{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bc79694b-71b6-4fa8-96b3-cbffe73abefd",
          "code": "99788-75-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=99788-75-7",
          "code_system": "CAS",
          "references": [
            "2b5def99-9ea1-4015-9c09-8a40513a7dd2",
            "4141442a-1e6f-4a09-84c0-8ab068d17305"
          ]
        },
        {
          "uuid": "5dcc3dcc-f8d0-4404-b5e8-c5cc189edc1e",
          "code": "384121",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/384121",
          "code_system": "PUBCHEM",
          "references": [
            "2b5def99-9ea1-4015-9c09-8a40513a7dd2"
          ]
        },
        {
          "uuid": "63aa46f9-9dff-4cb7-870b-23aa75cad6b7",
          "code": "UVQ553995F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b586166a-94d8-a5d0-6df8-0c4e5827a486",
          "code": "DTXSID40879813",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40879813",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c86c79ba-f3cf-47a7-a157-7d0f5e9d16b8",
          "name": "9,10-ANTHRACENEDIONE, 1,4-BIS((2,3-DIHYDROXYPROPYL)AMINO)-",
          "stdName": "9,10-ANTHRACENEDIONE, 1,4-BIS((2,3-DIHYDROXYPROPYL)AMINO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc657351-ceac-4541-9344-8c98def1d34e",
            "f8be6fbd-b6b9-42bd-806a-53f81b7ebf6a"
          ],
          "display_name": false
        },
        {
          "uuid": "6ee11d8b-ce47-4da7-a18e-089016ecd22a",
          "name": "BIS-DIHYDROXYPROPYLAMINO ANTHRAQUINONE",
          "stdName": "BIS-DIHYDROXYPROPYLAMINO ANTHRAQUINONE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f8be6fbd-b6b9-42bd-806a-53f81b7ebf6a",
            "4dc2021a-97f9-4511-b600-cf5274808acc"
          ],
          "display_name": false
        },
        {
          "uuid": "3297a712-0ed7-43e4-ba0b-1a9672e15245",
          "name": "HC BLUE 14",
          "stdName": "HC BLUE 14",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc657351-ceac-4541-9344-8c98def1d34e",
            "f8be6fbd-b6b9-42bd-806a-53f81b7ebf6a"
          ],
          "display_name": false
        },
        {
          "uuid": "f446f5b4-e1c0-487f-a8ef-3522d7ae14ac",
          "name": "HC BLUE NO. 14",
          "stdName": "HC BLUE NO. 14",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d371900-9feb-4c8d-9cc1-bc96fa7031de",
            "f8be6fbd-b6b9-42bd-806a-53f81b7ebf6a",
            "4dc2021a-97f9-4511-b600-cf5274808acc"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "0a9b2822-a389-4294-9a7d-2141a4487e2d",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "39542a00-1747-41e8-ba6f-172efec59ae5",
          "name": "IMEXINE BJ",
          "stdName": "IMEXINE BJ",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f8be6fbd-b6b9-42bd-806a-53f81b7ebf6a",
            "4dc2021a-97f9-4511-b600-cf5274808acc"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4dc2021a-97f9-4511-b600-cf5274808acc",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f8be6fbd-b6b9-42bd-806a-53f81b7ebf6a",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc657351-ceac-4541-9344-8c98def1d34e",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2b5def99-9ea1-4015-9c09-8a40513a7dd2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391500000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6a644fb0-96f1-4b02-9566-924fc915f468",
          "citation": "SRS import [UVQ553995F]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=UVQ553995F",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391500000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2d371900-9feb-4c8d-9cc1-bc96fa7031de",
          "citation": "HC BLUE NO. 14 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4141442a-1e6f-4a09-84c0-8ab068d17305",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "632fd682-c784-4979-b7e8-47c94c24099a",
          "id": "632fd682-c784-4979-b7e8-47c94c24099a",
          "molfile": "\n  Marvin  01132105092D          \n\n 28 30  0  0  0  0            999 V2000\n   12.5114   -5.8972    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7969   -5.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0825   -5.8972    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   11.0825   -6.7222    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3680   -5.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6536   -5.8972    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9391   -5.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2246   -5.8972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5101   -5.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5101   -4.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7957   -4.2472    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0812   -4.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3667   -4.2472    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.6522   -4.6596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3667   -3.4222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6522   -3.0096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2246   -4.2472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2246   -3.4222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5101   -3.0096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9391   -3.0096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9396   -2.1871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6541   -1.7743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3659   -2.1832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3709   -3.0076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6536   -3.4221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6536   -4.2471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3681   -4.6596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9391   -4.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7 28  2  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 17  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 28  1  0  0  0  0\n 18 19  2  0  0  0  0\n 20 18  1  0  0  0  0\n 20 21  1  0  0  0  0\n 25 20  2  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  2  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 26 27  2  0  0  0  0\n 28 26  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)C(=O)c3c(ccc(c3C2=O)NCC(CO)O)NCC(CO)O",
          "formula": "C20H22N2O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8a030b05-db93-4b36-987a-056b33821d46"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "386.3993",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4d4ccfc4-2b22-446c-afcd-e58b61ad316e",
      "version": "4",
      "structure": {
        "id": "f9975908-ded2-4aba-9195-951958f355b7",
        "molfile": "\n  Marvin  01132112562D          \n\n 28 30  0  0  0  0            999 V2000\n    8.9391   -4.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2246   -4.2472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5101   -4.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7957   -4.2472    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0812   -4.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3667   -4.2472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6522   -4.6596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5101   -5.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2246   -5.8972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9391   -5.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6536   -5.8972    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3680   -5.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0825   -5.8972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7969   -5.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5114   -5.8972    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0825   -6.7222    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3667   -3.4222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6522   -3.0096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6536   -4.2471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6536   -3.4221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9391   -3.0096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2246   -3.4222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9396   -2.1871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6541   -1.7743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3709   -3.0076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3659   -2.1832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5101   -3.0096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3681   -4.6596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  3  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10  1  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 13 16  1  0  0  0  0\n  6 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 21 22  1  0  0  0  0\n 20 21  2  0  0  0  0\n 19 20  1  0  0  0  0\n  1 19  1  0  0  0  0\n  2 22  1  0  0  0  0\n 26 24  1  0  0  0  0\n 25 26  2  0  0  0  0\n 24 23  2  0  0  0  0\n 20 25  1  0  0  0  0\n 21 23  1  0  0  0  0\n 22 27  2  0  0  0  0\n 19 28  2  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)C(=O)c3c(ccc(c3C2=O)NCC(CO)O)NCC(CO)O",
        "formula": "C20H22N2O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "386.3993",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "bc657351-ceac-4541-9344-8c98def1d34e",
          "6a644fb0-96f1-4b02-9566-924fc915f468"
        ],
        "stereo_centers": 2
      },
      "unii": "UVQ553995F"
    }
  ]
}