{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0f2475eb-09d8-4f3e-a0b4-ac977fe9303f",
          "code": "3846-71-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3846-71-7",
          "code_system": "CAS",
          "references": [
            "f494908f-5f59-4be8-9b08-bf0ce3f1cc50",
            "08cd5670-8ad2-4cb2-995e-631dc5052749"
          ]
        },
        {
          "uuid": "b45a3f57-c844-4e43-b7b5-10f05ce914fd",
          "code": "77455",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/77455",
          "code_system": "PUBCHEM",
          "references": [
            "f494908f-5f59-4be8-9b08-bf0ce3f1cc50"
          ]
        },
        {
          "uuid": "7ad4473b-26c5-41bb-a82c-45d153899d9d",
          "code": "223-346-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.021.225",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f494908f-5f59-4be8-9b08-bf0ce3f1cc50"
          ]
        },
        {
          "uuid": "6c417237-6a1b-be6a-1bf8-4006dff48ac3",
          "code": "DTXSID4052059",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4052059",
          "code_system": "EPA CompTox",
          "references": [
            "b1538642-250a-8a76-4947-7b9856dc326b"
          ]
        },
        {
          "uuid": "16036712-4323-41ee-8c78-48a8f22acd35",
          "code": "US7KL87A2P",
          "type": "PRIMARY",
          "code_system": "FDA UNII",
          "references": [
            "43bdd5e7-3c47-40e2-ad72-6f9db5dd7534"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8f7b7508-3e8a-4eba-8fbd-f39c59c09a04",
          "name": "2-(2'-HYDROXY-3',5'-DI-TERT-BUTYLPHENYL)BENZOTRIAZOLE",
          "stdName": "2-(2'-HYDROXY-3',5'-DI-TERT-BUTYLPHENYL)BENZOTRIAZOLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "43bdd5e7-3c47-40e2-ad72-6f9db5dd7534"
          ],
          "display_name": false
        },
        {
          "uuid": "48fbbe7e-8dab-43b5-86ce-356fa0e68a4e",
          "name": "2-BENZOTRIAZOL-2-YL-4,6-DI-TERT-BUTYLPHENOL",
          "stdName": "2-BENZOTRIAZOL-2-YL-4,6-DI-TERT-BUTYLPHENOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "43bdd5e7-3c47-40e2-ad72-6f9db5dd7534"
          ],
          "display_name": false
        },
        {
          "uuid": "46b2ba27-fc29-4e35-ba43-2d9044457b5e",
          "name": "CHISORB 320",
          "stdName": "CHISORB 320",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08cd5670-8ad2-4cb2-995e-631dc5052749"
          ],
          "display_name": false
        },
        {
          "uuid": "319295e9-9d5f-4b91-9445-14276e649286",
          "name": "EVERSORB 77",
          "stdName": "EVERSORB 77",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08cd5670-8ad2-4cb2-995e-631dc5052749"
          ],
          "display_name": false
        },
        {
          "uuid": "bed32215-7beb-40c3-a01b-ffb703fe7b30",
          "name": "KEMISORB 75",
          "stdName": "KEMISORB 75",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08cd5670-8ad2-4cb2-995e-631dc5052749"
          ],
          "display_name": false
        },
        {
          "uuid": "1ad9a530-8577-4e10-a97e-a4536d9354f5",
          "name": "PHENOL, 2-(2H-BENZOTRIAZOL-2-YL)-4,6-BIS(1,1-DIMETHYLETHYL)-",
          "stdName": "PHENOL, 2-(2H-BENZOTRIAZOL-2-YL)-4,6-BIS(1,1-DIMETHYLETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "43bdd5e7-3c47-40e2-ad72-6f9db5dd7534"
          ],
          "display_name": false
        },
        {
          "uuid": "3e92bc18-f4a4-4a2d-a46d-5241355bc7df",
          "name": "SEESORB 705",
          "stdName": "SEESORB 705",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08cd5670-8ad2-4cb2-995e-631dc5052749"
          ],
          "display_name": false
        },
        {
          "uuid": "cca81de9-50cc-40a3-93f0-7b6d0d692e66",
          "name": "SUMISORB 320",
          "stdName": "SUMISORB 320",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08cd5670-8ad2-4cb2-995e-631dc5052749"
          ],
          "display_name": false
        },
        {
          "uuid": "a63724fa-51b8-41c5-aff6-fe06b2a83041",
          "name": "TINUVIN 320",
          "stdName": "TINUVIN 320",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87dfc8d5-0554-4e07-8169-136291e8218c",
            "08cd5670-8ad2-4cb2-995e-631dc5052749"
          ],
          "display_name": true
        },
        {
          "uuid": "33e74dc6-6382-46af-9a09-d8ba44fab7a8",
          "name": "UV-320",
          "stdName": "UV-320",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08cd5670-8ad2-4cb2-995e-631dc5052749"
          ],
          "display_name": false
        },
        {
          "uuid": "8694d6f4-ab58-4285-a260-0519198ee64f",
          "name": "VIOSORB 582",
          "stdName": "VIOSORB 582",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08cd5670-8ad2-4cb2-995e-631dc5052749"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "87dfc8d5-0554-4e07-8169-136291e8218c",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f494908f-5f59-4be8-9b08-bf0ce3f1cc50",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391995000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b1538642-250a-8a76-4947-7b9856dc326b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3846-71-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "43bdd5e7-3c47-40e2-ad72-6f9db5dd7534",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "08cd5670-8ad2-4cb2-995e-631dc5052749",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3c977145-bdd3-45dc-bb7a-b068586ca31a",
