{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a38fc016-372a-4f43-9bb4-ae3cd13eb95a",
          "code": "139-40-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=139-40-2",
          "code_system": "CAS",
          "references": [
            "c9b24401-dfb6-4e1e-a231-841c15d88a20",
            "13c1ba3c-359e-4923-ba7e-d3baaa775b09"
          ]
        },
        {
          "uuid": "a8a2a082-e5fb-4ffb-8208-40a2d04416c2",
          "code": "80808",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3604",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "c9b24401-dfb6-4e1e-a231-841c15d88a20"
          ]
        },
        {
          "uuid": "a448f8b8-2cce-4084-b084-63173a6a73a1",
          "code": "m9196",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9196?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "c9b24401-dfb6-4e1e-a231-841c15d88a20"
          ]
        },
        {
          "uuid": "21c9468f-b057-4713-8176-6433ce244640",
          "code": "205-359-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.873",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c9b24401-dfb6-4e1e-a231-841c15d88a20"
          ]
        },
        {
          "uuid": "164f36da-4c9b-42ee-9c74-c81811dd4444",
          "code": "4937",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4937",
          "code_system": "PUBCHEM",
          "references": [
            "c9b24401-dfb6-4e1e-a231-841c15d88a20"
          ]
        },
        {
          "uuid": "d8b314cd-72cd-bde0-0a23-9514d7f9cfaf",
          "code": "1400",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1400",
          "code_system": "HSDB",
          "references": [
            "caf7ca94-2f2e-cd4a-b928-455af787f06c"
          ]
        },
        {
          "uuid": "ed5672f2-0e46-3de6-846f-d5d739bb7346",
          "code": "DTXSID3021196",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3021196",
          "code_system": "EPA CompTox",
          "references": [
            "47697c78-1f90-4fe5-ce5d-527f80638d5c"
          ]
        },
        {
          "uuid": "2a1dc1c4-f0cf-4967-8352-6ff5eb439ac2",
          "code": "UYP5U99Q5T",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f3513fc3-14aa-73ef-046b-6c5114595a26",
          "code": "38067",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:38067",
          "code_system": "CHEBI",
          "references": [
            "2c07fbdf-c189-ff46-fd18-5e9b45bc4ced"
          ]
        },
        {
          "uuid": "aac110d8-2c2c-cdda-c477-697129a4cd99",
          "code": "100000183775",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "b8eb8ad4-997c-9713-4add-d55d5edadaab"
          ]
        },
        {
          "uuid": "a79502a1-9ad9-e18a-3d4a-6a516a4e9a45",
          "code": "26002",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=26002",
          "code_system": "NSC",
          "references": [
            "f45baf42-518f-3ff0-a282-75afa026fe49"
          ]
        },
        {
          "uuid": "0b404580-5c0e-99b0-2049-3de68de5176e",
          "code": "propazine",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/propazine.html",
          "code_system": "ALANWOOD",
          "references": [
            "185c5122-0f54-7305-a113-554e663015d7"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "42f1eb09-df8c-4351-95d5-ed7e5c7a0683",
          "name": "6-CHLORO-N(SUP 2),N(SUP 4)-DIISOPROPYL-1,3,5-TRIAZINE-2,4-DIAMINE",
          "stdName": "6-CHLORO-N(SUP 2),N(SUP 4)-DIISOPROPYL-1,3,5-TRIAZINE-2,4-DIAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "18ea7fab-ee0b-412d-b5de-673f4187beca",
            "8746da2b-e63e-4b31-a2e6-b880f39bd9e8"
          ],
          "display_name": false
        },
        {
          "uuid": "ef5fa5bb-abe6-4754-a430-adb597f0655c",
          "name": "6-CHLORO-N,N'-BIS(1-METHYLETHYL)-1,3,5-TRIAZINE-2,4-DIAMINE",
          "stdName": "6-CHLORO-N,N'-BIS(1-METHYLETHYL)-1,3,5-TRIAZINE-2,4-DIAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "18ea7fab-ee0b-412d-b5de-673f4187beca",
            "fde3f26d-fca2-4b31-ae80-4e1ef9604b30"
          ],
          "display_name": false
        },
        {
          "uuid": "bb8b0bb1-7559-4817-95be-a73a6d54f011",
          "name": "G-30028",
          "stdName": "G-30028",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "860b71c8-5161-4a85-bce1-d6f0950d64da",
            "67ae7d16-7ae9-4717-86da-aa3fb5a39e8e"
          ],
          "display_name": false
        },
        {
          "uuid": "1535c4ef-a4df-408c-a8f0-6dd92fbfa4c4",
          "name": "GEIGY 30028",
          "stdName": "GEIGY 30028",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "860b71c8-5161-4a85-bce1-d6f0950d64da",
            "8991c699-ff8b-4feb-ad86-154c3caee394"
          ],
          "display_name": false
        },
        {
          "uuid": "d372792d-1f59-4f34-becd-f920179f7108",
          "name": "GESAMIL",
