{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9d0889a1-bf76-4b62-9d80-8c4e234838c6",
          "code": "A12CC08",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|MINERAL SUPPLEMENTS|OTHER MINERAL SUPPLEMENTS|Magnesium|magnesium pidolate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A12CC08&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "07d31a02-59d6-4143-a371-75805abc0ac4"
          ]
        },
        {
          "uuid": "74163f50-75bc-4218-a76b-f9a6f4ab5a73",
          "code": "QA12CC08",
          "comments": "VATC|MINERAL SUPPLEMENTS|OTHER MINERAL SUPPLEMENTS|Magnesium|magnesium pidolate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA12CC08&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "07d31a02-59d6-4143-a371-75805abc0ac4"
          ]
        },
        {
          "uuid": "f3103b6e-7b37-46e4-8d9f-69b0a1301b12",
          "code": "62003-27-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=62003-27-4",
          "code_system": "CAS",
          "references": [
            "07d31a02-59d6-4143-a371-75805abc0ac4",
            "43512318-8082-4cc7-85c7-056a0b0662d4"
          ]
        },
        {
          "uuid": "057b381b-44d1-408e-bfe9-8ad90189d145",
          "code": "MAGNESIUM PIDOLATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Magnesium_pidolate",
          "code_system": "WIKIPEDIA",
          "references": [
            "07d31a02-59d6-4143-a371-75805abc0ac4"
          ]
        },
        {
          "uuid": "990f5710-c144-411d-a3cc-e0e2de138881",
          "code": "263-365-7",
          "type": "PRIMARY",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "07d31a02-59d6-4143-a371-75805abc0ac4"
          ]
        },
        {
          "uuid": "94515ab6-9659-46bf-af30-8e93beb9d1d9",
          "code": "116240",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/116240/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "07d31a02-59d6-4143-a371-75805abc0ac4"
          ]
        },
        {
          "uuid": "cacc8bf0-9b1e-4488-82b3-9e1c4f490366",
          "code": "SUB03045MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "07d31a02-59d6-4143-a371-75805abc0ac4"
          ]
        },
        {
          "uuid": "49e241f5-a679-4502-8266-73eb894c8a3b",
          "code": "CHEMBL397976",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL397976",
          "code_system": "ChEMBL",
          "references": [
            "07d31a02-59d6-4143-a371-75805abc0ac4"
          ]
        },
        {
          "uuid": "554d0425-785b-89a0-1170-37ce2c2d9a69",
          "code": "14559042",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/14559042",
          "code_system": "PUBCHEM",
          "references": [
            "8d175dc7-8bba-cc8e-aafd-8aa4c2895982"
          ]
        },
        {
          "uuid": "9642c21f-21a3-008f-e3bd-7ee27bde136a",
          "code": "4597",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/4597",
          "code_system": "DRUG CENTRAL",
          "references": [
            "77c2bcdf-4e51-7dcd-ce85-1ec9c00ec40e"
          ]
        },
        {
          "uuid": "2287fbe3-010f-2e2c-3f97-6915d259c2c0",
          "code": "DBSALT002689",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DBSALT002689",
          "code_system": "DRUG BANK",
          "references": [
            "77c2bcdf-4e51-7dcd-ce85-1ec9c00ec40e"
          ]
        },
        {
          "uuid": "52498405-cd3d-4fac-a161-524b3f8cc0e8",
          "code": "V5PC588N7G",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "53ee49b3-f2a4-d9e8-14e5-5d64fcad24d1",
          "code": "V5PC588N7G",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=V5PC588N7G",
          "code_system": "DAILYMED",
          "references": [
            "b5606904-7840-9e76-8015-56fd8229136e"
          ]
        },
        {
          "uuid": "69887a5c-2d93-d11e-5d16-7a68af77d2b2",
          "code": "100000089075",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "324cb093-c04a-eda6-365b-3f2c5f409e4b"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "f006aa52-542a-49bc-91b3-2f693a49adef",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "8970f018-442b-42e1-aba8-ebb74a6c92af",
            "refuuid": "b4015ea9-cdb5-43db-87a3-91407212b35b",
            "name": "PIDOLIC ACID",
            "unii": "SZB83O1W42",
            "linking_id": "SZB83O1W42",
            "ref_pname": "PIDOLIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "087a6c04-2464-45f5-953f-aa2b730a2dea",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "51214451-a120-46f3-8909-f1380efb73e7",
            "refuuid": "b4015ea9-cdb5-43db-87a3-91407212b35b",
            "name": "PIDOLIC ACID",
            "unii": "SZB83O1W42",
            "linking_id": "SZB83O1W42",
            "ref_pname": "PIDOLIC ACID",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a2e41dc0-5850-4f08-bd6f-f79268118a2f",
          "name": "L-PROLINE, 5-OXO-, MAGNESIUM SALT (2:1)",
          "stdName": "L-PROLINE, 5-OXO-, MAGNESIUM SALT (2:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "55e95203-fb7a-4aae-9d5a-9ff1bc3ee3a4",
