{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e121f12a-ec9c-4908-a8fd-813ad93facd9",
          "code": "319-78-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=319-78-8",
          "code_system": "CAS",
          "references": [
            "55275b64-7372-4106-8f13-0aed59d9fa81",
            "5f89a907-8b42-42ab-8fff-63ef0195b857"
          ]
        },
        {
          "uuid": "eccc7e1d-1cf9-4fe0-90d4-cf933d6be039",
          "code": "206-269-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.701",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "55275b64-7372-4106-8f13-0aed59d9fa81"
          ]
        },
        {
          "uuid": "e6ef8660-f257-00be-0ef9-1d1d0e67e12f",
          "code": "DTXSID1046346",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1046346",
          "code_system": "EPA CompTox",
          "references": [
            "bf3be932-d464-bbc6-f009-01c60b4b15cc"
          ]
        },
        {
          "uuid": "dd01f3aa-914c-8431-e13c-73d2ef8ff862",
          "code": "76551",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/76551",
          "code_system": "PUBCHEM",
          "references": [
            "e877e3f6-2e6c-3680-76b6-b9e055e3775a"
          ]
        },
        {
          "uuid": "6b581410-9420-4dcb-8909-699cfbadcabe",
          "code": "V87GJA0G54",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ff44a4b6-bef1-1ef6-c3b2-9dbe7f12c86e",
          "code": "27730",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:27730",
          "code_system": "CHEBI",
          "references": [
            "e517f419-24fe-f30b-4849-f03e2bd0258b"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "32ec8995-d363-46e2-bf43-fe5ae442e32e",
          "name": "(2R,3R)-2-AMINO-3-METHYLPENTANOIC ACID",
          "stdName": "(2R,3R)-2-AMINO-3-METHYLPENTANOIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b619d984-a262-4898-89bf-7da8993d33e7",
            "82f208e9-bb4b-4e6c-95ac-3df81740f240"
          ],
          "display_name": false
        },
        {
          "uuid": "adcad148-67c9-4515-88fe-38a1701f566b",
          "name": "(R)-ISOLEUCINE",
          "stdName": "(R)-ISOLEUCINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b619d984-a262-4898-89bf-7da8993d33e7",
            "82f208e9-bb4b-4e6c-95ac-3df81740f240"
          ],
          "display_name": false
        },
        {
          "uuid": "3dcbb402-fe91-46fc-a2ed-f72b9aa149be",
          "name": "D-ISOLEUCINE",
          "stdName": "D-ISOLEUCINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b619d984-a262-4898-89bf-7da8993d33e7",
            "82f208e9-bb4b-4e6c-95ac-3df81740f240"
          ],
          "display_name": false
        },
        {
          "uuid": "7b4e01e2-96c6-4308-892c-fd21d2b49113",
          "name": "ISOLEUCINE, (-)-",
          "stdName": "ISOLEUCINE, (-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b03ee729-8a01-4b40-81d9-2fc0c4175d1d",
            "82f208e9-bb4b-4e6c-95ac-3df81740f240"
          ],
          "display_name": false
        },
        {
          "uuid": "bdc5fdad-604e-4a6c-9d49-ea3ef87d9dca",
          "name": "ISOLEUCINE, D-",
          "stdName": "ISOLEUCINE, D-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b619d984-a262-4898-89bf-7da8993d33e7",
            "82f208e9-bb4b-4e6c-95ac-3df81740f240"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "b619d984-a262-4898-89bf-7da8993d33e7",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "82f208e9-bb4b-4e6c-95ac-3df81740f240",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b03ee729-8a01-4b40-81d9-2fc0c4175d1d",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "55275b64-7372-4106-8f13-0aed59d9fa81",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392403000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e37d2eae-d2a9-45f3-a769-66aee6a2ae1f",
          "citation": "SRS import [V87GJA0G54]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=V87GJA0G54",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392403000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf3be932-d464-bbc6-f009-01c60b4b15cc",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=319-78-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e877e3f6-2e6c-3680-76b6-b9e055e3775a",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "5f89a907-8b42-42ab-8fff-63ef0195b857",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e517f419-24fe-f30b-4849-f03e2bd0258b",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "68b1bec1-6bdb-4dda-9a8a-7ba5f99c61de",
          "id": "68b1bec1-6bdb-4dda-9a8a-7ba5f99c61de",
          "molfile": "\n  Marvin  01132105272D          \n\n  9  8  0  0  1  0            999 V2000\n    9.0932   -7.1453    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    9.0709   -6.3206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3890   -7.5673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6562   -7.1866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8037   -7.5387    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    9.8227   -8.3539    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5111   -7.1073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4920   -6.2731    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2343   -7.4974    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  2  0  0  0  0\nM  END",
          "smiles": "CC[C@@H](C)[C@H](C(=O)O)N",
          "formula": "C6H13NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1f0c6179-0c97-4d5b-95b2-df7de231bd69"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "131.1732",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "05ee3afd-8831-45fe-95bc-18f61a58533f",
      "version": "5",
      "structure": {
        "id": "88f90504-fce9-4e34-9296-7c76988b7648",
        "molfile": "\n  Marvin  01132107062D          \n\n  9  8  0  0  1  0            999 V2000\n   10.5111   -7.1073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8037   -7.5387    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.8227   -8.3539    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0932   -7.1453    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.3890   -7.5673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6562   -7.1866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0709   -6.3206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4920   -6.2731    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2343   -7.4974    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  6  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  4  7  1  1  0  0  0\n  8  1  2  0  0  0  0\n  9  1  1  0  0  0  0\nM  END",
        "smiles": "CC[C@@H](C)[C@H](C(=O)O)N",
        "formula": "C6H13NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "131.1732",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b619d984-a262-4898-89bf-7da8993d33e7",
          "e37d2eae-d2a9-45f3-a769-66aee6a2ae1f"
        ],
        "stereo_centers": 2
      },
      "unii": "V87GJA0G54"
    }
  ]
}