{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "86344c43-db46-480f-a91a-e408ec52813c",
          "code": "5323-27-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5323-27-3",
          "code_system": "CAS",
          "references": [
            "3bcc5909-2da7-43b8-a5c1-51982049f6a1",
            "8008b84d-3154-43ae-a688-294180c881db"
          ]
        },
        {
          "uuid": "c482699e-41ff-447a-8b74-eea76d070ae3",
          "code": "4000",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule III.|Anabolic Steroids",
          "type": "GENERIC (FAMILY)",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "3bcc5909-2da7-43b8-a5c1-51982049f6a1"
          ]
        },
        {
          "uuid": "41db2736-2bc8-4834-a501-e774295eb3f0",
          "code": "1-ANDROSTENEDIOL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/1-Androstenediol",
          "code_system": "WIKIPEDIA",
          "references": [
            "df266b0c-5296-0954-1314-285973716940"
          ]
        },
        {
          "uuid": "d9051a24-a6ad-4e74-b865-a8226e1c4912",
          "code": "11300765",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11300765",
          "code_system": "PUBCHEM",
          "references": [
            "3bcc5909-2da7-43b8-a5c1-51982049f6a1"
          ]
        },
        {
          "uuid": "7f7ba82e-2c1d-7e66-57ce-3afd4603a230",
          "code": "DTXSID60627737",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60627737",
          "code_system": "EPA CompTox",
          "references": [
            "eff1d517-213a-a779-9361-8df6899de781"
          ]
        },
        {
          "uuid": "c7bb244e-a203-405d-8eac-0c95561affa2",
          "code": "DB01503",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01503",
          "code_system": "DRUG BANK",
          "references": [
            "f1704237-45b6-a6ac-acc7-9d025e8a6896"
          ]
        },
        {
          "uuid": "e3dbbd06-8080-492c-8ac9-329f2b368ea4",
          "code": "V7W74907I7",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4abc6b24-df84-4cb6-8f9a-1a40e951f741",
          "name": "1-ANDROSTENEDIOL",
          "stdName": "1-ANDROSTENEDIOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f74f7ee-558e-4e34-8bd3-c9fca08fd2cc"
          ],
          "display_name": true
        },
        {
          "uuid": "f9ae1f43-fc40-4e5d-999a-12a15e954c83",
          "name": "3β,17β-dihydroxy-5α-androst-1-ene",
          "stdName": "3.BETA.,17.BETA.-DIHYDROXY-5.ALPHA.-ANDROST-1-ENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8c529564-a4e4-4a03-afc8-8bb39f22eeac",
            "fc24370f-f44a-4932-9565-ebb20ec202b6"
          ],
          "display_name": false
        },
        {
          "uuid": "6816b669-09d4-4fea-818b-4cebea70644e",
          "name": "5.ALPHA.-ANDROST-1-ENE-3.BETA.,17.BETA.-DIOL",
          "stdName": "5.ALPHA.-ANDROST-1-ENE-3.BETA.,17.BETA.-DIOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d60b17c-3533-4abe-8b73-220306b6a30c"
          ],
          "display_name": false
        },
        {
          "uuid": "3628913c-593a-420f-a4e6-c99ea67a3ee5",
          "name": "ANDROST-1-ENE-3,17-DIOL, (3.BETA.,5.ALPHA.,17.BETA.)-",
          "stdName": "ANDROST-1-ENE-3,17-DIOL, (3.BETA.,5.ALPHA.,17.BETA.)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d60b17c-3533-4abe-8b73-220306b6a30c"
          ],
          "display_name": false
        },
        {
          "uuid": "07186cf6-9821-4e73-9479-bfa3cb7ef984",
          "name": "J1.958.985D",
          "stdName": "J1.958.985D",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e63d0369-c17b-4ac1-ad00-802774816200"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2f74f7ee-558e-4e34-8bd3-c9fca08fd2cc",
          "citation": "dea list",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8c529564-a4e4-4a03-afc8-8bb39f22eeac",
          "citation": "fda_srs",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7d60b17c-3533-4abe-8b73-220306b6a30c",
          "citation": "SciFinder",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e63d0369-c17b-4ac1-ad00-802774816200",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J1.958.985D",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J1.958.985D",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3bcc5909-2da7-43b8-a5c1-51982049f6a1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393015000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "48728050-b5d2-42c3-a42c-f220ff69f4d8",
          "citation": "SRS import [V7W74907I7]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=V7W74907I7",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393015000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a38bf2d0-beb4-44d0-bccb-f2033621f234",
          "citation": "http://forendex.southernforensic.org/index.php/detail/index/493",
          "url": "http://forendex.southernforensic.org/index.php/detail/index/493",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eff1d517-213a-a779-9361-8df6899de781",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=5323-27-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "df266b0c-5296-0954-1314-285973716940",
          "citation": "1-Androstenediol",
          "url": "https://en.wikipedia.org/wiki/1-Androstenediol",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "f1704237-45b6-a6ac-acc7-9d025e8a6896",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "8008b84d-3154-43ae-a688-294180c881db",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "fc24370f-f44a-4932-9565-ebb20ec202b6",
          "citation": "CFR",
