{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "6428c4b6-ae2b-42b8-8dcb-e02fcfee3bf6", "code": "1103-39-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1103-39-5", "code_system": "CAS", "references": [ "c96fc230-657d-4467-b74e-fb856cfe4052", "6b02525c-57e8-45d6-9fa8-c43c7c5cf689" ] }, { "uuid": "485a9553-9477-4487-9cef-48eb7cd7e6bb", "code": "214-161-1", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.012.874", "code_system": "ECHA (EC/EINECS)", "references": [ "c96fc230-657d-4467-b74e-fb856cfe4052" ] }, { "uuid": "d29ff82a-0ed2-5877-3fd2-76e61174cbac", "code": "5524", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/5524", "code_system": "HSDB", "references": [ "7284604c-b6c9-5fa0-94f8-b45aa168340a" ] }, { "uuid": "cbd26711-736f-7e5c-c0b8-dd594d265f13", "code": "DTXSID2061486", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2061486", "code_system": "EPA CompTox", "references": [ "668532fd-8187-93ed-e595-76370a735295" ] }, { "uuid": "b5b45088-1787-4a0c-8ca9-b36327607596", "code": "V7JY576DQ4", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "e68a6ce7-3b23-e0e5-7bd4-54d62485f6ad", "code": "16089", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=16089", "code_system": "NSC", "references": [ "598646ee-0cbd-ef54-5d5d-c616fb56163c" ] } ], "substance_class": "chemical", "names": [ { "uuid": "425faf5e-35a1-4a04-a18c-4f2ed1f01bfc", "name": "1-NAPHTHALENESULFONIC ACID, 2-((2-HYDROXY-1-NAPHTHALENYL)AZO)- CALCIUM SALT", "stdName": "1-NAPHTHALENESULFONIC ACID, 2-((2-HYDROXY-1-NAPHTHALENYL)AZO)- CALCIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8fe5d0a3-b264-4d34-ac0f-418c6502c40a", "fc453d1c-59ce-4e47-8ff6-87c66b342f55" ], "display_name": false }, { "uuid": "fc9f9ce8-85c8-46c4-8eec-b6338eb921ec", "name": "1-NAPHTHALENESULFONIC ACID, 2-(2-(2-HYDROXY-1-NAPHTHALENYL)DIAZENYL)-, CALCIUM SALT (2:1)", "stdName": "1-NAPHTHALENESULFONIC ACID, 2-(2-(2-HYDROXY-1-NAPHTHALENYL)DIAZENYL)-, CALCIUM SALT (2:1)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "fc453d1c-59ce-4e47-8ff6-87c66b342f55", "f4ef867e-b5ef-4f32-a2e0-02e66b1a6569" ], "display_name": false }, { "uuid": "ef09cece-b15f-4fcb-ac99-1d34e1b1d661", "name": "AKA206", "stdName": "AKA206", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "8fe5d0a3-b264-4d34-ac0f-418c6502c40a", "858ecc6f-6946-41a3-8132-690ca33d08af", "fc453d1c-59ce-4e47-8ff6-87c66b342f55" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "4856e532-1c26-4466-b0e2-f109927effb4", "name_org": "INCI" } ] }, { "uuid": "c3a128f1-0cfa-4be2-bd7f-e3ed879ab51a", "name": "C.I. PIGMENT RED 49:2", "stdName": "C.I. PIGMENT RED 49:2", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "fc453d1c-59ce-4e47-8ff6-87c66b342f55", "f4ef867e-b5ef-4f32-a2e0-02e66b1a6569" ], "display_name": false }, { "uuid": "c9dcf983-bbd3-4420-8426-8cfa709f09d7", "name": "CALCIUM LITHOL RED [HSDB]", "stdName": "CALCIUM LITHOL RED [HSDB]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0f4d8bde-f2ec-4144-a5f8-2f772e083532", "fc453d1c-59ce-4e47-8ff6-87c66b342f55" ], "display_name": false }, { "uuid": "110bb768-910c-40ff-8bbf-3a306e497d52", "name": "CALCIUM, 2-((2-HYDROXY-1-NAPHTHALENYL)AZO)-1-NAPHTHALENESULFONATE", "stdName": "CALCIUM, 2-((2-HYDROXY-1-NAPHTHALENYL)AZO)-1-NAPHTHALENESULFONATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8fe5d0a3-b264-4d34-ac0f-418c6502c40a", "fc453d1c-59ce-4e47-8ff6-87c66b342f55" ], "display_name": false }, { "uuid": "0a010ea4-8900-448f-9f2b-c7bf7a2de4ef", "name": "CI 15630:2", "stdName": "CI 15630:2", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8fe5d0a3-b264-4d34-ac0f-418c6502c40a", "fc453d1c-59ce-4e47-8ff6-87c66b342f55" ], "display_name": false }, { "uuid": "1b806415-51dc-4267-9d40-8b1100bf5911", "name": "LITHOL RED, CA", "stdName": "LITHOL RED, CA", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8fe5d0a3-b264-4d34-ac0f-418c6502c40a", "fc453d1c-59ce-4e47-8ff6-87c66b342f55" ], "display_name": false }, { "uuid": "df819555-8e21-4322-bff4-d368d713b69c", "name": "NSC-16089", "stdName": "NSC-16089", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "fc453d1c-59ce-4e47-8ff6-87c66b342f55", "7722cda8-2152-4d26-a7d3-0a003ff04b42" ], "display_name": false }, { "uuid": "2a9bed30-6cc4-4fcb-afe5-2082672e9255", "name": "PIGMENT RED 49:2", "stdName": "PIGMENT RED 49:2", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8fe5d0a3-b264-4d34-ac0f-418c6502c40a", "fc453d1c-59ce-4e47-8ff6-87c66b342f55" ], "display_name": false }, { "uuid": "e1f5f09a-2faa-446f-b115-572537c99439", "name": "RED 11", "stdName": "RED 11", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8fe5d0a3-b264-4d34-ac0f-418c6502c40a", "fc453d1c-59ce-4e47-8ff6-87c66b342f55" ], "display_name": false }, { "uuid": "835788f0-95ad-4908-b09f-12c9ab8f594b", "name": "RED NO. 206", "stdName": "RED NO. 206", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8fe5d0a3-b264-4d34-ac0f-418c6502c40a", "fc453d1c-59ce-4e47-8ff6-87c66b342f55" ], "display_name": false } ], "references": [ { "uuid": "8fe5d0a3-b264-4d34-ac0f-418c6502c40a", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "fc453d1c-59ce-4e47-8ff6-87c66b342f55", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f4ef867e-b5ef-4f32-a2e0-02e66b1a6569", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0f4d8bde-f2ec-4144-a5f8-2f772e083532", "citation": "HSDB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7722cda8-2152-4d26-a7d3-0a003ff04b42", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c96fc230-657d-4467-b74e-fb856cfe4052", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391420000, "tags": [ "NOMEN" ] }, { "uuid": "004dd51d-8f7e-4870-a4e5-26addb1c0824", "citation": "SRS import [V7JY576DQ4]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=V7JY576DQ4", "doc_type": "SRS", "public_domain": true, "document_date": 1493391420000, "tags": [ "NOMEN" ] }, { "uuid": "858ecc6f-6946-41a3-8132-690ca33d08af", "citation": "AKA206 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "7284604c-b6c9-5fa0-94f8-b45aa168340a", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+1103-39-5", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "668532fd-8187-93ed-e595-76370a735295", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1103-39-5", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "6b02525c-57e8-45d6-9fa8-c43c7c5cf689", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "598646ee-0cbd-ef54-5d5d-c616fb56163c", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "89f73847-f3e6-478e-b9a3-4f43afb940f0", "id": "89f73847-f3e6-478e-b9a3-4f43afb940f0", "molfile": "\n Marvin 01132107102D \n\n 1 0 0 0 0 0 999 V2000\n 16.2300 -5.7415 0.0000 Ca 0 2 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 2\nM END", "smiles": "[Ca+2]", "formula": "Ca", "atropisomerism": "No", "charge": 2, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "fa0534a7-dd26-4d5d-9ec7-e82c1e4e05ed" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "40.078", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "a11907ed-15bf-4c1b-9705-2f10aeda97ba", "id": "a11907ed-15bf-4c1b-9705-2f10aeda97ba", "molfile": "\n Marvin 01132108222D \n\n 27 30 0 0 0 0 999 V2000\n 9.0988 -5.0391 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0988 -5.8641 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9238 -5.8641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2737 -5.8641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0988 -6.6891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8132 -7.1016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8132 -7.9266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0987 -8.3391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3843 -7.9266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6698 -8.3391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9554 -7.9266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9554 -7.1016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6698 -6.6891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3843 -7.1016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5277 -6.6891 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2422 -7.1016 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9567 -6.6891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9567 -5.8641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2422 -5.4516 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 12.6712 -5.4516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3856 -5.8641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3856 -6.6891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1001 -7.1016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1001 -7.9266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3856 -8.3391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6712 -7.9266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6712 -7.1016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 2 0 0 0 0\n 2 4 2 0 0 0 0\n 5 2 1 0 0 0 0\n 6 5 1 0 0 0 0\n 14 5 2 0 0 0 0\n 7 6 2 0 0 0 0\n 6 15 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 2 0 0 0 0\n 10 9 1 0 0 0 0\n 9 14 1 0 0 0 0\n 11 10 2 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 2 0 0 0 0\n 14 13 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 18 17 1 0 0 0 0\n 17 27 2 0 0 0 0\n 18 19 1 0 0 0 0\n 20 18 2 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 2 0 0 0 0\n 22 23 1 0 0 0 0\n 27 22 1 0 0 0 0\n 24 23 2 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 2 0 0 0 0\n 27 26 1 0 0 0 0\nM CHG 1 19 -1\nM END", "smiles": "c1ccc2c(c1)ccc(c2/N=N/c3ccc4ccccc4c3S(=O)(=O)O)[O-]", "formula": "C20H13N2O4S", "atropisomerism": "No", "charge": -1, "count": 2, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "e8fbdf2a-aebd-4973-b1dd-df10cbe1158a" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "377.3951", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "12e17510-7801-48a9-ae2a-a8c073ed636c", "version": "6", "structure": { "id": "f12a1a1d-0271-4e44-8db6-774d13590efb", "molfile": "\n Marvin 01132112312D \n\n 55 60 0 0 0 0 999 V2000\n 16.2300 -5.7415 0.0000 Ca 0 2 0 0 0 0 0 0 0 0 0 0\n 6.9554 -7.1016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9554 -7.9266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6698 -8.3391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3843 -7.9266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3843 -7.1016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6698 -6.6891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0988 -6.6891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8132 -7.1016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8132 -7.9266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0987 -8.3391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5277 -6.6891 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2422 -7.1016 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9567 -6.6891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9567 -5.8641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6712 -5.4516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3856 -5.8641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3856 -6.6891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6712 -7.1016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6712 -7.9266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3856 -8.3391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1001 -7.9266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1001 -7.1016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2422 -5.4516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0988 -5.8641 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9238 -5.8641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2737 -5.8641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0988 -5.0391 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9554 -7.1016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9554 -7.9266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6698 -8.3391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3843 -7.9266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3843 -7.1016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6698 -6.6891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0988 -6.6891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8132 -7.1016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8132 -7.9266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0987 -8.3391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5277 -6.6891 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2422 -7.1016 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9567 -6.6891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9567 -5.8641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6712 -5.4516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3856 -5.8641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3856 -6.6891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6712 -7.1016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6712 -7.9266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3856 -8.3391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1001 -7.9266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1001 -7.1016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2422 -5.4516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0988 -5.8641 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9238 -5.8641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2737 -5.8641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0988 -5.0391 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 2 7 2 0 0 0 0\n 6 7 1 0 0 0 0\n 6 8 1 0 0 0 0\n 9 8 2 0 0 0 0\n 10 9 1 0 0 0 0\n 5 11 1 0 0 0 0\n 11 10 2 0 0 0 0\n 9 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 15 14 2 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 2 0 0 0 0\n 18 17 1 0 0 0 0\n 14 19 1 0 0 0 0\n 19 18 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 18 23 1 0 0 0 0\n 22 23 2 0 0 0 0\n 15 24 1 0 0 0 0\n 8 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 25 27 2 0 0 0 0\n 25 28 1 0 0 0 0\n 29 30 1 0 0 0 0\n 29 34 2 0 0 0 0\n 30 31 2 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 2 0 0 0 0\n 32 38 1 0 0 0 0\n 33 34 1 0 0 0 0\n 33 35 1 0 0 0 0\n 36 35 2 0 0 0 0\n 35 52 1 0 0 0 0\n 37 36 1 0 0 0 0\n 36 39 1 0 0 0 0\n 38 37 2 0 0 0 0\n 39 40 2 0 0 0 0\n 40 41 1 0 0 0 0\n 42 41 2 0 0 0 0\n 41 46 1 0 0 0 0\n 43 42 1 0 0 0 0\n 42 51 1 0 0 0 0\n 44 43 2 0 0 0 0\n 45 44 1 0 0 0 0\n 46 45 2 0 0 0 0\n 45 50 1 0 0 0 0\n 46 47 1 0 0 0 0\n 47 48 2 0 0 0 0\n 48 49 1 0 0 0 0\n 49 50 2 0 0 0 0\n 52 53 2 0 0 0 0\n 52 54 2 0 0 0 0\n 52 55 1 0 0 0 0\nM CHG 1 1 2\nM STY 1 1 MUL\nM SCN 1 1 HT \nM SAL 1 15 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16\nM SAL 1 15 17 18 19 20 21 22 23 24 25 26 27 28 29 30 31\nM SAL 1 15 32 33 34 35 36 37 38 39 40 41 42 43 44 45 46\nM SAL 1 9 47 48 49 50 51 52 53 54 55\nM SPA 1 15 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16\nM SPA 1 12 17 18 19 20 21 22 23 24 25 26 27 28\nM SDI 1 4 6.5354 -8.7591 6.5354 -4.6191\nM SDI 1 4 14.5201 -4.6191 14.5201 -8.7591\nM SMT 1 2\nM END", "smiles": "c1ccc2c(c1)ccc(c2/N=N/c3ccc4ccccc4c3S(=O)(=O)O)O.c1ccc2c(c1)ccc(c2/N=N/c3ccc4ccccc4c3S(=O)(=O)O)O.[Ca+2]", "formula": "2C20H14N2O4S.Ca", "atropisomerism": "No", "charge": 2, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "796.884", "optical_activity": "NONE", "references": [ "004dd51d-8f7e-4870-a4e5-26addb1c0824", "8fe5d0a3-b264-4d34-ac0f-418c6502c40a" ], "stereo_centers": 0 }, "unii": "V7JY576DQ4" } ] }