{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bc6f8bb9-dba9-4713-9d70-8fabc57b1cdc",
          "code": "34312-10-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=34312-10-2",
          "code_system": "CAS",
          "references": [
            "bde3a87a-1b42-4c62-9d3c-873983c9cd46",
            "d098e91e-035f-4ca1-bd43-251ce2ce56e7"
          ]
        },
        {
          "uuid": "57ea5bd1-de5f-4a58-b0ac-f26e82071dfc",
          "code": "m3600",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3600?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "bde3a87a-1b42-4c62-9d3c-873983c9cd46"
          ]
        },
        {
          "uuid": "eac52da6-be3e-44e9-9f99-34d6c9286068",
          "code": "72941546",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/72941546",
          "code_system": "PUBCHEM",
          "references": [
            "bde3a87a-1b42-4c62-9d3c-873983c9cd46"
          ]
        },
        {
          "uuid": "61ab0fe2-7648-47c8-a10a-83d893e4b613",
          "code": "SUB193781",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "0f4d2b47-9584-dfe1-5bef-1ca49a2eec9d"
          ]
        },
        {
          "uuid": "ac23e4e5-e5b4-4c63-9b2b-efbdb1e2ee2d",
          "code": "UVA0OHH18U",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e845902f-d0eb-6377-5c64-8b6687527d12",
          "code": "100000178182",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "dca8c579-0018-d566-4be8-e871e2937340"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "528427bd-4bfe-4fff-988c-f626188dec99",
          "name": "CITRULLINE HYDROCHLORIDE",
          "stdName": "CITRULLINE HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce169efa-5823-4cfc-a94f-157f3e903066",
            "e1a5acb2-ed16-463d-99ec-10739ae8b6a4",
            "4a10ca20-f75a-4f48-a372-07153da09bc3"
          ],
          "display_name": true
        },
        {
          "uuid": "26b1401c-6b93-401c-9e57-d332e4853d20",
          "name": "CITRULLINE HYDROCHLORIDE [MI]",
          "stdName": "CITRULLINE HYDROCHLORIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce169efa-5823-4cfc-a94f-157f3e903066",
            "e1a5acb2-ed16-463d-99ec-10739ae8b6a4"
          ],
          "display_name": false
        },
        {
          "uuid": "0e905028-ebe2-4472-83a0-de5f0ae1aadd",
          "name": "CITRULLINE MONOHYDROCHLORIDE",
          "stdName": "CITRULLINE MONOHYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce169efa-5823-4cfc-a94f-157f3e903066",
            "17d2e6ca-e46b-4df0-bde2-17d3a6cdaeca"
          ],
          "display_name": false
        },
        {
          "uuid": "563279fd-0a2c-4955-883c-30c657ef4052",
          "name": "L-ORNITHINE, N5-(AMINOCARBONYL)-, MONOHYDROCHLORIDE",
          "stdName": "L-ORNITHINE, N5-(AMINOCARBONYL)-, MONOHYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce169efa-5823-4cfc-a94f-157f3e903066",
            "e488ddfc-a4b4-474a-a150-4948b9a0a85b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e488ddfc-a4b4-474a-a150-4948b9a0a85b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "17d2e6ca-e46b-4df0-bde2-17d3a6cdaeca",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bde3a87a-1b42-4c62-9d3c-873983c9cd46",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392437000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0a8159b1-8fff-446a-bebd-582ee0fc32aa",
          "citation": "SRS import [UVA0OHH18U]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=UVA0OHH18U",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392437000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a10ca20-f75a-4f48-a372-07153da09bc3",
          "citation": "CITRULLINE HYDROCHLORIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e1a5acb2-ed16-463d-99ec-10739ae8b6a4",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ce169efa-5823-4cfc-a94f-157f3e903066",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0f4d2b47-9584-dfe1-5bef-1ca49a2eec9d",
          "citation": "EVMPD",
          "doc_type": "EVMPD",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d098e91e-035f-4ca1-bd43-251ce2ce56e7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "dca8c579-0018-d566-4be8-e871e2937340",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "327a6e09-ef3e-4f47-a737-76e802f46a93",
          "id": "327a6e09-ef3e-4f47-a737-76e802f46a93",
          "molfile": "\n  Marvin  01132102422D          \n\n  1  0  0  0  1  0            999 V2000\n   18.7311   -8.2077    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "42b786d1-9d8a-465e-aae2-bc6df675e834"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "b92de407-a323-4619-bb37-ad337a78bd59",
          "id": "b92de407-a323-4619-bb37-ad337a78bd59",
          "molfile": "\n  Marvin  01132109352D          \n\n 12 11  0  0  1  0            999 V2000\n   15.5645   -9.1589    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   15.5645   -9.8446    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8153   -8.7684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1207   -9.2135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3987   -8.8365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6947   -9.2589    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9410   -8.8956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2553   -9.3179    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9410   -8.0510    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2639   -8.7185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0041   -9.0863    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2639   -7.9239    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 10  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 10  2  0  0  0  0\nM  END",
          "smiles": "C(C[C@@H](C(=O)O)N)CNC(=O)N",
          "formula": "C6H13N3O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d1f9d6a9-6169-4132-ac16-184cfccbe045"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "175.186",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "30d809ad-934e-46f6-bf45-1ad3f8fee26d",
      "version": "4",
      "structure": {
        "id": "86293599-dc8b-4cc1-993b-016949e3e3c1",
        "molfile": "\n  Marvin  01132106582D          \n\n 13 11  0  0  1  0            999 V2000\n   11.9410   -8.8956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2639   -8.7185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9410   -8.0510    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0041   -9.0863    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6947   -9.2589    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5645   -9.1589    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.2553   -9.3179    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2639   -7.9239    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5645   -9.8446    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3987   -8.8365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8153   -8.7684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1207   -9.2135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.7311   -8.2077    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  3  1  2  0  0  0  0\n  4  2  2  0  0  0  0\n  5  1  1  0  0  0  0\n  2  6  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  2  1  0  0  0  0\n  6  9  1  1  0  0  0\n 10  5  1  0  0  0  0\n  6 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 10  1  0  0  0  0\nM  END",
        "smiles": "C(C[C@@H](C(=O)O)N)CNC(=O)N.Cl",
        "formula": "C6H13N3O3.ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "211.6468",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "0a8159b1-8fff-446a-bebd-582ee0fc32aa",
          "e488ddfc-a4b4-474a-a150-4948b9a0a85b"
        ],
        "stereo_centers": 1
      },
      "unii": "UVA0OHH18U"
    }
  ]
}