{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b98475e1-4677-4c72-ba67-9be9dc4ea12d",
          "code": "55285-14-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=55285-14-8",
          "code_system": "CAS",
          "references": [
            "011dcda0-beeb-435c-b8d7-7d1767595f86",
            "2aeaeaec-c717-445f-aa6a-e67e64fac5ca"
          ]
        },
        {
          "uuid": "da9ff5f0-a5e6-4761-9bf2-df15db9b4036",
          "code": "C035038",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67035038",
          "code_system": "MESH",
          "references": [
            "011dcda0-beeb-435c-b8d7-7d1767595f86"
          ]
        },
        {
          "uuid": "45a0fc84-4016-40f8-b6d6-a15ae11e097f",
          "code": "CARBOSULFAN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Carbosulfan",
          "code_system": "WIKIPEDIA",
          "references": [
            "011dcda0-beeb-435c-b8d7-7d1767595f86"
          ]
        },
        {
          "uuid": "49adb6f0-b4cf-48e2-b9a3-8fe9065d17f4",
          "code": "90602",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1757",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "011dcda0-beeb-435c-b8d7-7d1767595f86"
          ]
        },
        {
          "uuid": "dd180d43-bfc0-4bce-aaa9-3bd76950d137",
          "code": "259-565-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.054.132",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "011dcda0-beeb-435c-b8d7-7d1767595f86"
          ]
        },
        {
          "uuid": "69405610-8648-4655-8173-5d1c396120b6",
          "code": "m3097",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3097?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "011dcda0-beeb-435c-b8d7-7d1767595f86"
          ]
        },
        {
          "uuid": "92af5b38-b71d-4916-bb03-2d186739aa39",
          "code": "41384",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/41384",
          "code_system": "PUBCHEM",
          "references": [
            "011dcda0-beeb-435c-b8d7-7d1767595f86"
          ]
        },
        {
          "uuid": "b4bcb92b-b59a-92f8-4bcc-7ab05b5666fd",
          "code": "DTXSID5023950",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5023950",
          "code_system": "EPA CompTox",
          "references": [
            "79034f4e-97fe-3256-7be5-bd6fae5c0316"
          ]
        },
        {
          "uuid": "c47c23eb-318c-4a32-952b-0bee1fbc6dae",
          "code": "V1DGN4AK6G",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "34b52b77-1676-57f4-85ea-17837c115c8a",
          "code": "300000046388",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "2916deaf-45a6-4e3d-db01-1f858cb9a551"
          ]
        },
        {
          "uuid": "c758a3f5-9911-130f-310c-5edbd7757c01",
          "code": "carbosulfan",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/carbosulfan.html",
          "code_system": "ALANWOOD",
          "references": [
            "4211bb7c-2821-a215-cdc7-127803162927"
          ]
        },
        {
          "uuid": "26f80f49-bf75-7ab7-ba94-d55e5f463bb7",
          "code": "C163638",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C163638",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5b0c3be3-7d35-7fc4-04c9-789e7ffd1cc8"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8eead06f-1112-426c-9a9c-148bda9528d3",
          "name": "2,3-DIHYDRO-2,2-DIMETHYL-7-BENZOFURANYL N-((DIBUTYLAMINO)THIO)-N-METHYLCARBAMATE",
          "stdName": "2,3-DIHYDRO-2,2-DIMETHYL-7-BENZOFURANYL N-((DIBUTYLAMINO)THIO)-N-METHYLCARBAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "166d81cd-40f1-4ff5-b873-ec158fc04857",
            "7a3d2c1d-d78b-4f09-9dd7-e124d0830b6f"
          ],
          "display_name": false
        },
        {
          "uuid": "4543d78b-b3b2-46cf-b94e-35c5efc9284b",
          "name": "2,3-DIHYDRO-2,2-DIMETHYLBENZOFURAN-7-YL (DIBUTYLAMINOTHIO)METHYLCARBAMATE",
          "stdName": "2,3-DIHYDRO-2,2-DIMETHYLBENZOFURAN-7-YL (DIBUTYLAMINOTHIO)METHYLCARBAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a333e979-fc8f-4234-8fc7-77b4ddc2ff2e",
            "7a3d2c1d-d78b-4f09-9dd7-e124d0830b6f"
          ],
          "display_name": false
        },
        {
          "uuid": "038bcb1b-5f1a-4b31-93df-c4260e018da8",
          "name": "CARBAMIC ACID, ((DIBUTYLAMINO)THIO)METHYL-, 2,3-DIHYDRO-2,2-DIMETHYL-7-BENZOFURANYL ESTER",
          "stdName": "CARBAMIC ACID, ((DIBUTYLAMINO)THIO)METHYL-, 2,3-DIHYDRO-2,2-DIMETHYL-7-BENZOFURANYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "85d323b8-4073-4734-aac7-fbc5fb6d355a",
            "911d7406-bc56-4d6b-9b9c-0465db2f58e4"
          ],
          "display_name": false
        },
        {
          "uuid": "6862528d-5b17-4534-929c-03e416621585",
          "name": "CARBOSULFAN",
          "stdName": "CARBOSULFAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c642a3be-6612-4674-8136-f8e67ffee911",
