{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6de5a40f-e42e-4805-b00c-74befffeb40b",
          "code": "M04AB02",
          "comments": "ATC|MUSCULO-SKELETAL SYSTEM|ANTIGOUT PREPARATIONS|ANTIGOUT PREPARATIONS|Preparations increasing uric acid excretion|sulfinpyrazone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=M04AB02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "d8a00209-6b16-4c29-aa7b-a83c4bff2dc6"
          ]
        },
        {
          "uuid": "fd63b28a-de67-4d16-a92a-3f33d210dade",
          "code": "QM04AB02",
          "comments": "VATC|ANTIGOUT PREPARATIONS|ANTIGOUT PREPARATIONS|Preparations increasing uric acid excretion|sulfinpyrazone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QM04AB02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "d8a00209-6b16-4c29-aa7b-a83c4bff2dc6"
          ]
        },
        {
          "uuid": "5a8ee95e-c76a-45f9-aab4-0eeebf7e8161",
          "code": "57-96-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=57-96-5",
          "code_system": "CAS",
          "references": [
            "d8a00209-6b16-4c29-aa7b-a83c4bff2dc6",
            "120223d9-d35a-454b-b62b-b59e370328a6"
          ]
        },
        {
          "uuid": "39b2ffbe-23f6-4577-aae4-02c935acec21",
          "code": "C47739",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47739",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d8a00209-6b16-4c29-aa7b-a83c4bff2dc6"
          ]
        },
        {
          "uuid": "de1e9ff2-eb1f-48ed-8189-96ea6814146f",
          "code": "913",
          "comments": "LiverTox|Antimicrobial|Antibacterial|Sulfonamide",
          "type": "PRIMARY",
          "url": "https://livertox.nlm.nih.gov/Sulfinpyrazone.htm",
          "code_system": "LIVERTOX",
          "references": [
            "d8a00209-6b16-4c29-aa7b-a83c4bff2dc6"
          ]
        },
        {
          "uuid": "7b668e7d-248a-42de-84cd-d4a0fa74663e",
          "code": "D013442",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68013442",
          "code_system": "MESH",
          "references": [
            "d8a00209-6b16-4c29-aa7b-a83c4bff2dc6"
          ]
        },
        {
          "uuid": "c5cedef3-248d-42e7-a456-1090b6937cf7",
          "code": "SULFINPYRAZONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Sulfinpyrazone",
          "code_system": "WIKIPEDIA",
          "references": [
            "d8a00209-6b16-4c29-aa7b-a83c4bff2dc6"
          ]
        },
        {
          "uuid": "0eab9226-80a3-4f72-96de-e77c946d729f",
          "code": "777",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=777",
          "code_system": "INN",
          "references": [
            "d8a00209-6b16-4c29-aa7b-a83c4bff2dc6"
          ]
        },
        {
          "uuid": "97eaaba8-e197-4d32-b90d-80a7297cb364",
          "code": "5826",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=5826",
          "code_system": "IUPHAR",
          "references": [
            "d8a00209-6b16-4c29-aa7b-a83c4bff2dc6"
          ]
        },
        {
          "uuid": "b6da5309-6c3c-43b8-8158-00db76c9d50c",
          "code": "10205",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/10205/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "d8a00209-6b16-4c29-aa7b-a83c4bff2dc6"
          ]
        },
        {
          "uuid": "826aa6f2-a2e5-4b4f-9efd-1bf46499b5d7",
          "code": "m10349",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10349?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d8a00209-6b16-4c29-aa7b-a83c4bff2dc6"
          ]
        },
        {
          "uuid": "69a4b80a-ddb1-400c-8f65-a08bbb3d7c54",
          "code": "DB01138",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01138",
          "code_system": "DRUG BANK",
          "references": [
            "d8a00209-6b16-4c29-aa7b-a83c4bff2dc6"
          ]
        },
        {
          "uuid": "29a408f4-97e3-4f50-abae-5537edab2831",
          "code": "SUB10737MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "d8a00209-6b16-4c29-aa7b-a83c4bff2dc6"
          ]
        },
        {
          "uuid": "160f3d88-a892-4b89-8c84-32dae8c1cf87",
          "code": "CHEMBL832",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL832",
          "code_system": "ChEMBL",
          "references": [
            "d8a00209-6b16-4c29-aa7b-a83c4bff2dc6"
          ]
        },
        {
          "uuid": "17b0b027-b813-44ae-a60b-bbe33ab5d6fe",