            "ee3ab14b-47fc-43ba-b385-970683ac5de3"
          ],
          "display_name": false
        },
        {
          "uuid": "13a704fe-3522-4d1b-af2f-95975f78017b",
          "name": "MAGNESIUM PCA",
          "stdName": "MAGNESIUM PCA",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "55e95203-fb7a-4aae-9d5a-9ff1bc3ee3a4",
            "ab22a85a-d7a9-4a8e-ad80-486cd5218f2f",
            "eb284dd2-207d-4f8b-8eb2-e8227d34d30d",
            "133da721-428a-41ad-b5bf-723862937116"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "99ca36b8-283b-4fa9-bd80-e516305fbe67",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "650fb4e6-528f-4c17-923d-cb3e78dbb2c0",
          "name": "MAGNESIUM PIDOLATE",
          "stdName": "MAGNESIUM PIDOLATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "17b8e16c-ada0-4a00-8e6d-4f5bc2b6b1ff",
            "da486ab4-d25c-49dc-bcfc-48eb2c0ce6a5",
            "5ea25ce2-3534-4b7b-bc5c-4828acd7dac8",
            "55e95203-fb7a-4aae-9d5a-9ff1bc3ee3a4",
            "2cdade86-3800-4f02-a8b2-511356fe1ffd",
            "5ff89886-7e62-4d13-9edd-0c2078bf71f8",
            "9e4a84c7-6618-4791-9aca-83cddbc1884c",
            "6b774d78-77dc-4a52-b57d-63917c3d882d"
          ],
          "display_name": true
        },
        {
          "uuid": "cf5811b3-f052-f763-5eff-765afb359dab",
          "name": "MAGNESIUM PIDOLATE [EP MONOGRAPH]",
          "stdName": "MAGNESIUM PIDOLATE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "294ad743-28ef-0ac3-f1f3-f0c0dd0e8c80"
          ],
          "display_name": false
        },
        {
          "uuid": "00aa76fb-2eac-46c7-8263-67b35b126a61",
          "name": "MAGNESIUM PIDOLATE [MART.]",
          "stdName": "MAGNESIUM PIDOLATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2cdade86-3800-4f02-a8b2-511356fe1ffd"
          ],
          "display_name": false
        },
        {
          "uuid": "da6c2ff8-9bf3-4670-8091-04e836093a82",
          "name": "MAGNESIUM PYROGLUTAMATE",
          "stdName": "MAGNESIUM PYROGLUTAMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "55e95203-fb7a-4aae-9d5a-9ff1bc3ee3a4",
            "60fdc099-79d7-49b0-be5e-db002ff6aa55"
          ],
          "display_name": false
        },
        {
          "uuid": "02dd5163-b7f5-7c21-d72f-855fea863d9e",
          "name": "Magnesium pidolate [WHO-DD]",
          "stdName": "MAGNESIUM PIDOLATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e9caa109-fb5e-6d58-ace7-4c39bc3799c6"
          ],
          "display_name": false
        },
        {
          "uuid": "603aec84-bdaa-4239-99f2-5fed853bd125",
          "name": "PIDOLIC ACID MAGNESIUM SALT (2:1)",
          "stdName": "PIDOLIC ACID MAGNESIUM SALT (2:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "55e95203-fb7a-4aae-9d5a-9ff1bc3ee3a4",
            "ee3ab14b-47fc-43ba-b385-970683ac5de3"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "17b8e16c-ada0-4a00-8e6d-4f5bc2b6b1ff",
          "citation": "http://www.solabia.fr/solabia/content/NT0000538E.pdf",
          "url": "http://www.solabia.fr/solabia/content/NT0000538E.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ee3ab14b-47fc-43ba-b385-970683ac5de3",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "55e95203-fb7a-4aae-9d5a-9ff1bc3ee3a4",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60fdc099-79d7-49b0-be5e-db002ff6aa55",
          "citation": "http://www.drugs.com/mmx/magnesium-pidolate.html",
          "url": "http://www.drugs.com/mmx/magnesium-pidolate.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6b774d78-77dc-4a52-b57d-63917c3d882d",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2cdade86-3800-4f02-a8b2-511356fe1ffd",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "133da721-428a-41ad-b5bf-723862937116",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "da486ab4-d25c-49dc-bcfc-48eb2c0ce6a5",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab22a85a-d7a9-4a8e-ad80-486cd5218f2f",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "07d31a02-59d6-4143-a371-75805abc0ac4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390590000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "42655dcd-f6c4-462e-b363-8462d1436270",
          "citation": "SRS import [V5PC588N7G]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=V5PC588N7G",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390590000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "115247fe-4ea9-42da-99d9-3fcbdb01e240",
          "citation": "Wikipedia",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9e4a84c7-6618-4791-9aca-83cddbc1884c",
          "citation": "MAGNESIUM PIDOLATE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5ff89886-7e62-4d13-9edd-0c2078bf71f8",
          "citation": "MAGNESIUM PIDOLATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "eb284dd2-207d-4f8b-8eb2-e8227d34d30d",
          "citation": "MAGNESIUM PCA [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5ea25ce2-3534-4b7b-bc5c-4828acd7dac8",
