{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "cd70fea7-e9d0-4b28-8ed1-4e801de65e0c",
          "code": "119-44-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=119-44-8",
          "code_system": "CAS",
          "references": [
            "108e2169-3f34-4e1e-a803-8a85ff67af66",
            "7d236e64-2b5d-4f7b-8c0d-964ed0cc6682"
          ]
        },
        {
          "uuid": "3bf7f940-e6c2-4845-ab52-9042a3932398",
          "code": "D014976",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68014976",
          "code_system": "MESH",
          "references": [
            "108e2169-3f34-4e1e-a803-8a85ff67af66"
          ]
        },
        {
          "uuid": "cf7af54e-c15e-4f8d-949c-e7a7393dd419",
          "code": "XANTHOPTERIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Xanthopterin",
          "code_system": "WIKIPEDIA",
          "references": [
            "108e2169-3f34-4e1e-a803-8a85ff67af66"
          ]
        },
        {
          "uuid": "3195d073-b700-4ae0-977d-2778702444eb",
          "code": "204-325-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.003.932",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "108e2169-3f34-4e1e-a803-8a85ff67af66"
          ]
        },
        {
          "uuid": "983e7169-38bc-42b5-aebe-0fc2726b2cb0",
          "code": "m11532",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11532?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "108e2169-3f34-4e1e-a803-8a85ff67af66"
          ]
        },
        {
          "uuid": "a6f3cba5-d7dd-4a93-95b2-7fd343124b5e",
          "code": "SUB15734MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "108e2169-3f34-4e1e-a803-8a85ff67af66"
          ]
        },
        {
          "uuid": "b4b8a4d5-0102-f623-dca0-c2193c768d9b",
          "code": "DTXSID70152282",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70152282",
          "code_system": "EPA CompTox",
          "references": [
            "a2396091-f064-4a29-c811-df1fe5ea8415"
          ]
        },
        {
          "uuid": "f4f1a745-9a8b-d08c-aef4-9afe0ab9a32e",
          "code": "80185-2",
          "comments": "LOINC|ACTIVE|CHEM|Urine|Xanthopterin/Creatinine [Molar ratio] in Urine",
          "type": "PRIMARY",
          "url": "https://loinc.org/80185-2/",
          "code_system": "LOINC",
          "references": [
            "0a81e634-6f93-774b-1450-5474d496acce"
          ]
        },
        {
          "uuid": "4b6923b3-964b-1783-ef39-abc2e06a655a",
          "code": "80183-7",
          "comments": "LOINC|ACTIVE|CHEM|Ser/Plas|Xanthopterin [Moles/volume] in Serum or Plasma",
          "type": "PRIMARY",
          "url": "https://loinc.org/80183-7/",
          "code_system": "LOINC",
          "references": [
            "0a81e634-6f93-774b-1450-5474d496acce"
          ]
        },
        {
          "uuid": "b19bf3d5-dafd-0516-fb65-aec4673da9aa",
          "code": "80184-5",
          "comments": "LOINC|ACTIVE|CHEM|CSF|Xanthopterin [Moles/volume] in Cerebral spinal fluid",
          "type": "PRIMARY",
          "url": "https://loinc.org/80184-5/",
          "code_system": "LOINC",
          "references": [
            "0a81e634-6f93-774b-1450-5474d496acce"
          ]
        },
        {
          "uuid": "b31b6ac8-9755-fdd4-71d8-3e3d297e9780",
          "code": "135403800",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135403800",
          "code_system": "PUBCHEM",
          "references": [
            "c7ec13cd-0ec0-ed21-33d7-f323c4915416"
          ]
        },
        {
          "uuid": "706aa81b-73aa-4edb-ad27-de87dad908a4",
          "code": "V66551EU1R",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1b86837c-d450-0bdb-91d0-a0a5603a12a2",
          "code": "100000076729",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "f5292f47-af08-5e5b-093d-76d684d6ded0"
          ]
        },
        {
          "uuid": "76c1c0e0-f5e6-8535-98d9-d568b5e67466",
          "code": "41836",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=41836",
          "code_system": "NSC",
          "references": [
            "3bde4e10-c20a-730c-4b14-a8c9696d01f3"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "faa894c2-63b1-44cb-9318-060b7febd317",
          "name": "2-AMINO-4,6-DIHYDROXYPTERIDINE",
          "stdName": "2-AMINO-4,6-DIHYDROXYPTERIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2d2258c-6781-4f44-99e9-49e3f1ccd643",
            "af4fcd0f-cc91-48c6-996f-24513b1b8d02"
          ],
          "display_name": false
        },
        {
          "uuid": "96d1bebe-149c-40c9-b9e6-9648ad9eed74",
          "name": "NSC-41836",
          "stdName": "NSC-41836",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bedb8675-db88-46d8-8e0c-de6d5bbbec2f",
            "d2d2258c-6781-4f44-99e9-49e3f1ccd643"
          ],
          "display_name": false
        },
        {
          "uuid": "0b0c3192-d3e1-4aec-9fb9-48854330888a",
          "name": "XANTHOPTERIN",
          "stdName": "XANTHOPTERIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5bee8899-86ab-4a6d-adbb-67010ccf0ece",
            "75e6f37d-67da-40fa-b447-046d5e2d85c0",
            "517a834d-4cb8-43ab-ae03-f9ca24182ca5",
            "36ac70d4-b12a-4f6b-b050-45c67f644d52",
            "d2d2258c-6781-4f44-99e9-49e3f1ccd643",
            "af4fcd0f-cc91-48c6-996f-24513b1b8d02",
            "8522e6bd-9bf1-4ff6-911c-b1d85ae66237",
            "5c199864-fc09-4635-b824-90234e084e11"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "63bc5371-b8f7-4402-bb8b-368b05b2a94c",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "41d6eb1b-ca7b-480c-ae09-30e21535d361",
          "name": "XANTHOPTERIN [MART.]",
          "stdName": "XANTHOPTERIN [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "517a834d-4cb8-43ab-ae03-f9ca24182ca5"
          ],
          "display_name": false
        },
        {
          "uuid": "0c8e40c8-a812-4c55-9a4e-719ed6ac2622",
