{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "72e3db4c-2995-4826-b6a8-0dacf5f53375",
          "code": "7512-17-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7512-17-6",
          "code_system": "CAS",
          "references": [
            "a7e6dcc4-7cf8-4432-8981-66c529b1905c",
            "9d131864-147b-4297-8736-6d07990a1381"
          ]
        },
        {
          "uuid": "b8344381-5f23-4709-81a9-2f1479274a0b",
          "code": "72-87-7",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=72-87-7",
          "code_system": "CAS",
          "references": [
            "a7e6dcc4-7cf8-4432-8981-66c529b1905c",
            "06205ac0-c71d-4c80-ae12-a1566d71c793"
          ]
        },
        {
          "uuid": "cd7b2cdc-db2f-43cc-9a75-c8587d0c8934",
          "code": "C83975",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C83975",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a7e6dcc4-7cf8-4432-8981-66c529b1905c"
          ]
        },
        {
          "uuid": "f455548b-e401-4691-9e67-cd73ce54d96c",
          "code": "N-ACETYLGLUCOSAMINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/N-Acetylglucosamine",
          "code_system": "WIKIPEDIA",
          "references": [
            "a7e6dcc4-7cf8-4432-8981-66c529b1905c"
          ]
        },
        {
          "uuid": "48c85926-8b0f-46ed-aefa-07b70bd18caf",
          "code": "231-368-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.028.517",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a7e6dcc4-7cf8-4432-8981-66c529b1905c"
          ]
        },
        {
          "uuid": "cea598cc-6c11-4edb-a085-d6f348f38f30",
          "code": "1362871",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1362871/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "a7e6dcc4-7cf8-4432-8981-66c529b1905c"
          ]
        },
        {
          "uuid": "5fd1ee73-e7c3-4f77-a223-30a648587319",
          "code": "m5764",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5764?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "a7e6dcc4-7cf8-4432-8981-66c529b1905c"
          ]
        },
        {
          "uuid": "db629db0-2609-4a0a-a495-c10c340ab34d",
          "code": "DB00141",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00141",
          "code_system": "DRUG BANK",
          "references": [
            "a7e6dcc4-7cf8-4432-8981-66c529b1905c"
          ]
        },
        {
          "uuid": "deb23cdd-9f63-41d4-930d-8be0afac77f0",
          "code": "SUB21868",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "a7e6dcc4-7cf8-4432-8981-66c529b1905c"
          ]
        },
        {
          "uuid": "ba443dc3-04b6-4841-a0c5-8f1770af60a7",
          "code": "1738118",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1738118",
          "code_system": "PUBCHEM",
          "references": [
            "a7e6dcc4-7cf8-4432-8981-66c529b1905c"
          ]
        },
        {
          "uuid": "9342fca5-c306-b4c2-c123-42db389b8ba6",
          "code": "DTXSID3045855",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3045855",
          "code_system": "EPA CompTox",
          "references": [
            "5cc380d4-9998-5522-e798-7905d38b9f49"
          ]
        },
        {
          "uuid": "18ebf0e8-ac44-4727-fd5e-7435f85d9f3b",
          "code": "C1505",
          "comments": "Dietary Supplement",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1505",
          "code_system": "NCI_THESAURUS",
          "references": [
            "854dd1ae-633f-f98b-d7c4-2f3343e300b1"
          ]
        },
        {
          "uuid": "2634c765-de44-beb9-f21b-2644f971377d",
          "code": "767420",
          "comments": "ORPHAN DRUG|Designated|Treatment for Duchenne Muscular Dystrophy",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=767420",
          "code_system": "FDA ORPHAN DRUG",
          "references": [
            "854dd1ae-633f-f98b-d7c4-2f3343e300b1"
          ]
        },
        {
          "uuid": "f7bef9ea-520c-c9d2-28d1-0da63d5636ea",
          "code": "4615",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/4615",
          "code_system": "DRUG CENTRAL",
          "references": [
            "854dd1ae-633f-f98b-d7c4-2f3343e300b1"
          ]
        },
        {
          "uuid": "83f20f5a-ed0a-45ee-b14b-339a46871357",
