{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "154bdd0e-9386-405c-a1ca-2d10a18a3b35", "code": "12768-44-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=12768-44-4", "code_system": "CAS", "references": [ "f9a8eb2a-4a1f-4598-8705-b87f1abd5b50", "80dd4fea-1986-4227-a773-9dc1fe0cddee" ] }, { "uuid": "f420b341-f707-4e33-9d8e-d1e0b7e33053", "code": "28959-51-5", "type": "ALTERNATIVE", "url": "https://commonchemistry.cas.org/detail?cas_rn=28959-51-5", "code_system": "CAS", "references": [ "f9a8eb2a-4a1f-4598-8705-b87f1abd5b50", "5b37537a-73d9-4079-baf0-62e5e1f0e5c8" ] }, { "uuid": "25a5581b-e6f1-4eef-b5fe-fe1bee6bc5c1", "code": "29189-76-2", "type": "ALTERNATIVE", "url": "https://commonchemistry.cas.org/detail?cas_rn=29189-76-2", "code_system": "CAS", "references": [ "f9a8eb2a-4a1f-4598-8705-b87f1abd5b50", "bb45b0da-d8e3-4426-a491-df6d596a0e68" ] }, { "uuid": "dde83db5-5ed3-453a-8260-6056827acdaa", "code": "235-805-8", "type": "PRIMARY", "code_system": "ECHA (EC/EINECS)", "references": [ "f9a8eb2a-4a1f-4598-8705-b87f1abd5b50" ] }, { "uuid": "0d1ed901-7b47-4148-9abe-92529e9db45a", "code": "236445", "type": "ALTERNATIVE", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/236445/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "f9a8eb2a-4a1f-4598-8705-b87f1abd5b50" ] }, { "uuid": "ea64ec18-b8b6-4608-a169-81d3654513cd", "code": "1723153", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1723153/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "f9a8eb2a-4a1f-4598-8705-b87f1abd5b50" ] }, { "uuid": "1b93a851-bce5-4394-9470-b8799bb83914", "code": "SUB04293MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "f9a8eb2a-4a1f-4598-8705-b87f1abd5b50" ] }, { "uuid": "59ed7919-d196-4734-92a9-f2f18d1959fc", "code": "76958463", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/76958463", "code_system": "PUBCHEM", "references": [ "f9a8eb2a-4a1f-4598-8705-b87f1abd5b50" ] }, { "uuid": "c5d17270-8540-029b-30a3-03fdfdd8b1e4", "code": "DTXSID1021249", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1021249", "code_system": "EPA CompTox", "references": [ "a696571c-ebfd-efbe-cf78-0b363d7c26f0" ] }, { "uuid": "f613c5de-f2f0-4f23-ac14-b1e202403809", "code": "V5J3537PND", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "161d4aee-6bdb-8e80-5cf6-196c02a3ba69", "code": "100000084944", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "096edbd7-072f-4318-b3bc-48a9cbb23ae6" ] }, { "uuid": "2c848f65-81fc-efc8-4bd5-8e710ba0d62c", "code": "V5J3537PND", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=V5J3537PND", "code_system": "DAILYMED", "references": [ "ec7e81c0-bd64-ac03-7f3f-cd0b39de9b42" ] } ], "substance_class": "chemical", "names": [ { "uuid": "9db3f8fc-504d-4276-9891-a6f1f79f3ff5", "name": "4H-1-BENZOPYRAN-4-ONE, 3-((6-O-(6-DEOXY-.ALPHA.-L- MANNOPYRANOSYL)-.BETA.-D-GLUCOPYRANOSYL)OXY)-2-(3,4- DIHYDROXYPHENYL)-5,7-DIHYDROXY-, HYDROGEN SULFATE, SODIUM SALT", "stdName": "4H-1-BENZOPYRAN-4-ONE, 3-((6-O-(6-DEOXY-.ALPHA.-L- MANNOPYRANOSYL)-.BETA.-D-GLUCOPYRANOSYL)OXY)-2-(3,4- DIHYDROXYPHENYL)-5,7-DIHYDROXY-, HYDROGEN SULFATE, SODIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "986bd242-0211-46b8-b39e-8617fa04f402", "0a89a9ec-362b-4b27-af83-b896438df2cb" ], "display_name": false }, { "uuid": "a914e14c-1cdf-4893-b241-4fc44cdb4d85", "name": "BIRUTIN FORTE", "stdName": "BIRUTIN FORTE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4d6e1375-5fa9-4686-8a30-241bd8482ed0", "0a89a9ec-362b-4b27-af83-b896438df2cb" ], "display_name": false }, { "uuid": "ab962524-8ebf-4848-a744-867f1a3e4f3e", "name": "DISODIUM RUTINYL DISULFATE", "stdName": "DISODIUM RUTINYL DISULFATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "0a89a9ec-362b-4b27-af83-b896438df2cb", "e9ed3142-29d6-4483-a22b-af5dc7bd25fc", "d09e6a28-5591-4141-a056-8a5f6be53816" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "88a6c75c-fa07-4e9e-a02a-b0d1b899e29c", "name_org": "INCI" } ] }, { "uuid": "7255a972-7c3e-4a94-aef7-f76a9b0c89c0", "name": "KOPRUTIN WATER SOLUBLE", "stdName": "KOPRUTIN WATER SOLUBLE", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "0a89a9ec-362b-4b27-af83-b896438df2cb", "e9ed3142-29d6-4483-a22b-af5dc7bd25fc" ], "display_name": false }, { "uuid": "29c480b2-020c-4cdb-9ddf-04284d870eda", "name": "RUTIN ACID SALT", "stdName": "RUTIN ACID SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4d6e1375-5fa9-4686-8a30-241bd8482ed0", "0a89a9ec-362b-4b27-af83-b896438df2cb" ], "display_name": false }, { "uuid": "ec4db613-2913-4416-96a5-c633dc4725e1", "name": "RUTIN SODIUM SULFATE", "stdName": "RUTIN SODIUM SULFATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "986bd242-0211-46b8-b39e-8617fa04f402", "0a89a9ec-362b-4b27-af83-b896438df2cb" ], "display_name": false }, { "uuid": "2b5dd3a7-272a-4b97-8cd1-2a300bfb97b4", "name": "RUTIN WATER-SOLUBLE IN FLAKES (RUTIN SULFATE