            "e35258a7-f320-4758-80db-03a1ab45047a",
            "b1949395-bb4b-41c8-9b38-3bca842e33db",
            "074a612f-1139-4e0b-9944-d5fe682b6ba3",
            "911d7406-bc56-4d6b-9b9c-0465db2f58e4",
            "6a28b528-62af-41b8-b52b-23ae970ca0db"
          ],
          "display_name": true
        },
        {
          "uuid": "47c95625-7b98-4132-b744-e61c4fb7b48f",
          "name": "CARBOSULFAN [ISO]",
          "stdName": "CARBOSULFAN [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c642a3be-6612-4674-8136-f8e67ffee911",
            "911d7406-bc56-4d6b-9b9c-0465db2f58e4"
          ],
          "display_name": false
        },
        {
          "uuid": "6f422804-438d-4631-8c98-1848a268c942",
          "name": "CARBOSULFAN [MI]",
          "stdName": "CARBOSULFAN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e35258a7-f320-4758-80db-03a1ab45047a",
            "911d7406-bc56-4d6b-9b9c-0465db2f58e4"
          ],
          "display_name": false
        },
        {
          "uuid": "8f90d3f6-b1da-4a3b-b720-3cdc8c843727",
          "name": "FMC-35001",
          "stdName": "FMC-35001",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c66a917-b4c7-4c96-9831-455c0979107f",
            "911d7406-bc56-4d6b-9b9c-0465db2f58e4"
          ],
          "display_name": false
        },
        {
          "uuid": "57c4811b-f1a1-4845-85ed-36bb4c590c99",
          "name": "MARSHAL",
          "stdName": "MARSHAL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "419be84d-1f2a-4ad2-b1ba-4d6379aacc82",
            "911d7406-bc56-4d6b-9b9c-0465db2f58e4"
          ],
          "display_name": false
        },
        {
          "uuid": "6ae35b52-f70b-4cfc-aa64-119544801cfe",
          "name": "N-((DIBUTYLAMINO)THIO)-N-METHYLCARBAMIC ACID 2,3-DIHYDRO-2,2-DIMETHYL-7-BENZOFURANYL ESTER",
          "stdName": "N-((DIBUTYLAMINO)THIO)-N-METHYLCARBAMIC ACID 2,3-DIHYDRO-2,2-DIMETHYL-7-BENZOFURANYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c66a917-b4c7-4c96-9831-455c0979107f",
            "911d7406-bc56-4d6b-9b9c-0465db2f58e4"
          ],
          "display_name": false
        },
        {
          "uuid": "2810986b-1971-4bce-a424-d233f21f5e3b",
          "name": "POSSE",
          "stdName": "POSSE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "419be84d-1f2a-4ad2-b1ba-4d6379aacc82",
            "911d7406-bc56-4d6b-9b9c-0465db2f58e4"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "074a612f-1139-4e0b-9944-d5fe682b6ba3",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7a3d2c1d-d78b-4f09-9dd7-e124d0830b6f",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a333e979-fc8f-4234-8fc7-77b4ddc2ff2e",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "166d81cd-40f1-4ff5-b873-ec158fc04857",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e35258a7-f320-4758-80db-03a1ab45047a",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "911d7406-bc56-4d6b-9b9c-0465db2f58e4",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7c66a917-b4c7-4c96-9831-455c0979107f",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "85d323b8-4073-4734-aac7-fbc5fb6d355a",
          "citation": "chemid",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "419be84d-1f2a-4ad2-b1ba-4d6379aacc82",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c642a3be-6612-4674-8136-f8e67ffee911",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "011dcda0-beeb-435c-b8d7-7d1767595f86",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bec31898-2428-434a-84fb-fd12924cf500",
          "citation": "SRS import [V1DGN4AK6G]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=V1DGN4AK6G",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cffbf549-d505-4c39-9897-317e37d19faf",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6a28b528-62af-41b8-b52b-23ae970ca0db",
          "citation": "CARBOSULFAN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b1949395-bb4b-41c8-9b38-3bca842e33db",
          "citation": "CARBOSULFAN [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "79034f4e-97fe-3256-7be5-bd6fae5c0316",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=55285-14-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4211bb7c-2821-a215-cdc7-127803162927",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "5b0c3be3-7d35-7fc4-04c9-789e7ffd1cc8",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "2aeaeaec-c717-445f-aa6a-e67e64fac5ca",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2916deaf-45a6-4e3d-db01-1f858cb9a551",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "27676039-daf4-44ce-b560-902d1c3bbdc0",
          "id": "27676039-daf4-44ce-b560-902d1c3bbdc0",