          "code": "V956696549",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8f887712-6816-e1d8-ba1e-2b42ba0f34b1",
          "code": "1095 (Number of products:142)",
          "comments": "Dietary Supplement Label Database|Chemical|N-Acetyl Glucosamine",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=1095&item=N-Acetyl Glucosamine",
          "code_system": "DSLD",
          "references": [
            "854dd1ae-633f-f98b-d7c4-2f3343e300b1"
          ]
        },
        {
          "uuid": "73de6cb9-dad0-c53d-2b69-501748ecb0c1",
          "code": "1010022",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1010022",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "854dd1ae-633f-f98b-d7c4-2f3343e300b1"
          ]
        },
        {
          "uuid": "0555eb3d-3552-96d4-e3aa-d162e55a376f",
          "code": "73685",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:73685",
          "code_system": "CHEBI",
          "references": [
            "854dd1ae-633f-f98b-d7c4-2f3343e300b1"
          ]
        },
        {
          "uuid": "ad6cf10e-554e-eb2e-21ac-86715f361776",
          "code": "28009",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:28009",
          "code_system": "CHEBI",
          "references": [
            "854dd1ae-633f-f98b-d7c4-2f3343e300b1"
          ]
        },
        {
          "uuid": "6917959e-d964-bbd9-13fb-d05d072a9737",
          "code": "506227",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:506227",
          "code_system": "CHEBI",
          "references": [
            "854dd1ae-633f-f98b-d7c4-2f3343e300b1"
          ]
        },
        {
          "uuid": "7629f9a3-4deb-1cef-1362-0db5af5b113d",
          "code": "17411",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:17411",
          "code_system": "CHEBI",
          "references": [
            "854dd1ae-633f-f98b-d7c4-2f3343e300b1"
          ]
        },
        {
          "uuid": "1c82c523-51dc-f8be-27be-2686a4c2b2d8",
          "code": "V956696549",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=V956696549",
          "code_system": "DAILYMED",
          "references": [
            "8ec1d5cb-30d1-fc56-f51d-e26eafadc988"
          ]
        },
        {
          "uuid": "a2473b41-a3e6-2299-7f8e-9e603d13637d",
          "code": "100000085222",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "f60f5755-e811-1eea-d1ed-b37882b88fa1"
          ]
        },
        {
          "uuid": "8a65be98-1811-9bb3-2406-fbdd3ea4f510",
          "code": "524344",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=524344",
          "code_system": "NSC",
          "references": [
            "ada557c6-e132-bf15-0b92-dc35fb563549"
          ]
        },
        {
          "uuid": "86811e25-fd34-6298-28a9-cc04849df81f",
          "code": "400525",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=400525",
          "code_system": "NSC",
          "references": [
            "ada557c6-e132-bf15-0b92-dc35fb563549"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "bfd1ca07-2941-4316-823a-f1a2bb794bc6",
          "amount": {
            "uuid": "cbb8bda8-501f-45b5-ac8e-286d57312733"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "9cb19aef-4f5c-4eeb-a3da-4832a3fa5fbc",
            "refuuid": "743bfa4d-44e5-44c1-9f22-bf0ff9b05ce5",
            "name": "N-ACETYLGLUCOSAMINE",
            "unii": "V956696549",
            "linking_id": "V956696549",
            "ref_pname": "N-ACETYLGLUCOSAMINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c5b3e801-c55a-4f27-bde7-013c078d8090",
          "amount": {
            "uuid": "3890d147-bfbc-4cf2-85d5-cdbc7f82c67f"
          },
          "type": "PARENT->IMPURITY",
          "references": [
            "2710c2ed-7908-4317-921b-adafb03cc1be"
          ],
          "related_substance": {
            "uuid": "bc2ceb0d-f1e5-4272-b63f-0f7db6b25688",
            "refuuid": "ace8c952-6314-4c52-8dde-3b1306ecf59d",
            "name": "GLUCOSAMINE SULFATE POTASSIUM CHLORIDE",
            "unii": "15VQ11I66N",
            "linking_id": "15VQ11I66N",
            "ref_pname": "GLUCOSAMINE SULFATE POTASSIUM CHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2d990308-99b7-42b9-90ff-47025cf57829",
          "name": "2-ACETAMIDO-2-DEOXY-D-GLUCOPYRANOSE",