          "stdName": "GESAMIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "860b71c8-5161-4a85-bce1-d6f0950d64da",
            "8991c699-ff8b-4feb-ad86-154c3caee394"
          ],
          "display_name": false
        },
        {
          "uuid": "ca04d7bc-f353-43c1-af1f-3c7348205061",
          "name": "MILOGARD",
          "stdName": "MILOGARD",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "860b71c8-5161-4a85-bce1-d6f0950d64da",
            "8991c699-ff8b-4feb-ad86-154c3caee394"
          ],
          "display_name": false
        },
        {
          "uuid": "f6258857-674d-4c6c-abb8-4aeaeb25d04d",
          "name": "NSC-26002",
          "stdName": "NSC-26002",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1e386b1-4cd8-46dd-bb58-6dcc01f658fa",
            "860b71c8-5161-4a85-bce1-d6f0950d64da"
          ],
          "display_name": false
        },
        {
          "uuid": "85b8262e-7fe8-4abb-9349-a949e0d8bd25",
          "name": "PLANTULIN",
          "stdName": "PLANTULIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "860b71c8-5161-4a85-bce1-d6f0950d64da",
            "8991c699-ff8b-4feb-ad86-154c3caee394"
          ],
          "display_name": false
        },
        {
          "uuid": "6df7f282-0abb-46d6-b695-9e97c730c079",
          "name": "PRIMATOL P",
          "stdName": "PRIMATOL P",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "860b71c8-5161-4a85-bce1-d6f0950d64da",
            "8991c699-ff8b-4feb-ad86-154c3caee394"
          ],
          "display_name": false
        },
        {
          "uuid": "2f6361cb-ec61-40e1-bc4c-1699cfa1704d",
          "name": "PROPAZINE",
          "stdName": "PROPAZINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "860b71c8-5161-4a85-bce1-d6f0950d64da",
            "9f348af4-d3de-4d13-b5d9-9bbe3be03ac5",
            "8dca4e7f-e270-4961-a753-9c45dd86f7dd",
            "67ae7d16-7ae9-4717-86da-aa3fb5a39e8e",
            "6ecd080e-fbb6-4199-8575-0efd24957119",
            "6c3f324a-5254-4311-957e-0764368d5c10",
            "ac16e712-7914-48fc-9dc6-535cf00b46c7",
            "df2dce21-6629-4bac-b248-c6788703b2f9"
          ],
          "display_name": true
        },
        {
          "uuid": "343cc6b1-6678-4ecc-a99d-4aec96bc14da",
          "name": "PROPAZINE [HSDB]",
          "stdName": "PROPAZINE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "860b71c8-5161-4a85-bce1-d6f0950d64da",
            "df2dce21-6629-4bac-b248-c6788703b2f9"
          ],
          "display_name": false
        },
        {
          "uuid": "3ebc5158-edab-4c14-a967-51212b76de72",
          "name": "PROPAZINE [ISO]",
          "stdName": "PROPAZINE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9f348af4-d3de-4d13-b5d9-9bbe3be03ac5",
            "860b71c8-5161-4a85-bce1-d6f0950d64da"
          ],
          "display_name": false
        },
        {
          "uuid": "b7b227b9-5179-41b6-ba65-e93c8b489521",
          "name": "PROPAZINE [MI]",
          "stdName": "PROPAZINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "860b71c8-5161-4a85-bce1-d6f0950d64da",
            "6c3f324a-5254-4311-957e-0764368d5c10"
          ],
          "display_name": false
        },
        {
          "uuid": "aced9dac-9bff-4674-b84f-483053f2bb40",
          "name": "PROZINEX",
          "stdName": "PROZINEX",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "860b71c8-5161-4a85-bce1-d6f0950d64da",
            "67ae7d16-7ae9-4717-86da-aa3fb5a39e8e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "67ae7d16-7ae9-4717-86da-aa3fb5a39e8e",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "860b71c8-5161-4a85-bce1-d6f0950d64da",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "18ea7fab-ee0b-412d-b5de-673f4187beca",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8746da2b-e63e-4b31-a2e6-b880f39bd9e8",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fde3f26d-fca2-4b31-ae80-4e1ef9604b30",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c3f324a-5254-4311-957e-0764368d5c10",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8991c699-ff8b-4feb-ad86-154c3caee394",
          "citation": "http://extoxnet.orst.edu/pips/propazin.htm",
          "url": "http://extoxnet.orst.edu/pips/propazin.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "df2dce21-6629-4bac-b248-c6788703b2f9",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f348af4-d3de-4d13-b5d9-9bbe3be03ac5",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d1e386b1-4cd8-46dd-bb58-6dcc01f658fa",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c9b24401-dfb6-4e1e-a231-841c15d88a20",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391895000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d08abef7-8d55-4f34-9451-e361e2fe3f45",
          "citation": "SRS import [UYP5U99Q5T]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=UYP5U99Q5T",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391895000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8dca4e7f-e270-4961-a753-9c45dd86f7dd",
