{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "f173ff1c-3579-4007-bec5-62385bc30ab8", "code": "77804-81-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=77804-81-0", "code_system": "CAS", "references": [ "c6ab3d13-6490-4ad0-9fb1-a48ced3c6569", "b6e558c2-f14d-4deb-ae2f-e06fd7531427" ] }, { "uuid": "289c606a-12e9-451c-b59d-207cbd75b206", "code": "21 CFR 178.3297", "comments": "PART 178 -- INDIRECT FOOD ADDITIVES: ADJUVANTS, PRODUCTION AIDS, AND SANITIZERS|Subpart D--Certain Adjuvants and Production Aids|Sec. 178.3297 Colorants for polymers.", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/cfrsearch.cfm?fr=178.3297", "code_system": "CFR", "references": [ "c6ab3d13-6490-4ad0-9fb1-a48ced3c6569" ] }, { "uuid": "02ba1263-bb9a-4f37-ae42-4eb423a08f90", "code": "21 CFR 176.170", "comments": "PART 176 -- INDIRECT FOOD ADDITIVES: PAPER AND PAPERBOARD COMPONENTS|Subpart B--Substances for Use Only as Components of Paper and Paperboard|Sec. 176.170 Components of paper and paperboard in contact with aqueous and fatty foods.", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/cfrsearch.cfm?fr=176.170", "code_system": "CFR", "references": [ "c6ab3d13-6490-4ad0-9fb1-a48ced3c6569" ] }, { "uuid": "56364c4c-b523-4613-a222-cd6aeb10934c", "code": "278-770-4", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.071.589", "code_system": "ECHA (EC/EINECS)", "references": [ "c6ab3d13-6490-4ad0-9fb1-a48ced3c6569" ] }, { "uuid": "9ba9e24c-e451-44cc-842d-9cb071a05682", "code": "DTXSID2052520", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2052520", "code_system": "EPA CompTox", "references": [ "d697d703-c125-e15b-2fa4-788f4a64927f" ] }, { "uuid": "be9e5197-2217-4e4b-bc09-8ce7435a9a55", "code": "V05FA9PR1F", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "c0b17718-198f-4761-8725-1b4070af7a6b", "name": "2,2'-(ETHYLENEBIS(OXYPHENYL-2,1-ENEAZO))BIS(N-(2,3-DIHYDRO- 2-OXO-1H-BENZIMIDAZOL-5-YL)-3-OXOBUTYRAMIDE)", "stdName": "2,2'-(ETHYLENEBIS(OXYPHENYL-2,1-ENEAZO))BIS(N-(2,3-DIHYDRO- 2-OXO-1H-BENZIMIDAZOL-5-YL)-3-OXOBUTYRAMIDE)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7019da85-c164-4e0d-8556-f2816014e35c" ], "display_name": false }, { "uuid": "d8b12dd9-9223-46e5-8bff-db24433c39ee", "name": "BUTANAMIDE, 2,2'-(1,2-ETHANEDIYLBIS(OXY-2,1-PHENYLENE-2,1- DIAZENEDIYL))BIS(N-(2,3-DIHYDRO-2-OXO-1H-BENZIMIDAZOL-5-YL)- 3-OXO-", "stdName": "BUTANAMIDE, 2,2'-(1,2-ETHANEDIYLBIS(OXY-2,1-PHENYLENE-2,1- DIAZENEDIYL))BIS(N-(2,3-DIHYDRO-2-OXO-1H-BENZIMIDAZOL-5-YL)- 3-OXO-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7019da85-c164-4e0d-8556-f2816014e35c" ], "display_name": false }, { "uuid": "369feb36-55e9-403e-ba3c-c0590d20d3b1", "name": "BUTANAMIDE, 2,2'-(1,2-ETHANEDIYLBIS(OXY-2,1-PHENYLENE-2,1-DIAZENEDIYL))BIS(N-(2,3-DIHYDRO-2-OXO-1H-BENZIMIDAZOL-5-YL)-3-OXO-", "stdName": "BUTANAMIDE, 2,2'-(1,2-ETHANEDIYLBIS(OXY-2,1-PHENYLENE-2,1-DIAZENEDIYL))BIS(N-(2,3-DIHYDRO-2-OXO-1H-BENZIMIDAZOL-5-YL)-3-OXO-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d7c4aed9-a2be-499e-954a-95903e522a7e" ], "display_name": false }, { "uuid": "76a45e89-4476-4956-9e15-390832bd445f", "name": "C.I. PIGMENT YELLOW 180", "stdName": "C.I. PIGMENT YELLOW 180", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8e9aa470-4e59-419d-af80-d826a3c85b36" ], "display_name": false }, { "uuid": "21ba4b9a-1d83-40e5-a42c-547a90c46615", "name": "CHROMOFINE YELLOW 6280JC", "stdName": "CHROMOFINE YELLOW 6280JC", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "d7c4aed9-a2be-499e-954a-95903e522a7e" ], "display_name": false }, { "uuid": "77c8157f-2609-4d3a-be0f-08e49d70f636", "name": "CI 21290", "stdName": "CI 21290", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d7c4aed9-a2be-499e-954a-95903e522a7e" ], "display_name": false }, { "uuid": "f3ec0ffd-e629-4c3b-a7be-d7465844dd2c", "name": "NOVOPERM YELLOW P-HG", "stdName": "NOVOPERM YELLOW P-HG", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "d7c4aed9-a2be-499e-954a-95903e522a7e" ], "display_name": false }, { "uuid": "c27ca2dc-9820-409c-b48d-fbf3bdfd3495", "name": "PIGMENT YELLOW 180", "stdName": "PIGMENT YELLOW 180", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d7c4aed9-a2be-499e-954a-95903e522a7e" ], "display_name": true }, { "uuid": "b5c81084-50ef-4c5b-8b35-eb33fe7a8291", "name": "TONER YELLOW HG", "stdName": "TONER YELLOW HG", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "d7c4aed9-a2be-499e-954a-95903e522a7e" ], "display_name": false } ], "references": [ { "uuid": "8e9aa470-4e59-419d-af80-d826a3c85b36", "citation": "CEDI", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "d7c4aed9-a2be-499e-954a-95903e522a7e", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7019da85-c164-4e0d-8556-f2816014e35c", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c6ab3d13-6490-4ad0-9fb1-a48ced3c6569", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391925000, "tags": [ "NOMEN" ] }, { "uuid": "0e14cca5-9477-44ed-824d-963a8f86a6bd", "citation": "SRS import [V05FA9PR1F]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=V05FA9PR1F", "doc_type": "SRS", "public_domain": true, "document_date": 1493391925000, "tags": [ "NOMEN" ] }, { "uuid": "d697d703-c125-e15b-2fa4-788f4a64927f", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=77804-81-0", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "b6e558c2-f14d-4deb-ae2f-e06fd7531427", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "a874eeb7-23b3-4e02-90a6-226a1e85f23c", "id": "a874eeb7-23b3-4e02-90a6-226a1e85f23c", "molfile": "\n Marvin 01132108452D \n\n 54 59 0 0 0 0 999 V2000\n -0.3572 -3.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0717 -3.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 -3.9188 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0717 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n -0.3572 -2.2687 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 -2.6812 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0717 -2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7862 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5006 -2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5006 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7862 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0717 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 -1.0313 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 1.0313 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0717 1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5006 1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5006 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0717 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 2.6812 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 2.2687 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0717 2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 1.0717 3.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7862 3.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 3.9188 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7862 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7862 1.4438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5006 2.6812 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2151 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2151 1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9296 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6441 1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4287 1.1888 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9136 1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7386 1.8563 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4287 2.5237 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6441 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9296 2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 -2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 -1.4438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5006 -2.6812 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2151 -2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2151 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9296 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6441 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.4287 -1.1888 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -5.9136 -1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.7386 -1.8563 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -5.4287 -2.5237 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6441 -2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9296 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 2 0 0 0 0\n 4 2 1 0 0 0 0\n 5 4 1 0 0 0 0\n 42 4 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 12 2 0 0 0 0\n 9 8 2 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 2 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 22 17 2 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 2 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 29 25 1 0 0 0 0\n 26 27 1 0 0 0 0\n 26 28 2 0 0 0 0\n 29 30 2 0 0 0 0\n 29 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 41 32 2 0 0 0 0\n 33 34 2 0 0 0 0\n 35 34 1 0 0 0 0\n 35 36 1 0 0 0 0\n 40 35 2 0 0 0 0\n 37 36 1 0 0 0 0\n 37 38 2 0 0 0 0\n 37 39 1 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 1 0 0 0 0\n 42 43 2 0 0 0 0\n 42 44 1 0 0 0 0\n 44 45 1 0 0 0 0\n 45 46 1 0 0 0 0\n 54 45 2 0 0 0 0\n 46 47 2 0 0 0 0\n 48 47 1 0 0 0 0\n 48 49 1 0 0 0 0\n 53 48 2 0 0 0 0\n 50 49 1 0 0 0 0\n 50 51 2 0 0 0 0\n 50 52 1 0 0 0 0\n 52 53 1 0 0 0 0\n 53 54 1 0 0 0 0\nM