          "stdName": "2-ACETAMIDO-2-DEOXY-D-GLUCOPYRANOSE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68c96747-71af-44c9-9687-d7e09b87cf16",
            "5d96885a-f461-4c30-863c-50a6e7629175"
          ],
          "display_name": false
        },
        {
          "uuid": "7bc67ff0-bf79-4892-b403-20f76d78fc03",
          "name": "ACETYL GLUCOSAMINE",
          "stdName": "ACETYL GLUCOSAMINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "68c96747-71af-44c9-9687-d7e09b87cf16",
            "d3263ae1-d5ed-4203-84b3-4d75b2fd08c3",
            "968d3d90-745f-434b-8e9b-d616792c29d2",
            "c33618cc-b483-4765-ac5f-5a6dab457153"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "98b7f637-07b4-4a4b-8037-373a1fadad25",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "51b92ce3-cb17-4da8-9ad8-d8d76440127a",
          "name": "ACETYL-GLUCOSAMINE",
          "stdName": "ACETYL-GLUCOSAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b3c72d1-8aec-477d-9b11-c56420ce9769",
            "68c96747-71af-44c9-9687-d7e09b87cf16"
          ],
          "display_name": false
        },
        {
          "uuid": "4ac24d2e-3fe5-4fc1-ba51-9bdee560e0d0",
          "name": "ACETYLGLUCOSAMINE",
          "stdName": "ACETYLGLUCOSAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b3c72d1-8aec-477d-9b11-c56420ce9769",
            "68c96747-71af-44c9-9687-d7e09b87cf16"
          ],
          "display_name": false
        },
        {
          "uuid": "f4b2d34c-f71f-4e6a-bcc3-bb9d6b55dc87",
          "name": "BIO-NAG",
          "stdName": "BIO-NAG",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68c96747-71af-44c9-9687-d7e09b87cf16",
            "5d96885a-f461-4c30-863c-50a6e7629175"
          ],
          "display_name": false
        },
        {
          "uuid": "c854e45e-31b4-414b-9450-cf87aaf7fb0c",
          "name": "D-GLUCOPYRANOSE, 2-(ACETYLAMINO)-2-DEOXY-",
          "stdName": "D-GLUCOPYRANOSE, 2-(ACETYLAMINO)-2-DEOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68c96747-71af-44c9-9687-d7e09b87cf16",
            "5d96885a-f461-4c30-863c-50a6e7629175"
          ],
          "display_name": false
        },
        {
          "uuid": "b951abdd-73f2-4287-9b66-fb71ca052d4f",
          "name": "D-GLUCOSE, 2-(ACETYLAMINO)-2-DEOXY-",
          "stdName": "D-GLUCOSE, 2-(ACETYLAMINO)-2-DEOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68c96747-71af-44c9-9687-d7e09b87cf16",
            "5d96885a-f461-4c30-863c-50a6e7629175"
          ],
          "display_name": false
        },
        {
          "uuid": "d61ed9c0-601e-4eb9-94ed-bdd535745ee2",
          "name": "D-GLUCOSE, 2-ACETAMIDO-2-DEOXY-",
          "stdName": "D-GLUCOSE, 2-ACETAMIDO-2-DEOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68c96747-71af-44c9-9687-d7e09b87cf16",
            "5d96885a-f461-4c30-863c-50a6e7629175"
          ],
          "display_name": false
        },
        {
          "uuid": "837a1db2-57b2-4ba7-8a40-991289461897",
          "name": "GLCNAC",
          "stdName": "GLCNAC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b3c72d1-8aec-477d-9b11-c56420ce9769",
            "68c96747-71af-44c9-9687-d7e09b87cf16"
          ],
          "display_name": false
        },
        {
          "uuid": "662c49c7-4af6-4b34-b045-3defb52e50e9",
          "name": "GLUCOPYRANOSE, 2-ACETAMIDO-2-DEOXY-",
          "stdName": "GLUCOPYRANOSE, 2-ACETAMIDO-2-DEOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68c96747-71af-44c9-9687-d7e09b87cf16",
            "5d96885a-f461-4c30-863c-50a6e7629175"
          ],
          "display_name": false
        },
        {
          "uuid": "f7c22a09-acb7-4ba8-aa8a-4b21ff0947cf",
          "name": "GLUCOPYRANOSE, 2-ACETAMIDO-2-DEOXY-, D-",
          "stdName": "GLUCOPYRANOSE, 2-ACETAMIDO-2-DEOXY-, D-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68c96747-71af-44c9-9687-d7e09b87cf16",
            "5d96885a-f461-4c30-863c-50a6e7629175"
          ],
          "display_name": false
        },
        {
          "uuid": "f65192c4-547a-44da-bddd-757c905adfe2",
          "name": "GLUCOSAMINE SULFATE POTASSIUM CHLORIDE IMPURITY A [ EP IMPURITY]",
          "stdName": "GLUCOSAMINE SULFATE POTASSIUM CHLORIDE IMPURITY A [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2710c2ed-7908-4317-921b-adafb03cc1be"
