCCINATE [MART.]",
          "stdName": "DOXYLAMINE SUCCINATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8daf5481-6071-449a-95c5-7af3dad7cb70"
          ],
          "display_name": false
        },
        {
          "uuid": "db1a4957-eef5-40c4-8757-ebb52062ece9",
          "name": "DOXYLAMINE SUCCINATE [MI]",
          "stdName": "DOXYLAMINE SUCCINATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae30495f-1bc0-47e3-98fe-c772509e4f68"
          ],
          "display_name": false
        },
        {
          "uuid": "5878fe79-63e6-411b-878e-d785547ac6de",
          "name": "DOXYLAMINE SUCCINATE [ORANGE BOOK]",
          "stdName": "DOXYLAMINE SUCCINATE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71a66e7e-9b53-4a8d-bece-2929b82da757"
          ],
          "display_name": false
        },
        {
          "uuid": "10aeaea6-dda1-f832-944f-722683e84dc2",
          "name": "DOXYLAMINE SUCCINATE [USP MONOGRAPH]",
          "stdName": "DOXYLAMINE SUCCINATE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ba1dc498-50ee-f462-b426-5d0cb9c1dbc7"
          ],
          "display_name": false
        },
        {
          "uuid": "4f8d6445-a69b-4748-b29a-4de984143b01",
          "name": "DOXYLAMINE SUCCINATE [USP-RS]",
          "stdName": "DOXYLAMINE SUCCINATE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4fa16a67-bc49-47ab-a2fe-344db4c67f12"
          ],
          "display_name": false
        },
        {
          "uuid": "a94fa1a8-4354-4c22-bfce-6a6f8c2c36b2",
          "name": "DOXYLAMINE SUCCINATE [VANDF]",
          "stdName": "DOXYLAMINE SUCCINATE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c77fd10d-b87e-44b9-8451-588735833c8a"
          ],
          "display_name": false
        },
        {
          "uuid": "9b2892b2-9ec0-45ef-e74a-2400d8af772a",
          "name": "Doxylamine succinate [WHO-DD]",
          "stdName": "DOXYLAMINE SUCCINATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0579cc4f-e395-0356-e451-6e38cc1ed99b"
          ],
          "display_name": false
        },
        {
          "uuid": "f9a79efa-87c5-4a2f-abbc-41ee5123a73f",
          "name": "ETHANAMINE, N,N-DIMETHYL-2-(1-PHENYL-1-(2-PYRIDINYL)ETHOXY)-, BUTANEDIOATE (1:1)",
          "stdName": "ETHANAMINE, N,N-DIMETHYL-2-(1-PHENYL-1-(2-PYRIDINYL)ETHOXY)-, BUTANEDIOATE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a18d313-92cd-4e08-8cd4-0855aab77981"
          ],
          "display_name": false
        },
        {
          "uuid": "649a4322-3d10-4dbf-9345-939ae837ce89",
          "name": "GITTALUN",
          "stdName": "GITTALUN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "feb5ce02-6b0b-41ac-a5f5-3dd89529b74e"
          ],
          "display_name": false
        },
        {
          "uuid": "ac4553a2-8c17-43a9-9fda-ef226e3dfe0f",
          "name": "HOGGAR N",
          "stdName": "HOGGAR N",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "feb5ce02-6b0b-41ac-a5f5-3dd89529b74e"
          ],
          "display_name": false
        },
        {
          "uuid": "06edb841-b96f-4802-bb57-91358a5686f1",
          "name": "MERAPRINA",
          "stdName": "MERAPRINA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "feb5ce02-6b0b-41ac-a5f5-3dd89529b74e"
          ],
          "display_name": false
        },
        {
          "uuid": "94bba0ff-da91-482d-8f52-ac2194551f1f",
          "name": "N,N-DIMETHYL-2-((1RS)-1-PHENYL-1-(PYRIDIN-2-YL)ETHOXY(ETHANAMINE HYDROGEN BUTANEDIOATE",
          "stdName": "N,N-DIMETHYL-2-((1RS)-1-PHENYL-1-(PYRIDIN-2-YL)ETHOXY(ETHANAMINE HYDROGEN BUTANEDIOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d8c5ad20-9ea1-4c97-aa70-e57bb0f6f1bd"
          ],
          "display_name": false
        },
        {
          "uuid": "a2c4a2ef-c1b9-4c33-9b82-50ec0b56656a",
          "name": "NSC-74772",
          "stdName": "NSC-74772",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82a2aea2-ebb1-4d47-b75a-c20a34e516d5"
          ],
          "display_name": false
        },
        {
          "uuid": "09620399-0390-4afb-ba16-c0c3bce4aeae",
          "name": "UNISOM",
          "stdName": "UNISOM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca2b835f-cb39-4962-9e80-06ad36e6d165"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a8f2de1e-8888-490f-98df-bdd524842ee0",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8a18d313-92cd-4e08-8cd4-0855aab77981",