          "code": "200-357-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.325",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d8a00209-6b16-4c29-aa7b-a83c4bff2dc6"
          ]
        },
        {
          "uuid": "04496a99-44c8-4b55-8085-942c6a4d5ad1",
          "code": "5342",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5342",
          "code_system": "PUBCHEM",
          "references": [
            "d8a00209-6b16-4c29-aa7b-a83c4bff2dc6"
          ]
        },
        {
          "uuid": "a310432f-2869-4808-81ab-7adfe95aaf27",
          "code": "3396",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3396",
          "code_system": "HSDB",
          "references": [
            "478aad04-290b-9840-a6a5-e6987486a262"
          ]
        },
        {
          "uuid": "1dc79ed4-76d8-c175-e74b-eee445605e3c",
          "code": "DTXSID0023618",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0023618",
          "code_system": "EPA CompTox",
          "references": [
            "003e08d6-92f2-9781-1497-5f4e631ecc79"
          ]
        },
        {
          "uuid": "2a2c92f5-2ca3-d7f5-9cd3-ea306418821b",
          "code": "C921",
          "comments": "Pharmacologic Substance[C1909]|Protective Agent[C26170]|Uricosuric Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C921",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e9944e5f-b6b0-eec2-b807-55e032612bde"
          ]
        },
        {
          "uuid": "178866a7-0f9b-45d1-8783-8c9827bd3beb",
          "code": "V6OFU47K3W",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f523d9fe-e5d2-9b30-3c64-534452a22a3f",
          "code": "2528",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2528",
          "code_system": "DRUG CENTRAL",
          "references": [
            "e9944e5f-b6b0-eec2-b807-55e032612bde"
          ]
        },
        {
          "uuid": "dfce80d3-6ae3-415f-2b59-aa0278c00dd8",
          "code": "1637008",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1637008",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "e9944e5f-b6b0-eec2-b807-55e032612bde"
          ]
        },
        {
          "uuid": "0c582505-5334-f57c-f449-f04d73932ea0",
          "code": "9342",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:9342",
          "code_system": "CHEBI",
          "references": [
            "e9944e5f-b6b0-eec2-b807-55e032612bde"
          ]
        },
        {
          "uuid": "d0d65cba-71b8-a47b-b956-5d8a0c7c76f3",
          "code": "75925",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=75925",
          "code_system": "NSC",
          "references": [
            "465bbeba-198e-3ad5-a039-c7c9389cfd42"
          ]
        },
        {
          "uuid": "61f26a50-5b5a-e674-7d56-3d47a224d5df",
          "code": "100000091951",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "8e4e67fd-b495-988d-e746-ae9c864169ec"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "771ee893-524c-4e71-848b-a9e45c606272",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a6ed93b8-3b14-4be3-925e-892abc2b9f0e",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "67e3a499-6919-4658-82e1-b99029f8f59a",
          "citation": "INN Proposed List 8",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL08.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "332d4f65-f3c2-40a6-b878-9368cda4f5bb",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a9a0e4a0-978d-4fe9-bd23-2e556515d1a9",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a41887c3-64aa-432d-be10-1a984da7c0b4",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3af977bc-426c-4b49-83b1-4b1d255d7b02",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8d1a3914-3bb3-404f-89e1-269ab5746ce2",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f169243b-4cbc-43a0-be17-e1918dce483e",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff38f1df-7e83-4af4-a24c-41cc83d1eafa",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2c0ffee7-f417-467c-9962-504a7e2dbbe9",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7eafad8d-20e9-4e93-9213-7ad4ec322367",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b936a687-2b45-4696-a533-9b743d44cd42",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d8a00209-6b16-4c29-aa7b-a83c4bff2dc6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390965000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "89037fe4-0547-4fbb-b66a-379ef9a5dbd2",
          "citation": "SRS import [V6OFU47K3W]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=V6OFU47K3W",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390965000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2d363867-44f0-48ef-aca1-50fb193d5c11",
