{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4068bb91-bbee-4bcf-b266-5c08725582e5",
          "code": "581-89-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=581-89-5",
          "code_system": "CAS",
          "references": [
            "53222eab-4bd7-4397-b506-3e34e526578a",
            "d9e300b9-0c52-4042-94d8-9cb6b701817e"
          ]
        },
        {
          "uuid": "4497ad6f-3ef1-41b0-85ea-d5edb3f25b53",
          "code": "209-474-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.614",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "53222eab-4bd7-4397-b506-3e34e526578a"
          ]
        },
        {
          "uuid": "53a42b93-1f4a-4d26-8664-1e1fe51681d3",
          "code": "11392",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11392",
          "code_system": "PUBCHEM",
          "references": [
            "53222eab-4bd7-4397-b506-3e34e526578a"
          ]
        },
        {
          "uuid": "523112f9-29bc-66b8-fff4-ee5a7624873e",
          "code": "DTXSID2073198",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2073198",
          "code_system": "EPA CompTox",
          "references": [
            "ad569c0d-246c-175b-f1be-9c46bddb247e"
          ]
        },
        {
          "uuid": "7b22ebf1-5548-529c-de3c-8af29f0b2458",
          "code": "50637",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:50637",
          "code_system": "CHEBI",
          "references": [
            "21f5b820-1d25-eaf1-2cb6-3f886d2e1007"
          ]
        },
        {
          "uuid": "6962a432-316b-4cc5-9565-765e08d2c81c",
          "code": "V5NB52B64Q",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "125ec7d7-86a3-7356-1884-34deee7890e1",
          "code": "300000052952",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "11c2e9d8-3e7f-f009-8f6f-083fb24d0074"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6c741ab7-48a1-4c69-a04a-d2f213153a27",
          "name": ".BETA.-NITRONAPHTHALENE",
          "stdName": ".BETA.-NITRONAPHTHALENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d5c12029-cce3-46ed-895f-be77901a8349",
            "38c13dd2-4efe-4e74-afce-534b3a09655a"
          ],
          "display_name": false
        },
        {
          "uuid": "9fb16e6b-d426-481d-99df-ccf132266b1e",
          "name": "2-NITRONAPHTHALENE",
          "stdName": "2-NITRONAPHTHALENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d5c12029-cce3-46ed-895f-be77901a8349",
            "38c13dd2-4efe-4e74-afce-534b3a09655a"
          ],
          "display_name": true
        },
        {
          "uuid": "8e73456b-c646-69c7-65cf-b21ebac363ae",
          "name": "2-NITRONAPHTHALENE [IARC]",
          "stdName": "2-NITRONAPHTHALENE [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "54c507a5-d911-dd44-5675-10a1112905e7"
          ],
          "display_name": false
        },
        {
          "uuid": "fbd13111-9164-43b9-8565-d019230806d3",
          "name": "NAPHTHALENE, 2-NITRO-",
          "stdName": "NAPHTHALENE, 2-NITRO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d5c12029-cce3-46ed-895f-be77901a8349",
            "38c13dd2-4efe-4e74-afce-534b3a09655a"
          ],
          "display_name": false
        },
        {
          "uuid": "b6e1f14b-f5cf-405c-90be-7c4c81be3b26",
          "name": "NITRONAPHTHALENE, 2-",
          "stdName": "NITRONAPHTHALENE, 2-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1f900d2b-e7d9-42cd-a298-4a689f385dba"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1f900d2b-e7d9-42cd-a298-4a689f385dba",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d5c12029-cce3-46ed-895f-be77901a8349",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "38c13dd2-4efe-4e74-afce-534b3a09655a",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "53222eab-4bd7-4397-b506-3e34e526578a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390883000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "626f5478-bada-4cd6-8f50-9c28b4dfe1d0",
          "citation": "SRS import [V5NB52B64Q]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=V5NB52B64Q",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390883000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e9d41d4e-985f-46d9-a52b-39bf3d963123",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad569c0d-246c-175b-f1be-9c46bddb247e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=581-89-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "54c507a5-d911-dd44-5675-10a1112905e7",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "d9e300b9-0c52-4042-94d8-9cb6b701817e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "21f5b820-1d25-eaf1-2cb6-3f886d2e1007",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "11c2e9d8-3e7f-f009-8f6f-083fb24d0074",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f5e6e914-29c4-4b8c-8ba7-5436ee8c9e67",
          "id": "f5e6e914-29c4-4b8c-8ba7-5436ee8c9e67",
          "molfile": "\n  Marvin  01132112452D          \n\n 13 14  0  0  0  0            999 V2000\n    8.6644   -5.6795    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.2519   -4.9649    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    8.6644   -4.2506    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4269   -4.9649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0144   -4.2506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1894   -4.2506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7769   -4.9649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9520   -4.9649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5394   -5.6795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9520   -6.3939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7769   -6.3939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1894   -5.6795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0144   -5.6795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4 13  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n 12  7  2  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\nM  CHG  2   1  -1   2   1\nM  END",
          "smiles": "c1ccc2cc(ccc2c1)[N+](=O)[O-]",
          "formula": "C10H7NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "77b8a21e-80a4-4543-93e5-336f2a5c56f8"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "173.1685",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0c0298cb-9a8d-4dc0-af90-87675d84f937",
      "version": "7",
      "structure": {
        "id": "efac5b24-6de7-49d2-a480-be765e54cb0e",
        "molfile": "\n  Marvin  01132112262D          \n\n 13 14  0  0  0  0            999 V2000\n    6.1894   -5.6795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7769   -4.9649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1894   -4.2506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0144   -4.2506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4269   -4.9649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0144   -5.6795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2519   -4.9649    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    8.6644   -5.6795    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.6644   -4.2506    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9520   -4.9649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5394   -5.6795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9520   -6.3939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7769   -6.3939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  1  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n  2 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n  1 13  1  0  0  0  0\nM  CHG  2   7   1   8  -1\nM  END",
        "smiles": "c1ccc2cc(ccc2c1)[N+](=O)[O-]",
        "formula": "C10H7NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "173.1685",
        "optical_activity": "NONE",
        "references": [
          "e9d41d4e-985f-46d9-a52b-39bf3d963123",
          "626f5478-bada-4cd6-8f50-9c28b4dfe1d0"
        ],
        "stereo_centers": 0
      },
      "unii": "V5NB52B64Q"
    }
  ]
}