          "url": "https://www.ecfr.gov/current/title-21/chapter-II/part-1308",
          "doc_type": "CFR",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7452b112-477c-4b9d-89f0-4b837b26e540",
          "id": "7452b112-477c-4b9d-89f0-4b837b26e540",
          "molfile": "\n  Marvin  01132106022D          \n\n 21 24  0  0  1  0            999 V2000\n    9.8373   -9.8393    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   10.0949   -9.0501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3260  -10.5029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8373  -11.1707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0581  -10.9133    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.3423  -11.3238    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    8.3423  -12.1547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6266  -12.5651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9162  -12.1547    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.2005  -12.5651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4900  -12.1547    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.7741  -12.5651    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4900  -11.3238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2005  -10.9133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9162  -11.3238    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.9162  -10.5029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6266  -10.9133    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.6266  -10.0922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3423   -9.6810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0581  -10.0922    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.0581   -9.2659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 20  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  1  0  0  0\n  6  5  1  0  0  0  0\n  5 20  1  0  0  0  0\n  6  7  1  6  0  0  0\n  6 17  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  1  0  0  0\n 15  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  1  0  0  0\n 13 11  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  1  0  0  0\n 17 15  1  0  0  0  0\n 17 18  1  1  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  1  1  0  0  0\nM  END",
          "smiles": "C[C@@]12C=C[C@@H](C[C@@H]2CC[C@H]3[C@@H]4CC[C@@H]([C@@]4(C)CC[C@@H]31)O)O",
          "formula": "C19H30O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5099b62f-101b-443d-9a16-36c10219d89a"
          },
          "defined_stereo": 8,
          "ez_centers": 0,
          "molecular_weight": "290.441",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 8
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3508d39b-39a3-4b31-8fbd-543c899949b3",
      "version": "8",
      "structure": {
        "id": "e0be8731-df3f-450a-b91a-60b3507d1ba9",
        "molfile": "\n  Marvin  01132111382D          \n\n 25 28  0  0  1  0            999 V2000\n    5.4900  -11.3238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4900  -12.1547    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.2005  -12.5651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9162  -12.1547    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.9162  -11.3238    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.2005  -10.9133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6266  -10.9133    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.3423  -11.3238    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.3423  -12.1547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6266  -12.5651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0581  -10.9133    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.0581  -10.0922    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.3423   -9.6810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6266  -10.0922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8373   -9.8393    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.3260  -10.5029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8373  -11.1707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0949   -9.0501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0581   -9.2659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0581  -11.7443    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3423  -10.5029    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6266  -11.7443    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9162  -10.5029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9162  -12.9652    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7741  -12.5651    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  1  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n  4 10  1  0  0  0  0\n  8 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n  7 14  1  0  0  0  0\n 12 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 11 17  1  0  0  0  0\n 15 18  1  1  0  0  0\n 12 19  1  1  0  0  0\n 11 20  1  6  0  0  0\n  8 21  1  1  0  0  0\n  7 22  1  6  0  0  0\n  5 23  1  1  0  0  0\n  4 24  1  6  0  0  0\n  2 25  1  1  0  0  0\nM  END",
        "smiles": "C[C@@]12C=C[C@@H](C[C@]2([H])CC[C@@]3([H])[C@]4([H])CC[C@@H]([C@@]4(C)CC[C@@]31[H])O)O",
        "formula": "C19H30O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 8,
        "ez_centers": 0,
        "molecular_weight": "290.441",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "a38bf2d0-beb4-44d0-bccb-f2033621f234",
          "48728050-b5d2-42c3-a42c-f220ff69f4d8"
        ],
        "stereo_centers": 8
      },
      "unii": "V7W74907I7"
    }
  ]
}