          "citation": "MAGNESIUM PIDOLATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8d175dc7-8bba-cc8e-aafd-8aa4c2895982",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "43512318-8082-4cc7-85c7-056a0b0662d4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "77c2bcdf-4e51-7dcd-ce85-1ec9c00ec40e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "294ad743-28ef-0ac3-f1f3-f0c0dd0e8c80",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "b5606904-7840-9e76-8015-56fd8229136e",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "e9caa109-fb5e-6d58-ace7-4c39bc3799c6",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "324cb093-c04a-eda6-365b-3f2c5f409e4b",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "946cef05-0636-4469-9eee-82ef1802f6d5",
          "id": "946cef05-0636-4469-9eee-82ef1802f6d5",
          "molfile": "\n  Marvin  01132107422D          \n\n  1  0  0  0  1  0            999 V2000\n    8.6206   -3.4501    0.0000 Mg  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Mg+2]",
          "formula": "Mg",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d821c310-2790-433a-96a6-5c32351ceeee"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "24.3051",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "dc593aed-6ef4-4fd5-acbb-619bc7783443",
          "id": "dc593aed-6ef4-4fd5-acbb-619bc7783443",
          "molfile": "\n  Marvin  01132111262D          \n\n  9  9  0  0  1  0            999 V2000\n    5.6492   -3.7054    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.2800   -4.4436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5554   -4.3754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3320   -3.5367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6119   -3.1949    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0430   -3.1448    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4513   -3.5641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7292   -2.7801    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.9572   -4.2158    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  6  1  0  0  0  0\n  1  7  1  6  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  4  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  2  0  0  0  0\nM  CHG  1   8  -1\nM  END",
          "smiles": "C1CC(=O)N[C@@H]1C(=O)[O-]",
          "formula": "C5H6NO3",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "953984c4-c13b-45b6-b92c-47026792f82f"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "128.1062",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2cba7509-7aa0-4cc0-8ee5-611eee201019",
      "version": "13",
      "structure": {
        "id": "81ba9d42-e4b4-45c8-a14a-63a2ab2893b2",
        "molfile": "\n  Marvin  01132106442D          \n\n 19 18  0  0  1  0            999 V2000\n    8.6206   -3.4501    0.0000 Mg  0  2  0  0  0  0  0  0  0  0  0  0\n    5.0430   -3.1448    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3320   -3.5367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6119   -3.1949    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5554   -4.3754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2800   -4.4436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6492   -3.7054    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.4513   -3.5641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7292   -2.7801    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.9572   -4.2158    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0430   -3.1448    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3320   -3.5367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6119   -3.1949    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5554   -4.3754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2800   -4.4436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6492   -3.7054    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.4513   -3.5641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7292   -2.7801    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.9572   -4.2158    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  6  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\n  7  2  1  0  0  0  0\n 12 11  1  0  0  0  0\n 16 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 12  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  6  0  0  0\n 18 17  1  0  0  0  0\n 19 17  2  0  0  0  0\nM  CHG  3   1   2   9  -1  18  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 15   2   3   4   5   6   7   8   9  10  11  12  13  14  15  16\nM  SAL   1  3  17  18  19\nM  SPA   1  9   2   3   4   5   6   7   8   9  10\nM  SDI   1  4    3.1919   -4.8636    3.1919   -2.3601\nM  SDI   1  4    7.3772   -2.3601    7.3772   -4.8636\nM  SMT   1 2\nM  END",
        "smiles": "C1CC(=O)N[C@@H]1C(=O)[O-].C1CC(=O)N[C@@H]1C(=O)[O-].[Mg+2]",
        "formula": "2C5H6NO3.Mg",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "280.5175",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "42655dcd-f6c4-462e-b363-8462d1436270",
          "115247fe-4ea9-42da-99d9-3fcbdb01e240"
        ],
        "stereo_centers": 2
      },
      "unii": "V5PC588N7G"
    }
  ]
}