          "molfile": "\n  Marvin  01132102102D          \n\n 26 27  0  0  0  0            999 V2000\n    3.8031   -5.4335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5071   -5.0268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2251   -5.4335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9498   -5.0268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9498   -4.2193    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2251   -3.8048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5071   -4.2193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8031   -3.8048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0916   -4.2193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6645   -3.8048    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3687   -4.2193    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3687   -5.0268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0795   -3.8048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0795   -2.9797    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7982   -4.2193    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7982   -5.0268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0795   -5.4335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0795   -6.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7844   -6.6662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5152   -6.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2882   -6.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7655   -5.8557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3103   -5.0681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2896   -6.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2882   -5.1785    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5152   -5.4335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n 10  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 11  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 13  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 26 16  2  0  0  0  0\n 17 18  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 20 21  1  0  0  0  0\n 26 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 25 22  1  0  0  0  0\n 26 25  1  0  0  0  0\nM  END",
          "smiles": "CCCCN(CCCC)SN(C)C(=O)Oc1cccc2CC(C)(C)Oc21",
          "formula": "C20H32N2O3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "86115daa-f4a0-4b8b-990c-521895315fb1"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "380.5465",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "375422b6-a33a-4df2-92ce-13375476e23b",
      "version": "6",
      "structure": {
        "id": "7251aea2-4344-46b5-93e4-8388d7ada00a",
        "molfile": "\n  Marvin  01132105562D          \n\n 26 27  0  0  0  0            999 V2000\n    9.5152   -5.4335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5152   -6.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2882   -6.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7655   -5.8557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2882   -5.1785    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3103   -5.0681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2896   -6.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7844   -6.6662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0795   -6.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0795   -5.4335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7982   -5.0268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7982   -4.2193    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0795   -3.8048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3687   -4.2193    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6645   -3.8048    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9498   -4.2193    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9498   -5.0268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2251   -5.4335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5071   -5.0268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8031   -5.4335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2251   -3.8048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5071   -4.2193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8031   -3.8048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0916   -4.2193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3687   -5.0268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0795   -2.9797    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  1  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  2  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n  1 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 16 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 14 25  1  0  0  0  0\n 13 26  2  0  0  0  0\nM  END",
        "smiles": "CCCCN(CCCC)SN(C)C(=O)Oc1cccc2CC(C)(C)Oc21",
        "formula": "C20H32N2O3S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "380.5465",
        "optical_activity": "NONE",
        "references": [
          "cffbf549-d505-4c39-9897-317e37d19faf",
          "bec31898-2428-434a-84fb-fd12924cf500"
        ],
        "stereo_centers": 0
      },
      "unii": "V1DGN4AK6G"
    }
  ]
}