          "citation": "SULFINPYRAZONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "be13450f-3027-4f42-8894-91163b6ce699",
          "citation": "SULFINPYRAZONE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e0f700ae-1c7c-45c1-82d9-8c2a08ebe4bc",
          "citation": "SULFINPYRAZONE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "febe81b8-2d18-4e1c-9c23-47bd2d13a7c8",
          "citation": "SULFINPYRAZONE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e1a1e6b4-a321-4b1b-95ce-e0d22e26a192",
          "citation": "SULFINPYRAZONE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bc630834-2fdc-4e1c-8b57-68a92cd5c389",
          "citation": "SULFINPYRAZONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d0031a54-f2f4-4af8-82e3-c7b02924f13f",
          "citation": "SULFINPYRAZONE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "075fe6ac-2ed7-456b-912e-0ba06939a77c",
          "citation": "SULFINPYRAZONE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "091cb3ee-ac8d-457e-a21b-6c88c9ca07d7",
          "citation": "SULFINPYRAZONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cacba80d-0e51-4b85-9ce1-9a23d905a732",
          "citation": "SULFINPYRAZONE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "da68fc1a-2371-408c-40d3-fdb48bb5849a",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "478aad04-290b-9840-a6a5-e6987486a262",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+57-96-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "003e08d6-92f2-9781-1497-5f4e631ecc79",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=57-96-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "367152ad-20ae-a881-941e-ab4fba31abae",
          "citation": "https://www.clinicalkey.com/pharmacology/monograph/1575?sec=monphar",
          "doc_type": "CLINICAL PHARMACOLOGY",
          "public_domain": true
        },
        {
          "uuid": "63e466b6-2a35-c5f4-13d7-7315146d6bcf",
          "citation": "https://www.drugbank.ca/drugs/DB01138",
          "doc_type": "WEBSITE",
          "public_domain": true
        },
        {
          "uuid": "e9944e5f-b6b0-eec2-b807-55e032612bde",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "120223d9-d35a-454b-b62b-b59e370328a6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "bad1825c-689f-40c2-a01a-6d6bd59261b5",
          "citation": "European Pharmacopoeia Online 9.8, Sulfinpyrazone Monograph",
          "url": "http://online6.edqm.eu/ep908/",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5e37ffbe-8166-482c-8693-11e0d40901a2",
          "citation": "European Pharmacopoeia Online 9.8, Sulfinpyrazone Monograph",
          "url": "http://online6.edqm.eu/ep908/",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ad8a266a-919d-4a3c-aae9-99006cf0d7c7",
          "citation": "European Pharmacopoeia Online 9.8, Sulfinpyrazone Monograph",
          "url": "http://online6.edqm.eu/ep908/",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c5fdec46-3657-b384-9b69-c9b3697581ca",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "465bbeba-198e-3ad5-a039-c7c9389cfd42",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "af825f46-680f-edef-69cf-a7089843a1a6",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "1ab314c7-a756-f014-a238-9f09b63b7b1a",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "8e4e67fd-b495-988d-e746-ae9c864169ec",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a89fd348-865a-4b8b-ad8b-d9a05bc39d72",
          "id": "a89fd348-865a-4b8b-ad8b-d9a05bc39d72",
          "molfile": "\n  Marvin  01132108452D          \n\n 29 32  0  0  0  0            999 V2000\n   -1.4032   -0.0181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9191   -0.6990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0906   -0.6990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6032   -0.2692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3256   -0.6680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0376   -0.2330    0.0000 S   0  0  0  0  0  0  0  0  0  3  0  0\n    2.0143    0.5799    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7806   -0.6214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4823   -0.1890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2098   -0.5877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2279   -1.