SODIUM SALT)", "stdName": "RUTIN WATER-SOLUBLE IN FLAKES (RUTIN SULFATE SODIUM SALT)", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "0a89a9ec-362b-4b27-af83-b896438df2cb", "34c66c58-16d3-4501-afa9-291f5e123077" ], "display_name": false }, { "uuid": "9e42653e-cdef-4df5-a399-b9c2a018c124", "name": "RUTIN, WATER SOLUBLE", "stdName": "RUTIN, WATER SOLUBLE", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "0a89a9ec-362b-4b27-af83-b896438df2cb", "e9ed3142-29d6-4483-a22b-af5dc7bd25fc" ], "display_name": false }, { "uuid": "4bb371cb-c939-4a7d-bb86-5f22de06ce88", "name": "RUTOSIDE SODIUM SULFATE", "stdName": "RUTOSIDE SODIUM SULFATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d1368858-1bba-46e3-8361-4366a9dea30d", "0a89a9ec-362b-4b27-af83-b896438df2cb", "2232a41f-ab1c-4afb-802d-e9498671d58d", "a2ebf014-81b0-4bdc-8ec9-64794db5020b" ], "display_name": false }, { "uuid": "94af07ec-b374-fb8e-2066-454f3afc3b7d", "name": "Rutoside sodium sulfate [WHO-DD]", "stdName": "RUTOSIDE SODIUM SULFATE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0bc6fa0a-4ac9-6131-e24b-b25f7e844ebd" ], "display_name": false }, { "uuid": "060d2ed1-2789-4c30-8ce5-faf7821eb916", "name": "SODIUM RUTIN SULFATE", "stdName": "SODIUM RUTIN SULFATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4d6e1375-5fa9-4686-8a30-241bd8482ed0", "0a89a9ec-362b-4b27-af83-b896438df2cb" ], "display_name": false } ], "references": [ { "uuid": "e9ed3142-29d6-4483-a22b-af5dc7bd25fc", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "0a89a9ec-362b-4b27-af83-b896438df2cb", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "34c66c58-16d3-4501-afa9-291f5e123077", "citation": "http://www.merckmillipore.com/rutin-water-soluble-in-flakes-rutin-sulfate-sodium-salt/MDA_CHEM-50006", "url": "http://www.merckmillipore.com/rutin-water-soluble-in-flakes-rutin-sulfate-sodium-salt/MDA_CHEM-50006", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "986bd242-0211-46b8-b39e-8617fa04f402", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4d6e1375-5fa9-4686-8a30-241bd8482ed0", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2232a41f-ab1c-4afb-802d-e9498671d58d", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d1368858-1bba-46e3-8361-4366a9dea30d", "citation": "SWISS MEDIC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f9a8eb2a-4a1f-4598-8705-b87f1abd5b50", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391656000, "tags": [ "NOMEN" ] }, { "uuid": "797e610a-9a64-49e0-8f5c-f5f598aa88f0", "citation": "SRS import [V5J3537PND]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=V5J3537PND", "doc_type": "SRS", "public_domain": true, "document_date": 1493391656000, "tags": [ "NOMEN" ] }, { "uuid": "d09e6a28-5591-4141-a056-8a5f6be53816", "citation": "DISODIUM RUTINYL DISULFATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "a2ebf014-81b0-4bdc-8ec9-64794db5020b", "citation": "RUTOSIDE SODIUM SULFATE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "a696571c-ebfd-efbe-cf78-0b363d7c26f0", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=12768-44-4", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "bb45b0da-d8e3-4426-a491-df6d596a0e68", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "5b37537a-73d9-4079-baf0-62e5e1f0e5c8", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "80dd4fea-1986-4227-a773-9dc1fe0cddee", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "0bc6fa0a-4ac9-6131-e24b-b25f7e844ebd", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "ec7e81c0-bd64-ac03-7f3f-cd0b39de9b42", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "096edbd7-072f-4318-b3bc-48a9cbb23ae6", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "011ff5eb-5d9c-414d-9477-97a6d07bfd5b", "id": "011ff5eb-5d9c-414d-9477-97a6d07bfd5b", "molfile": "\n Marvin 01132100222D \n\n 1 0 0 0 1 0 999 V2000\n 4.3319 -9.8630 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 1\nM END", "smiles": "[Na+]", "formula": "Na", "atropisomerism": "No", "charge": 1, "count": 2, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "566c037b-2ece-4117-aad4-7edc086f7474" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "22.9898", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "36a1defe-db35-4fc3-aa22-ff28b4552bdb", "id": "36a1defe-db35-4fc3-aa22-ff28b4552bdb", "molfile": "\n Marvin 01132102542D \n\n 51 55 0 0 1 0 999 V2000\n 12.7540 -5.9334 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 12.0996 -5.