          "citation": "PROPAZINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6ecd080e-fbb6-4199-8575-0efd24957119",
          "citation": "PROPAZINE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ac16e712-7914-48fc-9dc6-535cf00b46c7",
          "citation": "PROPAZINE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "caf7ca94-2f2e-cd4a-b928-455af787f06c",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+139-40-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "47697c78-1f90-4fe5-ce5d-527f80638d5c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=139-40-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "185c5122-0f54-7305-a113-554e663015d7",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "2c07fbdf-c189-ff46-fd18-5e9b45bc4ced",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "13c1ba3c-359e-4923-ba7e-d3baaa775b09",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f45baf42-518f-3ff0-a282-75afa026fe49",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b8eb8ad4-997c-9713-4add-d55d5edadaab",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d3d35f4e-3ab2-4449-a080-0268191e659b",
          "id": "d3d35f4e-3ab2-4449-a080-0268191e659b",
          "molfile": "\n  Marvin  01132110582D          \n\n 15 15  0  0  0  0            999 V2000\n    0.0340   -1.2480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7441   -0.8537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7519    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4751   -1.2871    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4516   -2.1226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7310   -2.5299    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7441   -3.3549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.7752    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.4516   -3.7700    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1644   -3.3706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8902   -3.7909    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6369   -3.3758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3340   -3.8170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6369   -2.5560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1644   -2.5403    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 15  2  0  0  0  0\n  6  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11 10  1  0  0  0  0\n 15 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  1  0  0  0  0\nM  END",
          "smiles": "CC(C)Nc1nc(Cl)nc(NC(C)C)n1",
          "formula": "C9H16ClN5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c3c5994d-e170-4165-8203-61a38022b335"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "229.7101",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2ec0c2d7-f02a-4c42-9b76-6eb07ab12624",
      "version": "8",
      "structure": {
        "id": "5bc50348-9f1e-4eea-8761-2d291760dc7a",
        "molfile": "\n  Marvin  01132104452D          \n\n 15 15  0  0  0  0            999 V2000\n    2.1644   -3.3706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4516   -2.1226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1644   -2.5403    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4516   -3.7700    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7310   -2.5299    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7441   -3.3549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8902   -3.7909    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4751   -1.2871    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.7752    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.7441   -0.8537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6369   -3.3758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0340   -1.2480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3340   -3.8170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6369   -2.5560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7519    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  1  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  4  2  0  0  0  0\n  7  1  1  0  0  0  0\n  8  2  1  0  0  0  0\n  9  6  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11  7  1  0  0  0  0\n 12 10  1  0  0  0  0\n 13 11  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15 10  1  0  0  0  0\n  2  5  2  0  0  0  0\nM  END",
        "smiles": "CC(C)Nc1nc(Cl)nc(NC(C)C)n1",
        "formula": "C9H16ClN5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "229.7101",
        "optical_activity": "NONE",
        "references": [
          "67ae7d16-7ae9-4717-86da-aa3fb5a39e8e",
          "d08abef7-8d55-4f34-9451-e361e2fe3f45"
        ],
        "stereo_centers": 0
      },
      "unii": "UYP5U99Q5T"
    }
  ]
}