{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "de663dbc-ffd6-4870-a3b6-256f24c20db7",
          "code": "87-18-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=87-18-3",
          "code_system": "CAS",
          "references": [
            "40e4c566-761f-499a-bef2-2afb44eec740",
            "42bfdf05-4f2d-48c8-9449-511921c7635c"
          ]
        },
        {
          "uuid": "ec50ee6c-69ea-4389-ad52-b9c03cfd6601",
          "code": "m2859",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2859?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "40e4c566-761f-499a-bef2-2afb44eec740"
          ]
        },
        {
          "uuid": "ab547817-c783-4fe2-932c-77063dcd8c99",
          "code": "SUB124992",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "40e4c566-761f-499a-bef2-2afb44eec740"
          ]
        },
        {
          "uuid": "be48d80c-7545-4c2d-9645-f88c90c25da7",
          "code": "201-728-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.572",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "40e4c566-761f-499a-bef2-2afb44eec740"
          ]
        },
        {
          "uuid": "4b11de36-d531-4795-9119-f91508532525",
          "code": "66597",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/66597",
          "code_system": "PUBCHEM",
          "references": [
            "40e4c566-761f-499a-bef2-2afb44eec740"
          ]
        },
        {
          "uuid": "5606624f-c932-1c36-025b-e2297909e743",
          "code": "DTXSID9037745",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9037745",
          "code_system": "EPA CompTox",
          "references": [
            "f1430ab8-4a23-24a2-3a2a-a66b8762db48"
          ]
        },
        {
          "uuid": "dbc4d107-e3b0-424d-b1ba-07ab6e87c86c",
          "code": "V0H9R55TGV",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a8286bdc-cffd-1bbc-e78d-a12dda9ad3f2",
          "code": "100000146064",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "b47ad5f3-770f-5804-409e-cc279707aaff"
          ]
        },
        {
          "uuid": "3e2ac869-c501-75d8-e317-7df7365f5829",
          "code": "33404",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=33404",
          "code_system": "NSC",
          "references": [
            "74a394ce-af33-4153-9e57-c4d01ecd823d"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "71b86a0c-0573-4871-9a41-574ee74dcc6a",
          "name": "2-HYDROXYBENZOIC ACID 4-(1,1-DIMETHYLETHYL)PHENYL ESTER",
          "stdName": "2-HYDROXYBENZOIC ACID 4-(1,1-DIMETHYLETHYL)PHENYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5211f975-6079-4c5c-a099-b3007891fed7",
            "8102313d-3ea1-445d-84aa-6d5e0446ee63"
          ],
          "display_name": false
        },
        {
          "uuid": "ab38a576-451b-477f-8db8-2184b3378d1f",
          "name": "4-TERT-BUTYLPHENYL SALICYLATE",
          "stdName": "4-TERT-BUTYLPHENYL SALICYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5211f975-6079-4c5c-a099-b3007891fed7",
            "8102313d-3ea1-445d-84aa-6d5e0446ee63",
            "4cae67d7-e311-4916-a220-dff12914908e",
            "9b9a52bf-50f7-4b61-923b-2e21bcdb2dd8"
          ],
          "display_name": true
        },
        {
          "uuid": "c4bf5479-5612-4860-8b07-0a4e72a548c2",
          "name": "4-TERT-BUTYLPHENYL SALICYLATE [MI]",
          "stdName": "4-TERT-BUTYLPHENYL SALICYLATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5211f975-6079-4c5c-a099-b3007891fed7",
            "8102313d-3ea1-445d-84aa-6d5e0446ee63"
          ],
          "display_name": false
        },
        {
          "uuid": "2644c098-bb70-49a1-9620-948705bdfdaf",
          "name": "NSC-33404",
          "stdName": "NSC-33404",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8102313d-3ea1-445d-84aa-6d5e0446ee63",
            "4cae67d7-e311-4916-a220-dff12914908e"
          ],
          "display_name": false
        },
        {
          "uuid": "4e66055c-9f9d-4a7b-90cb-344ff0f01a13",
          "name": "P-TERT-BUTYLPHENYL SALICYLATE",
          "stdName": "P-TERT-BUTYLPHENYL SALICYLATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8102313d-3ea1-445d-84aa-6d5e0446ee63",
            "4cae67d7-e311-4916-a220-dff12914908e"
          ],
          "display_name": false
        },
        {
          "uuid": "8e2f722d-d785-4fc9-9e93-a22e169a7359",
          "name": "SALICYLIC ACID P-TERT-BUTYLPHENYL ESTER",
          "stdName": "SALICYLIC ACID P-TERT-BUTYLPHENYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5211f975-6079-4c5c-a099-b3007891fed7",
            "8102313d-3ea1-445d-84aa-6d5e0446ee63"
          ],
          "display_name": false
        },
        {
          "uuid": "f7b78711-e16a-4b6d-aee3-4985745efe24",
          "name": "SEESORB 202",
          "stdName": "SEESORB 202",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8102313d-3ea1-445d-84aa-6d5e0446ee63",
            "4cae67d7-e311-4916-a220-dff12914908e"
          ],
          "display_name": false
        },
        {
          "uuid": "ba2e82ec-34e0-43bb-bb9f-d85b3b07034b",
          "name": "SUMISORB 90",
          "stdName": "SUMISORB 90",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8102313d-3ea1-445d-84aa-6d5e0446ee63",
            "4cae67d7-e311-4916-a220-dff12914908e"
          ],
          "display_name": false
        },
        {
          "uuid": "f1fcea22-d425-4dd2-b902-e58602b40dd5",
          "name": "TBS",
          "stdName": "TBS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5211f975-6079-4c5c-a099-b3007891fed7",
            "8102313d-3ea1-445d-84aa-6d5e0446ee63"
          ],
          "display_name": false
        },
        {
          "uuid": "04001f23-8cfc-42c2-8cfb-b33d4a58a1b3",
          "name": "VIOSORB 90",
          "stdName": "VIOSORB 90",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8102313d-3ea1-445d-84aa-6d5e0446ee63",