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7084 -6.7155 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3627 -7.1460 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 13.3171 -7.9281 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6205 -8.7593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8002 -9.5217 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 12.2298 -10.0586 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4096 -10.8211 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 11.1822 -10.9954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3690 -10.8336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1026 -10.0486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2889 -9.8870 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7680 -10.5016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9543 -10.3400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4072 -10.9635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5941 -10.8017 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6512 -11.2934 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9077 -11.5399 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4048 -10.5498 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8977 -12.0370 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6737 -11.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4873 -11.9102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7539 -12.6956 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3782 -13.3338 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8374 -13.9006 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8114 -12.7930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9449 -13.8746 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0345 -11.2866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8219 -11.4571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0884 -12.2422 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6492 -9.4252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4658 -9.5877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0085 -8.9616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7418 -8.1809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2858 -7.5607 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9285 -8.0192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6629 -7.2365 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3829 -8.6401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1598 -11.0467 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 13.3394 -11.8091 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7302 -10.5098 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 14.4804 -10.7353 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5504 -9.7473 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 14.1209 -9.2104 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0628 -6.7945 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 14.7172 -7.2252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1085 -6.0126 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 14.8086 -5.6611 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 13.4542 -5.5820 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 13.4998 -4.8000 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 3 1 0 0 0 0\n 50 1 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 6 0 0 0\n 46 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 6 0 0 0\n 7 8 1 0 0 0 0\n 44 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 6 0 0 0\n 9 40 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 2 0 0 0 0\n 11 30 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 32 1 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 29 14 2 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 16 22 1 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 2 0 0 0 0\n 18 21 2 0 0 0 0\n 22 23 2 0 0 0 0\n 23 24 1 0 0 0 0\n 29 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 25 26 1 0 0 0 0\n 25 27 2 0 0 0 0\n 25 28 2 0 0 0 0\n 30 29 1 0 0 0 0\n 30 31 2 0 0 0 0\n 32 33 1 0 0 0 0\n 39 32 2 0 0 0 0\n 33 34 2 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 35 37 2 0 0 0 0\n 37 38 1 0 0 0 0\n 37 39 1 0 0 0 0\n 40 41 1 1 0 0 0\n 40 42 1 0 0 0 0\n 42 43 1 6 0 0 0\n 42 44 1 0 0 0 0\n 44 45 1 1 0 0 0\n 46 47 1 1 0 0 0\n 48 46 1 0 0 0 0\n 48 49 1 1 0 0 0\n 50 48 1 0 0 0 0\n 50 51 1 6 0 0 0\nM CHG 2 49 -1 51 -1\nM END", "smiles": "C[C@H]1[C@@H]([C@H]([C@H]([C@H](OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)Oc3c(=O)c4c(cc(cc4OS(=O)(=O)O)OS(=O)(=O)O)oc3-c5ccc(c(c5)O)O)O)O)O)O1)O)[O-])[O-]", "formula": "C27H28O22S2", "atropisomerism": "No", "charge": -2, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "aee38bdf-676d-4348-81ea-e506f253dbc0" }, "defined_stereo": 10, "ez_centers": 0, "molecular_weight": "768.6313", "optical_activity": "UNSPECIFIED", "stereo_centers": 10 } ], "definition_level": "COMPLETE", "uuid": "2da31477-a181-4b22-b977-fa00533f6752", "version": "8", "structure": { "id": "29e2ea33-5c9a-4174-960f-f57260e3a05a", "molfile": "\n Marvin 01132102172D \n\n 53 55 0 0 1 0 999 V2000\n 4.3319 -9.8630 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 8.1870 -14.7544 