          "citation": "usp dictionary 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "feb5ce02-6b0b-41ac-a5f5-3dd89529b74e",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca2b835f-cb39-4962-9e80-06ad36e6d165",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "daa9e9a1-5b57-4b5c-8bae-21404a4f7c2d",
          "citation": "ORANGE BOOK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "09844a5b-acb0-482c-937d-827d1f080449",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d5ac65b9-b354-4f52-be4d-18d9a42a0117",
          "citation": "Drugs@FDA 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "568f87fb-1584-4c5a-aa6d-f8070798fb87",
          "citation": "Drugs@FDA 2012",
          "doc_type": "DRUGS@FDA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d8c5ad20-9ea1-4c97-aa70-e57bb0f6f1bd",
          "citation": "EP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "71a66e7e-9b53-4a8d-bece-2929b82da757",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8daf5481-6071-449a-95c5-7af3dad7cb70",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fd2c51c6-9af7-4734-acae-187c1edbfee0",
          "citation": "FDA SRS 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4fa16a67-bc49-47ab-a2fe-344db4c67f12",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cea637d0-4bf0-4755-a704-c98391094d1b",
          "citation": "http://diclectin.com/",
          "url": "http://diclectin.com/",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ec194174-dcce-40e6-a3c2-95624c198e7e",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c77fd10d-b87e-44b9-8451-588735833c8a",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7daaade9-9229-4fbb-95d6-29116d649959",
          "citation": "http://www.diclegis.com/",
          "url": "http://www.diclegis.com/",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "82a2aea2-ebb1-4d47-b75a-c20a34e516d5",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae30495f-1bc0-47e3-98fe-c772509e4f68",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c6c4cfb9-fa84-4e72-bcfd-9d4bf9f0bf48",
          "citation": "http://www.accessdata.fda.gov/drugsatfda_docs/label/2016/209661lbl.pdf",
          "url": "http://www.accessdata.fda.gov/drugsatfda_docs/label/2016/209661lbl.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33ab3079-8195-4131-8fe2-496329133589",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389650000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2881fce1-1bef-4147-95ba-fc5852de54dd",
          "citation": "SRS import [V9BI9B5YI2]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=V9BI9B5YI2",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389650000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "da7fb40a-80bb-4f7a-8807-d4150a4120cf",
          "citation": "DOXYLAMINE SUCCINATE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1b0a39ac-dffd-408b-9df9-e80e2dce5d8f",
          "citation": "DOXYLAMINE HYDROGEN SUCCINATE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a0e3ebba-52d5-4197-8c56-c09dc06bc2d4",
          "citation": "DOXYLAMINE SUCCINATE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3a53c922-6266-4a9c-bab2-d4587a437b84",
          "citation": "DOXYLAMINE SUCCINATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e8f36102-4df1-4125-8ffa-2e091ce06387",
          "citation": "DOXYLAMINE SUCCINATE [GREEN BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4ae7defe-01f6-4ec1-a18b-53aa9df4ba91",
          "citation": "DOXYLAMINE SUCCINATE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fe237a3a-6948-480a-8f25-484b5924116e",
          "citation": "DOXYLAMINE SUCCINATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9afe69bf-4c96-4dbe-8193-285f611e0985",
          "citation": "DOXYLAMINE SUCCINATE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1d4ee4d8-82e0-4329-a88d-91a2a1b2c2b5",
          "citation": "DOXYLAMINE SUCCINATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "aa217304-d9b9-b439-1219-9a35ac88924e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=562-10-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "93e5e730-8051-9189-9b10-2aa797634b29",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "e96a85ed-9e07-fcee-ab53-07b6720bf5ae",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ad9b90e0-03ad-4e52-9dee-361370e565e6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "31458be3-2727-4740-87fb-9d2b49a94d06",
          "citation": "USP43-NF38 - 1544, Doxylamine Succinate Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c633d543-a4a2-4149-85fd-3e98a1b15f80",