            "4cae67d7-e311-4916-a220-dff12914908e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4cae67d7-e311-4916-a220-dff12914908e",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8102313d-3ea1-445d-84aa-6d5e0446ee63",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5211f975-6079-4c5c-a099-b3007891fed7",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "40e4c566-761f-499a-bef2-2afb44eec740",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391669000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1bc2dae8-ce2f-4ee9-b159-194bfb47e8e2",
          "citation": "SRS import [V0H9R55TGV]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=V0H9R55TGV",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391669000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a0e24d7b-ea6d-4e71-9222-d0230613579e",
          "citation": "CHEMID RECORD 87-18-3",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9b9a52bf-50f7-4b61-923b-2e21bcdb2dd8",
          "citation": "4-TERT-BUTYLPHENYL SALICYLATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f1430ab8-4a23-24a2-3a2a-a66b8762db48",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=87-18-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "42bfdf05-4f2d-48c8-9449-511921c7635c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "74a394ce-af33-4153-9e57-c4d01ecd823d",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b47ad5f3-770f-5804-409e-cc279707aaff",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "22f3124f-3c2b-4bab-8073-2ace36f40e95",
          "id": "22f3124f-3c2b-4bab-8073-2ace36f40e95",
          "molfile": "\n  Marvin  01132101572D          \n\n 20 21  0  0  0  0            999 V2000\n    0.6229   -3.9631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8905   -3.2474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1845   -3.4928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1206   -2.7759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6104   -2.8285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6104   -2.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3277   -1.5929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0383   -2.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7611   -1.5878    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7601   -0.7609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0453   -0.3491    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4701   -0.3477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4696    0.4803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1800    0.8926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9017    0.4812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9022   -0.3468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1852   -0.7592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1841   -1.5830    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0383   -2.8285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3277   -3.2404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 20  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 19  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 10 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 12 17  2  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 20 19  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)c1ccc(cc1)OC(=O)c2ccccc2O",
          "formula": "C17H18O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5d648534-29f8-48d2-83e1-6ff421b380d6"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "270.3237",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "11740712-1b8b-4669-a830-7e20d1fc94f6",
      "version": "5",
      "structure": {
        "id": "951781b3-4e2a-48f4-9431-c1f6189f8528",
        "molfile": "\n  Marvin  01132107442D          \n\n 20 21  0  0  0  0            999 V2000\n    3.0453   -0.3491    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7601   -0.7609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7611   -1.5878    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0383   -2.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3277   -1.5929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6104   -2.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6104   -2.8285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3277   -3.2404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0383   -2.8285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8905   -3.2474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6229   -3.9631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1845   -3.4928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1206   -2.7759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4701   -0.3477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1852   -0.7592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1841   -1.5830    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9022   -0.3468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9017    0.4812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1800    0.8926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4696    0.4803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9  4  2  0  0  0  0\n  7 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 10 13  1  0  0  0  0\n  2 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 14  2  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)c1ccc(cc1)OC(=O)c2ccccc2O",
        "formula": "C17H18O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "270.3237",
        "optical_activity": "NONE",
        "references": [
          "1bc2dae8-ce2f-4ee9-b159-194bfb47e8e2",
          "a0e24d7b-ea6d-4e71-9222-d0230613579e"
        ],
        "stereo_centers": 0
      },
      "unii": "V0H9R55TGV"
    }
  ]
}