{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "39c8e700-2e98-4642-b60c-d101feddd096",
          "code": "10408-14-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=10408-14-7",
          "code_system": "CAS",
          "references": [
            "b600e12f-8600-48d3-9d92-7fce02d543b8",
            "cf1b4373-17f5-4499-8599-c5431c7d9c13"
          ]
        },
        {
          "uuid": "b541d339-2272-4fca-bfab-598754014b15",
          "code": "71586938",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71586938",
          "code_system": "PUBCHEM",
          "references": [
            "b600e12f-8600-48d3-9d92-7fce02d543b8"
          ]
        },
        {
          "uuid": "51ff3910-8fff-02c1-7d9d-9cf486fcd281",
          "code": "DTXSID10146246",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10146246",
          "code_system": "EPA CompTox",
          "references": [
            "9d68a31b-6eb5-e380-36a2-1b258aa8b77f"
          ]
        },
        {
          "uuid": "139e662c-fc7b-4f65-8b5f-c951d627ed26",
          "code": "V98ORR8KV5",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "202258e0-ba80-44c3-b401-428fbf007532",
          "name": "BUTANAMIDE, 2,4-BIS((4-AMINOBENZOYL)OXY)-N-(3-((4-AMINOBENZOYL)OXY)PROPYL)-3,3-DIMETHYL-, (2R)-",
          "stdName": "BUTANAMIDE, 2,4-BIS((4-AMINOBENZOYL)OXY)-N-(3-((4-AMINOBENZOYL)OXY)PROPYL)-3,3-DIMETHYL-, (2R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e4d2bd6f-90ae-4b82-8bd6-ce977096ad56",
            "cbfc9fe7-58ab-45d5-83cf-9d54e11c3617"
          ],
          "display_name": false
        },
        {
          "uuid": "90ad2d51-bdb5-4d58-bdf3-555e7b7436e3",
          "name": "BUTANAMIDE, 2-((4-AMINOBENZOYL)OXY)-3-(((4-AMINOBENZOYL)OXY)METHYL)-N-(3-((4-AMINOBENZOYL)OXY)PROPYL)-3-METHYL-, (2R)-",
          "stdName": "BUTANAMIDE, 2-((4-AMINOBENZOYL)OXY)-3-(((4-AMINOBENZOYL)OXY)METHYL)-N-(3-((4-AMINOBENZOYL)OXY)PROPYL)-3-METHYL-, (2R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e4d2bd6f-90ae-4b82-8bd6-ce977096ad56",
            "cbfc9fe7-58ab-45d5-83cf-9d54e11c3617"
          ],
          "display_name": false
        },
        {
          "uuid": "9747bd09-789d-4de6-b171-59400c0f136b",
          "name": "BUTYRAMIDE, 2,4-DIHYDROXY-N-(3-HYDROXYPROPYL)-3,3-DIMETHYL-, TRIS(P-AMINOBENZOATE) (ESTER), (R)-(+)-",
          "stdName": "BUTYRAMIDE, 2,4-DIHYDROXY-N-(3-HYDROXYPROPYL)-3,3-DIMETHYL-, TRIS(P-AMINOBENZOATE) (ESTER), (R)-(+)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e4d2bd6f-90ae-4b82-8bd6-ce977096ad56",
            "cbfc9fe7-58ab-45d5-83cf-9d54e11c3617"
          ],
          "display_name": false
        },
        {
          "uuid": "7fcdfa6a-ccaf-438d-86b2-01cd3e262f31",
          "name": "TRIPABA PANTHENOL",
          "stdName": "TRIPABA PANTHENOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b68cb508-ce8f-4b9f-a39e-1e598f231f1f",
            "cbfc9fe7-58ab-45d5-83cf-9d54e11c3617",
            "b8c5abc3-592b-4b44-b0cb-913dda16402a"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "22f4cc05-1f6f-4a34-b65a-12ef655096f1",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "b8c5abc3-592b-4b44-b0cb-913dda16402a",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "cbfc9fe7-58ab-45d5-83cf-9d54e11c3617",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e4d2bd6f-90ae-4b82-8bd6-ce977096ad56",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b600e12f-8600-48d3-9d92-7fce02d543b8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391123000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "892b86c1-32f4-4c75-83e9-3d29d89a9763",
          "citation": "SRS import [V98ORR8KV5]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=V98ORR8KV5",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391123000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b68cb508-ce8f-4b9f-a39e-1e598f231f1f",
          "citation": "TRIPABA PANTHENOL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9d68a31b-6eb5-e380-36a2-1b258aa8b77f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=10408-14-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cf1b4373-17f5-4499-8599-c5431c7d9c13",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f7342eb8-c1dd-4354-83ea-7913009599a7",
          "id": "f7342eb8-c1dd-4354-83ea-7913009599a7",
          "molfile": "\n  Marvin  01132112492D          \n\n 41 43  0  0  1  0            999 V2000\n    3.7020  -11.2572    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.7020  -12.0822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4165  -12.4947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1310  -12.0822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4165  -13.3197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1309  -13.7325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1301  -14.5550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4155  -14.9676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4155  -15.7928    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7037  -14.5585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6990  -13.7340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4165  -10.8448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4165  -10.0198    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1310  -11.2572    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8454  -10.8447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5599  -11.2572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2743  -10.8447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9888  -11.2572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7033  -10.8447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7033  -10.0197    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4178  -11.2572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1324  -10.8450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8444  -11.2569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8443  -12.0821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5590  -12.4948    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1342  -12.4940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4178  -12.0858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9876  -10.8448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5751  -11.5593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4001  -10.1303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2731  -10.4322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2731   -9.6072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5586   -9.1948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8442   -9.6073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5586   -8.3698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8442   -7.9570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8450   -7.1345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5597   -6.7219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5597   -5.8966    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2714   -7.1310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2762   -7.9555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1 12  1  0  0  0  0\n  1 28  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 11  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  8  2  0  0  0  0\n 11 10  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 19  1  0  0  0  0\n 22 21  1  0  0  0  0\n 21 27  2  0  0  0  0\n 23 22  2  0  0  0  0\n 24 23  1  0  0  0  0\n 24 25  1  0  0  0  0\n 26 24  2  0  0  0  0\n 27 26  1  0  0  0  0\n 29 28  1  0  0  0  0\n 30 28  1  0  0  0  0\n 31 28  1  0  0  0  0\n 32 31  1  0  0  0  0\n 33 32  1  0  0  0  0\n 34 33  2  0  0  0  0\n 35 33  1  0  0  0  0\n 36 35  1  0  0  0  0\n 35 41  2  0  0  0  0\n 37 36  2  0  0  0  0\n 38 37  1  0  0  0  0\n 38 39  1  0  0  0  0\n 40 38  2  0  0  0  0\n 41 40  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(COC(=O)c1ccc(cc1)N)[C@H](C(=O)NCCCOC(=O)c2ccc(cc2)N)OC(=O)c3ccc(cc3)N",
          "formula": "C30H34N4O7",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7bb085c6-d4b9-4ce1-bf9e-8719c31f08d7"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "562.6147",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "734209a4-bce3-47b9-a244-83dec4e34418",
      "version": "4",
      "structure": {
        "id": "ffaf4ba0-97c0-4d26-82e2-cf4a242fb064",
        "molfile": "\n  Marvin  01132113142D          \n\n 41 43  0  0  1  0            999 V2000\n    3.7020  -11.2572    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.4165  -10.8448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4165  -10.0198    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1310  -11.2572    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8454  -10.8447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5599  -11.2572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2743  -10.8447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9888  -11.2572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7033  -10.8447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7033  -10.0197    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4178  -11.2572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9876  -10.8448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2731  -10.4322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2731   -9.6072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5586   -9.1948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8442   -9.6073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5586   -8.3698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5751  -11.5593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4001  -10.1303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7020  -12.0822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4165  -12.4947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1310  -12.0822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4165  -13.3197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8450   -7.1345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8442   -7.9570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5597   -6.7219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2762   -7.9555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2714   -7.1310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8444  -11.2569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1324  -10.8450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8443  -12.0821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4178  -12.0858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1342  -12.4940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1301  -14.5550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1309  -13.7325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4155  -14.9676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6990  -13.7340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7037  -14.5585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5597   -5.8966    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4155  -15.7928    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5590  -12.4948    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11  9  1  0  0  0  0\n 12  1  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 15  1  0  0  0  0\n 18 12  1  0  0  0  0\n 19 12  1  0  0  0  0\n  1 20  1  6  0  0  0\n 21 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 21  1  0  0  0  0\n 28 26  1  0  0  0  0\n 27 28  2  0  0  0  0\n 24 25  1  0  0  0  0\n 26 24  2  0  0  0  0\n 25 17  2  0  0  0  0\n 17 27  1  0  0  0  0\n 33 31  1  0  0  0  0\n 32 33  2  0  0  0  0\n 29 30  1  0  0  0  0\n 31 29  2  0  0  0  0\n 30 11  2  0  0  0  0\n 11 32  1  0  0  0  0\n 38 36  1  0  0  0  0\n 37 38  2  0  0  0  0\n 34 35  1  0  0  0  0\n 36 34  2  0  0  0  0\n 35 23  2  0  0  0  0\n 23 37  1  0  0  0  0\n 26 39  1  0  0  0  0\n 36 40  1  0  0  0  0\n 31 41  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(COC(=O)c1ccc(cc1)N)[C@H](C(=O)NCCCOC(=O)c2ccc(cc2)N)OC(=O)c3ccc(cc3)N",
        "formula": "C30H34N4O7",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "562.6147",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "e4d2bd6f-90ae-4b82-8bd6-ce977096ad56",
          "892b86c1-32f4-4c75-83e9-3d29d89a9763"
        ],
        "stereo_centers": 1
      },
      "unii": "V98ORR8KV5"
    }
  ]
}