          "citation": "USP43-NF38 - 1544, Doxylamine Succinate Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "efb223e5-4056-4feb-8942-4a84f396e741",
          "citation": "USP43-NF38 - 1544, Doxylamine Succinate Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7752b016-60e8-4bdc-aa8f-40e55ac1062d",
          "citation": "USP43-NF38 - 1544, Doxylamine Succinate Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b731d77f-67e0-4514-92d7-5ea420466b25",
          "citation": "USP43-NF38 - 1544, Doxylamine Succinate Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a4d7e35d-e171-4e03-b797-5fe4acb874c0",
          "citation": "USP43-NF38 - 1544, Doxylamine Succinate Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "bde6c74a-f669-0742-c377-6ad687431a23",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "ba1dc498-50ee-f462-b426-5d0cb9c1dbc7",
          "citation": "USP/NF",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "0579cc4f-e395-0356-e451-6e38cc1ed99b",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "4698a13a-183d-abf2-68b8-48acd0705ff5",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "69503222-c826-334f-0c0a-98e0e3438cf5",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "631e961c-bdaa-b3b7-88d9-0ae976f689b8",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "b64c0545-0ad5-47b3-af57-b7f58574a8db",
          "citation": "Updated Information | Recommended Acceptable Intake Limits for Nitrosamine Drug Substance-Related Impurities (NDSRIs); Table 1",
          "url": "https://www.fda.gov/regulatory-information/search-fda-guidance-documents/updated-information-recommended-acceptable-intake-limits-nitrosamine-drug-substance-related",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8046178e-8603-4259-90ad-d8a763a322fc",
          "citation": "Updated Information | Recommended Acceptable Intake Limits for Nitrosamine Drug Substance-Related Impurities (NDSRIs); Table 1",
          "url": "https://www.fda.gov/regulatory-information/search-fda-guidance-documents/updated-information-recommended-acceptable-intake-limits-nitrosamine-drug-substance-related",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "bf340249-4ea0-415f-a6f6-57c9af111679",
          "id": "bf340249-4ea0-415f-a6f6-57c9af111679",
          "molfile": "\n  Marvin  06122309222D          \n\n  8  7  0  0  0  0            999 V2000\n   10.3744   -5.8898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8696   -6.1726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3744   -5.3127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8696   -6.7499    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3712   -5.8840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8728   -6.1726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8759   -6.1785    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3681   -5.8812    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  3  1  2  0  0  0  0\n  6  1  1  0  0  0  0\n  7  1  1  0  0  0  0\n  2  5  1  0  0  0  0\n  4  2  2  0  0  0  0\n  8  2  1  0  0  0  0\n  5  6  1  0  0  0  0\nM  END",
          "smiles": "C(CC(=O)O)C(=O)O",
          "formula": "C4H6O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f093be8e-8db4-4f60-b3a9-b40e4a4695af"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "118.0882",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "0b4e0d54-e24a-4967-a0d3-8ef76ef8d8df",
          "id": "0b4e0d54-e24a-4967-a0d3-8ef76ef8d8df",
          "molfile": "\n  Marvin  06122309222D          \n\n 20 21  0  0  0  0            999 V2000\n   13.3855   -3.0974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6799   -2.6603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9512   -3.0800    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0908   -2.6632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3766   -3.9252    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4462   -4.3304    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0848   -4.3509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7794   -3.5672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2488   -2.6487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7582   -3.8785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6916   -1.8267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8340   -3.0567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0877   -1.