{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "4b1a95a5-8403-47f7-bb6b-5c672e95de21", "code": "184706-97-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=184706-97-6", "code_system": "CAS", "references": [ "97125bdd-eae9-47d6-882c-b20466cde056", "10d620a1-6e12-4bf7-9931-794811792215" ] }, { "uuid": "b5669995-21c6-4f70-926c-986799c06c6f", "code": "71587595", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587595", "code_system": "PUBCHEM", "references": [ "97125bdd-eae9-47d6-882c-b20466cde056" ] }, { "uuid": "52a56432-ded0-4416-876d-880b126bbdcc", "code": "UW3PE5833F", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "4d8ba1df-5025-b331-4f03-478c0c4bc446", "code": "DTXSID501021383", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID501021383", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "47628263-c8be-430e-8874-4e370ebca7e5", "name": "(±)-DECANEDIOIC ACID, BIS(2-BUTYLOCTYL) ESTER", "stdName": "(+/-)-DECANEDIOIC ACID, BIS(2-BUTYLOCTYL) ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "caed675f-2371-49b8-b365-dc831ae38615", "37144f4d-debb-495c-8d8d-2bf5a81a8292" ], "display_name": false }, { "uuid": "a81bf0cb-5777-465b-8a37-3a44c4354874", "name": "DECANEDIOIC ACID, 1,10-BIS(2-BUTYLOCTYL) ESTER", "stdName": "DECANEDIOIC ACID, 1,10-BIS(2-BUTYLOCTYL) ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2d1bf210-5a92-413d-a088-d810352c5951", "caed675f-2371-49b8-b365-dc831ae38615" ], "display_name": false }, { "uuid": "70932584-05af-4c91-8509-71b2641b1a7b", "name": "DECANEDIOIC ACID, BIS(2-BUTYLOCTYL) ESTER", "stdName": "DECANEDIOIC ACID, BIS(2-BUTYLOCTYL) ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "73746690-858d-424d-b590-d3f09a8452ad", "caed675f-2371-49b8-b365-dc831ae38615" ], "display_name": false }, { "uuid": "9f37c496-858d-4bb8-a220-07830f38d94d", "name": "DIBUTYLOCTYL SEBACATE", "stdName": "DIBUTYLOCTYL SEBACATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "21c41652-4254-45a2-ad08-2409276abbf0", "73746690-858d-424d-b590-d3f09a8452ad", "caed675f-2371-49b8-b365-dc831ae38615" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "a2ac0505-f617-4bf1-a610-e33cd304e55e", "name_org": "INCI" } ] }, { "uuid": "5f87ef35-60ef-4228-bd40-593df6e8895c", "name": "DS-1220", "stdName": "DS-1220", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "73746690-858d-424d-b590-d3f09a8452ad", "caed675f-2371-49b8-b365-dc831ae38615" ], "display_name": false } ], "references": [ { "uuid": "73746690-858d-424d-b590-d3f09a8452ad", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "caed675f-2371-49b8-b365-dc831ae38615", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2d1bf210-5a92-413d-a088-d810352c5951", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "37144f4d-debb-495c-8d8d-2bf5a81a8292", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "97125bdd-eae9-47d6-882c-b20466cde056", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390691000, "tags": [ "NOMEN" ] }, { "uuid": "15e4c8ee-db29-4593-bac6-98f55b146c25", "citation": "SRS import [UW3PE5833F]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=UW3PE5833F", "doc_type": "SRS", "public_domain": true, "document_date": 1493390691000, "tags": [ "NOMEN" ] }, { "uuid": "21c41652-4254-45a2-ad08-2409276abbf0", "citation": "DIBUTYLOCTYL SEBACATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "10d620a1-6e12-4bf7-9931-794811792215", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "649c4b31-fcb2-406e-b8a4-b7395379fedd", "id": "649c4b31-fcb2-406e-b8a4-b7395379fedd", "molfile": "\n Marvin 01132105142D \n\n 38 37 0 0 0 0 999 V2000\n 13.5566 3.0245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5565 2.1995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8421 1.7870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8421 0.9620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1276 0.5495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1276 -0.2755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4131 -0.6880 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 10.6987 -0.2755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6987 0.5495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9842 0.9620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9842 1.7870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4131 -1.5130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6987 -1.9255 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6987 -2.7506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9842 -3.1630 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4131 -3.1630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4131 -3.9880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6987 -4.4006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6987 -5.2256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9842 -5.6380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9842 -6.4630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2697 -6.8756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2697 -7.7006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5552 -8.1130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8407 -7.7006 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5552 -8.9380 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2697 -9.3506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2697 -10.1756 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 8.5552 -10.5880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5552 -11.4130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8407 -11.8256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8407 -12.6506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9842 -10.5880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9842 -11.4130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6987 -11.8256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6987 -12.6506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4131 -13.0630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4131 -13.8880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 12 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 2 0 0 0 0\n 14 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 2 0 0 0 0\n 24 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 28 33 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 0 0 0 0\nM END", "smiles": "CCCCCCC(CCCC)COC(=O)CCCCCCCCC(=O)OCC(CCCC)CCCCCC", "formula": "C34H66O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "303b7c08-26a3-4caa-b991-b143eeb47765" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "538.8867", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "9a6f86cb-ae3e-4172-9613-ee6929550332", "version": "4", "structure": { "id": "5f1837d5-5d7f-49b3-b126-ef18da0ce4c8", "molfile": "\n Marvin 01132104552D \n\n 38 37 0 0 0 0 999 V2000\n 10.6987 -0.2755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4131 -0.6880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1276 -0.2755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1276 0.5495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8421 0.9620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8421 1.7870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5565 2.1995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5566 3.0245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4131 -1.5130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6987 -1.9255 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6987 -2.7506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9842 -3.1630 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4131 -3.1630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4131 -3.9880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6987 -4.4006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6987 -5.2256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9842 -5.6380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9842 -6.4630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2697 -6.8756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2697 -7.7006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5552 -8.1130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5552 -8.9380 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2697 -9.3506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2697 -10.1756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9842 -10.5880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9842 -11.4130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6987 -11.8256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6987 -12.6506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4131 -13.0630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4131 -13.8880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5552 -10.5880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5552 -11.4130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8407 -11.8256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8407 -12.6506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8407 -7.7006 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6987 0.5495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9842 0.9620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9842 1.7870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 2 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 2 0 0 0 0\n 11 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 24 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 21 35 2 0 0 0 0\n 1 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 0 0 0 0\nM END", "smiles": "CCCCCCC(CCCC)COC(=O)CCCCCCCCC(=O)OCC(CCCC)CCCCCC", "formula": "C34H66O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "538.8867", "optical_activity": "UNSPECIFIED", "references": [ "15e4c8ee-db29-4593-bac6-98f55b146c25", "2d1bf210-5a92-413d-a088-d810352c5951" ], "stereo_centers": 2 }, "unii": "UW3PE5833F" } ] }