          ],
          "display_name": false
        },
        {
          "uuid": "470eda88-9960-4637-9b71-eee3feb75365",
          "name": "GREENNAG",
          "stdName": "GREENNAG",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68c96747-71af-44c9-9687-d7e09b87cf16",
            "5d96885a-f461-4c30-863c-50a6e7629175"
          ],
          "display_name": false
        },
        {
          "uuid": "cec484b4-e340-41ed-891e-8156919b6979",
          "name": "MARINE SWEET",
          "stdName": "MARINE SWEET",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68c96747-71af-44c9-9687-d7e09b87cf16",
            "5d96885a-f461-4c30-863c-50a6e7629175"
          ],
          "display_name": false
        },
        {
          "uuid": "9e283212-be4c-4aed-859f-43a7a36ac9d4",
          "name": "N-((2R,3R,4S,5R)-3,4,5,6-TETRAHYDROXY-1-OXOHEXAN-2-YL)ACETAMIDE",
          "stdName": "N-((2R,3R,4S,5R)-3,4,5,6-TETRAHYDROXY-1-OXOHEXAN-2-YL)ACETAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "515a81c2-d7d8-4100-bf1a-1c6e65e1658e",
            "68c96747-71af-44c9-9687-d7e09b87cf16"
          ],
          "display_name": false
        },
        {
          "uuid": "e8502b53-ce66-4940-93e9-8058097c9b43",
          "name": "N-((3R,4R,5S,6R)-2,4,5-TRIHYDROXY-6-(HYDROXYMETHYL)TETRAHYDRO-2H-PYRAN-3-YL)ACETAMIDE",
          "stdName": "N-((3R,4R,5S,6R)-2,4,5-TRIHYDROXY-6-(HYDROXYMETHYL)TETRAHYDRO-2H-PYRAN-3-YL)ACETAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "515a81c2-d7d8-4100-bf1a-1c6e65e1658e",
            "68c96747-71af-44c9-9687-d7e09b87cf16"
          ],
          "display_name": false
        },
        {
          "uuid": "4a9b1bc1-9437-445e-aee6-c50e903dc9c7",
          "name": "N-ACETYL GLUCOSAMINE",
          "stdName": "N-ACETYL GLUCOSAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9abde997-bff5-46b9-b189-5b21ff3333ff",
            "68c96747-71af-44c9-9687-d7e09b87cf16"
          ],
          "display_name": false
        },
        {
          "uuid": "c37d2254-5edc-45e6-b271-71d860841980",
          "name": "N-ACETYL GLUCOSAMINE D-",
          "stdName": "N-ACETYL GLUCOSAMINE D-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0923dd35-ed8b-4e76-8d18-83179f43a4b2"
          ],
          "display_name": false
        },
        {
          "uuid": "7a7d3379-aca8-45f1-92ef-4b24ed5c014e",
          "name": "N-ACETYL-D-GLUCOSAMINE",
          "stdName": "N-ACETYL-D-GLUCOSAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68c96747-71af-44c9-9687-d7e09b87cf16",
            "d63f1669-d268-4dab-b2a7-11cbaff952b2"
          ],
          "display_name": false
        },
        {
          "uuid": "b93532b6-aaaf-4c6b-b093-61df2b0e3e2e",
          "name": "N-ACETYLGLUCOSAMINE",
          "stdName": "N-ACETYLGLUCOSAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4876b4ef-5872-4d55-83ff-b4811f88f27b",
            "bff7467a-ebff-416a-93df-f2fb63687675",
            "9a37706d-df06-42eb-a58b-4f3baf245325",
            "79c115aa-6e97-4bf6-9f69-1256994d0762",
            "61f78bda-fb6e-4159-af43-6ffa3b09ee10",
            "ed1e6233-40a8-48f9-94ec-fa14c16574c9",
            "68c96747-71af-44c9-9687-d7e09b87cf16",
            "1b8edcfe-2db3-4a61-ab05-4ef241c7eb6c",
            "0d0e6f21-e425-4ed1-b04f-5aa6c3815f7f"
          ],
          "display_name": true
        },
        {
          "uuid": "09b6affd-b36b-4f52-836e-79c5ced92da2",
          "name": "N-ACETYLGLUCOSAMINE [DSC]",
          "stdName": "N-ACETYLGLUCOSAMINE [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68c96747-71af-44c9-9687-d7e09b87cf16",
            "4876b4ef-5872-4d55-83ff-b4811f88f27b"
          ],
          "display_name": false
        },
        {
          "uuid": "118f59a7-5272-40b3-91b6-5648125c79e6",
          "name": "N-ACETYLGLUCOSAMINE [MI]",
          "stdName": "N-ACETYLGLUCOSAMINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68c96747-71af-44c9-9687-d7e09b87cf16",
            "79c115aa-6e97-4bf6-9f69-1256994d0762"
          ],
          "display_name": false
        },
        {
          "uuid": "943210b9-c184-437c-ad18-84e5540f72e1",
          "name": "N-ACETYLGLUCOSAMINE [USP-RS]",
          "stdName": "N-ACETYLGLUCOSAMINE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68c96747-71af-44c9-9687-d7e09b87cf16",