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5211   -1.8460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7858   -1.4369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1605   -1.4913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9372   -1.7554    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5152   -1.9806    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1910   -1.4835    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9755   -1.7321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5891   -1.1806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3735   -1.4240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5522   -2.2240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9489   -2.7806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1411   -2.5217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5308   -2.7884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2376   -3.2104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2376   -4.0338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5385   -4.4506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1890   -4.0338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1968   -3.2104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  3  2  1  0  0  0  0\n  2 17  1  0  0  0  0\n  4  3  1  0  0  0  0\n 14  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 13  8  2  0  0  0  0\n 10  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 24 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 23 18  2  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n 22 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 29 24  2  0  0  0  0\n 26 25  2  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  2  0  0  0  0\n 28 29  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)N2C(=O)C(CCS(=O)c3ccccc3)C(=O)N2c4ccccc4",
          "formula": "C23H20N2O3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "58e63459-d147-4b05-bb25-b67faeb34480"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "404.4834",
          "optical_activity": "NONE",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "52b5c76e-d0d1-4766-914f-c9fefd813b91",
      "version": "36",
      "structure": {
        "id": "c7f70591-30ab-45e6-8b66-be9462f7982c",
        "molfile": "\n  Marvin  01132110202D          \n\n 29 32  0  0  0  0            999 V2000\n   -1.1910   -1.4835    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5152   -1.9806    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1605   -1.4913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9191   -0.6990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0906   -0.6990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0376   -0.2330    0.0000 S   0  3  0  0  0  0  0  0  0  0  0  0\n    0.6032   -0.2692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9755   -1.7321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5308   -2.7884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4032   -0.0181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9372   -1.7554    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3256   -0.6680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0143    0.5799    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.7806   -0.6214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2376   -3.2104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1968   -3.2104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1411   -2.5217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5891   -1.1806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4823   -0.1890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7858   -1.4369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3735   -1.4240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2376   -4.0338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1890   -4.0338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2098   -0.5877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5211   -1.8460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9489   -2.7806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5385   -4.4506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5522   -2.2240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2279   -1.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6 12  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  1  1  0  0  0  0\n  9  2  1  0  0  0  0\n 10  4  2  0  0  0  0\n 11  3  2  0  0  0  0\n 12  7  1  0  0  0  0\n 13  6  1  0  0  0  0\n 14  6  1  0  0  0  0\n 15  9  2  0  0  0  0\n 16  9  1  0  0  0  0\n 17  8  1  0  0  0  0\n 18  8  2  0  0  0  0\n 19 14  2  0  0  0  0\n 20 14  1  0  0  0  0\n 21 18  1  0  0  0  0\n 22 15  1  0  0  0  0\n 23 16  2  0  0  0  0\n 24 19  1  0  0  0  0\n 25 20  2  0  0  0  0\n 26 17  2  0  0  0  0\n 27 23  1  0  0  0  0\n 28 21  2  0  0  0  0\n 29 25  1  0  0  0  0\n  3  5  1  0  0  0  0\n 26 28  1  0  0  0  0\n 22 27  2  0  0  0  0\n 24 29  2  0  0  0  0\nM  CHG  2   6   1  13  -1\nM  END",
