{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "cf5b3363-ae9d-40c8-80fc-a27998f98af8",
          "code": "976-56-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=976-56-7",
          "code_system": "CAS",
          "references": [
            "cca23580-9ebe-4dc5-a737-096556c3454c",
            "bd591322-7bda-44aa-b58b-ed4064db0f64"
          ]
        },
        {
          "uuid": "d466b8fd-0a5e-47a0-8684-5696a0c4d382",
          "code": "FCN NO. 556",
          "comments": "FCN|ANTIOXIDANT|EHTYLENE PHTHALATE POLYMERS",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=556",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "cca23580-9ebe-4dc5-a737-096556c3454c"
          ]
        },
        {
          "uuid": "35e2b19e-16a1-4998-aed4-940b9bac4471",
          "code": "FCN NO. 393",
          "comments": "FCN|COMPONENT|PET POLYMER",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=393",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "cca23580-9ebe-4dc5-a737-096556c3454c"
          ]
        },
        {
          "uuid": "9cd7b314-eefd-4c8d-8218-000ff5c823b9",
          "code": "213-551-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.012.320",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "cca23580-9ebe-4dc5-a737-096556c3454c"
          ]
        },
        {
          "uuid": "6e4e5d80-e434-4263-9066-0c0b36437375",
          "code": "70421",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/70421",
          "code_system": "PUBCHEM",
          "references": [
            "cca23580-9ebe-4dc5-a737-096556c3454c"
          ]
        },
        {
          "uuid": "53de2a68-2274-e338-61b9-c267d90cd1cb",
          "code": "DTXSID7061356",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7061356",
          "code_system": "EPA CompTox",
          "references": [
            "a8582afb-2a54-6751-d74c-fae39b9d4b4b"
          ]
        },
        {
          "uuid": "2c858bd4-efbd-4506-86e8-9d7b1ac6dd50",
          "code": "V6MOU97T5J",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b8064291-9880-44f5-bdf3-97c978206be8",
          "name": "ANTIOXIDANT 1222",
          "stdName": "ANTIOXIDANT 1222",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "38836c59-4740-44e7-ab99-de9b5a61c767",
            "df101312-c5a9-4653-a8e4-d200ad19579e"
          ],
          "display_name": false
        },
        {
          "uuid": "d1319598-317f-4fb0-a183-46cbc7db3765",
          "name": "BIS(1,1-DIMETHYLETHYL)-4-HYDROXYPHENYL)METHYL)PHOSPHONIC ACID DIETHYL ESTER, ((3,5-",
          "stdName": "BIS(1,1-DIMETHYLETHYL)-4-HYDROXYPHENYL)METHYL)PHOSPHONIC ACID DIETHYL ESTER, ((3,5-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a36d3a2f-c4b2-4ea2-942a-af87e0bf193a"
          ],
          "display_name": false
        },
        {
          "uuid": "5cdd382a-f2fe-4105-b955-dd0e4c725ec9",
          "name": "DIETHYL 3,5-DI-TERT-BUTYL-4-HYDROXYBENZYL PHOSPHATE",
          "stdName": "DIETHYL 3,5-DI-TERT-BUTYL-4-HYDROXYBENZYL PHOSPHATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "38836c59-4740-44e7-ab99-de9b5a61c767",
            "df101312-c5a9-4653-a8e4-d200ad19579e"
          ],
          "display_name": false
        },
        {
          "uuid": "651377f4-54f3-4079-948f-64540310f409",
          "name": "DIETHYL 3,5-DI-TERT-BUTYL-4-HYDROXYBENZYLPHOSPHONATE",
          "stdName": "DIETHYL 3,5-DI-TERT-BUTYL-4-HYDROXYBENZYLPHOSPHONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8db44121-d639-479d-8733-1354e1bf9c07",
            "df101312-c5a9-4653-a8e4-d200ad19579e"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "a36d3a2f-c4b2-4ea2-942a-af87e0bf193a",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "38836c59-4740-44e7-ab99-de9b5a61c767",
          "citation": "http://www.chemblink.com/products/976-56-7.htm",
          "url": "http://www.chemblink.com/products/976-56-7.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "df101312-c5a9-4653-a8e4-d200ad19579e",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8db44121-d639-479d-8733-1354e1bf9c07",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cca23580-9ebe-4dc5-a737-096556c3454c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390949000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "73fa15f6-6111-4315-a6d4-a1f112e5a352",
          "citation": "SRS import [V6MOU97T5J]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=V6MOU97T5J",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390949000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d90b3e75-3c4f-4be1-a33e-a12528836f15",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a8582afb-2a54-6751-d74c-fae39b9d4b4b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=976-56-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "bd591322-7bda-44aa-b58b-ed4064db0f64",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "65146c6e-9721-4485-9a50-e289cb34ef62",
          "id": "65146c6e-9721-4485-9a50-e289cb34ef62",
          "molfile": "\n  Marvin  01132105162D          \n\n 24 24  0  0  0  0            999 V2000\n    9.7505   -4.5365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0887   -4.5365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6730   -3.8188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8435   -3.8188    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0231   -3.8188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8435   -4.6483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1350   -5.0640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1350   -5.8890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4084   -6.3037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6984   -5.8890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2708   -6.1342    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6984   -5.0640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4112   -4.6493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9827   -4.6507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3050   -5.0109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9827   -3.7026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2624   -4.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4084   -7.1285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1969   -7.3456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5517   -7.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4084   -7.9581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8435   -2.9939    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5613   -2.5782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5613   -1.7545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  4  6  1  0  0  0  0\n  4 22  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7 13  2  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n  9 18  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 10  2  0  0  0  0\n 13 12  1  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 14 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 18 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\nM  END",
          "smiles": "CCOP(=O)(Cc1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C)OCC",
          "formula": "C19H33O4P",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "102393f4-b817-49ac-a618-adf47759047b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "356.4374",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5b2adb69-063d-48df-ad00-cbd346abcc89",
      "version": "4",
      "structure": {
        "id": "9458d5c5-de92-400e-aa55-601b0fd3b670",
        "molfile": "\n  Marvin  01132107422D          \n\n 24 24  0  0  0  0            999 V2000\n    7.0231   -3.8188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8435   -3.8188    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8435   -4.6483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1350   -5.0640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4112   -4.6493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6984   -5.0640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6984   -5.8890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4084   -6.3037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1350   -5.8890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4084   -7.1285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1969   -7.3456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5517   -7.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4084   -7.9581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2708   -6.1342    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9827   -4.6507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3050   -5.0109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9827   -3.7026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2624   -4.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6730   -3.8188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0887   -4.5365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7505   -4.5365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8435   -2.9939    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5613   -2.5782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5613   -1.7545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9  4  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 10 13  1  0  0  0  0\n  7 14  1  0  0  0  0\n  6 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 15 18  1  0  0  0  0\n  2 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n  2 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\nM  END",
        "smiles": "CCOP(=O)(Cc1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C)OCC",
        "formula": "C19H33O4P",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "356.4374",
        "optical_activity": "NONE",
        "references": [
          "d90b3e75-3c4f-4be1-a33e-a12528836f15",
          "73fa15f6-6111-4315-a6d4-a1f112e5a352"
        ],
        "stereo_centers": 0
      },
      "unii": "V6MOU97T5J"
    }
  ]
}