{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "83112b0a-5e38-44bd-a978-5fe915245ab3",
          "code": "152019-73-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=152019-73-3",
          "code_system": "CAS",
          "references": [
            "c67e3196-b3ef-40a0-99b7-de2e7fd33cc2",
            "10b99da0-cab6-4225-860e-6fd0d5114361"
          ]
        },
        {
          "uuid": "e2eb8cc0-e823-4b45-bd48-852177dcd622",
          "code": "15842092",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/15842092",
          "code_system": "PUBCHEM",
          "references": [
            "c67e3196-b3ef-40a0-99b7-de2e7fd33cc2"
          ]
        },
        {
          "uuid": "2da29eda-d516-4914-736e-9655b21fe8fb",
          "code": "DTXSID6037568",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6037568",
          "code_system": "EPA CompTox",
          "references": [
            "e6bb4dd1-570b-5b5d-7083-6543daf3ca44"
          ]
        },
        {
          "uuid": "98f18b09-0264-4803-b25c-89b524911359",
          "code": "V09UDI0MFU",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ca06e035-17bf-6588-a6ef-b1684f3cadf1",
          "code": "100000183643",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "e1bb1d26-e09f-90dc-6d0d-8f0cecc213a4"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f2471cee-2561-483c-bec4-b2cb16a4f861",
          "name": "2-((2-ETHYL-6-METHYLPHENYL)(2-METHOXY-1-METHYLETHYL)AMINO)-2-OXOACETIC ACID",
          "stdName": "2-((2-ETHYL-6-METHYLPHENYL)(2-METHOXY-1-METHYLETHYL)AMINO)-2-OXOACETIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d505d15-293e-485a-8b66-06ae34f71845",
            "1e186104-c71d-47fa-89cd-1d32dbc4d844"
          ],
          "display_name": false
        },
        {
          "uuid": "c6a89da4-7118-408d-92d9-91d9c3f75047",
          "name": "ACETIC ACID, 2-((2-ETHYL-6-METHYLPHENYL)(2-METHOXY-1-METHYLETHYL)AMINO)-2-OXO-",
          "stdName": "ACETIC ACID, 2-((2-ETHYL-6-METHYLPHENYL)(2-METHOXY-1-METHYLETHYL)AMINO)-2-OXO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d505d15-293e-485a-8b66-06ae34f71845",
            "cb813175-11da-44ae-bf13-c73f6431b1b0"
          ],
          "display_name": false
        },
        {
          "uuid": "08c0d59e-6c2d-4d74-aee2-6d6ba7e8128e",
          "name": "CGA 51202",
          "stdName": "CGA 51202",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d505d15-293e-485a-8b66-06ae34f71845",
            "cb813175-11da-44ae-bf13-c73f6431b1b0"
          ],
          "display_name": false
        },
        {
          "uuid": "2df8880c-d396-4176-b4fb-885a1e23dc36",
          "name": "METOLACHLOR OA",
          "stdName": "METOLACHLOR OA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d505d15-293e-485a-8b66-06ae34f71845",
            "1e6486c4-1bda-45b4-b0df-83d9c6eb1889"
          ],
          "display_name": true
        },
        {
          "uuid": "e5541179-052c-40d3-85a6-1768b8e9f597",
          "name": "METOLACHLOR OXANILIC ACID",
          "stdName": "METOLACHLOR OXANILIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d505d15-293e-485a-8b66-06ae34f71845",
            "cb813175-11da-44ae-bf13-c73f6431b1b0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1e186104-c71d-47fa-89cd-1d32dbc4d844",
          "citation": "EPA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2d505d15-293e-485a-8b66-06ae34f71845",
          "citation": "EPA",
          "doc_type": "EPA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb813175-11da-44ae-bf13-c73f6431b1b0",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1e6486c4-1bda-45b4-b0df-83d9c6eb1889",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c67e3196-b3ef-40a0-99b7-de2e7fd33cc2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392157000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5cd804fb-561a-47dc-b744-3df4d3c0f712",
          "citation": "SRS import [V09UDI0MFU]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=V09UDI0MFU",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392157000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e6bb4dd1-570b-5b5d-7083-6543daf3ca44",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=152019-73-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "10b99da0-cab6-4225-860e-6fd0d5114361",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e1bb1d26-e09f-90dc-6d0d-8f0cecc213a4",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d0911690-7f22-4fc5-b79a-4a5d21ecfd66",
          "id": "d0911690-7f22-4fc5-b79a-4a5d21ecfd66",
          "molfile": "\n  Marvin  01132110472D          \n\n 20 20  0  0  0  0            999 V2000\n    2.1450    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1450   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4300   -1.2300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7150   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.0550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7150   -2.4700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7150   -3.2950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4300   -2.0550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1450   -2.4700    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8550   -2.0550    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.8550   -1.2300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5700   -2.4700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2850   -2.0550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0001   -2.4700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1450   -3.2950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4300   -3.7100    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8550   -3.7100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5700   -3.2950    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8550   -4.5350    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  9  3  2  0  0  0  0\n  5  4  2  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 16  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\nM  END",
          "smiles": "CCc1cccc(C)c1N(C(C)COC)C(=O)C(=O)O",
          "formula": "C15H21NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0479acf5-15fa-458e-a53e-b3d4f5284ae5"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "279.3321",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "bbd0abd0-9a44-41b3-8d1d-5e85840ab1f9",
      "version": "4",
      "structure": {
        "id": "f89f0102-7899-42fc-808b-f7b0e01638d4",
        "molfile": "\n  Marvin  01132112532D          \n\n 20 20  0  0  0  0            999 V2000\n    2.1450   -2.4700    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4300   -2.0550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1450   -3.2950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7150   -2.4700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4300   -3.7100    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4300   -1.2300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8550   -2.0550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8550   -3.7100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5700   -3.2950    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2850   -2.0550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.0550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7150   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1450   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5700   -2.4700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7150   -3.2950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8550   -1.2300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0001   -2.4700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1450    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8550   -4.5350    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  7  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  6  2  0  0  0  0\n  3  5  2  0  0  0  0\n  3  8  1  0  0  0  0\n  4 12  2  0  0  0  0\n  4 16  1  0  0  0  0\n  6 13  1  0  0  0  0\n  6 14  1  0  0  0  0\n  7 15  1  0  0  0  0\n  7 17  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 20  2  0  0  0  0\n 10 13  2  0  0  0  0\n 10 12  1  0  0  0  0\n 11 15  1  0  0  0  0\n 11 18  1  0  0  0  0\n 14 19  1  0  0  0  0\nM  END",
        "smiles": "CCc1cccc(C)c1N(C(C)COC)C(=O)C(=O)O",
        "formula": "C15H21NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "279.3321",
        "optical_activity": "( + / - )",
        "references": [
          "5cd804fb-561a-47dc-b744-3df4d3c0f712",
          "1e6486c4-1bda-45b4-b0df-83d9c6eb1889"
        ],
        "stereo_centers": 1
      },
      "unii": "V09UDI0MFU"
    }
  ]
}