        "smiles": "c1ccc(cc1)N2C(=O)C(CC[S+](c3ccccc3)[O-])C(=O)N2c4ccccc4",
        "formula": "C23H20N2O3S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "404.4834",
        "optical_activity": "( + / - )",
        "references": [
          "89037fe4-0547-4fbb-b66a-379ef9a5dbd2",
          "771ee893-524c-4e71-848b-a9e45c606272",
          "67e3a499-6919-4658-82e1-b99029f8f59a"
        ],
        "stereo_centers": 1
      },
      "unii": "V6OFU47K3W",
      "relationships": [
        {
          "uuid": "393f0359-f388-429f-9d7d-dc5cd7a5830c",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "5706d24e-5821-402d-9cca-e9f82dda9f69",
            "refuuid": "52b5c76e-d0d1-4766-914f-c9fefd813b91",
            "name": "SULFINPYRAZONE",
            "unii": "V6OFU47K3W",
            "linking_id": "V6OFU47K3W",
            "ref_pname": "SULFINPYRAZONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "17a5036b-a85a-4490-9879-4727eef1f686",
          "type": "METABOLITE->PARENT",
          "related_substance": {
            "uuid": "c74d0e55-741e-48e5-96b5-ee16c3a56e96",
            "refuuid": "fa2b1ef5-5445-4b89-aed3-3549aae28908",
            "name": "1-(4-HYDROXYPHENYL)-2-PHENYL-4-(2-(PHENYLSULFONYL)ETHYL)-3,5-PYRAZOLIDINEDIONE",
            "unii": "VR6G7RHH26",
            "linking_id": "VR6G7RHH26",
            "ref_pname": "1-(4-HYDROXYPHENYL)-2-PHENYL-4-(2-(PHENYLSULFONYL)ETHYL)-3,5-PYRAZOLIDINEDIONE"
          }
        },
        {
          "uuid": "7605eb4e-7b81-48b2-ae52-2e36b230d500",
          "type": "METABOLITE->PARENT",
          "related_substance": {
            "uuid": "b9691377-4040-4d51-aa27-67c22cca3e9d",
            "refuuid": "4739c8eb-c88b-4289-98cd-54288ac11213",
            "name": "SULFINPYRAZONE SULFONE",
            "unii": "5M9FOG2KDI",
            "linking_id": "5M9FOG2KDI",
            "ref_pname": "SULFINPYRAZONE SULFONE"
          }
        },
        {
          "uuid": "5c47890a-3a20-4598-a56f-7df03d23eed4",
          "type": "METABOLITE->PARENT",
          "related_substance": {
            "uuid": "ec678e08-ff37-463f-ac22-a6b25a91c611",
            "refuuid": "a2852f98-f145-475b-b9c2-05d583f44268",
            "name": "SULFINPYRAZONE-C-GLUCURONIDE",
            "unii": "Q9BR5Q8U97",
            "linking_id": "Q9BR5Q8U97",
            "ref_pname": "SULFINPYRAZONE-C-GLUCURONIDE"
          }
        },
        {
          "uuid": "5a9fb299-7c50-4f3e-8e78-fca327d678d1",
          "type": "METABOLITE->PARENT",
          "related_substance": {
            "uuid": "f6c367f9-7ac4-4b52-b9ee-1bd7469a0417",
            "refuuid": "dbf6d7cf-3a00-4d34-bf7c-5ad0ccb34cfe",
            "name": "G-25671",
            "unii": "BH57G6G6BN",
            "linking_id": "BH57G6G6BN",
            "ref_pname": "G-25671"
          }
        },
        {
          "uuid": "86fc6450-b9c7-44c8-99f8-1f1116dfeeb6",
          "amount": {
            "uuid": "e575031b-c2fe-4a20-b4db-db913ff78f4a",
            "high": 99,
            "low": 98,
            "units": "%"
          },
          "type": "BINDER->LIGAND",
          "interaction_type": "BINDING",
          "references": [
            "367152ad-20ae-a881-941e-ab4fba31abae"
          ],
          "related_substance": {
            "uuid": "9c6051e6-3f38-4b9b-9f34-97ee24b42505",
            "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30",
            "name": "PLASMA PROTEIN FRACTION (HUMAN)",
            "unii": "6D53G0FD0Z",
            "linking_id": "6D53G0FD0Z",
            "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "60700a28-43f5-4042-9c16-df6325aba6c2",
          "type": "TARGET->INHIBITOR",
          "references": [
            "63e466b6-2a35-c5f4-13d7-7315146d6bcf"
          ],
          "related_substance": {
            "uuid": "57c4dd23-5b9c-4a1b-8560-81c17b4c1e69",
            "refuuid": "b4997637-93fc-4a84-9c54-a054fde9cfaf",
            "name": "MRP-2",
            "unii": "4AF605U6JN",
            "linking_id": "4AF605U6JN",
            "ref_pname": "MRP-2",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ffff8279-8e5e-4bb0-9656-273fc001ff2a",
          "amount": {