            "bff7467a-ebff-416a-93df-f2fb63687675"
          ],
          "display_name": false
        },
        {
          "uuid": "2dd1bd59-33a3-adf9-3a2e-bf5880df7a37",
          "name": "N-Acetylglucosamine [WHO-DD]",
          "stdName": "N-ACETYLGLUCOSAMINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e590a34-7a05-ea9e-6d01-fc9d4c763c0f"
          ],
          "display_name": false
        },
        {
          "uuid": "dc683392-1c93-4a47-acbd-2a17aa71bcba",
          "name": "NAG",
          "stdName": "NAG",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b3c72d1-8aec-477d-9b11-c56420ce9769",
            "68c96747-71af-44c9-9687-d7e09b87cf16"
          ],
          "display_name": false
        },
        {
          "uuid": "437a4247-370f-4079-9de5-4f9380259f1c",
          "name": "NSC-400525",
          "stdName": "NSC-400525",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68c96747-71af-44c9-9687-d7e09b87cf16",
            "3dbb6502-24ec-4911-976c-e48fcbec1c67"
          ],
          "display_name": false
        },
        {
          "uuid": "83d38b93-d3a6-4487-96e1-334dd13a8a2f",
          "name": "NSC-524344",
          "stdName": "NSC-524344",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68c96747-71af-44c9-9687-d7e09b87cf16",
            "5d96885a-f461-4c30-863c-50a6e7629175"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0923dd35-ed8b-4e76-8d18-83179f43a4b2",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "79c115aa-6e97-4bf6-9f69-1256994d0762",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "68c96747-71af-44c9-9687-d7e09b87cf16",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2b3c72d1-8aec-477d-9b11-c56420ce9769",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d63f1669-d268-4dab-b2a7-11cbaff952b2",
          "citation": "SIGMA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bff7467a-ebff-416a-93df-f2fb63687675",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c33618cc-b483-4765-ac5f-5a6dab457153",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "968d3d90-745f-434b-8e9b-d616792c29d2",
          "citation": "VCRP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0d0e6f21-e425-4ed1-b04f-5aa6c3815f7f",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9abde997-bff5-46b9-b189-5b21ff3333ff",
          "citation": "fda_srs",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "515a81c2-d7d8-4100-bf1a-1c6e65e1658e",
          "citation": "CHEMDRAW",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5d96885a-f461-4c30-863c-50a6e7629175",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3dbb6502-24ec-4911-976c-e48fcbec1c67",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4876b4ef-5872-4d55-83ff-b4811f88f27b",
          "citation": "DSC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a7e6dcc4-7cf8-4432-8981-66c529b1905c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390860000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e7e9529c-38cd-43a5-ad94-9c72da2603e6",
          "citation": "SRS import [V956696549]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=V956696549",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390860000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1b8edcfe-2db3-4a61-ab05-4ef241c7eb6c",
          "citation": "N-ACETYLGLUCOSAMINE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d3263ae1-d5ed-4203-84b3-4d75b2fd08c3",
          "citation": "ACETYL GLUCOSAMINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9a37706d-df06-42eb-a58b-4f3baf245325",
          "citation": "N-ACETYLGLUCOSAMINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "61f78bda-fb6e-4159-af43-6ffa3b09ee10",
          "citation": "N-ACETYLGLUCOSAMINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ed1e6233-40a8-48f9-94ec-fa14c16574c9",
          "citation": "N-ACETYLGLUCOSAMINE [DSC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "accf98d8-f008-5dab-2dea-f3aa967dff7e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=72-87-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "854dd1ae-633f-f98b-d7c4-2f3343e300b1",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "06205ac0-c71d-4c80-ae12-a1566d71c793",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9d131864-147b-4297-8736-6d07990a1381",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ada557c6-e132-bf15-0b92-dc35fb563549",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "8ec1d5cb-30d1-fc56-f51d-e26eafadc988",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "7e590a34-7a05-ea9e-6d01-fc9d4c763c0f",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "5cc380d4-9998-5522-e798-7905d38b9f49",