END", "smiles": "CC(=O)C(C(=O)Nc1ccc2c(c1)[nH]c(=O)[nH]2)/N=N/c3ccccc3OCCOc4ccccc4/N=N/C(C(=O)C)C(=O)Nc5ccc6c(c5)[nH]c(=O)[nH]6", "formula": "C36H32N10O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "56a72227-1abb-46e4-aede-7bac1b4aaaff" }, "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "732.7029", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "f0e1e5ad-5fd5-4e97-bc96-cf8e3a40e123", "version": "3", "structure": { "id": "e7f3807b-2af9-4fd5-ba43-c5a2a4a89ba6", "molfile": "\n Marvin 01132112002D \n\n 54 59 0 0 0 0 999 V2000\n 0.3572 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 -2.2687 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 -2.6812 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0717 -2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0717 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7862 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5006 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5006 -2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7862 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 -1.0313 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 2.2687 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 2.6812 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0717 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0717 1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5006 1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5006 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 1.0313 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 -2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0717 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0717 -3.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 -3.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 -1.4438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5006 -2.6812 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 -3.9188 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -5.9136 -1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.4287 -2.5237 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6441 -2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6441 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.4287 -1.1888 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9296 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2151 -2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2151 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9296 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.7386 -1.8563 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7862 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0717 2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0717 3.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7862 3.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7862 1.4438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5006 2.6812 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 3.9188 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9136 1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4287 2.5237 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6441 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6441 1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4287 1.1888 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9296 2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2151 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2151 1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9296 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7386 1.8563 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 4 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 5 10 2 0 0 0 0\n 6 11 1 0 0 0 0\n 4 5 1 0 0 0 0\n 1 11 1 0 0 0 0\n 12 13 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 14 19 2 0 0 0 0\n 15 20 1 0 0 0 0\n 13 14 1 0 0 0 0\n 2 20 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 21 25 2 0 0 0 0\n 21 26 1 0 0 0 0\n 23 27 2 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 28 32 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 2 0 0 0 0\n 35 36 1 0 0 0 0\n 31 36 2 0 0 0 0\n 30 33 2 0 0 0 0\n 28 37 2 0 0 0 0\n 26 34 1 0 0 0 0\n 3 22 1 0 0 0 0\n 38 39 1 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 1 0 0 0 0\n 38 42 2 0 0 0 0\n 38 43 1 0 0 0 0\n 40 44 2 0 0 0 0\n 45 46 1 0 0 0 0\n 46 47 1 0 0 0 0\n 47 48 1 0 0 0 0\n 48 49 1 0 0 0 0\n 45 49 1 0 0 0 0\n 50 51 1 0 0 0 0\n 51 52 2 0 0 0 0\n 52 53 1 0 0 0 0\n 48 53 2 0 0 0 0\n 47 50 2 0 0 0 0\n 45 54 2 0 0 0 0\n 43 51 1 0 0 0 0\n 12 39 1 0 0 0 0\nM END", "smiles": "CC(=O)C(C(=O)Nc1ccc2c(c1)[nH]c(=O)[nH]2)/N=N/c3ccccc3OCCOc4ccccc4/N=N/C(C(=O)C)C(=O)Nc5ccc6c(c5)[nH]c(=O)[nH]6", "formula": "C36H32N10O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "732.7029", "optical_activity": "UNSPECIFIED", "references": [ "0e14cca5-9477-44ed-824d-963a8f86a6bd", "d7c4aed9-a2be-499e-954a-95903e522a7e" ], "stereo_centers": 2 }, "unii": "V05FA9PR1F" } ] }