            "uuid": "a0ac2c98-31b0-4912-aa8d-13a9b8a0d145"
          },
          "type": "TARGET->INHIBITOR",
          "related_substance": {
            "uuid": "22ea4722-64c4-4369-ad58-3dd1470b0d52",
            "refuuid": "a92ba84a-46dc-4e3f-80d1-e490da271998",
            "name": "MRP-1",
            "unii": "Y49M64GZ4Q",
            "linking_id": "Y49M64GZ4Q",
            "ref_pname": "MRP-1",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "16cd891e-cdf6-4ebd-b0b1-862f5c5ad749",
          "amount": {
            "uuid": "b652ba3a-6c9a-4c24-a1f6-a89c5f32a8be",
            "type": "MOLE PERCENT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "bad1825c-689f-40c2-a01a-6d6bd59261b5"
          ],
          "related_substance": {
            "uuid": "5cd61905-c204-470e-a2aa-ccef850541ec",
            "refuuid": "378fcbf9-b23b-4156-a060-ba235d072fa6",
            "name": "3,5-PYRAZOLIDINEDIONE, 4-HYDROXY-1,2-DIPHENYL-4-(2-(PHENYLSULFINYL)ETHYL)-",
            "unii": "4EC249R46A",
            "linking_id": "4EC249R46A",
            "ref_pname": "3,5-PYRAZOLIDINEDIONE, 4-HYDROXY-1,2-DIPHENYL-4-(2-(PHENYLSULFINYL)ETHYL)-"
          }
        },
        {
          "uuid": "aed5a20e-402a-4270-9318-a60e61c607b8",
          "amount": {
            "uuid": "54ff14fa-51bb-45f7-ac4c-2e8e58e39c5f",
            "type": "MOLE PERCENT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "5e37ffbe-8166-482c-8693-11e0d40901a2"
          ],
          "related_substance": {
            "uuid": "0ceae28c-cdcd-4a7f-8c39-0fa117571b8a",
            "refuuid": "dbf6d7cf-3a00-4d34-bf7c-5ad0ccb34cfe",
            "name": "G-25671",
            "unii": "BH57G6G6BN",
            "linking_id": "BH57G6G6BN",
            "ref_pname": "G-25671"
          }
        },
        {
          "uuid": "26354cfb-59f1-444f-832d-09d78d4143f4",
          "amount": {
            "uuid": "299c1374-9aaf-4775-88de-c340cab3887f",
            "type": "MOLE PERCENT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "ad8a266a-919d-4a3c-aae9-99006cf0d7c7"
          ],
          "related_substance": {
            "uuid": "0429756d-4a5f-4e05-831a-3bb7e699675c",
            "refuuid": "4739c8eb-c88b-4289-98cd-54288ac11213",
            "name": "SULFINPYRAZONE SULFONE",
            "unii": "5M9FOG2KDI",
            "linking_id": "5M9FOG2KDI",
            "ref_pname": "SULFINPYRAZONE SULFONE"
          }
        }
      ],
      "names": [
        {
          "uuid": "7ae22655-1a05-49dc-94ee-2f7e0883c7ce",
          "name": "1,2-Diphenyl-4-[2-(phenylsulfinyl)ethyl]-3,5-pyrazolidinedione",
          "stdName": "1,2-DIPHENYL-4-(2-(PHENYLSULFINYL)ETHYL)-3,5-PYRAZOLIDINEDIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "771ee893-524c-4e71-848b-a9e45c606272"
          ],
          "display_name": false
        },
        {
          "uuid": "b0664dcc-843f-49da-aabe-27f22ce9edc0",
          "name": "3,5-PYRAZOLIDINEDIONE, 1,2-DIPHENYL-4-(2-(PHENYLSULFINYL)ETHYL)-",
          "stdName": "3,5-PYRAZOLIDINEDIONE, 1,2-DIPHENYL-4-(2-(PHENYLSULFINYL)ETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "771ee893-524c-4e71-848b-a9e45c606272"
          ],
          "display_name": false
        },
        {
          "uuid": "467d2068-c1ed-424d-bd5f-533f59c72d8d",
          "name": "ANTURANE",
          "stdName": "ANTURANE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6ed93b8-3b14-4be3-925e-892abc2b9f0e"
          ],
          "display_name": false
        },
        {
          "uuid": "5b56b01f-cec2-4e23-af62-f94ef7479de3",
          "name": "NSC-75925",
          "stdName": "NSC-75925",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b936a687-2b45-4696-a533-9b743d44cd42"
          ],
          "display_name": false
        },
        {
          "uuid": "12295e86-a21d-419f-be52-5f6bf535a0b3",
          "name": "SULFINPYRAZONE",
          "stdName": "SULFINPYRAZONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "771ee893-524c-4e71-848b-a9e45c606272",
            "091cb3ee-ac8d-457e-a21b-6c88c9ca07d7",
            "cacba80d-0e51-4b85-9ce1-9a23d905a732",
            "075fe6ac-2ed7-456b-912e-0ba06939a77c",
            "7eafad8d-20e9-4e93-9213-7ad4ec322367",
            "2d363867-44f0-48ef-aca1-50fb193d5c11",
            "2c0ffee7-f417-467c-9962-504a7e2dbbe9",
            "bc630834-2fdc-4e1c-8b57-68a92cd5c389",
            "febe81b8-2d18-4e1c-9c23-47bd2d13a7c8",
            "be13450f-3027-4f42-8894-91163b6ce699",
            "8d1a3914-3bb3-404f-89e1-269ab5746ce2",
            "f169243b-4cbc-43a0-be17-e1918dce483e",