          "id": "3c977145-bdd3-45dc-bb7a-b068586ca31a",
          "molfile": "\n  Marvin  01132103132D          \n\n 24 26  0  0  0  0            999 V2000\n    1.1258   -4.0077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7159   -3.2979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3059   -2.5821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.7079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4318   -2.8819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1415   -3.2979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8574   -2.8819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8574   -2.0620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5733   -1.6459    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1415   -1.6459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4318   -2.0620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1354   -0.8199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3094   -0.8260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9614   -0.8199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1354    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5733   -3.2979    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6590   -4.1179    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4666   -4.2892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8827   -4.9990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7087   -4.9928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1187   -4.2830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7026   -3.5672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8766   -3.5733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3320   -2.9614    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  5  6  1  0  0  0  0\n 11  5  2  0  0  0  0\n  6  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  7 16  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 12 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 24  1  0  0  0  0\n 18 17  2  0  0  0  0\n 18 19  1  0  0  0  0\n 23 18  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  2  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)c1cc(c(c(c1)-n2nc3ccccc3n2)O)C(C)(C)C",
          "formula": "C20H25N3O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bbbd7a3f-cf7b-4d38-b434-488dd603e6cd"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "323.4328",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "65e477be-fa8c-4628-9040-9281b1839779",
      "version": "5",
      "structure": {
        "id": "f0da16d7-62cd-4048-be86-2bf7529c3898",
        "molfile": "\n  Marvin  01132112302D          \n\n 24 26  0  0  0  0            999 V2000\n    3.5733   -1.6459    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8574   -2.0620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1415   -1.6459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4318   -2.0620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4318   -2.8819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1415   -3.2979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8574   -2.8819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5733   -3.2979    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3320   -2.9614    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8766   -3.5733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4666   -4.2892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8827   -4.9990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7087   -4.9928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1187   -4.2830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7026   -3.5672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6590   -4.1179    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7159   -3.2979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1258   -4.0077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3059   -2.5821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.7079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1354   -0.8199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3094   -0.8260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9614   -0.8199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1354    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  7  2  0  0  0  0\n  3  4  2  0  0  0  0\n  3 21  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5 17  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 16  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 10 15  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 16  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 17 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 21 24  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)c1cc(c(c(c1)-n2nc3ccccc3n2)O)C(C)(C)C",
        "formula": "C20H25N3O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "323.4328",
        "optical_activity": "NONE",
        "references": [
          "87dfc8d5-0554-4e07-8169-136291e8218c"
        ],
        "stereo_centers": 0
      },
      "unii": "US7KL87A2P"
    }
  ]
}