          "citation": "EPA",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "f60f5755-e811-1eea-d1ed-b37882b88fa1",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "2710c2ed-7908-4317-921b-adafb03cc1be",
          "citation": "11.2",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "08af56e2-b2e0-48f9-9dea-1ee52036adbe",
          "id": "08af56e2-b2e0-48f9-9dea-1ee52036adbe",
          "molfile": "\n  Marvin  01132100432D          \n\n 15 14  0  0  1  0            999 V2000\n    8.4400   -7.2010    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    8.4400   -8.0260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7255   -6.7886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0110   -7.2010    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1544   -6.7886    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    9.1544   -5.9635    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8689   -7.2010    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    9.8689   -8.0260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5834   -6.7886    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   10.5834   -5.9635    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2978   -5.5510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0123   -5.9635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2978   -4.7260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2978   -7.2010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2978   -8.0260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  5  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  1  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  1  0  0  0\n  9 14  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\n 14 15  2  0  0  0  0\nM  END",
          "smiles": "CC(=O)N[C@@H](C=O)[C@H]([C@@H]([C@@H](CO)O)O)O",
          "formula": "C8H15NO6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b4587963-427c-46b7-8a8e-7381252fe828"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "221.2081",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "743bfa4d-44e5-44c1-9f22-bf0ff9b05ce5",
      "version": "29",
      "structure": {
        "id": "7652974a-b1dd-451e-ba61-283917241c3f",
        "molfile": "\n  Marvin  01132106082D          \n\n 15 14  0  0  1  0            999 V2000\n    7.0110   -7.2010    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7255   -6.7886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4400   -7.2010    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.1544   -6.7886    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.8689   -7.2010    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.5834   -6.7886    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.2978   -7.2010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2978   -8.0260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5834   -5.9635    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8689   -8.0260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1544   -5.9635    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4400   -8.0260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2978   -5.5510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2978   -4.7260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0123   -5.9635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  6  9  1  1  0  0  0\n  5 10  1  1  0  0  0\n  4 11  1  1  0  0  0\n  3 12  1  6  0  0  0\n  9 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  1  0  0  0  0\nM  END",
        "smiles": "CC(=O)N[C@@H](C=O)[C@H]([C@@H]([C@@H](CO)O)O)O",
        "formula": "C8H15NO6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "221.2081",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "e7e9529c-38cd-43a5-ad94-9c72da2603e6",
          "79c115aa-6e97-4bf6-9f69-1256994d0762"
        ],
        "stereo_centers": 4
      },
      "unii": "V956696549"
    }
  ]
}