{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9ae181bd-e972-4495-8978-99c5d1f7e0e3",
          "code": "6283-63-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6283-63-2",
          "code_system": "CAS",
          "references": [
            "2b2ce014-81ca-4c78-9f19-5a6da187c0ff",
            "c19aa676-ec95-4b61-99ec-f5ce5d2e8082"
          ]
        },
        {
          "uuid": "fe0194df-29ac-47c0-9456-22844aa01d8d",
          "code": "228-500-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.025.910",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "2b2ce014-81ca-4c78-9f19-5a6da187c0ff"
          ]
        },
        {
          "uuid": "31d9e89e-0de3-4b6c-98b3-aeec9516a6e5",
          "code": "80166",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/80166",
          "code_system": "PUBCHEM",
          "references": [
            "2b2ce014-81ca-4c78-9f19-5a6da187c0ff"
          ]
        },
        {
          "uuid": "11abc5b8-9b48-4528-b8af-d7c9322bebc3",
          "code": "USP19T3GDA",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c1f22960-d1dc-420b-8669-0be13aa7b306",
          "code": "6065-27-6",
          "type": "NON-SPECIFIC STOICHIOMETRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6065-27-6",
          "code_system": "CAS",
          "references": [
            "c19aa676-ec95-4b61-99ec-f5ce5d2e8082"
          ]
        },
        {
          "uuid": "08676d5d-660d-33af-6e52-0710f8d576a7",
          "code": "DTXSID301015702",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID301015702",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "95ff2607-b0cd-1e2f-cb2a-f037ac8587f0",
          "code": "7653",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=7653",
          "code_system": "NSC",
          "references": [
            "11c8417e-84c5-cd6a-2808-dea68f8e08b8"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "a670b6fb-0223-4eb8-bad0-7b34c1e8116b",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "e5622169-29c1-4baf-9944-105a773e52ef",
            "refuuid": "27065258-ebd7-479e-be0f-2a36bff3587b",
            "name": "N,N-DIETHYL-P-PHENYLENEDIAMINE",
            "unii": "0QQA4DFV2J",
            "linking_id": "0QQA4DFV2J",
            "ref_pname": "N,N-DIETHYL-P-PHENYLENEDIAMINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "495fbf54-da08-4cd8-ab70-6e6bf148cfcb",
          "name": "1,4-BENZENEDIAMINE, N,N-DIETHYL-, SULFATE (1:1)",
          "stdName": "1,4-BENZENEDIAMINE, N,N-DIETHYL-, SULFATE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "805dc96a-5645-4474-bfc1-5ea49fe4e3ef",
            "956ecba8-dedb-4597-b51b-7ec6112b452b"
          ],
          "display_name": false
        },
        {
          "uuid": "464294b5-074b-4915-9360-70ea1fc54235",
          "name": "DIETHYL-P-PHENYLENEDIAMINE SULFATE",
          "stdName": "DIETHYL-P-PHENYLENEDIAMINE SULFATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "805dc96a-5645-4474-bfc1-5ea49fe4e3ef",
            "956ecba8-dedb-4597-b51b-7ec6112b452b"
          ],
          "display_name": false
        },
        {
          "uuid": "7eefa698-19e2-453d-827d-c01297e9241c",
          "name": "N,N-DIETHYL-1,4-PHENYLENEDIAMINE SULFATE",
          "stdName": "N,N-DIETHYL-1,4-PHENYLENEDIAMINE SULFATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "805dc96a-5645-4474-bfc1-5ea49fe4e3ef",
            "956ecba8-dedb-4597-b51b-7ec6112b452b"
          ],
          "display_name": false
        },
        {
          "uuid": "818ca37c-0c14-47e2-8211-9939d0af20ea",
          "name": "N,N-DIETHYL-P-PHENYLENEDIAMINE SULFATE",
          "stdName": "N,N-DIETHYL-P-PHENYLENEDIAMINE SULFATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e3e67d1-aace-475c-b26d-47225beeaa7e",
            "af800e84-c6cf-457f-a74f-c4206a04a3f7",
            "956ecba8-dedb-4597-b51b-7ec6112b452b"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "4cb7ead3-3b6a-47f6-9ad8-dcb8e8424856",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "ba7104e4-2b6a-4355-a84c-98a87ad11aab",
          "name": "N,N-DIETHYL-P-PHENYLENEDIAMINE SULFATE SALT",
          "stdName": "N,N-DIETHYL-P-PHENYLENEDIAMINE SULFATE SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c68ad48-64e0-4895-a1b1-4b50bd22c8fd",
            "956ecba8-dedb-4597-b51b-7ec6112b452b"
          ],
          "display_name": false
        },
        {
          "uuid": "ec1a2a41-ef81-41f3-8a59-4a57b7dac6c7",
          "name": "N,N-DIETHYLBENZENE-1,4-DIAMINE SULFATE",
          "stdName": "N,N-DIETHYLBENZENE-1,4-DIAMINE SULFATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "805dc96a-5645-4474-bfc1-5ea49fe4e3ef",
            "956ecba8-dedb-4597-b51b-7ec6112b452b"
          ],
          "display_name": false
        },
        {
          "uuid": "36440a3f-798a-4f0f-a1e0-f16776dccae7",
          "name": "NSC-7653",
          "stdName": "NSC-7653",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "805dc96a-5645-4474-bfc1-5ea49fe4e3ef",
            "956ecba8-dedb-4597-b51b-7ec6112b452b"
          ],
          "display_name": false
        },
        {
          "uuid": "ead76f28-4e4b-4f90-badb-85c48d687a03",
          "name": "P-PHENYLENEDIAMINE, N,N-DIETHYL-, SULFATE (1:1)",
          "stdName": "P-PHENYLENEDIAMINE, N,N-DIETHYL-, SULFATE (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "805dc96a-5645-4474-bfc1-5ea49fe4e3ef",
            "956ecba8-dedb-4597-b51b-7ec6112b452b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2b2ce014-81ca-4c78-9f19-5a6da187c0ff",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391545000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "79c460ee-60ac-4755-b45f-ebaef7462813",