            "67e3a499-6919-4658-82e1-b99029f8f59a",
            "a9a0e4a0-978d-4fe9-bd23-2e556515d1a9",
            "a41887c3-64aa-432d-be10-1a984da7c0b4",
            "d0031a54-f2f4-4af8-82e3-c7b02924f13f",
            "3af977bc-426c-4b49-83b1-4b1d255d7b02",
            "e0f700ae-1c7c-45c1-82d9-8c2a08ebe4bc",
            "ff38f1df-7e83-4af4-a24c-41cc83d1eafa",
            "332d4f65-f3c2-40a6-b878-9368cda4f5bb",
            "e1a1e6b4-a321-4b1b-95ce-e0d22e26a192"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "f1e17217-412f-48de-8a0f-f5ee50c6c421",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "6a2133ab-b222-65fe-a30f-068e2f0fa405",
          "name": "SULFINPYRAZONE [EP IMPURITY]",
          "stdName": "SULFINPYRAZONE [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "332d4f65-f3c2-40a6-b878-9368cda4f5bb"
          ],
          "display_name": false
        },
        {
          "uuid": "ad1594c8-a84b-0408-b524-628d859077d1",
          "name": "SULFINPYRAZONE [EP MONOGRAPH]",
          "stdName": "SULFINPYRAZONE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c5fdec46-3657-b384-9b69-c9b3697581ca"
          ],
          "display_name": false
        },
        {
          "uuid": "b7d77666-c5e9-456e-aa51-129e9ea484c3",
          "name": "SULFINPYRAZONE [JAN]",
          "stdName": "SULFINPYRAZONE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "da68fc1a-2371-408c-40d3-fdb48bb5849a"
          ],
          "display_name": false
        },
        {
          "uuid": "d703661b-e176-4ad2-97f9-1db41b950de1",
          "name": "SULFINPYRAZONE [MART.]",
          "stdName": "SULFINPYRAZONE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3af977bc-426c-4b49-83b1-4b1d255d7b02"
          ],
          "display_name": false
        },
        {
          "uuid": "4c326ca7-6c30-4c70-8165-f0fb60b0576e",
          "name": "SULFINPYRAZONE [MI]",
          "stdName": "SULFINPYRAZONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8d1a3914-3bb3-404f-89e1-269ab5746ce2"
          ],
          "display_name": false
        },
        {
          "uuid": "debc6b8c-3622-4f9a-b6f2-102ff7f30d49",
          "name": "SULFINPYRAZONE [ORANGE BOOK]",
          "stdName": "SULFINPYRAZONE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a41887c3-64aa-432d-be10-1a984da7c0b4"
          ],
          "display_name": false
        },
        {
          "uuid": "ff5336fb-8841-cf3d-0424-9d50fdce068f",
          "name": "SULFINPYRAZONE [USP IMPURITY]",
          "stdName": "SULFINPYRAZONE [USP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a9a0e4a0-978d-4fe9-bd23-2e556515d1a9"
          ],
          "display_name": false
        },
        {
          "uuid": "db89cb3d-22f8-4cbc-afc4-afbb4bee4bb7",
          "name": "SULFINPYRAZONE [USP-RS]",
          "stdName": "SULFINPYRAZONE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff38f1df-7e83-4af4-a24c-41cc83d1eafa"
          ],
          "display_name": false
        },
        {
          "uuid": "42af3ec6-bfb7-462b-941c-5a5c4229ca42",
          "name": "SULFINPYRAZONE [VANDF]",
          "stdName": "SULFINPYRAZONE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7eafad8d-20e9-4e93-9213-7ad4ec322367"
          ],
          "display_name": false
        },
        {
          "uuid": "c9b49c21-bec3-445b-8b11-c142fc9e9ba9",
          "name": "SULPHINPYRAZONE",
          "stdName": "SULPHINPYRAZONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6ed93b8-3b14-4be3-925e-892abc2b9f0e"
          ],
          "display_name": false
        },
        {
          "uuid": "be5b5887-e253-36f9-f3f6-3710d6973235",
          "name": "Sulfinpyrazone [WHO-DD]",
          "stdName": "SULFINPYRAZONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ab314c7-a756-f014-a238-9f09b63b7b1a"
          ],
          "display_name": false
        },
        {
          "uuid": "0d8d5549-7d7a-4e8f-aab1-96c1f3961769",
          "name": "sulfinpyrazone [INN]",
          "stdName": "SULFINPYRAZONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67e3a499-6919-4658-82e1-b99029f8f59a"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "4797a53b-0d87-41cc-bf20-035942910e82",
          "name": "Biological Half-life",
          "value": {
            "uuid": "20629d9d-c7e7-4d6e-ba42-24277fd72045",
            "high": 6,
            "low": 4,
            "units": "hours"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "367152ad-20ae-a881-941e-ab4fba31abae"
          ]
        }
      ]
    }
  ]
}