{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "9ec5d6a3-5a11-456b-9bd5-351119529e10", "code": "267-153-5", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.061.030", "code_system": "ECHA (EC/EINECS)", "references": [ "e1e30a22-4737-4d1c-b847-a21eac7b091b" ] }, { "uuid": "d1ccd856-5b1c-4c99-8b07-c4a1efd4b803", "code": "6437272", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6437272", "code_system": "PUBCHEM", "references": [ "e1e30a22-4737-4d1c-b847-a21eac7b091b" ] }, { "uuid": "96257cc5-f3d4-4b45-93ba-f8939a6a422f", "code": "67801-32-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=67801-32-5", "code_system": "CAS", "references": [ "e1e30a22-4737-4d1c-b847-a21eac7b091b", "a465188a-c627-4eea-8a12-e5bfa809980f" ] }, { "uuid": "ff64cc1a-d4fa-45aa-ab91-056288ae0296", "code": "V0Z60YM36T", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "44668773-8623-6205-8236-3a2e8f518e53", "code": "DTXSID90867341", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90867341", "code_system": "EPA CompTox", "references": [ "9a0dd117-8ea2-e4d2-35ef-c72da92f9851" ] } ], "substance_class": "chemical", "names": [ { "uuid": "3bbd2492-e8a2-4509-99e4-6fb4855c97e8", "name": "1-(3,5,6-TRIMETHYL-3-CYCLOHEXEN-1-YL)-1-PENTEN-3-ONE", "stdName": "1-(3,5,6-TRIMETHYL-3-CYCLOHEXEN-1-YL)-1-PENTEN-3-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a8bbf7fc-4cb2-4f52-858d-f28489285a3d", "5f90cf00-b812-462b-8dcc-bde1db7bb4e1" ], "display_name": true }, { "uuid": "096b1ae7-35c5-4f9c-ae69-a201fd92d0c0", "name": "1-PENTEN-3-ONE, 1-(3,5,6-TRIMETHYL-3-CYCLOHEXEN-1-YL)-", "stdName": "1-PENTEN-3-ONE, 1-(3,5,6-TRIMETHYL-3-CYCLOHEXEN-1-YL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4456fa5c-86ce-4cd1-ab67-1f18bfacf5a5", "5f90cf00-b812-462b-8dcc-bde1db7bb4e1" ], "display_name": false } ], "references": [ { "uuid": "a8bbf7fc-4cb2-4f52-858d-f28489285a3d", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "5f90cf00-b812-462b-8dcc-bde1db7bb4e1", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4456fa5c-86ce-4cd1-ab67-1f18bfacf5a5", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e1e30a22-4737-4d1c-b847-a21eac7b091b", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392212000, "tags": [ "NOMEN" ] }, { "uuid": "bf9a9f32-c26e-49db-849e-2f495857cbfd", "citation": "SRS import [V0Z60YM36T]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=V0Z60YM36T", "doc_type": "SRS", "public_domain": true, "document_date": 1493392212000, "tags": [ "NOMEN" ] }, { "uuid": "a465188a-c627-4eea-8a12-e5bfa809980f", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "9a0dd117-8ea2-e4d2-35ef-c72da92f9851", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "5b045edd-4e57-4211-bf94-ffd6881a92e9", "id": "5b045edd-4e57-4211-bf94-ffd6881a92e9", "molfile": "\n Marvin 01132104432D \n\n 15 15 0 0 0 0 999 V2000\n 9.9931 -3.6721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2817 -4.0898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5642 -3.6826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5582 -2.8576 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8528 -4.1003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1353 -3.6931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4239 -4.1108 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 5.7064 -3.7035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9950 -4.1213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2776 -3.7140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0011 -4.9462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7185 -5.3535 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 5.7246 -6.1785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4299 -4.9358 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 7.1474 -5.3430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 2 0 0 0 0\n 5 3 1 0 0 0 0\n 6 5 2 0 0 0 0\n 6 7 1 0 0 0 0\n 8 7 1 0 0 0 0\n 14 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 1 0 0 0 0\n 14 15 1 0 0 0 0\nM END", "smiles": "CCC(=O)/C=C/C1CC(=CC(C)C1C)C", "formula": "C14H22O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "2a72b109-abc2-4312-a4dc-bb9b4303412a" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "206.3244", "optical_activity": "UNSPECIFIED", "stereo_centers": 3 } ], "definition_level": "COMPLETE", "uuid": "54944742-d674-4ef4-b180-5af7fef7b9a4", "version": "5", "structure": { "id": "a0dd67fc-c735-4234-b916-c433d25bc46e", "molfile": "\n Marvin 01132108212D \n\n 15 15 0 0 0 0 999 V2000\n 4.9950 -4.1213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2776 -3.7140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7064 -3.7035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4239 -4.1108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1353 -3.6931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8528 -4.1003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5642 -3.6826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5582 -2.8576 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2817 -4.0898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9931 -3.6721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4299 -4.9358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1474 -5.3430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7185 -5.3535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7246 -6.1785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0011 -4.9462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 4 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 11 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 13 1 0 0 0 0\n 1 15 2 0 0 0 0\nM END", "smiles": "CCC(=O)/C=C/C1CC(=CC(C)C1C)C", "formula": "C14H22O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "206.3244", "optical_activity": "UNSPECIFIED", "references": [ "4456fa5c-86ce-4cd1-ab67-1f18bfacf5a5", "bf9a9f32-c26e-49db-849e-2f495857cbfd" ], "stereo_centers": 3 }, "unii": "V0Z60YM36T" } ] }