          "name": "XANTHOPTERIN [MI]",
          "stdName": "XANTHOPTERIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2d2258c-6781-4f44-99e9-49e3f1ccd643",
            "8522e6bd-9bf1-4ff6-911c-b1d85ae66237"
          ],
          "display_name": false
        },
        {
          "uuid": "dedc28b4-5c20-0c8c-5c6c-1a144be3ccd3",
          "name": "Xanthopterin [WHO-DD]",
          "stdName": "XANTHOPTERIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c37e1835-4856-e0fe-6171-c972699ae27a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0a81e634-6f93-774b-1450-5474d496acce",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7d236e64-2b5d-4f7b-8c0d-964ed0cc6682",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "af4fcd0f-cc91-48c6-996f-24513b1b8d02",
          "citation": "MARTINDALE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d2d2258c-6781-4f44-99e9-49e3f1ccd643",
          "citation": "MARTINDALE",
          "doc_type": "MARTINDALE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "517a834d-4cb8-43ab-ae03-f9ca24182ca5",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8522e6bd-9bf1-4ff6-911c-b1d85ae66237",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5bee8899-86ab-4a6d-adbb-67010ccf0ece",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bedb8675-db88-46d8-8e0c-de6d5bbbec2f",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "108e2169-3f34-4e1e-a803-8a85ff67af66",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390963000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b9dbe327-c1b2-48b9-85b0-c4a168cf19c7",
          "citation": "SRS import [V66551EU1R]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=V66551EU1R",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390963000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5c199864-fc09-4635-b824-90234e084e11",
          "citation": "XANTHOPTERIN [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "75e6f37d-67da-40fa-b447-046d5e2d85c0",
          "citation": "XANTHOPTERIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "36ac70d4-b12a-4f6b-b050-45c67f644d52",
          "citation": "XANTHOPTERIN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a2396091-f064-4a29-c811-df1fe5ea8415",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=119-44-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c7ec13cd-0ec0-ed21-33d7-f323c4915416",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "3bde4e10-c20a-730c-4b14-a8c9696d01f3",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "c37e1835-4856-e0fe-6171-c972699ae27a",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "f5292f47-af08-5e5b-093d-76d684d6ded0",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5987b6cc-5c65-93a8-27ce-f426366ae9bd",
          "id": "5987b6cc-5c65-93a8-27ce-f426366ae9bd",
          "molfile": "\n  Marvin  01132104392D          \n\n 13 14  0  0  0  0            999 V2000\n   13.1297   -5.3127    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8446   -4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5615   -5.3083    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2721   -4.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9903   -5.3107    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7006   -4.8937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7006   -4.0721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4160   -3.6592    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9852   -3.6593    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2721   -4.0705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5597   -3.6583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5597   -2.8328    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8446   -4.0709    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n 13  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4 10  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\nM  END",
          "smiles": "c1c(=O)[nH]c2c(n1)nc(N)[nH]c2=O",
          "formula": "C6H5N5O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5df70049-2e48-492f-bff2-30ca8ba4f956"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "179.1364",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b7469070-8b3e-493c-8564-1d77b7d69a66",
      "version": "18",
      "structure": {
        "id": "0543e3c7-eab5-4b9e-b184-25857e12d678",
        "molfile": "\n  Marvin  01132100342D          \n\n 13 14  0  0  0  0            999 V2000\n   13.8446   -4.0709    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8446   -4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5615   -5.3083    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2721   -4.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2721   -4.0705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5597   -3.6583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5597   -2.8328    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9852   -3.6593    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7006   -4.0721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7006   -4.8937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9903   -5.3107    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4160   -3.6592    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1297   -5.3127    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  1  1  0  0  0  0\n  6  7  2  0  0  0  0\n  5  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n  4 11  1  0  0  0  0\n  9 12  2  0  0  0  0\n  2 13  1  0  0  0  0\nM  END",
        "smiles": "c1c(=O)[nH]c2c(n1)nc(N)[nH]c2=O",
        "formula": "C6H5N5O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "179.1364",
        "optical_activity": "NONE",
        "references": [
          "b9dbe327-c1b2-48b9-85b0-c4a168cf19c7",
          "af4fcd0f-cc91-48c6-996f-24513b1b8d02"
        ],
        "stereo_centers": 0
      },
      "unii": "V66551EU1R"
    }
  ]
}