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4345   -5.1553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1282   -3.8640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2605   -1.8180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9745   -1.4215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5365   -2.6166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7874   -1.4039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5248   -1.7916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  8  1  0  0  0  0\n  2  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  1  1  0  0  0  0\n 11  2  2  0  0  0  0\n  3  2  1  0  0  0  0\n  9  3  2  0  0  0  0\n 12  4  2  0  0  0  0\n 13  4  1  0  0  0  0\n  7  5  1  0  0  0  0\n 14  6  1  0  0  0  0\n 15  6  1  0  0  0  0\n  6 10  1  0  0  0  0\n 10  7  1  0  0  0  0\n  9 16  1  0  0  0  0\n 17 11  1  0  0  0  0\n 18 12  1  0  0  0  0\n 19 13  2  0  0  0  0\n 16 17  2  0  0  0  0\n 18 20  2  0  0  0  0\n 20 19  1  0  0  0  0\nM  END",
          "smiles": "CC(c1ccccc1)(c2ccccn2)OCCN(C)C",
          "formula": "C17H22N2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "98934035-e4d8-4a4d-979c-d9ba1e14e7e6"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "270.37",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "cd5a1a78-294f-4210-b9ba-d5e0e030b0e1",
      "version": "45",
      "structure": {
        "id": "cc6a1921-d92b-43e0-82a2-442d6582d710",
        "molfile": "\n   JSDraw206122309222D\n\n 28 28  0  0  0  0              0 V2000\n   25.2678   -5.8470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9360   -5.0218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.5604   -5.8141    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5992   -5.0273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.2510   -7.4096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   29.1578   -8.1745    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5880   -8.2132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1238   -6.7339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.2344   -4.9999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8591   -7.3215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9580   -3.4482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.0022   -5.7701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5935   -3.4758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.1357   -9.7317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.4453   -7.2941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.2565   -3.4318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.6043   -2.6833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.3283   -4.9393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.9142   -2.6502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.3062   -3.3821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.5838  -11.1183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4063  -11.6521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.5838  -10.0289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4063  -12.7418    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.4655  -11.1073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.5246  -11.6521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6427  -11.6631    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.3474  -11.1019    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  8  1  0  0  0  0\n  9  3  2  0  0  0  0\n 10  7  1  0  0  0  0\n 11  2  2  0  0  0  0\n 12  4  2  0  0  0  0\n 13  4  1  0  0  0  0\n 14  6  1  0  0  0  0\n 15  6  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 11  1  0  0  0  0\n 18 12  1  0  0  0  0\n 19 13  2  0  0  0  0\n 20 19  1  0  0  0  0\n 18 20  2  0  0  0  0\n  9 16  1  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6 10  1  0  0  0  0\n  7  5  1  0  0  0  0\n 22 25  1  0  0  0  0\n 23 21  2  0  0  0  0\n 24 22  2  0  0  0  0\n 25 26  1  0  0  0  0\n 26 21  1  0  0  0  0\n 27 21  1  0  0  0  0\n 28 22  1  0  0  0  0\nM  END",
        "smiles": "CC(c1ccccc1)(c2ccccn2)OCCN(C)C.C(CC(=O)O)C(=O)O",
        "formula": "C17H22N2O.C4H6O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "388.4582",
        "optical_activity": "( + / - )",
        "references": [
          "a8f2de1e-8888-490f-98df-bdd524842ee0",
          "2881fce1-1bef-4147-95ba-fc5852de54dd"
        ],
        "stereo_centers": 1
      },
      "unii": "V9BI9B5YI2"
    }
  ]
}