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 13.7302 -10.5098 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 13.1598 -11.0467 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 12.4096 -10.8211 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 12.8002 -9.5217 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 13.3627 -7.1460 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.0628 -6.7945 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 14.1085 -6.0126 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 13.4542 -5.5820 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 12.7540 -5.9334 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 13.5504 -9.7473 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 14.4804 -10.7353 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3394 -11.8091 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1822 -10.9954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3690 -10.8336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8219 -11.4571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0884 -12.2422 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0345 -11.2866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4873 -11.9102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7539 -12.6956 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6737 -11.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4072 -10.9635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5941 -10.8017 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9543 -10.3400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7680 -10.5016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2889 -9.8870 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1026 -10.0486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6492 -9.4252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4658 -9.5877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0085 -8.9616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7418 -8.1809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2858 -7.5607 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9285 -8.0192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6629 -7.2365 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3829 -8.6401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2298 -10.0586 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6205 -8.7593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3171 -7.9281 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7172 -7.2252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8086 -5.6611 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4998 -4.8000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0996 -5.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7084 -6.7155 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1209 -9.2104 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9077 -11.5399 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 5.4048 -10.5498 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8977 -12.0370 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6512 -11.2934 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8374 -13.9006 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 7.8114 -12.7930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9449 -13.8746 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3782 -13.3338 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 6 1 0 0 0 0\n 3 12 1 0 0 0 0\n 3 13 1 6 0 0 0\n 4 14 1 1 0 0 0\n 5 15 1 6 0 0 0\n 16 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 17 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 22 20 1 0 0 0 0\n 23 22 2 0 0 0 0\n 23 24 1 0 0 0 0\n 25 23 1 0 0 0 0\n 26 25 2 0 0 0 0\n 19 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 28 27 1 0 0 0 0\n 28 16 2 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 32 34 2 0 0 0 0\n 34 35 1 0 0 0 0\n 34 36 1 0 0 0 0\n 36 29 2 0 0 0 0\n 37 5 1 0 0 0 0\n 6 37 1 0 0 0 0\n 6 38 1 6 0 0 0\n 38 39 1 0 0 0 0\n 7 39 1 6 0 0 0\n 8 40 1 1 0 0 0\n 9 41 1 1 0 0 0\n 10 42 1 6 0 0 0\n 11 43 1 1 0 0 0\n 11 44 1 0 0 0 0\n 44 7 1 0 0 0 0\n 12 45 1 1 0 0 0\n 49 48 2 0 0 0 0\n 49 47 2 0 0 0 0\n 49 46 1 0 0 0 0\n 49 24 1 0 0 0 0\n 53 52 2 0 0 0 0\n 53 51 2 0 0 0 0\n 53 50 1 0 0 0 0\n 53 21 1 0 0 0 0\nM CHG 4 1 1 2 1 46 -1 50 -1\nM END", "smiles": "C[C@H]1[C@@H]([C@H]([C@H]([C@H](OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)Oc3c(=O)c4c(cc(cc4OS(=O)(=O)[O-])OS(=O)(=O)[O-])oc3-c5ccc(c(c5)O)O)O)O)O)O1)O)O)O.[Na+].[Na+]", "formula": "C27H28O22S2.2Na", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 10, "ez_centers": 0, "molecular_weight": "814.6108", "optical_activity": "UNSPECIFIED", "references": [ "797e610a-9a64-49e0-8f5c-f5f598aa88f0", "e9ed3142-29d6-4483-a22b-af5dc7bd25fc" ], "stereo_centers": 10 }, "unii": "V5J3537PND" } ] }