{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8a94a5f6-5938-42c9-b543-a39d5598b8cb",
          "code": "67151-63-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=67151-63-7",
          "code_system": "CAS",
          "references": [
            "4479c4d7-a872-4a48-81a1-3018f4487d71",
            "d89aa8d8-56bc-4275-b1c0-ccc0391de718"
          ]
        },
        {
          "uuid": "6b312827-964a-424c-a1da-2207ed9599b9",
          "code": "266-587-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.060.515",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4479c4d7-a872-4a48-81a1-3018f4487d71"
          ]
        },
        {
          "uuid": "135ad611-d386-4a3d-b138-e71e69bd3e1c",
          "code": "106705",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/106705",
          "code_system": "PUBCHEM",
          "references": [
            "4479c4d7-a872-4a48-81a1-3018f4487d71"
          ]
        },
        {
          "uuid": "fecc5891-32e4-cac8-6e56-eaef095483ed",
          "code": "DTXSID2044975",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2044975",
          "code_system": "EPA CompTox",
          "references": [
            "c3c90861-361c-8222-dc3a-063fec9ef86e"
          ]
        },
        {
          "uuid": "dbfddfaa-8717-4523-8794-b0211202e86d",
          "code": "V3Z0042FN5",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "28a672a2-8ef0-4b71-8d80-7a0ba0d7308c",
          "name": "1-(BIS(3-(DIMETHYLAMINO)PROPYL)AMINO)-2-PROPANOL",
          "stdName": "1-(BIS(3-(DIMETHYLAMINO)PROPYL)AMINO)-2-PROPANOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81c09972-1eca-48d4-9ac6-beb28621add2"
          ],
          "display_name": false
        },
        {
          "uuid": "043a04ed-56ca-426d-8e7c-d43e400649ee",
          "name": "1-(BIS(3-(DIMETHYLAMINO)PROPYL)AMINO)PROPAN-2-OL",
          "stdName": "1-(BIS(3-(DIMETHYLAMINO)PROPYL)AMINO)PROPAN-2-OL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f0e3b0b-5133-46cf-8c13-9c2c0e3af8e7"
          ],
          "display_name": true
        },
        {
          "uuid": "881acf60-d56b-49ad-ac4d-ec717be85f4f",
          "name": "2-PROPANOL, 1-(BIS(3-(DIMETHYLAMINO)PROPYL)AMINO)-",
          "stdName": "2-PROPANOL, 1-(BIS(3-(DIMETHYLAMINO)PROPYL)AMINO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81c09972-1eca-48d4-9ac6-beb28621add2"
          ],
          "display_name": false
        },
        {
          "uuid": "ea9326e2-e3b4-49f1-98fd-cb4307f9e798",
          "name": "N,N-BIS(3-DIMETHYLAMINOPROPYL)-N-(2-HYDROXYPROPYL)AMINE",
          "stdName": "N,N-BIS(3-DIMETHYLAMINOPROPYL)-N-(2-HYDROXYPROPYL)AMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81c09972-1eca-48d4-9ac6-beb28621add2"
          ],
          "display_name": false
        },
        {
          "uuid": "42034c46-8161-4dd4-a34d-efd93c35c511",
          "name": "N,N-BIS(3-DIMETHYLAMINOPROPYL)ISOPROPANOLAMINE",
          "stdName": "N,N-BIS(3-DIMETHYLAMINOPROPYL)ISOPROPANOLAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81c09972-1eca-48d4-9ac6-beb28621add2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0f0e3b0b-5133-46cf-8c13-9c2c0e3af8e7",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "81c09972-1eca-48d4-9ac6-beb28621add2",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4479c4d7-a872-4a48-81a1-3018f4487d71",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392320000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0c1b3c93-cee0-47d4-a919-8299c367f38f",
          "citation": "SRS import [V3Z0042FN5]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=V3Z0042FN5",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392320000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c3c90861-361c-8222-dc3a-063fec9ef86e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=67151-63-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d89aa8d8-56bc-4275-b1c0-ccc0391de718",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b9946770-6e34-457a-9df3-bfc7871ec664",
          "id": "b9946770-6e34-457a-9df3-bfc7871ec664",
          "molfile": "\n  Marvin  01132109362D          \n\n 17 16  0  0  0  0            999 V2000\n    3.7524   -4.3097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1306   -3.5832    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.9667   -3.5633    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7225   -2.8715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9013   -2.8616    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4933   -2.1449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9113   -1.4283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7325   -1.4283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1505   -0.7216    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9767   -0.7216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7425    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4833   -3.5732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6572   -3.5732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2392   -2.8616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4180   -2.8516    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0199   -2.1350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.5633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 12  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\nM  END",
          "smiles": "CC(CN(CCCN(C)C)CCCN(C)C)O",
          "formula": "C13H31N3O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9c03ca5e-f9d8-4599-aea5-350c93c8867c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "245.4052",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2a2b9e1c-bf5b-414d-99be-1f183ff3cb3c",
      "version": "3",
      "structure": {
        "id": "9087d35c-acbd-4bfe-9a79-40f3549c873d",
        "molfile": "\n  Marvin  01132107292D          \n\n 17 16  0  0  0  0            999 V2000\n    3.7225   -2.8715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1306   -3.5832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7524   -4.3097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9667   -3.5633    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9013   -2.8616    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4933   -2.1449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9113   -1.4283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7325   -1.4283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1505   -0.7216    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9767   -0.7216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7425    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4833   -3.5732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6572   -3.5732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2392   -2.8616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4180   -2.8516    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0199   -2.1350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.5633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  5  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 12  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\nM  END",
        "smiles": "CC(CN(CCCN(C)C)CCCN(C)C)O",
        "formula": "C13H31N3O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "245.4052",
        "optical_activity": "( + / - )",
        "references": [
          "0f0e3b0b-5133-46cf-8c13-9c2c0e3af8e7",
          "0c1b3c93-cee0-47d4-a919-8299c367f38f"
        ],
        "stereo_centers": 1
      },
      "unii": "V3Z0042FN5"
    }
  ]
}