          "citation": "SRS import [USP19T3GDA]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=USP19T3GDA",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391545000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8e3e67d1-aace-475c-b26d-47225beeaa7e",
          "citation": "N,N-DIETHYL-P-PHENYLENEDIAMINE SULFATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "af800e84-c6cf-457f-a74f-c4206a04a3f7",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "956ecba8-dedb-4597-b51b-7ec6112b452b",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "805dc96a-5645-4474-bfc1-5ea49fe4e3ef",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7c68ad48-64e0-4895-a1b1-4b50bd22c8fd",
          "citation": "SIGMA-ALDRICH",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c19aa676-ec95-4b61-99ec-f5ce5d2e8082",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "11c8417e-84c5-cd6a-2808-dea68f8e08b8",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6a41c9e4-2b98-4531-a15d-b0518d5e401c",
          "id": "6a41c9e4-2b98-4531-a15d-b0518d5e401c",
          "molfile": "\n  Marvin  01132105312D          \n\n  5  4  0  0  0  0            999 V2000\n   11.3320   -3.4691    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7721   -2.8612    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2240   -3.4691    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1224   -2.3551    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4297   -2.3551    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  2  0  0  0  0\n  2  5  2  0  0  0  0\nM  END",
          "smiles": "OS(=O)(=O)O",
          "formula": "H2O4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "835305bc-89a5-430b-a8a3-810ce699ee8c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "98.0796",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "bfb78719-17ac-4ed8-9710-250cecc7f7fc",
          "id": "bfb78719-17ac-4ed8-9710-250cecc7f7fc",
          "molfile": "\n  Marvin  01132109552D          \n\n 12 12  0  0  0  0            999 V2000\n   12.9859   -4.2652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1609   -4.2652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7485   -4.9791    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1609   -5.6969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9859   -5.6969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9236   -4.9791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5230   -5.6969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6980   -5.6969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2835   -4.9791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4586   -4.9791    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6980   -4.2652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5230   -4.2652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  6  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 12  2  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11  9  2  0  0  0  0\n 12 11  1  0  0  0  0\nM  END",
          "smiles": "CCN(CC)c1ccc(cc1)N",
          "formula": "C10H16N2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0f4843fb-619b-475a-9d49-47edef3fdbeb"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "164.2478",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "cbf3b532-1408-4a1b-a173-242feae41056",
      "version": "6",
      "structure": {
        "id": "cbf5b330-6c01-40b9-bbed-7d3f8d90dfa6",
        "molfile": "\n  Marvin  01132110322D          \n\n 17 16  0  0  0  0            999 V2000\n    8.4586   -4.9791    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2835   -4.9791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9859   -4.2652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9859   -5.6969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6980   -5.6969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6980   -4.2652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1609   -4.2652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1609   -5.6969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5230   -5.6969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5230   -4.2652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7485   -4.9791    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9236   -4.9791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0728   -2.3436    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3737   -2.3436    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2765   -3.4521    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1739   -3.4521    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7193   -2.8472    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n  5  2  2  0  0  0  0\n  2  1  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  3  1  0  0  0  0\n  8  4  1  0  0  0  0\n  9  5  1  0  0  0  0\n 10  6  2  0  0  0  0\n 11  7  1  0  0  0  0\n 11  8  1  0  0  0  0\n 12  9  2  0  0  0  0\n 12 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 17 13  2  0  0  0  0\n 17 14  2  0  0  0  0\n 17 15  1  0  0  0  0\n 17 16  1  0  0  0  0\nM  END",
        "smiles": "CCN(CC)c1ccc(cc1)N.OS(=O)(=O)O",
        "formula": "C10H16N2.H2O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "262.3274",
        "optical_activity": "NONE",
        "references": [
          "805dc96a-5645-4474-bfc1-5ea49fe4e3ef",
          "79c460ee-60ac-4755-b45f-ebaef7462813"
        ],
        "stereo_centers": 0
      },
      "unii": "USP19T3GDA"
    }
  ]
}